The IFRA Transparency List
The IFRA Transparency List is the ‘perfumer’s palette’ – an overview of the ingredients used to create fragrance mixtures employed by consumer goods companies in personal care products, home care products and fine fragrance worldwide.
It represents a ‘snapshot’ of all the ingredients used by fragrance companies around the world. This includes those ingredients used in minimal quantities or only in certain countries or regions.
The IFRA Transparency List is one of IFRA’s key tools for providing information to people inside and outside our industry about all the ingredients used by IFRA members worldwide.
It also allows IFRA to build a range of tools and services for members, such as the IFRA Fragrance Ingredient Glossary.
Scroll down to find out more and view the List
On this page
What types of ingredients are on the List?
There are two main types of ingredient on the List.
Fragrance ingredients are substances used for odor or malodor coverage.
Functional ingredients are substances that are not used to provide odor or malodor coverage, but which are essential for the functionality or durability of a fragrance compound – such as an antioxidant, preservative, diluent, solvent or color.
How is the List compiled?
The IFRA Transparency List is based on reporting provided by IFRA Members in the ‘Volume of Use Survey’, which is compiled approximately every five years.
The latest List, published in 2022, provides a snapshot of the ingredients used by fragrance companies around the world. This snapshot is based on a global survey of IFRA member companies and National Associations, the most recent of which was carried out in 2021.
In line with our anti-trust obligations, the Survey is anonymous and confidential. As well as helping us to develop the IFRA Transparency List, the data provided by the Survey is relevant for the industry’s safety assessment program managed by the Research Institute for Fragrance Materials (RIFM).
How many ingredients are on the List?
The 2022 edition of the IFRA Transparency List includes 3,619 ingredients:
- 3,224 fragrance ingredients used for odor or malodor coverage; and
- 395 functional ingredients that are used to support the functionality and/or durability of a fragrance compound.
The 2022 List contains around 350 ingredients fewer than the previous edition, published in 2016.
Changes in the number of ingredients on the List are due to several factors, including new or modified ingredients as a result of innovation in the industry, quality control and elimination of duplicate identifiers for materials in active use, regulatory changes around the world, and market preferences.
What’s new in the 2022 edition of the IFRA Transparency List?
In the 2022 edition of the IFRA Transparency List, there are 992 Natural Complex Substances (NCSs).
These NCSs feature additional identifiers that allows users of the List to understand the origin or the processing of natural ingredients, or the part of the plant from which the natural ingredient is derived.
This information is based on the principles of the internationally recognized ISO 9235 standard on aromatic natural raw materials. It appears in addition to the Chemical Abstracts Service (CAS) number.
IFRA and the Research Institute for Fragrance Materials (RIFM) set up this specific nomenclature, which consists of a letter representing the botanical parts used for the preparation of the NCS and a number indicating the processing (type of extract).
For instance, the nomenclature for Orange peel, sweet oil (CAS 8008-57-9) is G2.5 (G meaning fruit/fruit parts and 2.5 of the ISO Standard meaning essential oil derived by cold expression).
What rules govern safe use of ingredients on the List?
Under the IFRA Code of Practice, IFRA members are obliged to adhere to the rules of IFRA’s safe use program, the IFRA Standards, as well as to national and local laws and restrictions on the use of materials and to good operating practices.
Manufacturers are responsible for the safety of the ingredients they use in their products.
The fragrance ingredients reported in the Volume of Use Survey appear on the IFRA Transparency List. In addition, these ingredients are part of the Research Institute for Fragrance Materials (RIFM) Safety Assessment Program.
RIFM publishes the resulting safety assessments in a peer-reviewed scientific journal and makes them available to the public via the open-access Fragrance Material Safety Resource Center.
The independent Expert Panel for Fragrance Safety also reviews all the safety assessments.
‘Non-supported’ materials
RIFM manages a list of ‘non-supported’ materials as part of this program. It is important to note that designation as a non-supported material does not mean that the material is unsafe. Instead, it means that RIFM has not received a sample or concentration data and so cannot conduct a safety assessment. In addition, many non-supported materials may no longer be in use.
Once RIFM has determined a material to be on the non-supported list, RIFM scientists take steps to gather data from the primary user or the industry.
Should the information not be provided, the material is removed from the safety assessment program and has its RIFM identity number removed. IFRA is informed and may or may not implement risk management measures.
In all cases, companies must demonstrate the safety of the products they place on the market. A company may show the material’s safety via its own safety assessment.
However, as the representative body of the global fragrance industry, IFRA encourages members to have as many materials as possible assessed in the RIFM program to reinforce the risk assessment and management process.
Functional ingredients
IFRA and RIFM define a functional ingredient as “any basic substance necessary for a fragrance ingredient or compound’s functionality or stability.” Functional ingredients include, but are not limited to, pigments, antioxidants, solvents, plasticizers, surfactants, UV absorbers, and buffering agents.
As those materials have a much broader use outside the fragrance and flavor industries and many other industries review them, they are not evaluated in the RIFM Safety Assessment Program and are classified as functional ingredients. RIFM therefore removes the material’s identity number.
IFRA Transparency List |
| CAS number | Principal name | Naturals (NCS) category |
|---|---|---|
| 4221-98-1 | (-)-(R)-.alpha.-Phellandrene | |
| 489-40-7 | (-)-.alpha.-Gurjunene | |
| 13837-56-4 | (.+-.)-Tetrahydro-2,6,6-trimethyl-2-vinyl-2H-pyrane | |
| 4610-11-1 | (+)-cis-Rose oxide | |
| 888021-82-7 | (+-)-Ethyl 3-mercapto-2-methylbutanoate | |
| 2216-52-6 | (+)-Neomenthol | |
| 87-69-4 | (+)-Tartaric acid | |
| 67663-01-8 | (+/-) 3-Methyl-gamma-decalactone | |
| 156472-94-5 | (+/-) Ethyl 3-mercaptobutyrate | |
| 258823-39-1 | (+/-)2-Mercapto-2-methylpentan-1-ol | |
| 58475-04-0 | (+/-)-4-Ethyloctanal | |
| 1120363-98-5 | (+/-)-5-Isopropyl-2,6-diethyl-2-methyltetrahydro-2H-pyran | |
| 15932-80-6 | (+/-)-Pulegone | |
| 10138-32-6 | (±)-Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, ethyl ester | |
| 68877-29-2 | (1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol | |
| 94400-98-3 | (1a.alpha.,4.alpha.,7a.alpha.)-1a,3,3,4,6,6-Hexamethyl-1a,2,3,4,5,6,7,7a-octahydronapth[3,3-b]oxirene | |
| 389083-83-4 | (1-Ethoxyethoxy)-cyclododecane | |
| 1655500-83-6 | (1-methyl-2-(5-methylhex-4-en-2-yl)cyclopropyl)methanol | |
| 35836-72-7 | (1R)-Nopyl acetate | |
| 68489-09-8 | (1R,2S,5R)-N-(4-Methoxyphenyl)-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide | |
| 29461-13-0 | (2.alpha.,4a.alpha.,8.beta.)-Hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalene-8(5H)-one | |
| 5331-14-6 | (2-Butoxyethyl)benzene | |
| 23726-91-2 | (2E)-1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one | |
| 28069-72-9 | (2E,6Z)-Nona-2,6-dien-1-ol | |
| 116044-44-1 | (2-endo,3-exo)-Ethyl 3-(1-methylethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate | |
| 120811-92-9 | (3-Methoxy-2-methylpropyl)benzene | |
| 124071-43-8 | (3-Z)-3,12-Tridecadienenitrile | |
| 92046-48-5 | (4-Ethylbicyclo[2.2.1]hept-2-yl)-cyclohexanol | |
| 67845-46-9 | (4-Methylphenoxy)acetaldehyde | |
| 3288-99-1 | (4-tert-Butylphenyl)acetonitrile | |
| 1071801-01-8 | (4Z)-4-Dodecenenitrile | |
| 79-77-6 | (E)-.beta.-Ionone | |
| 97358-54-8 | (E)-1-(1-Methoxypropoxy)hex-3-ene | |
| 39872-57-6 | (E)-1-(2,4,4-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one | |
| 24720-09-0 | (E)-1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one | |
| 65737-52-2 | (E)-2-(2-Octenyl)cyclopentanone | |
| 18409-17-1 | (E)-2-Octen-1-ol | |
| 37973-51-6 | (E)-2-Phenylpropenyl acetate | |
| 81786-74-5 | (E)-3,4,5,6,6-Pentamethylhept-3-en-2-one | |
| 1309389-73-8 | (E)-3-Benzo[1,3]dioxol-5-yl-N,N-diphenyl-2-propenamide | |
| 53243-60-0 | (E)-3-Methyl-5-phenylpent-2-enenitrile | |
| 3239-35-8 | (E)-6,10-Dimethylundeca-5,9-dien-2-yl acetate | |
| 68555-65-7 | (E,Z)-2,6-Nonadien-1-ol acetate | |
| 960253-23-0 | (E/Z)-ethyl 2-acetyl-4-methyltridec-2-enoate | |
| 400052-49-5 | (S1)-Methoxy-3-heptanethiol | |
| 102-76-1 | (tri-)Acetin | |
| 1576-95-0 | (Z)-2-Penten-1-ol | |
| 81786-73-4 | (Z)-3,4,5,6,6-Pentamethylhept-3-en-2-one | |
| 53243-59-7 | (Z)-3-Methyl-5-phenylpent-2-enenitrile | |
| 21944-98-9 | (Z)-4-Dodecenal | |
| 6191-71-5 | (Z)-4-Hepten-1-ol | |
| 63095-33-0 | (Z)-5-(3-Hexenyl)dihydrofuran-2(3H)-one | |
| 23726-92-3 | (Z)-beta-1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one | |
| 53398-85-9 | (Z)-Hex-3-enyl 2-methylbutyrate | |
| 76238-22-7 | (Z)-Non-6-enyl acetate | |
| 143-28-2 | (Z)-Octadec-9-enol | |
| 63449-64-9 | (Z,Z)-1,1'-[Ethylidenebis(oxy)]di(hex-3-ene) | |
| 20834-59-7 | .alpha.,.alpha.,4-Trimethylphenethyl alcohol | |
| 33885-52-8 | .alpha.,.alpha.,6,6-Tetramethylbicyclo[3.1.1]hept-2-ene-2-propionaldehyde | |
| 63767-86-2 | .alpha.-Methyl-4-(1-methylethyl)-cyclohexanemethanol | |
| 13487-27-9 | .alpha.-Methylcyclohexylmethyl acetate | |
| 103694-68-4 | .beta.,.beta.,3-Trimethyl benzenepropanol | |
| 7235-40-7 | .beta.,.beta.-Carotene | |
| 6784-13-0 | .beta.,4-Dimethylcyclohex-3-ene-1-propan-1-al | |
| 472-97-9 | .beta.-Caryophyllene alcohol | |
| 79-70-9 | .beta.-Irone | |
| 67801-36-9 | .Eta.-1H-Indol-1-yl-.alpha.,.alpha.,.epsilon.-trimethyl-1H-indole-1-heptanol | |
| 68039-73-6 | [1,1'-Bicyclopentyl]-2-yl 2-butenoate | |
| 71048-82-3 | [1.alpha.(E),2.beta.]-1-(2,6,6-Trimethyl-3-cyclohexen-1-yl)-2-buten-1-one | |
| 80858-47-5 | [2-(Cyclohexyloxy)ethyl]benzene | |
| 68555-28-2 | [2,2-Bis(3-methylbutoxy)ethyl]benzene | |
| 67634-02-0 | [2,2-Bis[(3,7-dimethyl-2,6-octadienyl)oxy]ethyl]benzene | |
| 68039-47-4 | [2-Isopropoxyethyl]benzene | |
| 1378867-81-2 | 1-Cyclohexene-1-propanal, 4-(1-methylethyl)-, (4R) | |
| 2425-77-6 | 1-Decanol, 2-hexyl- | |
| 661-19-8 | 1-Docosanol | |
| 54464-57-2 | 1-(1,2,3,4,5,6,7,8-Octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)ethanone | |
| 74499-60-8 | 1-(1,2,3,4-Tetrahydro-4,4-dimethyl-1-naphthyl)propan-1-one | |
| 68155-66-8 | 1-(1,2,3,5,6,7,8,8a-Octahydro-2,3,8,8-tetramethyl-2-naphthyl)ethan-1-one | |
| 29911-27-1 | 1-(1-Methyl-2-propoxyethoxy)propan-2-ol | |
| 941-98-0 | 1-(1-Naphthyl)ethanone | |
| 70788-30-6 | 1-(2,2,6-Trimethylcyclohexyl)-3-hexanol | |
| 35087-49-1 | 1-(2,2-Dimethyl-6-methylenecyclohexyl)but-2-en-1-one | |
| 69929-17-5 | 1-(2,4-Dimethyl-3-cyclohexenyl)-2,2-dimethylpropan-1-one | |
| 7779-30-8 | 1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)pent-1-en-3-one | |
| 23696-85-7 | 1-(2,6,6-Trimethylcyclohexa-1,3-dienyl)-2-buten-1-one | |
| 1646-26-0 | 1-(2-Benzofuranyl)ethanone | |
| 29911-28-2 | 1-(2-Butoxypropoxy)-propan-2-ol | |
| 870515-09-6 | 1(2H)-Naphthalenone, 4-ethyloctahydro-8-methyl- | |
| 85-83-6 | 1-(2-methyl-4-(2-methylphenylazo)phenylazo)-2-naphthol | |
| 526218-21-3 | 1-(2-Methylprop-2-enoloxy)-2,2,4-trimethylpentan-3-ol | |
| 139504-68-0 | 1-(2-tert.-Butyl cyclohexyloxy)-2-butanol | |
| 25304-14-7 | 1-(3,3-Dimethylcyclohexyl)ethan-1-one | |
| 25225-09-6 | 1-(3,3-Dimethylcyclohexyl)ethanol | |
| 56973-87-6 | 1-(3,3-Dimethylcyclohexyl)pent-4-en-1-one | |
| 68480-14-8 | 1-(3,5,6-Trimethyl-3-cyclohexen-1-yl)ethan-1-one | |
| 23911-56-0 | 1-(3-Methyl-2-benzofuranyl)ethanone | |
| 27113-22-0 | 1-(4-Hydroxy-3-methoxyphenyl)decan-3-one | |
| 16556-48-2 | 1-(4-Methoxy-2,2,6,6-tetramethyl-3-cyclohexen-1-yl)ethan-1-one | |
| 56973-85-4 | 1-(5,5-Dimethyl-1-cyclohexen-1-yl)pent-4-en-1-one | |
| 774-55-0 | 1-(5,6,7,8-tetrahydro-2-naphthalenyl)ethanone | |
| 1506-02-1 | 1-(5,6,7,8-Tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthyl)ethan-1-one (Fixolid) | |
| 1393645-32-3 | 1-(5-Ethyl-5-methyl-1-cyclohexen-1-yl)-4-penten-1-one | |
| 1370699-98-1 | 1-(5-propyl-1,3-benzodioxol-2-yl)-1-ethanone | |
| 6408-50-0 | 1-(Methylamino)-4-(m-tolylamino)-9,10-anthraquinone | |
| 10152-77-9 | 1-(Methylthio)-1-propene | |
| 1333-52-4 | 1-(Naphthyl)ethan-1-one | |
| 31375-17-4 | 1-(para-Menthen-6-yl)-1-propanone | |
| 122-84-9 | 1-(p-Methoxyphenyl)-2-propanone | |
| 5343-92-0 | 1,2-Pentanediol | |
| 70445-33-9 | 1,2-Propanediol, 3-[(2-ethylhexyl)oxy]- | |
| 72152-84-2 | 1,3-Cyclohexadiene-1-carbonitrile, 2,6,6-trimethyl- | |
| 100520-15-8 | 1,3-Cyclohexadiene-1-carboxylic acid, 4,6,6-trimethyl-, ethyl ester | |
| 13431-57-7 | 1,3-Propanediol, 2,2-dimethyl-, 1,3-diacetate | |
| 6358-69-6 | 1,3,6-Pyrenetrisulfonic acid, 8-hydroxy-, sodium salt (1:3) | |
| 900779-74-0 | 1,5-Cyclododecadiene, 9-methoxy-1,6,10-trimethyl- | |
| 53834-70-1 | 1,5,7-Octatrien-3-ol, 3,7-dimethyl-, (5E)- | |
| 39707-47-6 | 1,6-Octadiene-3-thiol, 3,7-dimethyl- | |
| 3910-35-8 | 1,1,3-Trimethyl-3-phenylindane | |
| 86198-35-8 | 1,1-Diethoxy-3,5,5-trimethylhexane | |
| 34764-02-8 | 1,1-Diethoxydecane | |
| 688-82-4 | 1,1-Diethoxyheptane | |
| 3658-93-3 | 1,1-Diethoxyhexane | |
| 69178-43-4 | 1,1-Diethoxyisooctane | |
| 33673-65-3 | 1,1-Dihexyloxyhexane | |
| 950-33-4 | 1,1-Dimethoxycyclododecane | |
| 151-05-3 | 1,1-Dimethyl-2-phenylethyl acetate | |
| 59354-71-1 | 1,1-Dimethyl-2-phenylethyl isobutyrate | |
| 89-88-3 | 1,2,3,3a,4,5,6,8a-Octahydro-4,8-dimethyl-2-(1-methylethylidene)-6-azulenol | |
| 41199-19-3 | 1,2,3,4,4a,5,6,7-Octahydro-2,5,5-trimethyl-2-naphthalenol | |
| 65405-72-3 | 1,2,3,4,4a,7,8,8a-Octahydro-2,4a,5,8a-tetramethyl-1-naphthyl formate | |
| 22690-27-3 | 1,2,3,4,5,6,7,8,9,10-Decahydro-5,9-methanobenzocycloocten-11-one | |
| 68991-96-8 | 1,2,3,4,5,6,7,8-Octahydro-5,5-dimethylnaphthalene-2-carbaldehyde | |
| 68991-97-9 | 1,2,3,4,5,6,7,8-Octahydro-8,8-dimethyl-2-naphthaldehyde | |
| 172820-60-9 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ethyl ester | |
| 866-84-2 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, tripotassium salt | |
| 25395-31-7 | 1,2,3-Propanetriol, diacetate | |
| 2634-33-5 | 1,2-Benzisothiazol-3(2H)-one | |
| 33079-56-0 | 1,2-Cyclopentanedione, 3,4,4-trimethyl- | |
| 1119-86-4 | 1,2-Decanediol | |
| 91-16-7 | 1,2-Dimethoxybenzene | |
| 6920-22-5 | 1,2-Hexanediol | |
| 1117-86-8 | 1,2-Octanediol | |
| 13851-11-1 | 1,3,3-Trimethyl-2-norbornanyl acetate | |
| 1222-05-5 | 1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylcyclopenta-gamma-2-benzopyran | |
| 40601-76-1 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris[[4-(1,1-dimethylethyl)-3-hydroxy-2,6-dimethylphenyl]methyl]- | |
| 9003-08-1 | 1,3,5-Triazine-2,4,6-triamine, polymer with formaldehyde | |
| 91-76-9 | 1,3,5-Triazine-2,4-diamine, 6-phenyl- | |
| 16356-11-9 | 1,3,5-Undecatriene | |
| 2051-85-6 | 1,3-Benzenediol, 4-(2-phenyldiazenyl)- | |
| 40527-42-2 | 1,3-Benzodioxole, 5-(diethoxymethyl)- | |
| 68844-96-2 | 1,3-Benzodioxole-5-propanol, alpha-methyl-, 5-acetate | |
| 107-88-0 | 1,3-Butanediol | |
| 80118-10-1 | 1,3-Dimethyl-3-butenyl salicylate | |
| 68083-58-9 | 1,3-Dimethyl-3-phenylbutyl acetate | |
| 80118-06-5 | 1,3-Dimethylbut-3-enyl isobutyrate | |
| 35206-51-0 | 1,3-Dimethylbutyl 2-butenoate | |
| 117933-89-8 | 1,3-Dioxane, 2-(2,4-dimethyl-3-cyclohexene-1-yl)-5-methyl-5-(1-methylpropyl)- | |
| 166301-22-0 | 1,3-Dioxane, 5-methyl-2-(2-methylpropyl)-cis- | |
| 131812-48-1 | 1,3-Dioxolane, 2,4-dimethyl-2-(5,6,7,8-tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthalenyl)- | |
| 131812-52-7 | 1,3-Dioxolane, 2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-, trans- | |
| 100-79-8 | 1,3-Dioxolane-4-methanol, 2,2-dimethyl | |
| 1322-17-4 | 1,3-Nonanediol acetate (mixed esters) | |
| 444880-09-5 | 1,3-Oxathiane,2-ethyl-4,4-dimethyl- | |
| 504-63-2 | 1,3-Propanediol | |
| 70356-09-1 | 1,3-Propanedione, 1-[4-(1,1-dimethylethyl)phenyl]-3-(4-methoxyphenyl)- | |
| 166432-52-6 | 1,3-Undecadien-5-yne | |
| 54889-63-3 | 1,4-Bis(ethoxymethyl)cyclohexane | |
| 124-20-9 | 1,4-Butanediamine, N-(3-aminopropyl)- | |
| 470-67-7 | 1,4-Cineole | |
| 21112-37-8 | 1,4-Dimethoxy-2-tert-butylbenzene | |
| 13786-79-3 | 1,5,9-Trimethylcyclododeca-1,5,9-triene epoxide | |
| 75147-23-8 | 1,5-Dimethylbicyclo[3.2.1]octan-8-one-oxime | |
| 67952-57-2 | 1,5-Dimethylhexyl acetate | |
| 313973-37-4 | 1,6-Heptadien-3-one, 2-cyclohexyl- | |
| 73018-51-6 | 1,6-Octadien-3-ol, 3,7-dimethyl-, acid-isomerized | |
| 76-22-2 | 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one | |
| 24238-95-7 | 1,7,7-Trimethylbicyclo[4.4.0]dec-3-yl acetate | |
| 3526-75-8 | 1.alpha.,5.alpha.-Dihydroguaiol | |
| 68259-33-6 | 1-[5(Or 6)-Methyl-7(or 8)-(1-methylethyl)bicyclo[2.2.2]oct-5-en-2-yl]ethan-1-one | |
| 68922-12-3 | 10-Dodecen-3-one, 5-hydroxy-7,11-dimethyl- | |
| 1725-01-5 | 10-Oxahexadecanolide | |
| 112-19-6 | 10-Undecen-1-yl acetate | |
| 112-45-8 | 10-Undecenal | |
| 112-38-9 | 10-Undecenoic acid | |
| 68141-27-5 | 10-Undecenoic acid, heptyl ester | |
| 3391-83-1 | 11-Oxahexadecanolide | |
| 68141-18-4 | 11-Tridecen-6-one, 8,12-dimethyl- | |
| 6707-60-4 | 12-Oxahexadecanolide | |
| 868846-58-6 | 13-Methyloxacyclopentadecan-2-one | |
| 6829-22-7 | 14H-Benz[4,5]isoquino[2,1-a]perimidin-14-one | |
| 543724-31-8 | 1-Butanone, 3-(dodecylthio)-1-(2,6,6-trimethyl-3-cyclohexen-1-yl)- | |
| 18294-87-6 | 1-Cyclohexene-1-acetic acid | |
| 850997-10-3 | 1-Cyclohexene-1-propanal, 4,4-dimethyl- | |
| 1193-81-3 | 1-Cyclohexylethanol | |
| 68039-69-0 | 1-Cyclohexylethyl 2-butenoate | |
| 63449-88-7 | 1-Cyclohexylethyl butyrate | |
| 16510-27-3 | 1-Cyclopropylmethyl-4-methoxybenzene | |
| 112-30-1 | 1-Decanol | |
| 51100-54-0 | 1-Decen-3-ol | |
| 61668-40-4 | 1-Ethoxy 1-decene | |
| 5240-32-4 | 1-Ethynylcyclohexyl acetate | |
| 66327-54-6 | 1-Formyl-1-methyl-4-(4-methyl-pentyl)-3-cyclohexene | |
| 1639-09-4 | 1-Heptanethiol | |
| 36653-82-4 | 1-Hexadecanol | |
| 285977-85-7 | 1H-Indende-2-methanol, 2,3-dihydro-2,5-dimethyl- | |
| 95-13-6 | 1H-Indene | |
| 351343-77-6 | 1H-Indene, 2,3,3a,4,5,7a-hexahydro-1,1,2,3,3-pentamethyl-6-(2-propenyl)- | |
| 1934-21-0 | 1H-Pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-1-(4-sulfophenyl)-4-[(4-sulfophenyl)azo]-, trisodium salt | |
| 1565-76-0 | 1-Menthyl methylether | |
| 4747-07-3 | 1-Methoxyhexane | |
| 94291-50-6 | 1-Methoxyhexane-3-thiol | |
| 107-98-2 | 1-Methoxypropan-2-ol | |
| 72183-75-6 | 1-Methyl-2-(1-methylpropyl)cyclohexyl acetate | |
| 3008-43-3 | 1-Methyl-2,3-cyclohexadione | |
| 215231-33-7 | 1-methyl-3-(2-methylpropyl)cyclohexan-1-ol | |
| 52474-60-9 | 1-Methyl-3-(4-methyl-3-pentenyl)cyclohex-3-ene-1-carbaldehyde | |
| 1076-56-8 | 1-Methyl-3-methoxy-4-isopropylbenzene | |
| 52475-86-2 | 1-Methyl-4-(4-methyl-3-pentenyl)cyclohex-3-ene-1-carbaldehyde | |
| 21129-27-1 | 1-Methyl-4-(isopropyl)cyclohexan-1-ol | |
| 37514-30-0 | 1-Methylcyclododecyl methyl ether | |
| 90-12-0 | 1-Methylnaphthalene | |
| 4548-53-2 | 1-Naphthalenesulfonic acid, 3-[(2,4-dimethyl-5-sulfophenyl)azo]-4-hydroxy-, disodium salt | |
| 103614-86-4 | 1-Naphthalenol, 1,2,3,4,4a,5,8,8a-octahydro-2,2,6,8-tetramethyl- | |
| 6535-42-8 | 1-Naphthalenol, 4-[(4-ethoxyphenyl)azo]- | |
| 68922-14-5 | 1-Nonanol, 2,4,6,8-tetramethyl-,acetate | |
| 111-87-5 | 1-Octanol | |
| 3391-86-4 | 1-Octen-3-ol | |
| 4312-99-6 | 1-Octen-3-one | |
| 2442-10-6 | 1-Octen-3-yl acetate | |
| 111-66-0 | 1-Octene | |
| 71078-31-4 | 1-Oxaspiro[4.5]deca-3,6-diene, 2,6,9,10-tetramethyl- | |
| 89079-92-5 | 1-Oxaspiro[4.5]deca-3,6-diene, 2,7-dimethyl-10-(1-methylethyl)- | |
| 79893-63-3 | 1-Oxaspiro[4.5]deca-3,6-diene, 6-ethyl-2,10,10-trimethyl- | |
| 699-61-6 | 1-Oxaspiro[4.5]decan-2-one | |
| 4625-90-5 | 1-Oxaspiro[4.5]decan-2-one, 8-(1-methylethyl)-, trans- | |
| 91069-40-8 | 1-Oxaspiro[4.5]decan-2-one, 8-ethyl-, trans- | |
| 94201-19-1 | 1-Oxaspiro[4.5]decan-2-one, 8-methyl- | |
| 57967-68-7 | 1-Oxaspiro[4.5]decan-6-ol, 2,6,10,10-tetramethyl-, (2R,5S,6S)-rel- | |
| 616-25-1 | 1-Penten-3-ol | |
| 1629-58-9 | 1-Penten-3-one | |
| 68555-94-2 | 1-Penten-3-one, 2-methyl-1-(2,2,6-trimethylcyclohexenyl)- | |
| 579-07-7 | 1-Phenyl-1,2-propanedione | |
| 10415-87-9 | 1-Phenyl-3-methyl-3-pentanol | |
| 71159-90-5 | 1-p-Menthene-8-thiol | |
| 75150-29-7 | 1-Propanaminium, N,N,N-trimethyl-3-[(1-oxo-2-propenyl)amino]-, chloride, polymer with 2-propenamide | |
| 128119-70-0 | 1-Propanol, 2-methyl-3-[(1,7,7-trimethylbicyclo-[2.2.1]hept-2-yl)oxy]- | |
| 1569-01-3 | 1-Propoxypropan-2-ol | |
| 112-72-1 | 1-Tetradecanol | |
| 112-70-9 | 1-Tridecanol | |
| 1401065-88-0 | 2-Cyclohexen-1-ol, 2,6-dimethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)- | |
| 1447712-18-6 | 2-Cyclohexen-1-one, 2-methyl-5-propyl- | |
| 15848-49-4 | 2-Cyclopentene-1-acetic acid, ethyl ester | |
| 16874-34-3 | 2-Furancarboxylic acid, tetrahydro-, ethyl ester | |
| 1247790-47-1 | 2-Heptanol, 3,6-dimethyl- | |
| 2371-13-3 | 2-Octen-1-ol, 1-acetate | |
| 947237-95-8 | 2-Octenenitrile, 3,5,7-trimethyl- | |
| 76649-17-7 | 2-Pentenoic acid, 2-methyl-, (3Z)-3-hexen-1-yl ester | |
| 6197-30-4 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester | |
| 25987-30-8 | 2-Propenoic acid, polymer with 2-propenamide, sodium salt | |
| 2810-04-0 | 2-Thiophenecarboxylic acid, ethyl ester | |
| 68480-25-1 | 2-Tridecen-1-ol | |
| 141773-73-1 | 2-(1-(3',3'-Dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate | |
| 1217-08-9 | 2-(1,1,2,3,3-Pentamethylindan-5-yl)-1-propanol | |
| 67634-11-1 | 2-(1,1-Dimethylethyl)-4-methylcyclohexan-1-ol | |
| 5947-36-4 | 2(10)-Pinen-3-ol | |
| 7399-50-0 | 2-(1-Ethylpropyl)pyridine | |
| 37172-02-4 | 2-(1-Methylpropyl)-1-vinylcyclohexyl acetate | |
| 3147-75-9 | 2-(2 Hydroxy-5-tert-oxyphenyl) benzotriazole | |
| 929625-08-1 | 2-(2,2,7,7-Tetramethyltricyclo[6.2.1.01,6]undec-5-en-5-yl)propan-1-ol | |
| 68133-79-9 | 2-(3,7-Dimethyl-2,6-octadienyl)cyclopentanone | |
| 66094-79-9 | 2(3H)-Furanone, 3-ethyldihydro-5,5-dimethyl- | |
| 92015-65-1 | 2(3H)-Benzofuranone, hexahydro-3,6-dimethyl- | |
| 4359-47-1 | 2-(3-Heptyl)-1,3-dioxolane | |
| 2110-18-1 | 2-(3-Phenylpropyl)pyridine | |
| 3208-40-0 | 2-(3-Phenylpropyl)tetrahydrofuran | |
| 80417-97-6 | 2(4H)-Benzofuranone, 5,6-dihydro-3,6-dimethyl- | |
| 80819-94-9 | 2-(4-Methyl-1-phenyl)-2-propanethiol | |
| 65817-24-5 | 2-(4-Methyl-2-hydroxyphenyl)propionic acid-gamma-lactone | |
| 94159-31-6 | 2-(4-Methyl-5-thiazolyl)ethyl butanoate | |
| 15149-10-7 | 2-(4-Methylphenoxy)ethanol | |
| 1374760-95-8 | 2-(4-Methylphenoxy)-N-(1H-pyrazol-3-yl)-N-(thiophen-2-ylmethyl)acetamide | |
| 1333-58-0 | 2-(Methylpropyl)quinoline | |
| 95962-14-4 | 2-(p-Menth-1-ene-10-yl)cyclopentanone | |
| 60047-17-8 | 2-(Tetrahydro-5-methyl-5-vinyl-2-furyl)propan-2-ol | |
| 51608-18-5 | 2-(trans-2-Pentenyl)cyclopentanone | |
| 1958026-97-5 | 2,10-Tetradecadienenitrile, (2E,10Z)- | |
| 118635-60-2 | 2,11-Dodecadienal, (E)- (9CI) | |
| 24634-61-5 | 2,4-Hexadienoic acid, potassium salt (1:1), (2E,4E)- | |
| 197098-61-6 | 2,5,7-Octatrien-1-ol, 2,6-dimethyl-, 1-acetate | |
| 76917-23-2 | 2,6-Octadienal, (2E,6Z)- | |
| 1891-67-4 | 2,6-Octadienal, 3,6,7-trimethyl- | |
| 52711-52-1 | 2,7-Decadienal, (2E,7Z)- | |
| 1801275-25-1 | 2,7-Decadienenitrile | |
| 1801275-26-2 | 2,7-Decadienenitrile, (2E,7Z)- | |
| 21662-22-6 | 2,7-Nonadienal, (2E,7Z)- | |
| 6931-54-0 | 2,10-Epoxypinane | |
| 4437-20-1 | 2,2'-(Dithiodimethylene)-difuran | |
| 4501-58-0 | 2,2,3-Trimethyl-3-Cyclopentene-1-acetaldehyde | |
| 15373-31-6 | 2,2,3-Trimethylcyclopent-3-enylacetonitrile | |
| 131-55-5 | 2,2',4,4'-Tetrahydroxybenzophenone | |
| 75490-39-0 | 2,2,4-Trimethyl-4-phenyl-butane-nitrile | |
| 65443-14-3 | 2,2,5-Trimethyl-5-pentylcyclopentanone | |
| 7392-19-0 | 2,2,6-Trimethyl-6-vinyltetrahydropyran | |
| 2408-37-9 | 2,2,6-Trimethylcyclohexanone | |
| 69103-20-4 | 2,2-Dimethyl-3-(3-methyl-2,4-pentadienyl)oxirane | |
| 104468-21-5 | 2,2-Dimethyl-3-methyl-3-butenyl propanoate | |
| 13351-61-6 | 2,2-Dimethyl-3-phenylpropanol | |
| 7416-35-5 | 2,2-Dimethyl-5-(1-methylpropen-1-yl)tetrahydrofuran | |
| 54440-17-4 | 2,3,3-Trimethylindanone | |
| 68433-81-8 | 2,3,4,4a,5,6-hexahydro-2,2-dimethyl-1,3-methanonaphthalen-7(1H)-one | |
| 3054-92-0 | 2,3,4-Trimethyl-3-pentanol | |
| 1124-11-4 | 2,3,5,6-Tetramethylpyrazine | |
| 14667-55-1 | 2,3,5-Trimethylpyrazine | |
| 18138-04-0 | 2,3-Diethyl-5-methylpyrazine | |
| 15707-24-1 | 2,3-Diethylpyrazine | |
| 300371-33-9 | 2,3-Dihydro-1,1-dimethyl-1H-indene-ar-propanal | |
| 3782-00-1 | 2,3-Dimethylbenzofuran | |
| 526-75-0 | 2,3-Dimethylphenol | |
| 5910-89-4 | 2,3-Dimethylpyrazine | |
| 96-04-8 | 2,3-Heptanedione | |
| 3848-24-6 | 2,3-Hexanedione | |
| 74338-72-0 | 2,4,4,7-Tetramethyl-6-octen-3-one | |
| 81782-89-0 | 2,4,4,7-Tetramethylnona-6,8-dien-3-one | |
| 81783-01-9 | 2,4,4,7-Tetramethylnona-6,8-diene-3-one-oxime | |
| 13623-11-5 | 2,4,5-Trimethylthiazole | |
| 499-44-5 | 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-4-(1-methylethyl)- | |
| 68527-77-5 | 2,4,6-Trimethyl-3-cyclohexene-1-methanol | |
| 5182-36-5 | 2,4,6-Trimethyl-4-phenyl-1,3-dioxane | |
| 1423-46-7 | 2,4,6-Trimethylcyclohex-3-enecarbaldehyde | |
| 527-60-6 | 2,4,6-Trimethylphenol | |
| 18409-21-7 | 2,4-Decadien-1-ol | |
| 131812-67-4 | 2,4-Dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolane | |
| 68039-49-6 | 2,4-Dimethyl-3-cyclohexen-1-carboxaldehyde | |
| 27606-09-3 | 2,4-Dimethyl-4,4a,5,9b-tetrahydroindeno[1,2-d]-1,3-dioxin | |
| 82461-14-1 | 2,4-Dimethyl-4-phenyltetrahydrofuran | |
| 62346-96-7 | 2,4-Dimethylbenzyl acetate | |
| 67634-17-7 | 2,4-Dimethylcyclohex-3-ene-1-methanol | |
| 67634-26-8 | 2,4-Dimethylcyclohex-3-ene-1-methyl acetate | |
| 67634-22-4 | 2,4-Dimethylcyclohexylmethyl acetate | |
| 108-47-4 | 2,4-Dimethylpyridine | |
| 16491-24-0 | 2,4-Hexadienyl isobutyrate | |
| 6440-58-0 | 2,4-Imidazolidinedione, 1,3-bis(hydroxymethyl)-5,5-dimethyl- | |
| 105-67-9 | 2,4-Xylenol | |
| 68378-13-2 | 2,5 or 6-Methoxy-3-methylpyrazine (mixture of isomers) | |
| 5406-58-6 | 2,5,5-Trimethyl-2-phenyl-1,3-dioxane | |
| 82784-84-7 | 2,5,6-Trimethyl-4-heptenal | |
| 41239-48-9 | 2,5-Diethyltetrahydrofuran | |
| 4077-47-8 | 2,5-Dimethyl-4-methoxy-3(2H)-furanone | |
| 123-32-0 | 2,5-Dimethylpyrazine | |
| 95-87-4 | 2,5-Xylenol | |
| 141-13-9 | 2,6,10-Trimethyl-9-undecenal | |
| 24048-14-4 | 2,6,10-Trimethylundeca-5,9-dienol | |
| 432-25-7 | 2,6,6-Trimethyl-1&2-cyclohexen-1-carboxaldehyde | |
| 472-66-2 | 2,6,6-Trimethyl-1-cyclohexen-1-acetaldehyde | |
| 1125-21-9 | 2,6,6-Trimethylcyclohex-2-ene-1,4-dione | |
| 116-26-7 | 2,6,6-Trimethylcyclohexa-1,3-dienyl methanal | |
| 123-18-2 | 2,6,8-Trimethylnonan-4-one | |
| 91-10-1 | 2,6-Dimethoxyphenol | |
| 17909-77-2 | 2,6-Dimethyl-10-methylene-2,6,11-dodecatrienal | |
| 3016-19-1 | 2,6-Dimethyl-2,4,6-octatriene | |
| 13254-34-7 | 2,6-Dimethyl-2-heptanol | |
| 108-82-7 | 2,6-Dimethyl-4-heptanol | |
| 106-72-9 | 2,6-Dimethyl-5-heptenal | |
| 25279-09-8 | 2,6-Dimethyloct-7-en-2-yl formate | |
| 1879-00-1 | 2,6-Dimethyloct-7-en-4-one | |
| 673-84-7 | 2,6-Dimethylocta-2,4,6-triene | |
| 108-50-9 | 2,6-Dimethylpyrazine | |
| 108-48-5 | 2,6-Dimethylpyridine | |
| 7786-44-9 | 2,6-Nonadien-1-ol | |
| 67674-36-6 | 2,6-Nonadienal diethyl acetal | |
| 67019-89-0 | 2,6-Nonadienenitrile | |
| 90480-35-6 | 2,6-Octadienal, 3,7-dimethyl-, acid-isomerized | |
| 147060-73-9 | 2,6-Octadienal, 3,7-dimethyl-, reaction products with Et alc. | |
| 38237-00-2 | 2,6-Octadiene-1-thiol, 3,7-dimethyl- | |
| 576-26-1 | 2,6-Xylenol | |
| 3567-66-6 | 2,7-Naphthalenedisulfonic acid, 5-amino-4-hydroxy-3-(phenylazo)-, disodium salt | |
| 84642-57-9 | 2-[(3,3,5-Trimethylcyclohexyl)acetyl]cyclopentan-1-one | |
| 94087-23-7 | 2-[7-Isopropyl-5-methylbicyclo[2.2.2]oct-5-en-2-yl]-1,3-dioxolane | |
| 68901-32-6 | 2-[8-Isopropyl-6-methylbicyclo[2.2.2]oct-5-en-2-yl]-1,3-dioxolane | |
| 29926-41-8 | 2-Acetyl-2-thiazoline | |
| 32974-92-8 | 2-Acetyl-3-ethylpyrazine | |
| 23787-80-6 | 2-Acetyl-3-methylpyrazine | |
| 1193-79-9 | 2-Acetyl-5-methylfuran | |
| 1122-62-9 | 2-Acetylpyridine | |
| 24295-03-2 | 2-Acetylthiazole | |
| 88-15-3 | 2-Acetylthiophene | |
| 77-86-1 | 2-Amino-2-(hydroxymethyl)-1,3-propanediol | |
| 97384-48-0 | 2-Benzyl-2-methylbut-3-enenitrile | |
| 92368-90-6 | 2-Benzylheptanol | |
| 78-93-3 | 2-Butanone | |
| 1803467-44-8 | 2-Butanone, 4-(dodecylthio)-4-[2,6,6-trimethyl-1(or 2)-cyclohexen-1-yl] | |
| 1129-62-0 | 2-Butanone, phenylhydrazone | |
| 54533-29-8 | 2-Buten-1-one, 2-methyl-1-(1-piperidinyl)- | |
| 54546-26-8 | 2-Butyl-4,4,6-trimethyl-1,3-dioxane | |
| 24237-02-3 | 2-Butyltetrahydro-6-methyl-4-methylene-2H-pyrane | |
| 90-42-6 | 2-Cyclohexylcyclohexanone | |
| 4442-79-9 | 2-Cyclohexylethyl alcohol | |
| 916887-53-1 | 2-Cyclohexylidene-2-o-tolylacetonitrile | |
| 2109-22-0 | 2-Cyclohexylpropanal | |
| 21835-00-7 | 2-Cyclopenten-1-one, 2-hydroxy-3,4-dimethyl- | |
| 4884-24-6 | 2-Cyclopentylcyclopentanone | |
| 693-54-9 | 2-Decanone | |
| 3913-71-1 | 2-Decenal | |
| 4826-62-4 | 2-Dodecenal | |
| 68845-00-1 | 2-Ethoxy-2,6,6-trimethyl-9-methylenebicyclo[3.3.1]nonane | |
| 5595-79-9 | 2-Ethoxy-4-(methoxymethyl)phenol | |
| 96840-56-1 | 2-Ethoxy-4-[(1-methylethoxy)methyl] phenol | |
| 2563-07-7 | 2-Ethoxy-4-methylphenol | |
| 18368-91-7 | 2-Ethyl-1,3,3-trimethyl-2-norbornanol | |
| 97-95-0 | 2-Ethyl-1-butanol | |
| 104-76-7 | 2-Ethyl-1-hexanol | |
| 15707-23-0 | 2-Ethyl-3-methylpyrazine | |
| 28219-61-6 | 2-Ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-buten-1-ol | |
| 27538-10-9 | 2-Ethyl-4-hydroxy-5-methylfuran-3(2H)-one | |
| 15679-12-6 | 2-Ethyl-4-methylthiazole | |
| 122795-41-9 | 2-Ethyl-5-methoxybicyclo[2.2.1]heptane | |
| 13360-64-0 | 2-Ethyl-5-methylpyrazine | |
| 10031-87-5 | 2-Ethylbutyl acetate | |
| 94278-39-4 | 2-Ethylbutyl cyclopent-2-ene-1-acetate | |
| 88-09-5 | 2-Ethylbutyric acid | |
| 27043-05-6 | 2-Ethyl-dimethylpyrazine (isomer unspecified) | |
| 3208-16-0 | 2-Ethylfuran | |
| 123-05-7 | 2-Ethylhexanal | |
| 103-09-3 | 2-Ethylhexyl acetate | |
| 90-00-6 | 2-Ethylphenol | |
| 13925-00-3 | 2-Ethylpyrazine | |
| 564-94-3 | 2-Formyl-6,6-dimethylbicyclo(3.1.1)hept-2-ene | |
| 59020-90-5 | 2-Furanmethanethiol formate | |
| 67801-17-6 | 2-Furfuryleneoctanal | |
| 1192-62-7 | 2-Furyl methyl ketone | |
| 1392277-05-2 | 2H-2,4a-Methanonaphthalen-1(5H)-one, hexahydro-5,5-dimethyl-2-propyl- | |
| 676125-00-1 | 2H-2,4a-Methanonaphthalene, 1,3,4,5,6,7-hexahydro-7-methoxy-1,1,5,5-tetramethyl- | |
| 1127890-59-8 | 2H-Cyclopenta[b]furan, hexahydro-6,6,6a-trimethyl-2-(1-methylpropyl)- | |
| 875471-31-1 | 2H-Pyran-2-one, tetrahydro-5-pentyl- | |
| 214335-70-3 | 2H-Pyran-2-one, tetrahydro-5-propyl- | |
| 1099648-69-7 | 2H-Pyran-4-ol, 2-(1-ethylpropyl)tetrahydro-4-methyl- | |
| 854737-09-0 | 2H-Pyran, 3-heptyltetrahydro- | |
| 1945993-03-2 | 2H-Pyran, 3,6-dihydro-4,6-dimethyl-2-(1-phenylethyl)- | |
| 60335-74-2 | 2H-Pyran, tetrahydro-4-methylene-2-phenyl- | |
| 195251-91-3 | 2H-1,5-Benzodioxepin-3(4H)-one, 7-(1,1-dimethylethyl)- | |
| 950919-28-5 | 2H-1,5-Benzodioxepin-3(4H)-one, 7-(1-methylethyl)- | |
| 10191-41-0 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)- | |
| 7695-91-2 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-, acetate | |
| 59-02-9 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)- | |
| 54-28-4 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)- | |
| 543-49-7 | 2-Heptanol | |
| 110-43-0 | 2-Heptanone | |
| 137-03-1 | 2-Heptylcyclopentanone | |
| 2435-16-7 | 2-Heptyltetrahydrofuran | |
| 7541-49-3 | 2-Hexadecen-1-ol, 3,7,11,15-tetramethyl- | |
| 626-93-7 | 2-Hexanol | |
| 2305-21-7 | 2-Hexen-1-ol | |
| 341017-24-1 | 2-Hexen-1-ol, 3-methyl-, 1-acetate | |
| 16493-96-2 | 2-Hexenoic acid, 2-methyl-, methyl ester, (2E)- | |
| 1708-34-5 | 2-Hexyl-1,3-dioxolane | |
| 13074-65-2 | 2-Hexylcyclopentanone | |
| 16429-07-5 | 2-Hexylidenecyclohexan-1-one | |
| 615-13-4 | 2H-Inden-2-one, 1,3-dihydro- | |
| 476332-65-7 | 2H-Indeno[4,5b] furan, decahydro-2,2,6,6,7,8,8-heptamethyl | |
| 947237-75-4 | 2H-Pyran, 3,6-dihydro-4-methyl-2-[(2,2,3-trimethyl-3-cyclopenten-1-yl)methyl]- | |
| 149713-23-5 | 2H-Pyran, tetrahydro-4-methyl-2-phenyl-,(2R,4S)-rel | |
| 118-93-4 | 2-Hydroxyacetophenone | |
| 42822-86-6 | 2-Hydroxy-alpha,alpha,4-trimethylcyclohexanemethanol | |
| 69-72-7 | 2-Hydroxybenzoic acid | |
| 1984-60-7 | 2-Hydroxyethyl phenoxyacetate | |
| 87-41-2 | 2-Hydroxymethylbenzoic acid gamma lactone | |
| 120-93-4 | 2-Imidazolidinone | |
| 24683-00-9 | 2-Isobutyl-3-methoxypyrazine | |
| 13925-06-9 | 2-Isobutyl-3-methylpyrazine | |
| 63500-71-0 | 2-Isobutyl-4-methyltetrahydro-2H-pyran-4-ol | |
| 93-19-6 | 2-Isobutylquinoline | |
| 18640-74-9 | 2-Isobutylthiazole | |
| 31574-44-4 | 2-Isopropyl-4-methylanisole | |
| 15679-13-7 | 2-Isopropyl-4-methylthiazole | |
| 35158-25-9 | 2-Isopropyl-5-methyl-2-hexenal | |
| 67801-23-4 | 2-Isopropyl-5-methylcyclohexyl 2-methylbut-2-enoate | |
| 51115-67-4 | 2-Isopropyl-N,2,3-trimethylbutyramide | |
| 4427-56-9 | 2-Isopropyl-p-cresol | |
| 88-69-7 | 2-Isopropylphenol | |
| 79-42-5 | 2-Mercaptopropionic acid | |
| 24168-70-5 | 2-Methoxy-3-(1-methylpropyl)pyrazine | |
| 25773-40-4 | 2-Methoxy-3(5 and 6)-isopropylpyrazine | |
| 2847-30-5 | 2-Methoxy-3-methylpyrazine | |
| 93-51-6 | 2-Methoxy-4-methylphenol | |
| 2785-87-7 | 2-Methoxy-4-propylphenol | |
| 7786-61-0 | 2-Methoxy-4-vinylphenol | |
| 91-63-4 | 2-Methyl quinoline | |
| 107-41-5 | 2-Methyl-2,4-pentandiol | |
| 75-85-4 | 2-Methyl-2-butanol | |
| 497-03-0 | 2-Methyl-2-butenal | |
| 1569-60-4 | 2-Methyl-2-hepten-6-ol | |
| 2682-20-4 | 2-Methyl-2H-isothiazol-3-one | |
| 623-36-9 | 2-Methyl-2-pentenal | |
| 16957-70-3 | 2-Methyl-2-pentenoic acid | |
| 75-65-0 | 2-Methyl-2-propanol | |
| 68555-63-5 | 2-Methyl-3-(1-oxopropoxy)-4H-pyran-4-one | |
| 103-95-7 | 2-Methyl-3-(p-isopropylphenyl)propionaldehyde | |
| 32737-14-7 | 2-Methyl-3,5 or 6-ethoxypyrazine | |
| 115-18-4 | 2-Methyl-3-buten-2-ol | |
| 28588-74-1 | 2-Methyl-3-furanthiol | |
| 41496-43-9 | 2-Methyl-3-tolylpropionaldehyde | |
| 28219-60-5 | 2-Methyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-buten-1-ol | |
| 104864-90-6 | 2-Methyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-4-penten-1-ol | |
| 72089-08-8 | 2-Methyl-4(2,2,3-trimethyl-3-cyclopentenyl)butanol | |
| 68555-62-4 | 2-Methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-2-butenal | |
| 3155-71-3 | 2-Methyl-4-(2,6,6-trimethylcyclohex-1-en-1-yl)-2-butenal | |
| 68901-22-4 | 2-Methyl-4-(camphenyl-8)-cyclohexanone | |
| 33941-99-0 | 2-Methyl-4-phenyl-1,3-dioxolane | |
| 103-05-9 | 2-Methyl-4-phenyl-2-butanol | |
| 103-07-1 | 2-Methyl-4-phenyl-2-butyl acetate | |
| 10031-71-7 | 2-Methyl-4-phenyl-2-butyl isobutyrate | |
| 40654-82-8 | 2-Methyl-4-phenylbutyraldehyde | |
| 92585-24-5 | 2-Methyl-4-phenylpentanol | |
| 67715-80-4 | 2-Methyl-4-propyl-1,3-oxathiane | |
| 13678-59-6 | 2-Methyl-5-(methylthio)furan | |
| 25634-93-9 | 2-Methyl-5-phenylpentanol | |
| 95-21-6 | 2-Methylbenzoxazole | |
| 137-32-6 | 2-Methylbutanol | |
| 2445-77-4 | 2-Methylbutyl 3-methylbutanoate | |
| 624-41-9 | 2-Methylbutyl acetate | |
| 51115-64-1 | 2-Methylbutyl butyrate | |
| 2601-13-0 | 2-Methylbutyl hexanoate | |
| 96-17-3 | 2-Methylbutyraldehyde | |
| 116-53-0 | 2-Methylbutyric acid | |
| 19009-56-4 | 2-Methyldecanal | |
| 69300-15-8 | 2-Methyldecanenitrile | |
| 1188-02-9 | 2-Methylheptanoic acid | |
| 4536-23-6 | 2-Methylhexanoic acid | |
| 91-57-6 | 2-Methylnaphthalene | |
| 7786-29-0 | 2-Methyloctanal | |
| 3142-72-1 | 2-Methylpent-2-en-1-oic acid | |
| 123-15-9 | 2-Methylpentanal | |
| 50607-64-2 | 2-Methylpentanal-methyl anthranilate (Schiff base) | |
| 90397-38-9 | 2-Methylpentyl 2-methylvalerate | |
| 2445-67-2 | 2-Methylpropyl 2-methylbutyrate | |
| 589-59-3 | 2-Methylpropyl 3-methylbutyrate | |
| 10588-10-0 | 2-Methylpropyl pentanoate | |
| 109-08-0 | 2-Methylpyrazine | |
| 3188-00-9 | 2-Methyltetrahydrofuran-3-one | |
| 80-59-1 | 2-Methyl-trans-2-butenoic acid | |
| 110-41-8 | 2-Methylundecanal | |
| 68141-17-3 | 2-Methylundecanal dimethyl acetal | |
| 24323-25-9 | 2-Methylundecanoic acid | |
| 97-61-0 | 2-Methylvaleric acid | |
| 127459-79-4 | 2-Naphthalenecarboxaldehyde, 5,6,7,8-tetrahydro-3,5,5,6,7,8,8-heptamethyl- | |
| 25956-17-6 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[(2-methoxy-5-methyl-4-sulfophenyl)azo]-, disodium salt | |
| 2783-94-0 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[(4-sulfophenyl)azo]-, disodium salt | |
| 85-86-9 | 2-Naphthalenol, 1-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]- | |
| 628-99-9 | 2-Nonanol | |
| 821-55-6 | 2-Nonanone | |
| 22104-79-6 | 2-Nonen-1-ol | |
| 2463-53-8 | 2-Nonenal | |
| 21963-26-8 | 2-Nonenoic acid gamma-lactone | |
| 13257-44-8 | 2-Nonyn-1-al dimethylacetal | |
| 123-96-6 | 2-Octanol | |
| 111-13-7 | 2-Octanone | |
| 4643-27-0 | 2-Octen-4-one | |
| 2363-89-5 | 2-Octenal | |
| 60308-76-1 | 2-Octenoic acid, 4-ethyl-, (2E)- | |
| 5333-42-6 | 2-Octyldodecan-1-ol | |
| 2345-28-0 | 2-Pentadecanone | |
| 6032-29-7 | 2-Pentanol | |
| 107-87-9 | 2-Pentanone | |
| 764-39-6 | 2-Pentenal | |
| 21016-46-6 | 2-Pentenoic acid, 2,4-dimethyl-, ethyl ester, (2E)- | |
| 84560-00-9 | 2-Pentylcyclopentan-1-ol | |
| 4819-67-4 | 2-Pentylcyclopentan-1-one | |
| 3777-69-3 | 2-Pentylfuran | |
| 122-99-6 | 2-Phenoxyethanol | |
| 103-60-6 | 2-Phenoxyethyl isobutyrate | |
| 23495-12-7 | 2-Phenoxyethyl propionate | |
| 4411-89-6 | 2-Phenyl-2-butenal | |
| 67662-96-8 | 2-Phenylethyl pivalate | |
| 7460-74-4 | 2-Phenylethyl valerate | |
| 3508-98-3 | 2-Phenylhexanenitrile | |
| 93-53-8 | 2-Phenylpropionaldehyde | |
| 90-87-9 | 2-Phenylpropionaldehyde dimethyl acetal | |
| 2520-60-7 | 2-Prenylcyclopentanone | |
| 102-60-3 | 2-Propanol, 1,1',1',1'-(1,2-ethanediyldinitrilo)tetrakis- | |
| 401913-53-9 | 2-Propanol, 1-[1-(2,3-dimethylbicyclo[2.2.1] hept-2-yl) ethoxy]- | |
| 90530-04-4 | 2-Propanol, reaction products with boron trifluoride and 5-ethylidenebicyclo[2.2.1]hept-2-ene | |
| 26590-05-6 | 2-Propen-1-aminium, N,N-dimethyl-N-2-propenyl-, chloride, polymer with 2-propenamide | |
| 56138-10-4 | 2-Propen-1-ol, 2-methyl-3-(4-methylphenyl)-, (2E)- | |
| 820975-49-3 | 2-Propenoic acid, 2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl ester | |
| 238402-46-5 | 2-Propenoic acid, 3-(2-hydroxyphenyl)-, 9-decen-1-yl ester, (2E)- | |
| 5466-77-3 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester | |
| 208041-98-9 | 2-Propyl heptanenitrile | |
| 699-02-5 | 2-p-Tolylethanol | |
| 2524-52-9 | 2-Pyridinecarboxylic acid, ethyl ester | |
| 9003-39-8 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer | |
| 14765-30-1 | 2-sec-Butylcyclohexanone | |
| 121-00-6 | 2-tert-Butyl-4-methoxyphenol | |
| 13491-79-7 | 2-tert-Butylcyclohexanol | |
| 1728-46-7 | 2-tert-Butylcyclohexanone | |
| 88-41-5 | 2-tert-Butylcyclohexyl acetate | |
| 1948-33-0 | 2-tert-Butylhydroquinone | |
| 2409-55-4 | 2-tert-Butyl-p-cresol | |
| 21662-13-5 | 2-trans-6-cis-Dodecadienal | |
| 56767-18-1 | 2-trans-6-trans-Octadienal | |
| 20407-84-5 | 2-trans-Dodecenal | |
| 593-08-8 | 2-Tridecanone | |
| 7774-82-5 | 2-Tridecenal | |
| 1653-30-1 | 2-Undecanol | |
| 112-12-9 | 2-Undecanone | |
| 2463-77-6 | 2-Undecenal | |
| 22629-48-7 | 2-Undecenenitrile | |
| 31906-04-4 | 3 and 4-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde | |
| 1708-81-2 | 3-Hepten-1-ol, (3Z)- | |
| 56922-80-6 | 3-Hexen-1-ol, 1-formate, (3E)- | |
| 1577-18-0 | 3-Hexenoic acid, (3E)- | |
| 85508-08-3 | 3-Pentenoic acid, 2-methyl-, hexyl ester | |
| 55965-84-9 | 3(2H)-Isothiazolone, 5-chloro-2-methyl-, mixt. with 2-methyl-3(2H)-isothiazolone | |
| 27538-09-6 | 3(2H)-Furanone, 5-ethyl-4-hydroxy-2-methyl- | |
| 26172-55-4 | 3(2H)-Isothiazolone, 5-chloro-2-methyl- | |
| 40942-73-2 | 3-(2-Oxopropyl)-2-pentylcyclopentanone | |
| 51414-25-6 | 3-(4-Hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde | |
| 1637294-12-2 | 3-(4-isobutyl-2-methylphenyl)propanal | |
| 15760-18-6 | 3-(4-Methyl-3-cyclohexenyl)butanol | |
| 68084-04-8 | 3-(4-Methyl-3-pentenyl)-3-cyclohexene-1-carbonitrile | |
| 52475-89-5 | 3-(4-Methyl-3-pentenyl)cyclohex-3-ene-1-carbaldehyde | |
| 36861-47-9 | 3-(4'-Methylbenzylidene)camphor | |
| 6819-19-8 | 3-(4-Methylcyclohex-3-enyl)-3-butenyl acetate | |
| 3407-42-9 | 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol | |
| 53253-09-1 | 3-(cis-3-hexenyl)-2-cyclopentenone | |
| 142653-61-0 | 3-(cis-3-Hexenyloxy)propanenitrile | |
| 67801-33-6 | 3-(Hydroxymethyl)nonan-2-one | |
| 51755-66-9 | 3-(Methylthio)-1-hexanol | |
| 51755-85-2 | 3-(Methylthio)hexyl acetate | |
| 505-10-2 | 3-(Methylthio)propanol | |
| 3268-49-3 | 3-(Methylthio)propionaldehyde | |
| 62518-65-4 | 3-(m-tert-Butylphenyl)-2-methylpropionaldehyde | |
| 67634-14-4 | 3-(o-Ethylphenyl)-2,2-dimethylpropionaldehyde | |
| 7775-00-0 | 3-(p-Isopropylphenyl)propionaldehyde | |
| 56107-04-1 | 3-(p-tert-Butylphenyl)-2-methylpropanol | |
| 86611-09-8 | 3,5-Heptadien-1-ol, 1-acetate, (3Z,5E)- | |
| 76649-26-8 | 3,6-Nonadien-1-ol, 1-acetate | |
| 134769-33-8 | 3,12-Tridecadienenitrile | |
| 124071-42-7 | 3,12-Tridecadienenitrile, (3E)- | |
| 36306-87-3 | 3,3,5,5-Tetramethyl-4-ethoxyvinylcyclohexanone | |
| 3213-73-8 | 3,3,5-Trimethylcyclohexaneacetic acid | |
| 67859-96-5 | 3,3,5-Trimethylcyclohexyl acetate | |
| 67583-77-1 | 3,3,5-Trimethylcyclohexyl ethyl ether | |
| 107898-54-4 | 3,3-Dimethyl-5-(2,2,3-trimethyl-3-cyclopenten-1-yl)-4-penten-2-ol | |
| 72429-08-4 | 3,4,4a,5,8,8a(Or 3,4,4a,7,8,8a)-Hexahydro-3,3,6,7-tetramethyl-1H-2-benzopyran | |
| 41816-03-9 | 3,4,4a,5,8,8a-Hexahydro-3',7-dimethylspiro[1,4-methanonaphthalene-2(1H),2'-oxirane] | |
| 86115-11-9 | 3,4,5,6,6-Pentamethylhept-3-en-2-one | |
| 87118-95-4 | 3,4,5,6,6-Pentamethylheptan-2-ol | |
| 6939-35-1 | 3,4-Dihydro-5-methylnaphthalen-1(2H)-one | |
| 13494-06-9 | 3,4-Dimethyl-1,2-cyclopentadione | |
| 632-15-5 | 3,4-Dimethylthiophene | |
| 4437-51-8 | 3,4-Hexanedione | |
| 95-65-8 | 3,4-Xylenol | |
| 3452-97-9 | 3,5,5-Trimethyl-1-hexanol | |
| 116-02-9 | 3,5,5-Trimethylcyclohexanol | |
| 5435-64-3 | 3,5,5-Trimethylhexanal | |
| 58430-94-7 | 3,5,5-Trimethylhexyl acetate | |
| 81787-06-6 | 3,5,6,6-Tetramethyl-4-methyleneheptan-2-ol | |
| 81786-75-6 | 3,5,6,6-Tetramethyl-4-methyleneheptan-2-one | |
| 4179-19-5 | 3,5-Dimethoxytoluene | |
| 13494-07-0 | 3,5-Dimethyl-1,2-cyclopentadione | |
| 68039-48-5 | 3,5-Dimethylcyclohex-3-ene-1-carbaldehyde | |
| 67634-25-7 | 3,5-Dimethylcyclohex-3-ene-1-methyl acetate | |
| 67634-16-6 | 3,5-Dimethylcyclohexene-1-methanol | |
| 108-68-9 | 3,5-Dimethylphenol | |
| 68039-40-7 | 3,6-Dihydro-2,4-dimethyl-6-phenyl-2H-pyran | |
| 68039-41-8 | 3,6-Dihydro-4,6-dimethyl-2-phenyl-2H-pyran | |
| 60335-71-9 | 3,6-Dihydro-4-methyl-2-phenyl-2H-pyran | |
| 67801-65-4 | 3,6-Dimethyl-3-cyclohexene-1-carboxaldehyde | |
| 76649-25-7 | 3,6-Nonadien-1-ol | |
| 13877-91-3 | 3,7-Dimethyl-1,3,6-octatriene | |
| 10339-55-6 | 3,7-Dimethyl-1,6-nonadien-3-ol | |
| 61931-80-4 | 3,7-Dimethyl-1,6-nonadien-3-yl acetate | |
| 106-21-8 | 3,7-Dimethyl-1-octanol | |
| 20780-49-8 | 3,7-Dimethyl-1-octanyl acetate | |
| 41448-29-7 | 3,7-Dimethyl-2,6-nonadien-1-al | |
| 61792-11-8 | 3,7-Dimethyl-2,6-nonadienenitrile | |
| 22418-66-2 | 3,7-Dimethyl-2-methylenocta-6-enal | |
| 55722-59-3 | 3,7-Dimethyl-3,6-octadienal | |
| 502-47-6 | 3,7-Dimethyl-6-octenoic acid | |
| 41890-92-0 | 3,7-Dimethyl-7-methoxyoctan-2-ol | |
| 18479-49-7 | 3,7-Dimethyloct-1-en-3-ol | |
| 18479-51-1 | 3,7-Dimethyloct-6-en-3-ol | |
| 67601-05-2 | 3,7-Dimethyloct-6-enyl acetate | |
| 141-25-3 | 3,7-Dimethyloct-7-en-1-ol | |
| 40188-41-8 | 3,7-Dimethyloctanenitrile | |
| 1315250-67-9 | 3-[trans-4-(2-methylpropyl)cyclohexyl]propanal | |
| 7158-25-0 | 3a,4,4a,5,8,8a,9,9a-Octahydro-4,9:5,8-dimethano-1H-benz[f]indene | |
| 94248-21-2 | 3a,4,5,6,7,7a-Hexahydro-2,6(or 3,6)-dimethyl-4,7-methano-1H-inden-5-ol | |
| 67634-20-2 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-yl isobutyrate | |
| 68039-45-2 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-yl pivalate | |
| 68039-44-1 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-yl pivalate | |
| 68912-13-0 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-indenyl propionate (mixture of isomers) | |
| 53018-24-9 | 3a,4,5,6,7,7a-Hexahydro-5-methoxy-4,7-methano-1H-indene | |
| 27135-90-6 | 3a,4,5,6,7,7a-Hexahydromethoxy-4,7-methano-1H-indene (isomer unspecified) | |
| 58096-47-2 | 3a,7-Methano-3aH-cyclopentacycloocten-3-ol, decahydro-1,1,7-trimethyl-, formate | |
| 10599-70-9 | 3-Acetyl-2,5-dimethylfuran | |
| 136954-25-1 | 3-Acetylmercaptohexyl acetate | |
| 350-03-8 | 3-Acetylpyridine | |
| 60466-73-1 | 3-Benzyltetrahydropyran | |
| 762300-77-6 | 3-Buten-2-one, 4-(2,2,3,6-tetramethylcyclohexyl)- | |
| 54992-90-4 | 3-Buten-2-one, 4-(2,2,3,6-tetramethylcyclohexyl)- | |
| 79-68-5 | 3-Buten-2-one, 4-(2,2,3-trimethyl-6-methylenecyclohexyl)- | |
| 54992-91-5 | 3-Buten-2-one, 4-[2,5,6,6-tetramethyl-1(or 2)-cyclohexen-1-yl]- | |
| 551-08-6 | 3-Butylidenephthalide | |
| 21690-43-7 | 3-Cyclohexene-1-carbonitrile, 4-(4-methyl-3-pentenyl)- | |
| 1049017-63-1 | 3-Cyclohexene-1-carboxaldehyde, 1-ethenyl- | |
| 815580-59-7 | 3-Cyclohexene-1-carboxylic acid, 2,6,6-trimethyl-, methyl ester | |
| 426218-78-2 | 3-Cyclohexene-1-methanol, 3(or 4)-methyl-1-(2,2,3-trimethyl-3-cyclopenten-1-yl)-, acid-isomerized | |
| 681433-04-5 | 3-Cyclooctene-1-methanol, alpha-ethyl- | |
| 166432-53-7 | 3-Cyclopentene-1-butanal, alpha,2,2,3-tetramethyl-.gamma.-methylene | |
| 67633-95-8 | 3-Decanone, 1-hydroxy | |
| 10519-33-2 | 3-Decen-2-one | |
| 73263-36-2 | 3-Dodecyldihydrofuran-2(3H)-one | |
| 13925-07-0 | 3-Ethyl-2,6-dimethylpyrazine | |
| 21835-01-8 | 3-Ethyl-2-hydroxy-2-cyclopenten-1-one | |
| 54491-17-7 | 3-Ethylhexahydro-2(3H)-benzofuranone | |
| 620-17-7 | 3-Ethylphenol | |
| 536-78-7 | 3-Ethylpyridine | |
| 106-35-4 | 3-Heptanone | |
| 623-37-0 | 3-Hexanol | |
| 589-38-8 | 3-Hexanone | |
| 86460-54-0 | 3-Hexanone, 2-methyl-, oxime | |
| 851768-51-9 | 3-Hexanone, 5-mercapto-5-methyl- | |
| 544-12-7 | 3-Hexen-1-ol (isomer unspecified) | |
| 4440-65-7 | 3-Hexenal | |
| 888744-18-1 | 3-Hexene, 1-(2-buten-1-yloxy)-, (3Z)- | |
| 215305-10-5 | 3-Hexene, 1,1',''-[ethylidynestris(oxy)]tris-, (3Z, 3'Z,3"Z)- | |
| 292605-05-1 | 3-Hexene, 1-[(2-methyl-2-propenyl)oxy]- (3Z)- | |
| 4219-24-3 | 3-Hexenoic acid | |
| 1253414-42-4 | 3-Hexenoic acid, cyclopropylmethyl ester | |
| 10094-41-4 | 3-Hexenyl 2-methylbutanoate | |
| 68133-76-6 | 3-Hexenyl 2-oxopropionate | |
| 42436-07-7 | 3-Hexenyl phenylacetate | |
| 18436-37-8 | 3-Hexyldihydrofuran-2(3H)-one | |
| 4314-14-1 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl-4-(phenylazo)- | |
| 4702-90-3 | 3H-Pyrazol-3-one, 4-[(1,5-dihydro-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-ylidene)methyl]-2,4-dihydro-5-methyl-2-phenyl- | |
| 87061-04-9 | 3-l-Menthoxypropane-1,2-diol | |
| 67633-97-0 | 3-Mercapto-2-pentanone | |
| 34300-94-2 | 3-Mercapto-3-methyl-1-butanol | |
| 51755-83-0 | 3-Mercaptohexanol | |
| 136954-20-6 | 3-Mercaptohexyl acetate | |
| 56539-66-3 | 3-Methoxy-3-methyl-1-butanol | |
| 3209-13-0 | 3-Methoxy-5-cresol | |
| 541-91-3 | 3-Methyl-1-cyclopentadecanone | |
| 589-35-5 | 3-Methyl-1-pentanol | |
| 1128-08-1 | 3-Methyl-2-(n-pentanyl)-2-cyclopenten-1-one | |
| 68922-13-4 | 3-Methyl-2-(pentyloxy)cyclopent-2-en-1-one | |
| 113486-29-6 | 3-Methyl-2,4-nonedione | |
| 556-82-1 | 3-Methyl-2-buten-1-ol | |
| 107-86-8 | 3-Methyl-2-butenal | |
| 1191-16-8 | 3-Methyl-2-butenyl acetate | |
| 5205-11-8 | 3-Methyl-2-butenyl benzoate | |
| 68555-58-8 | 3-Methyl-2-butenyl salicylate | |
| 1193-18-6 | 3-Methyl-2-cyclohexen-1-one | |
| 50652-80-7 | 3-Methyl-2-hexenoic acid methyl ester | |
| 13074-63-0 | 3-Methyl-2-pentylcyclopentan-1-one | |
| 5205-07-2 | 3-Methyl-3-butenyl acetate | |
| 67801-29-0 | 3-Methyl-4-(2,4,6-trimethyl-3-cyclohexen-1-yl)-3-buten-2-one | |
| 67801-20-1 | 3-Methyl-5-(2,2,3-trimethyl-3-cyclopenten-1-yl)pent-4-en-2-ol | |
| 63314-79-4 | 3-Methyl-5-cyclopentadecen-1-one | |
| 93893-89-1 | 3-Methyl-5-phenylpent-2-enenitrile | |
| 54089-83-7 | 3-Methyl-5-phenylpentanenitrile | |
| 55066-48-3 | 3-Methyl-5-phenylpentanol | |
| 3720-16-9 | 3-Methyl-5-propyl-2-cyclohexen-1-one | |
| 763-32-6 | 3-Methylbut-3-en-1-ol | |
| 3842-03-3 | 3-Methylbutanal diethyl acetal | |
| 25415-77-4 | 3-Methylbutyl 2-butenoate | |
| 27625-35-0 | 3-Methylbutyl 2-methylbutanoate | |
| 2050-01-3 | 3-Methylbutyl 2-methylpropanoate | |
| 2050-09-1 | 3-Methylbutyl valerate | |
| 590-86-3 | 3-Methylbutyraldehyde | |
| 82356-51-2 | 3-Methylcyclopentadecenone | |
| 765-70-8 | 3-Methylcyclopentane-1,2-dione | |
| 85351-07-1 | 3-Methyldodecanonitrile | |
| 105-43-1 | 3-Methylpentanoic acid | |
| 53082-58-9 | 3-Methylpentyl 2-methylisocrotonate | |
| 624-51-1 | 3-Nonanol | |
| 589-98-0 | 3-Octanol | |
| 106-68-3 | 3-Octanone | |
| 1669-44-9 | 3-Octen-2-one | |
| 4864-61-3 | 3-Octyl acetate | |
| 68611-23-4 | 3-Pentanone, 1-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, reaction products with 2-propyn-1-ol | |
| 122-97-4 | 3-Phenyl-1-propanol | |
| 7306-12-9 | 3-Phenyl-3-buten-1-yl acetate | |
| 16251-77-7 | 3-Phenylbutanal | |
| 104-53-0 | 3-Phenylpropionaldehyde | |
| 501-52-0 | 3-Phenylpropionic acid | |
| 105025-99-8 | 3-Phenylpropyl 2-(4-hydroxy-3-methoxyphenyl)acetate | |
| 122-72-5 | 3-Phenylpropyl acetate | |
| 122-68-9 | 3-Phenylpropyl cinnamate | |
| 103-58-2 | 3-Phenylpropyl isobutyrate | |
| 17369-59-4 | 3-Propylidenephthalide | |
| 621-27-2 | 3-Propylphenol | |
| 31846-06-7 | 3-tert-Butylcyclohexyl acetate | |
| 585-34-2 | 3-tert-Butylphenol | |
| 23267-57-4 | 4-(1,2-Epoxy-2,6,6-trimethylcyclohexyl)-3-buten-2-one | |
| 66072-32-0 | 4-(1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl)-cyclohexanol | |
| 14576-08-0 | 4-(1-Methoxy-1-methylethyl)-1-methylcyclohexene | |
| 67801-38-1 | 4-(2,4,6-Trimethyl-3-cyclohexen-1-yl)-3-buten-2-one | |
| 65405-84-7 | 4-(2,6,6-Trimethyl-2-cyclohexen)-2-methylbutanal | |
| 60241-53-4 | 4-(2,6,6-Trimethylcyclohexyl)-3-methylbutan-2-ol | |
| 13215-88-8 | 4-(2-Butenylidene)-3,5,5-trimethylcyclohex-2-en-1-one | |
| 55418-52-5 | 4-(3,4-Methylenedioxyphenyl)-2-butanone | |
| 2057-49-0 | 4-(3-Phenylpropyl)pyridine | |
| 38462-23-6 | 4-(4,8-Dimethylnona-3,7-dienyl)pyridine | |
| 67828-19-7 | 4-(4-Methoxyphenyl)-3-methylbutan-2-one | |
| 61315-75-1 | 4-(4-Methyl-3-penten-1-yl)-2(5H)-furanone | |
| 855737-35-8 | 4-(dodecylthio)-4-methylpentan-2-one | |
| 67634-03-1 | 4-(Isopropyl)-.beta.-methylcyclohexanethanol | |
| 63449-95-6 | 4-(Isopropyl)cyclohexyl propionate | |
| 23550-40-5 | 4-(Methylthio)-4-methyl-2-pentanone | |
| 5471-51-2 | 4-(p-Hydroxyphenyl)-2-butanone | |
| 104-20-1 | 4-(p-Methoxyphenyl)-2-butanone | |
| 934534-30-2 | 4,7-Decadienal | |
| 129520-41-8 | 4,7-Methano-3aH-indene-3a-carboxylic acid, octahydro-, ethyl ester | |
| 1958027-35-4 | 4,8-Decadienal, (4Z,8Z)- | |
| 1958027-16-1 | 4,8-Undecadienal, (4Z,8E)- | |
| 1882830-62-7 | 4,8-Undecadienal, (4Z,8Z)- | |
| 1882830-61-6 | 4,8-Undecadienenitrile, (4Z,8Z)- | |
| 1801275-28-4 | 4,9-Dodecadienal, (4Z,9Z)- | |
| 1882830-66-1 | 4,9-Dodecadienenitrile, (4Z,9Z)- | |
| 18096-62-3 | 4,4a,5,9b-Tetrahydroindeno[1,2-d]-1,3-dioxine | |
| 51519-65-4 | 4,4a,6,7,8,8a-Hexahydro-1,4-methanonaphthalen-5(1H)-one | |
| 38303-23-0 | 4,5,6,7,8,9,10,11,12,13-Decahydrocyclododecaoxazole | |
| 494-90-6 | 4,5,6,7-Tetrahydro-3,6-dimethylbenzofuran | |
| 1003-04-9 | 4,5-Dihydro-3(2H)thiophenone | |
| 28664-35-9 | 4,5-Dimethyl-3-hydroxy-2,5-dihydrofuran-2-one | |
| 675-09-2 | 4,6-Dimethyl-2H-pyran-2-one | |
| 74499-58-4 | 4,7,7-Trimethyl-2-(3-methyl-2-butenyl)bicyclo[4.1.0]heptan-3-one | |
| 68398-18-5 | 4,7,7-Trimethyl-6-thiabicyclo[3.2.1]octane | |
| 2550-11-0 | 4,7-Dimethyloct-6-en-3-one | |
| 79771-15-6 | 4,7-Methano-1H-inden-5-ol, 3a,4,5,6,7,7a-hexahydrodimethyl- | |
| 1340502-69-3 | 4,7-Methano-1H-inden-5-ol, octahydro-3,4,5-trimethyl- | |
| 1339119-15-1 | 4,7-Methano-1H-indene-5-acetaldehyde, octahydro- | |
| 189440-77-5 | 4,7-Octadienoic acid, methyl ester, (4E)- | |
| 1000399-21-2 | 4,8,11-Dodecatrienal | |
| 67845-50-5 | 4,8-Dimethyl-3-7-nonadien-2-ol | |
| 71077-31-1 | 4,8-Dimethyl-4,9-decadienal | |
| 40596-76-7 | 4,8-Dimethyl-7-nonen-2-ol | |
| 4166-20-5 | 4-Acetoxy-2,5-dimethyl-3(2H)furanone | |
| 72207-94-4 | 4-Acetoxy-3-ethoxybenzaldehyde | |
| 18871-14-2 | 4-Acetoxy-3-pentyltetrahydropyran | |
| 13171-00-1 | 4-Acetyl-6-t-butyl-1,1-dimethylindan | |
| 57371-42-3 | 4-Allyl-2-methoxyphenyl benzyl ether | |
| 501-92-8 | 4-Allylphenol | |
| 562-74-3 | 4-Carvomenthenol | |
| 83926-73-2 | 4-Cyclohexyl-2-methyl-2-butanol | |
| 35720-57-1 | 4-Cyclopentadecen-1-one | |
| 14595-54-1 | 4-Cyclopentadecen-1-one, (Z)- | |
| 926-50-1 | 4-Decenal, 9-hydroxy-5,9-dimethyl- | |
| 4748-78-1 | 4-Ethylbenzaldehyde | |
| 2785-89-9 | 4-Ethylguaiacol | |
| 16493-80-4 | 4-Ethyloctanoic acid | |
| 1373821-23-8 | 4H-1,3-Benzodioxin, hexahydro-4-methyl-2-(phenylmethyl)- | |
| 1357064-95-9 | 4H-4a,9-Methanoazuleno[5,6-d]-1,3-dioxole, octahydro-2,5,8,8,9a-pentamethyl-2-propyl-, (3aS,4aR,5R,7aS,9R,9aR)- | |
| 211299-54-6 | 4H-4a,9-Methanoazuleno[5,6-d]-1,3-dioxole, octahydro-2,2,5,8,8,9a-hexamethyl-, (4aR,5R,7aS,9R)- | |
| 10250-45-0 | 4-Heptanol, 2,6-dimethyl-,acetate | |
| 123-19-3 | 4-Heptanone | |
| 6728-31-0 | 4-Heptenal | |
| 18492-65-4 | 4-Heptenal diethyl acetal | |
| 928-91-6 | 4-Hexen-1-ol, (4Z)- | |
| 58461-27-1 | 4-Hexen-1-ol, 5-methyl-2-(1-methylethenyl)- | |
| 97384-47-9 | 4-Hexenenitrile, 2-ethenyl-2,5-dimethyl- | |
| 823178-41-2 | 4H-Indeno[4,5-D]-1,3-dioxole, 3a,5,6,7,8,8b-hexahydro-2,2,6,6,7,8,8-heptamethyl- | |
| 3658-77-3 | 4-Hydroxy-2,5-dimethyl-3(2H)-furanone | |
| 68141-16-2 | 4-Hydroxy-3,6,10-trimethylundec-9-en-2-one | |
| 498-02-2 | 4'-Hydroxy-3'-methoxyacetophenone | |
| 39212-23-2 | 4-Hydroxy-3-methyloctanoic acid lactone | |
| 591-12-8 | 4-Hydroxy-3-pentenoic acid lactone | |
| 99-93-4 | 4-Hydroxyacetophenone | |
| 123-08-0 | 4-Hydroxybenzaldehyde | |
| 96-48-0 | 4-Hydroxybutanoic acid lactone | |
| 14374-92-6 | 4-Isopropyl-1-methyl-2-propenylbenzene | |
| 29350-67-2 | 4-Isopropyl-1-methylcyclohexene | |
| 6379-73-3 | 4-Isopropyl-2-methoxy-1-methylbenzene | |
| 4621-04-9 | 4-Isopropylcyclohexanol | |
| 99-89-8 | 4-Isopropylphenol | |
| 19872-52-7 | 4-Mercapto-4-methyl-2-pentanone | |
| 94087-83-9 | 4-Methoxy-2-methyl-2-butanethiol | |
| 5462-06-6 | 4-Methoxy-alpha-methylbenzenepropanal | |
| 2403-58-9 | 4-Methoxybenzaldehyde diethyl acetal | |
| 100-09-4 | 4-Methoxybenzoic acid | |
| 68228-06-8 | 4-Methyl-1-oxaspiro[5.5]undecene | |
| 67634-23-5 | 4-Methyl-2-(1-phenylethyl)-1,3-dioxolane | |
| 108-11-2 | 4-Methyl-2-pentanol | |
| 108-10-1 | 4-Methyl-2-pentanone | |
| 26643-91-4 | 4-Methyl-2-phenyl-2-pentenal | |
| 81782-77-6 | 4-Methyl-3-decen-5-ol | |
| 141-79-7 | 4-Methyl-3-penten-2-one | |
| 7403-42-1 | 4-Methyl-4-phenyl-2-pentanone | |
| 137-00-8 | 4-Methyl-5-thiazoleethanol | |
| 656-53-1 | 4-Methyl-5-thiazoleethanol acetate | |
| 1759-28-0 | 4-Methyl-5-vinylthiazole | |
| 122760-85-4 | 4-Methyl-8-methylenetricyclo[3.3.1.(3,7)]decan-2-yl acetate | |
| 122-00-9 | 4'-Methylacetophenone | |
| 2216-45-7 | 4-Methylbenzyl acetate | |
| 45019-28-1 | 4-Methylnonanoic acid | |
| 54947-74-9 | 4-Methyloctanoic acid | |
| 646-07-1 | 4-Methylpentanoic acid | |
| 78989-37-4 | 4-Octenoic acid, ethyl ester, (4E)- | |
| 224031-71-4 | 4-Penten-1-one, 1-spiro[4.5]dec-6-en-7-yl- | |
| 224031-70-3 | 4-Penten-1-one, 1-spiro[4.5]dec-7-en-7-yl- | |
| 1226911-69-8 | 4-Pentenal, 4-methyl-5-(4-methylphenyl)-, (4E)- | |
| 20962-70-3 | 4-Pentenoic acid, 2-acetyl-4-methyl-, ethyl ester | |
| 17488-65-2 | 4-Phenyl-3-buten-2-ol | |
| 16587-71-6 | 4-t-Amylcyclohexanone | |
| 2040-10-0 | 4'-tert-Butyl-2',6'-dimethylacetophenone | |
| 98-52-2 | 4-tert-Butylcyclohexanol | |
| 32210-23-4 | 4-tert-Butylcyclohexyl acetate | |
| 98-51-1 | 4-tert-Butyltoluene | |
| 546-79-2 | 4-Thujanol | |
| 30168-23-1 | 4-Tricyclodecylidene butanal | |
| 72881-27-7 | 5- and 6-Decenoic acid | |
| 54088-65-2 | 5-Heptenenitrile, 2,6-dimethyl- | |
| 65113-99-7 | 5-(2,2,3-Trimethyl-3-cyclopentenyl)-3-methylpentan-2-ol | |
| 70851-61-5 | 5-(cis-3-Hexenyl)dihydro-5-methyl-2(3H)furanone | |
| 68259-31-4 | 5(Or 6)-Methyl-7(or 8)-(1-methylethyl)bicyclo[2.2.2]oct-5-ene-2-carbaldehyde | |
| 34413-35-9 | 5,6,7,8-Tetrahydroquinoxaline | |
| 358331-95-0 | 5,6,7-Trimethylocta-2,5-dien-4-one | |
| 36267-71-7 | 5,7-Dihydro-2-methylthieno(3,4-d)pyrimidine | |
| 69486-14-2 | 5,8-Methano-2H-1-benzopyran-2-one, 6- ethylideneoctahydro- | |
| 762-26-5 | 5,9-Dimethyl-4,8-decadienal | |
| 91482-37-0 | 5,9-Undecadien-2-ol,6,10-dimethyl-,acetate | |
| 54082-68-7 | 5,9-Undecadienal, 2,6,10-trimethyl- | |
| 24048-13-3 | 5,9-Undecadienal, 2,6,10-trimethyl- (dihydroapofarnesal) | |
| 15323-35-0 | 5-Acetyl-1,1,2,3,3,6-hexamethylindan | |
| 68140-48-7 | 5-Acetyl-3-isopropyl-1,1,2,6-tetramethylindane | |
| 7182-21-0 | 5-Benzofuranol, 3-methyl- | |
| 37609-25-9 | 5-Cyclohexadecen-1-one | |
| 259854-71-2 | 5-Cyclotetradecen-1-one, 3-methyl-, (5Z)- | |
| 259854-70-1 | 5-Cyclotetradecen-1-one, 3-methyl-,(5E)- | |
| 17369-60-7 | 5-Ethyl-2,3,4,5-tetramethylcyclohexen-1-one | |
| 698-10-2 | 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone | |
| 73347-77-0 | 5-Ethylidenebicyclo[2.2.1]hept-2-yl propionate | |
| 23747-48-0 | 5H-5-Methyl-6,7-dihydrocyclopenta(b)pyrazine | |
| 1392325-86-8 | 5H-Cyclopenta[h]quinazoline, 6,6a,7,8,9,9a-hexahydro-7,7,8,9,9-pentamethyl- | |
| 1315251-11-6 | 5H-Cyclopenta[H]quinazoline, 6,7,8,9-tetrahydro-7,7,8,9,9-pentamethyl- | |
| 109-49-9 | 5-Hexen-2-one | |
| 27593-23-3 | 5-Hydroxy-2,4-decadienoic acid delta-lactone | |
| 10413-18-0 | 5-Hydroxy-4-methylhexanoic acid delta-lactone | |
| 25524-95-2 | 5-Hydroxy-7-decenoic acid delta-lactone | |
| 13679-86-2 | 5-Isopropenyl-2-methyl-2-vinyltetrahydrofuran | |
| 139539-66-5 | 5-Methyl-1-(2,2,3-trimethyl-3-cyclopenten-1-yl)-6-oxabicyclo[3.2.1]octane | |
| 17162-29-7 | 5-Methyl-2-(1-methylethyl)cyclohexyl lactate | |
| 81925-81-7 | 5-Methyl-2-hepten-4-one | |
| 21834-92-4 | 5-Methyl-2-phenyl-2-hexenal | |
| 13679-70-4 | 5-Methyl-2-thiophenecarboxaldehyde | |
| 38285-49-3 | 5-Methyl-3-butyltetrahydropyran-4-yl acetate | |
| 541-85-5 | 5-Methyl-3-heptanone | |
| 22457-23-4 | 5-Methyl-3-heptanone oxime | |
| 4927-36-0 | 5-Methyl-5-phenyl-3-hexanone | |
| 80480-24-6 | 5-Methyl-5-propyl-2-(1-methylbutyl)-1,3-dioxan | |
| 620-02-0 | 5-Methylfurfural | |
| 13708-12-8 | 5-Methylquinoxaline | |
| 35151-11-2 | 5-Phenylhex-4-en-2-one | |
| 2277-20-5 | 6-Nonenal, (6E)- | |
| 80639-54-9 | 6-Nonenenitrile, (Z)- (9CI) | |
| 68141-26-4 | 6-(2-Methylpropyl)quinoline | |
| 68959-28-4 | 6-(3Z)-3-hexen-1-yltetrahydro-2H-Pyran-2-one, | |
| 502-69-2 | 6,10,14-Trimethyl-2-pentadecanone | |
| 3796-70-1 | 6,10-Dimethyl-5,9-undecadien-2-one | |
| 689-67-8 | 6,10-Dimethylundeca-5,9-dien-2-one | |
| 62406-73-9 | 6,10-Dioxaspiro[4.5]decane, 8,8-dimethyl-7-(1-methylethyl)- | |
| 194934-66-2 | 6,10-Dodecadienal, 3,7,11-trimethyl-, (3S,6E)- | |
| 67674-46-8 | 6,6-Dimethoxy-2,5,5-trimethylhex-2-ene | |
| 33885-51-7 | 6,6-Dimethylbicyclo[3.1.1]hept-2-ene-2-propionaldehyde | |
| 33704-61-9 | 6,7-Dihydro-1,1,2,3,3-pentamethyl-4(5H)-indanone | |
| 70214-77-6 | 6,8-Dimethylnonan-2-ol | |
| 21145-77-7 | 6-Acetyl-1,1,2,4,4,7-hexamethyltetraline | |
| 24237-00-1 | 6-Butyl-2,4-dimethyldihydropyrane | |
| 26330-65-4 | 6-Ethyl-3-methyloct-6-en-1-ol | |
| 93939-86-7 | 6-Ethylideneoctahydro-5,8-methano-2H-benzo-1-pyran | |
| 34131-98-1 | 6-Isopropyl-2(1H)-octahydronaphthalenone | |
| 135-79-5 | 6-Isopropylquinoline | |
| 62439-41-2 | 6-Methoxy-2,6-dimethylheptan-1-al | |
| 515-69-5 | 6-Methyl-2-(4-methyl-3-cyclohexen-1-yl)-5-hepten-2-ol | |
| 1604-28-0 | 6-Methyl-3,5-heptadien-2-one | |
| 110-93-0 | 6-Methyl-5-hepten-2-one | |
| 165261-13-2 | 6-Methyl-7oxa-1-thia-4-azaspiro(4,4)nonane | |
| 91-62-3 | 6-Methylquinoline | |
| 5949-05-3 | 6-Octenal, 3,7-dimethyl-, (3S)- | |
| 65442-31-1 | 6-sec-Butylquinoline | |
| 21661-97-2 | 7-Decenal, (7Z)- | |
| 899810-84-5 | 7-Nonenal, 6,8-dimethyl- | |
| 83863-64-3 | 7,9-Dimethylspiro[5.5]undecan-3-one | |
| 50542-90-0 | 7-[(3,7-Dimethyl-2,6-octadienyl)oxy]-4-methyl-2H-1-benzopyran-2-one | |
| 2550-59-6 | 7-Cyclohexadecen-1-one | |
| 489-84-9 | 7-Isopropyl-1,4-dimethylazulene | |
| 53767-86-5 | 7-Methoxy-3,7-dimethyloct-1-ene | |
| 28940-11-6 | 7-Methyl-2H-benzo-1,5-dioxepin-3(4H)-one | |
| 53219-21-9 | 7-Octen-2-ol, 2-methyl-6-methylene-, dihydro deriv. | |
| 207228-93-1 | 7-Propyl-2H-1,5-benzodioxepin-3(4H)-one | |
| 67634-06-4 | 8-(sec-Butyl)quinoline | |
| 57566-26-4 | 8aH-2, 4a-Methanonaphthalen-8a-ol, octahydro-1,1,5,5-tetramethyl-(2S,4aR,8aS)- | |
| 88644-30-8 | 8aH-2,4a-Methanonaphthalen-8a-ol, octahydro-1,1,5,5-tetramethyl- | |
| 84681-92-5 | 8-Ethyl-1,5-dimethylbicyclo[3.2.1]octan-8-ol | |
| 338735-71-0 | 8H-Indeno(4,5-B)furan,2,3,3a,4,5,5a,6,7,8a,9-decahydro-2,6,6,7,8,8-hexamethyl Mixture of isomers | |
| 67845-30-1 | 8-Isopropyl-6-methylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde | |
| 39770-04-2 | 8-Nonenal | |
| 58296-81-4 | 8-Undecenal | |
| 89319-68-6 | 9-Hexadecyn-8-one | |
| 17354-14-2 | 9,10-Anthracenedione, 1,4-bis(butylamino)- | |
| 116-75-6 | 9,10-Anthracenedione, 1,4-bis[(2,4,6-trimethylphenyl)amino]- | |
| 28198-05-2 | 9,10-Anthracenedione, 1,4-bis[(4-butylphenyl)amino]-5,8-dihydroxy- | |
| 128-80-3 | 9,10-Anthracenedione, 1,4-bis[(4-methylphenyl)amino]- | |
| 6408-72-6 | 9,10-Anthracenedione, 1,4-diamino-2,3-diphenoxy- | |
| 71701-33-2 | 9,10-Anthracenedione, 1-amino-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-4-[(2,4,6-trimethylphenyl)amino]- | |
| 81-48-1 | 9,10-Anthracenedione, 1-hydroxy-4-[(4-methylphenyl)amino]- | |
| 542-46-1 | 9-Cycloheptadecen-1-one | |
| 13019-22-2 | 9-Decen-1-ol | |
| 35194-30-0 | 9-Decen-2-one | |
| 39770-05-3 | 9-Decenal | |
| 14436-32-9 | 9-Decenoic acid | |
| 50816-18-7 | 9-Decenyl acetate | |
| 25496-72-4 | 9-Octadecenoic acid (Z)-, monoester with 1,2,3-propanetriol | |
| 141-24-2 | 9-Octadecenoic acid, 12-hydroxy-, methyl ester | |
| 13040-19-2 | 9-Octadecenoic acid, 12-hydroxy-, zinc salt (2:1), [R-(Z)]- | |
| 143-14-6 | 9-Undecenal | |
| 131379-26-5 | 9-Undecenenitrile, (E)- | |
| 362467-67-2 | a2H-1,5-Benzodioxepin-3(4H)-one,7-7-(3-methylbutyl)- | |
| 8021-27-0 | Abies alba absolute | E2.1 |
| 8021-27-0 | Abies alba needle oil | E2.12 |
| 8021-28-1 | Abies sachalinensis oil | E2.12 |
| 54200-50-9 | Abietyl acetate | |
| 9000-01-5 | Acacia gum | K2.15 |
| 105-57-7 | Acetal | |
| 75-07-0 | Acetaldehyde | |
| 3390-12-3 | Acetaldehyde cyclic propylene glycol acetal | |
| 5405-58-3 | Acetaldehyde dihexyl acetal | |
| 28069-74-1 | Acetaldehyde ethyl cis-3-hexenyl acetal | |
| 54484-73-0 | Acetaldehyde ethyl hexyl acetal | |
| 40910-49-4 | Acetaldehyde ethyl linalyl acetal | |
| 2556-10-7 | Acetaldehyde ethyl phenylethyl acetal | |
| 122-71-4 | Acetaldehyde, diphenethyl acetal | |
| 103-84-4 | Acetanilide | |
| 100-06-1 | Acetanisole | |
| 64-19-7 | Acetic acid | |
| 236391-76-7 | Acetic acid, (1-oxopropoxy)-, 1-(3,3-dimethylcyclohexyl)ethyl ester | |
| 2020341-69-7 | Acetic acid, 1,1'-anhydride, reaction products with 2-methylbutene dimer | |
| 71549-77-4 | Acetic acid, anhydride, reaction products with (1S,3aR,4S,8aS)-decahydro-4,8,8-trimethyl-9-methylene-1,4-methanoazulene | |
| 144020-22-4 | Acetic acid, anhydride, reaction products with 1,5,10-trimethyl-1,5,9-cyclododecatriene | |
| 862107-86-6 | Acetic acid, anhydride, reaction products with 2-methylbutene dimer, hydrogenated | |
| 108419-35-8 | Acetic acid, C11-14-branched alkyl esters, C13-rich | |
| 108419-32-5 | Acetic acid, C7-9-branched alkyl esters, C8-rich | |
| 108419-33-6 | Acetic acid, C8-10-branched alkyl esters, C9-rich | |
| 124358-45-8 | Acetic acid, cyano-, reaction products with 10-undecenal | |
| 69103-01-1 | Acetic acid, esters with turpentine-oil myrcene fraction terpene alcs. | |
| 513-86-0 | Acetoin | |
| 67-64-1 | Acetone | |
| 1392276-61-7 | Acetonitrile, 2-(2,4,4-trimethylcyclopentylidene)- | |
| 98-86-2 | Acetophenone | |
| 54830-99-8 | Acetoxydihydrodicyclopentadiene (Mixture of Isomers) | |
| 32388-55-9 | Acetyl cedrene | |
| 600-14-6 | Acetyl propionyl | |
| 77-89-4 | Acetyl triethyl citrate | |
| 3608-11-5 | Acetylcarene | |
| 22047-25-2 | Acetylpyrazine | |
| 85480-47-3 | Acorus calamus, ext., hydrogenated | |
| 94350-09-1 | Agarwood extract | D2.13 |
| 94350-09-1 | Agarwood oil | D2.12 |
| 1333524-00-7 | Agarwood oil, Indonesia | D2.12 |
| 958663-49-5 | Agarwood oil, Vietnamese | D2.12 |
| 958663-49-5 | Agarwood oil, Vietnamese, rectified | D2.24 |
| 8001-99-8 | Ajowan oil | E2.12 |
| 8001-99-8 | Ajowan seed oil | H2.12 |
| 943609-24-3 | Alcoholic beverages, rum, CO2 extract, nonalc. | E2.27 |
| 943609-24-3 | Alcoholic beverages, rum, extract, nonalc. | E2.13 |
| 69227-22-1 | Alcohols, C10-16, ethoxylated propoxylated | |
| 78330-21-9 | Alcohols, C11-14-isoalcohols, C13-rich, ethoxylated | |
| 68526-86-3 | Alcohols, C11-14-iso-, C13-rich | |
| 68131-40-8 | Alcohols, C11-15-secondary, ethoxylated | |
| 75782-86-4 | Alcohols, C12-13 | |
| 68439-50-9 | Alcohols, C12-14, ethoxylated | |
| 68131-39-5 | Alcohols, C12-15, ethoxylated | |
| 66455-14-9 | Alcohols, C12-13, ethoxylated | |
| 84133-50-6 | Alcohols, C12-14-secondary, ethoxylated | |
| 68855-56-1 | Alcohols, C12-16 | |
| 68002-94-8 | Alcohols, C16-18 and C18-unsaturated | |
| 68987-81-5 | Alcohols, C6-10, ethoxylated propoxylated | |
| 68439-45-2 | Alcohols, C6-12, ethoxylated (5 > EO < 20) | |
| 68526-84-1 | Alcohols, C8-10-iso-, C9-rich | |
| 68439-46-3 | Alcohols, C9-11, ethoxylated | |
| 93821-11-5 | Alcohols, C9-11-branched and linear, C10-rich | |
| 68526-85-2 | Alcohols, C9-11-iso-, C10-rich | |
| 73049-35-1 | Alcohols, sesquiterpenoidal, citronella-oil | E2.33 |
| 130169-57-2 | Aldehydes, C13-15-branched and linear | |
| 68551-17-7 | Alkanes, C10-13-iso- | |
| 68551-19-9 | Alkanes, C12-14-iso- | |
| 68551-20-2 | Alkanes, C13-16-iso- | |
| 93821-14-8 | Alkenes, C12-14, hydroformylation products, distn. lights | |
| 8006-77-7 | Allspice CO2 extract | G2.27 |
| 8006-77-7 | Allspice oil | G2.12 |
| 8006-77-7 | Allspice oil, low methyleugenol | G2.33 |
| 67634-01-9 | Allyl (2-methylbutoxy)acetate | |
| 67634-00-8 | Allyl (3-methylbutoxy)acetate | |
| 68901-15-5 | Allyl (cyclohexyloxy)acetate | |
| 79-78-7 | Allyl alpha-ionone | |
| 1866-31-5 | Allyl cinnamate | |
| 4728-82-9 | Allyl cyclohexaneacetate | |
| 2705-87-5 | Allyl cyclohexanepropionate | |
| 2179-57-9 | Allyl disulfide | |
| 142-19-8 | Allyl heptanoate | |
| 123-68-2 | Allyl hexanoate | |
| 4230-97-1 | Allyl octanoate | |
| 7493-74-5 | Allyl phenoxyacetate | |
| 2408-20-0 | Allyl propionate | |
| 592-88-1 | Allyl sulfide | |
| 68132-80-9 | Allyl trimethylhexanoate | |
| 8013-76-1 | Almond oil, bitter | H2.12 |
| 8007-69-0 | Almond oil, sweet | H2.50 |
| 8001-97-6 | Aloe extract | E2.13 |
| 65114-03-6 | alpha,2,2,3-tetramethylcyclopent-3-ene-1-butyraldehyde | |
| 67634-15-5 | alpha,alpha-Dimethyl-p-ethylphenylpropanal | |
| 100-86-7 | alpha,alpha-Dimethylphenethyl alcohol | |
| 10094-34-5 | alpha,alpha-Dimethylphenethyl butyrate | |
| 67785-77-7 | alpha,alpha-Dimethylphenylethyl propionate | |
| 43052-87-5 | alpha-1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one | |
| 60763-41-9 | alpha-Amyl cinnamic aldehyde diethyl acetal | |
| 122-40-7 | alpha-Amylcinnamaldehyde | |
| 91-87-2 | alpha-Amylcinnamaldehyde dimethyl acetal | |
| 68527-78-6 | alpha-Amylcinnamaldehyde-methyl anthranilate (Schiff base) | |
| 101-85-9 | alpha-Amylcinnamyl alcohol | |
| 17627-44-0 | alpha-Bisabolene | |
| 7492-44-6 | alpha-Butylcinnamaldehyde | |
| 469-61-4 | alpha-Cedrene | |
| 10461-98-0 | alpha-Cyclohexylidene benzeneacetonitrile | |
| 57-50-1 | alpha-D-Glucopyranoside, beta-D-fructofuranosyl | |
| 502-61-4 | alpha-Farnesene | |
| 3691-12-1 | alpha-Guaiene | |
| 101-86-0 | alpha-Hexylcinnamaldehyde | |
| 25322-69-4 | Alpha-hydro-omega-hydroxypoly(oxy(methyl-1,2-ethanediyl)) | |
| 25312-34-9 | alpha-Ionol | |
| 127-41-3 | alpha-Ionone | |
| 79-69-6 | alpha-Irone | |
| 7779-78-4 | alpha-Isobutylphenethyl alcohol | |
| 127-51-5 | alpha-iso-Methylionone | |
| 1205-17-0 | alpha-Methyl-1,3-benzodioxole-5-propionaldehyde | |
| 93-92-5 | alpha-Methylbenzyl acetate | |
| 98-85-1 | alpha-Methylbenzyl alcohol | |
| 3460-44-4 | alpha-Methylbenzyl butyrate | |
| 7775-39-5 | alpha-Methylbenzyl isobutyrate | |
| 120-45-6 | alpha-Methylbenzyl propionate | |
| 101-39-3 | alpha-Methylcinnamaldehyde | |
| 1504-55-8 | alpha-Methylcinnamic alcohol | |
| 10528-67-3 | alpha-Methyl-cyclohexanepropanol | |
| 99-83-2 | alpha-Phellandrene | |
| 80-56-8 | alpha-Pinene | |
| 705-73-7 | alpha-Propylphenethyl alcohol | |
| 98-55-5 | alpha-Terpineol | |
| 80-26-2 | alpha-Terpineol acetate | |
| 30745-55-2 | Aluminum, bis(2-ethylhexanoato)hydroxy- | |
| 8038-65-1 | Ambergris tincture | J2.31 |
| 8015-62-1 | Ambrette seed absolute | H2.1 |
| 8015-62-1 | Ambrette seed extract | H2.13 |
| 8015-62-1 | Ambrette seed oil | H2.51 |
| 8015-62-1 | Ambrette seed oil | H2.12 |
| 8015-62-1 | Ambrette tincture | H2.31 |
| 201363-52-2 | Amides, coco, N-(hydroxyethyl), propoxylated | |
| 70592-80-2 | Amine oxides, C10-16-alkyldimethyl | |
| 68955-55-5 | Amine oxides, C12-18-alkyldimethyl | |
| 85029-57-8 | Amines, C10-14-branched and linear alkyl, bis[2,4-dihydro-4-[2-(2-hydroxy-4-nitrophenyl)diazenyl]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)]chromate(1-) | |
| 61788-90-7 | Amines, coco alkyldimethyl, N-oxides | |
| 71-41-0 | Amyl alcohol | |
| 540-18-1 | Amyl butyrate | |
| 3487-99-8 | Amyl cinnamate | |
| 638-49-3 | Amyl formate | |
| 540-07-8 | Amyl hexanoate | |
| 2445-72-9 | Amyl isobutyrate | |
| 638-25-5 | Amyl octanoate | |
| 2050-08-0 | Amyl salicylate | |
| 2173-56-0 | Amyl valerate | |
| 67874-72-0 | Amylcyclohexyl acetate (mixed isomers) | |
| 113894-85-2 | Amylopectin, acid-hydrolyzed, 1-octenylbutanedioate | |
| 8015-65-4 | Amyris oil | D2.51 |
| 8015-65-4 | Amyris oil | D2.12 |
| 68916-14-3 | Amyris oil, acetylated | |
| 8015-65-4 | Amyris oil, rectified | D2.24 |
| 104-46-1 | Anethole (isomer unspecified) | |
| 8015-64-3 | Angelica root absolute | A2.1 |
| 84775-41-7 | Angelica root infusion | A2.31 |
| 8015-64-3 | Angelica root oil | A2.12 |
| 8015-64-3 | Angelica seed absolute | H2.1 |
| 8015-64-3 | Angelica seed extract | H2.13 |
| 8015-64-3 | Angelica seed oil | H2.12 |
| 8007-70-3 | Anise seed oil | H2.12 |
| 100-66-3 | Anisole | |
| 1331-83-5 | Anisyl acetate (isomer unspecified) | |
| 105-13-5 | Anisyl alcohol | |
| 1331-81-3 | Anisyl alcohol (o-,m-,p-) | |
| 122-91-8 | Anisyl formate | |
| 102-17-0 | Anisyl phenylacetate | |
| 7549-33-9 | Anisyl propionate | |
| 883111-87-3 | Apple alcoholate | G2.2 |
| 883111-87-3 | Apple CO2 extract | G2.27 |
| 883111-87-3 | Apple distillate | G2.8 |
| 883111-87-3 | Apple essence oil | G2.10 |
| 883111-87-3 | Apple extract | G2.13 |
| 883111-87-3 | Apple oil, rectified | G2.24 |
| 72869-69-3 | Apricot absolute | G2.1 |
| 72869-69-3 | Apricot kernel oil | H2.50 |
| 72869-69-3 | Apricot oil | H2.12 |
| 72869-69-3 | Apricot tincture | G2.31 |
| 223747-87-3 | Argania spinosa oil, expressed | H2.50 |
| 68991-20-8 | Armoise vulgaris oil | E2.12 |
| 8057-65-6 | Arnica absolute | F2.1 |
| 90045-70-8 | Arnica absolute, Mexicana | F2,1 |
| 8057-65-6 | Arnica resinoid | F2.26 |
| 84775-75-7 | Artemisia herba-alba oil | E2.12 |
| 84012-14-6 | Artichoke absolute | E2.1 |
| 9000-04-8 | Asafoetida absolute | K2.1 |
| 9000-04-8 | Asafoetida oil | K2.12 |
| 50-81-7 | Ascorbic acid | |
| 137-66-6 | Ascorbyl 6-palmitate | |
| 68916-62-1 | Baccartol | |
| 8014-71-9 | Balm leaf oil | E2.12 |
| 8014-71-9 | Balm leaves extract | E2.13 |
| 8014-71-9 | Balm leaves water | E2.3 |
| 8007-00-9 | Balsam absolute, Peru | K2.1 |
| 8007-00-9 | Balsam absolute, Peru, pyrogenated | K2.9.1 |
| 8007-00-9 | Balsam extract, Peru | K2.13 |
| 85085-34-3 | Balsam fir oleoresin | K2.16 |
| 8007-00-9 | Balsam oil, Peru | K2.9 |
| 8007-00-9 | Balsam oil, Peru | K2.12 |
| 8007-00-9 | Balsam resinoid, Peru | K2.26 |
| 8007-00-9 | Balsam, Peru | K2.4 |
| 8007-47-4 | Balsams, Canada, oleoresin | K2.16 |
| 8015-73-4 | Basil absolute, chemotype linalool | E2.1 |
| 8015-73-4 | Basil concrete, chemotype linalool | E2.7 |
| 8015-73-4 | Basil oil, chemotype estragole | E2.12 |
| 8015-73-4 | Basil oil, chemotype estragole, rectified | E2.24 |
| 8015-73-4 | Basil oil, chemotype linalool | E2.12 |
| 8015-73-4 | Basil oil, chemotype linalool, rectified | E2.24 |
| 8015-73-4 | Basil oleoresin, chemotype estragole | E2.21 |
| 68916-05-2 | Bay leaf oil, terpeneless | E2.29 |
| 8006-78-8 | Bay leaf oil, West Indian, rectified | E2.24 |
| 8006-78-8 | Bay leaf, West Indian, CO2 extract | E2.27 |
| 8006-78-8 | Bay leaf, West Indian, extract | E2.13 |
| 8006-78-8 | Bay leaf, West Indian, oil | E2.12 |
| 68916-05-2 | Bay leaf, West Indian, oil | E2.51 |
| 8012-89-3 | Beeswax absolute | J2.1 |
| 8012-89-3 | Beeswax CO2 extract | J2.27 |
| 8012-89-3 | Beeswax concrete | J2.7 |
| 1302-78-9 | Bentonite | |
| 100-52-7 | Benzaldehyde | |
| 1319-88-6 | Benzaldehyde glyceryl acetal | |
| 37837-44-8 | Benzaldehyde methyl anthranilate (Schiff base) | |
| 2568-25-4 | Benzaldehyde propylene glycol acetal | |
| 2186-92-7 | Benzene, 1-(dimethoxymethyl)-4-methoxy- | |
| 834-25-3 | Benzene, 1-methyl-4-(phenylmethoxy)- | |
| 621-23-8 | Benzene, 1,3,5-trimethoxy- | |
| 119345-04-9 | Benzene, 1,1'-oxybis-, tetrapropylene derivs., sulfonated, sodium salts | |
| 634-36-6 | Benzene, 1,2,3-trimethoxy- | |
| 95-63-6 | Benzene, 1,2,4-trimethyl- | |
| 108-67-8 | Benzene, 1,3,5-trimethyl- | |
| 68844-97-3 | Benzeneacetaldehyde, 3,4-dimethyl- | |
| 130786-09-3 | Benzeneacetonitrile, a-butylidene-, (Z) | |
| 2353-45-9 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-hydroxy-2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) | |
| 3844-45-9 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)met -hylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, disodium salt | |
| 2206-94-2 | Benzenemethanol, alpha-methylene-, acetate | |
| 134123-93-6 | Benzenepropanenitrile, 4-ethyl-.alpha.,.alpha.-dimethyl- | |
| 127519-17-9 | Benzenepropanoic acid, 3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxy-, C7-9-branched and linear alkyl esters | |
| 6683-19-8 | Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2,2-bis[[3-[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropoxy]methyl]- -1,3-propanediyl ester | |
| 125643-61-0 | Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, C7-9-branched alkyl esters | |
| 2082-79-3 | Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, octadecyl ester | |
| 56836-93-2 | Benzenepropanol, a,ß-dimethyl- | |
| 2035-93-0 | Benzenepropanol, alpha, gamma, gamma-trimethyl- | |
| 4403-90-1 | Benzenesulfonic acid, 2,2'-[(9,10-dihydro-9,10-dioxo-1,4-anthracenediyl)diimino]bis[5-methyl-, sodium salt (1:2) | |
| 4430-18-6 | Benzenesulfonic acid, 2-[(9,10-dihydro-4-hydroxy-9,10-dioxo-1-anthracenyl)amino]-5-methyl-, monosodium salt | |
| 92484-48-5 | Benzenesulfonic acid, 3-(2H-benzotriazol-2-yl)-4-hydroxy-5-(1-methylpropyl)-, monosodium salt | |
| 4474-24-2 | Benzenesulfonic acid, 3,3'-[(9,10-dihydro-9,10-dioxo-1,4-anthracenediyl)diimino]bis[2,4,6-trimethyl-, sodium salt (1:2) | |
| 633-96-5 | Benzenesulfonic acid, 4-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-, sodium salt (1:1) | |
| 36445-71-3 | Benzenesulfonic acid, decyl(sulfophenoxy)-, sodium salt (1:2) | |
| 28519-02-0 | Benzenesulfonic acid, dodecyl(sulfophenoxy)-, disodium salt | |
| 25167-32-2 | Benzenesulfonic acid, oxybis[dodecyl-, disodium salt | |
| 65-85-0 | Benzoic acid | |
| 67785-76-6 | Benzoic acid, 2-[(2-phenylethylidene)amino]-, methyl ester | |
| 111753-60-7 | Benzoic acid, 2-((3-(1,3-benzodioxol-5-yl)-2-methylpropylidene)amino)-, methyl ester | |
| 14735-72-9 | Benzoic acid, 2-.(..(.(4-methoxyphenyl)methylene.).amino.).-,methyl ester | |
| 144761-91-1 | Benzoic acid, 2-[(1-hydroxy-3-phenylbutyl)amino], methyl ester | |
| 94248-34-7 | Benzoic acid, 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]-, methyl ester | |
| 111753-62-9 | Benzoic acid, 2-[[3-(4-methoxyphenyl)-2-methylpropylidene]amino]-, methyl ester | |
| 302776-68-7 | Benzoic acid, 2-[4-(diethylamino)-2-hydroxybenzoyl]-, hexyl ester | |
| 873888-84-7 | Benzoic acid, 2-hydroxy-, (3Z)-1-methyl-3-hexen-1-yl ester | |
| 51115-63-0 | Benzoic acid, 2-hydroxy-, 2-methylbutyl ester | |
| 22717-57-3 | Benzoic acid, 2-hydroxy-5-methyl-, methyl ester | |
| 89-71-4 | Benzoic acid, 2-methyl-, methyl ester | |
| 67845-93-6 | Benzoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, hexadecyl ester | |
| 96682-10-9 | Benzoic acid, 4-(benzoyloxy)-, phenylmethyl ester | |
| 9000-72-0 | Benzoin absolute, Siam | K2.1 |
| 9000-72-0 | Benzoin CO2 extract, Siam | K2.27 |
| 9000-72-0 | Benzoin extract, Siam | K2.13 |
| 9000-05-9 | Benzoin extract, Sumatra | K2.13 |
| 9000-72-0 | Benzoin gum, Siam | K2.17 |
| 9000-05-9 | Benzoin gum, Sumatra | K2.17 |
| 9000-05-9 | Benzoin infusion, Sumatra | K2.31 |
| 9000-72-0 | Benzoin resinoid, Siam | K2.26 |
| 9000-05-9 | Benzoin resinoid, Sumatra | K2.26 |
| 9000-72-0 | Benzoin tincture, Siam | K2.31 |
| 100-47-0 | Benzonitrile | |
| 22884-95-3 | Benzonitrile, 3,4-dimethyl- | |
| 119-61-9 | Benzophenone | |
| 95-16-9 | Benzothiazole | |
| 2094-69-1 | Benzyl 2,2-dimethylpropanoate | |
| 2051-96-9 | Benzyl 2-hydroxypropionate | |
| 56423-40-6 | Benzyl 2-methylbutyrate | |
| 140-11-4 | Benzyl acetate | |
| 2550-26-7 | Benzyl acetone | |
| 100-51-6 | Benzyl alcohol | |
| 120-51-4 | Benzyl benzoate | |
| 103-37-7 | Benzyl butyrate | |
| 103-41-3 | Benzyl cinnamate | |
| 104-57-4 | Benzyl formate | |
| 6938-45-0 | Benzyl hexanoate | |
| 122-73-6 | Benzyl isoamyl ether | |
| 103-28-6 | Benzyl isobutyrate | |
| 103-38-8 | Benzyl isovalerate | |
| 140-25-0 | Benzyl laurate | |
| 538-86-3 | Benzyl methyl ether | |
| 10276-85-4 | Benzyl octanoate | |
| 102-16-9 | Benzyl phenylacetate | |
| 122-63-4 | Benzyl propionate | |
| 118-58-1 | Benzyl salicylate | |
| 37526-88-8 | Benzyl trans-2-methyl-2-butenoate | |
| 10361-39-4 | Benzyl valerate | |
| 68917-80-6 | Bergamot oil terpenes | G2.30 |
| 8007-75-8 | Bergamot oil, expressed | G2.5 |
| 68648-33-9 | Bergamot oil, furocoumarin free | G2.33 |
| 8007-75-8 | Bergamot oil, rectified | G2.24 |
| 8007-75-8 | Bergamot oil, terpeneless | G2.29 |
| 35044-68-9 | beta-1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one | |
| 87-44-5 | beta-Caryophyllene | |
| 2432005-07-5 | beta-dodecylseleno-gamma-damascone | |
| 18794-84-8 | beta-Farnesene | |
| 88-84-6 | beta-Guaiene | |
| 68424-94-2 | Betaines, coco alkyldimethyl | |
| 22029-76-1 | beta-Ionol | |
| 14901-07-6 | beta-Ionone | |
| 22030-19-9 | beta-Ionyl acetate | |
| 55066-49-4 | beta-Methyl-benzenepentanal | |
| 1123-85-9 | beta-Methylphenethyl alcohol | |
| 63449-68-3 | beta-Naphthyl anthranilate | |
| 93-18-5 | beta-Naphthyl ethyl ether | |
| 2173-57-1 | beta-Naphthyl isobutyl ether | |
| 93-04-9 | beta-Naphthyl methyl ether | |
| 514-51-2 | beta-Patchoulene | |
| 555-10-2 | beta-Phellandrene | |
| 127-91-3 | beta-Pinene | |
| 60066-88-8 | beta-Sinensal | |
| 464-48-2 | Bicyclo(2.2.1)heptan-2-one, 1,7,7-trimethyl-, (1S)- | |
| 6143-29-9 | Bicyclo[2.2.1]hept-5-en-2-ol, acetate | |
| 116126-82-0 | Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(1-methylethyl)-, ethyl ester, (2-exo,3-endo)- | |
| 55066-54-1 | Bicyclo[2.2.1]heptan-2-ol, 1,3,3-trimethyl-, benzoate | |
| 4747-61-9 | Bicyclo[3.1.1]heptane-2-ethanol, 6,6-dimethyl- | |
| 1196-01-6 | Bicyclo[3.1.1]hept-3-en-2-one, 4,6,6-trimethyl-, (1S,5S)- | |
| 216970-21-7 | Bicyclo[4,3,1]decane, 3-methoxy-7,7-dimethyl-10-methylene | |
| 68916-04-1 | Bigarade oil, washed | G2.23 |
| 92-52-4 | Biphenyl | |
| 8001-88-5 | Birch tar oil, rectified | C2.9.2 |
| 26160-83-8 | Bis(hydroxymethyl)tricyclo[5.2.1.02,6]decane | |
| 1618-26-4 | bis-(Methylthio)methane | |
| 495-62-5 | Bisabolene | |
| 507-70-0 | Borneol | |
| 76-49-3 | Bornyl acetate | |
| 8053-33-6 | Boronia absolute | F2.1 |
| 68916-76-7 | Bran absolute | H2.1 |
| 68650-46-4 | Bucchu absolute, betulina | E2.1 |
| 68650-46-4 | Bucchu Leaves Extract | E2.13 |
| 68650-46-4 | Bucchu oil, betulina | E2.12 |
| 68650-46-4 | Bucchu oil, rectified, betulina | E2.24 |
| 68650-46-4 | Bucchu oil, terpeneless | E2.29 |
| 68650-46-4 | Bucchu resinoid, betulina | E2.26 |
| 94333-88-7 | Bulnesia sarmienti, ext., acetate | |
| 959130-05-3 | Bursera graveolens wood oil | E2.12 |
| 1093653-57-6 | Butanal, 4-(heptyloxy)-3-methyl- | |
| 16485-10-2 | Butanamide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl- | |
| 406488-30-0 | Butanamide, 2-ethyl-N-methyl-N-(3-methylphenyl)- | |
| 2568-90-3 | Butane, 1,1'-[methylenebis(oxy)]bis- | |
| 2373-38-8 | Butanedioic acid, sulfo-, 1,4-bis(1,3-dimethylbutyl) ester, sodium salt | |
| 577-11-7 | Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt | |
| 155514-23-1 | Butanoic acid, 2-methyl-, 5-hexen-1-yl ester | |
| 1266606-26-1 | Butanoic acid, 2-methyl-5-(1-methylethyl)cyclopentyl ester | |
| 68039-26-9 | Butanoic acid, 2-methyl-, pentyl ester | |
| 113889-23-9 | Butanoic acid, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indenyl ester | |
| 9003-29-6 | Butene, homopolymer | |
| 97926-23-3 | Butter esters | |
| 91745-88-9 | Butter starter distillate | J2.9 |
| 109-42-2 | Butyl 10-undecenoate | |
| 7785-66-2 | Butyl 2-methylcrotonate (E) | |
| 7785-64-0 | Butyl 2-methylcrotonate (Z) | |
| 6297-41-2 | Butyl 2-methylvalerate | |
| 123-86-4 | Butyl acetate | |
| 71-36-3 | Butyl alcohol | |
| 7756-96-9 | Butyl anthranilate | |
| 136-60-7 | Butyl benzoate | |
| 109-21-7 | Butyl butyrate | |
| 7492-70-8 | Butyl butyryllactate | |
| 592-84-7 | Butyl formate | |
| 626-82-4 | Butyl hexanoate | |
| 97-87-0 | Butyl isobutyrate | |
| 109-19-3 | Butyl isovalerate | |
| 138-22-7 | Butyl lactate | |
| 97-88-1 | Butyl methacrylate | |
| 589-75-3 | Butyl octanoate | |
| 122-43-0 | Butyl phenylacetate | |
| 94-26-8 | Butyl p-hydroxy benzoate | |
| 590-01-2 | Butyl propionate | |
| 2052-14-4 | Butyl salicylate | |
| 123-95-5 | Butyl stearate | |
| 544-40-1 | Butyl sulfide | |
| 25013-16-5 | Butylated hydroxyanisole | |
| 128-37-0 | Butylated hydroxytoluene | |
| 123-72-8 | Butyraldehyde | |
| 107-92-6 | Butyric acid | |
| 495-40-9 | Butyrophenone | |
| 84012-17-9 | Buxus sempervirens absolute | E2.1 |
| 8004-92-0 | C.I. Acid Yellow 3 | |
| 8049-84-1 | C.I. Natural green 3 | |
| 1393-63-1 | C.I. Natural Orange C | |
| 37229-23-5 | C.I. Solvent Blue 45 | |
| 12227-55-3 | C.I. Solvent Red 122 | |
| 8003-22-3 | C.I. Solvent yellow 33 | |
| 90622-58-5 | C11-15-Isoalkanes | |
| 90622-57-4 | C9-12-Iso-alkanes | |
| 68188-03-4 | Cabreuva oil | D2.12 |
| 8002-31-1 | Cacao absolute | H2.1 |
| 8002-31-1 | Cacao extract | H2.13 |
| 8002-31-1 | Cacao infusion and tincture | H2.31 |
| 8002-31-1 | Cacao oil | H2.50 |
| 8002-31-1 | Cacao oleoresin | H2.18 |
| 8013-10-3 | Cade oil | D2.51 |
| 8013-10-3 | Cade oil | D2.12 |
| 8013-10-3 | Cade oil, rectified | D2.9.2 |
| 29350-73-0 | Cadinene | |
| 8008-98-8 | Cajuput oil | E2.12 |
| 8015-79-0 | Calamus oil | A2.12 |
| 23411-34-9 | Calciate(2-), [(ethylenedinitrilo)tetraacetato]-, disodium, hydrate | |
| 1344-95-2 | Calcium silicate | |
| 70892-20-5 | Calendula absolute | F2.1 |
| 1069136-34-0 | Callitropsis nootkatensis oil | E2.12 |
| 1069136-34-0 | Callitropsis nootkatensis oil | D2.12 |
| 1069136-34-0 | Callitropsis nootkatensis oil, rectified | E2.24 |
| 1069136-34-0 | Callitropsis nootkatensis oil, rectified | D2.24 |
| 68916-73-4 | Camellia leaf concentrate | E2.32 |
| 68916-73-4 | Camellia leaf distillate | E2.8 |
| 68916-73-4 | Camellia leaf extract | E2.13 |
| 68916-73-4 | Camillia leaf CO2 extract | E2.27 |
| 79-92-5 | Camphene | |
| 8008-51-3 | Camphor oil, white | D2.12 |
| 8008-51-3 | Camphor oil, white, rectified | D2.24 |
| 68606-83-7 | Cananga oil | F2.12 |
| 120962-03-0 | Canola oil | H2.50 |
| 8023-77-6 | Capsicum oleoresin | G2.21 |
| 8028-89-5 | Caramel color | K2.55 |
| 8000-42-8 | Caraway seed oil | H2.12 |
| 8000-42-8 | Caraway seed oil, rectified | H2.24 |
| 67643-70-3 | Carbamic acid, N,N-dimethyl-, 1-ethenyl-1,5-dimethyl-4-hexen-1-yl ester | |
| 144-55-8 | Carbonic acid monosodium salt | |
| 260781-16-6 | Carbonic acid, 2-hydroxypropyl (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester | |
| 156679-39-9 | Carbonic acid, 2-hydroxyethyl 5-methyl-2-(1-methylethyl)cyclohexyl ester | |
| 132638-45-0 | Carbonic acid, 2-methoxy-4-methylphenyl methyl ester | |
| 10361-29-2 | Carbonic acid, ammonium salt | |
| 1403495-60-2 | Carbonic acid, compd. with guanidine (1:2), polymer with bis(isocyanatomethyl)benzene and 2-ethyl-2-(hydroxymethyl)-1,3-propanediol | |
| 506-87-6 | Carbonic acid, diammonium salt | |
| 8000-66-6 | Cardamom seed absolute | H2.1 |
| 8000-66-6 | Cardamom seed CO2 extract | H2.27 |
| 8000-66-6 | Cardamom seed extract | H2.13 |
| 8000-66-6 | Cardamom seed oil | H2.12 |
| 8000-66-6 | Cardamom seed oleoresin | H2.21 |
| 8000-66-6 | Cardamon seed | H2.11 |
| 8021-43-0 | Carnation absolute | F2.1 |
| 8021-43-0 | Carnation extract | F2.13 |
| 79070-15-8 | Carob bean absolute | G2.1 |
| 79070-15-8 | Carob bean absolute | H2.1 |
| 79070-15-8 | Carob bean extract | G2.13 |
| 9000-40-2 | Carob gum | G2.15 |
| 8015-88-1 | Carrot seed | H2.11 |
| 8015-88-1 | Carrot seed absolute | H2.1 |
| 8015-88-1 | Carrot seed oil | H2.12 |
| 8015-88-1 | Carrot seed oil terpenless | H2.29 |
| 8015-88-1 | Carrot seed oil, rectified | H2.24 |
| 499-75-2 | Carvacrol | |
| 99-48-9 | Carveol | |
| 99-49-0 | Carvone | |
| 97-42-7 | Carvyl acetate | |
| 57082-24-3 | Caryophyllene acetate | |
| 75975-83-6 | Caryophyllene acetylated | |
| 1139-30-6 | Caryophyllene oxide | |
| 8007-06-5 | Cascarilla bark extract | C2.13 |
| 8007-06-5 | Cascarilla bark oil | C2.12 |
| 8007-80-5 | Cassia bark extract | C2.13 |
| 8007-80-5 | Cassia bark oil | C2.12 |
| 8007-80-5 | Cassia oil | E2.12 |
| 8007-80-5 | Cassia oil, (low coumarin) | E2.33 |
| 8007-80-5 | Cassia oil, rectified | E2.24 |
| 8023-82-3 | Cassie absolute | F2.1 |
| 8023-82-3 | Cassie concrete | F2.7 |
| 97676-19-2 | Cassis bud absolute | F2.1 |
| 97676-19-2 | Cassis bud CO2 extract | F2.27 |
| 97676-19-2 | Cassis bud oil | F2.12 |
| 97676-19-2 | Cassis bud oil, terpeneless | F2.29 |
| 97676-19-2 | Cassis essence oil | G2.10 |
| 97676-19-2 | Cassis tincture | G2.31 |
| 871465-49-5 | Cassyrane | |
| 8001-79-4 | Castor oil | H2.50 |
| 61788-85-0 | Castor oil, hydrogenated, ethoxylated | |
| 8023-83-4 | Castoreum absolute | J2.1 |
| 8023-83-4 | Castoreum concrete | J2.7 |
| 8023-83-4 | Castoreum resinoid | J2.26 |
| 8023-83-4 | Castoreum tincture | J2.31 |
| 8001-76-1 | Catechu extract | K2.13 |
| 8007-20-3 | Cedar leaf oil | E2.12 |
| 91770-83-1 | Cedar leaf oil, China | E2.12 |
| 8007-20-3 | Cedar leaf oil, rectified | E2.24 |
| 68917-35-1 | Cedar leaf oil, Western Canada/USA | E2.12 |
| 8023-85-6 | Cedarwood extract, Atlas | D2.13 |
| 68990-83-0 | Cedarwood extract, Texas | D2.13 |
| 68990-83-0 | Cedarwood oil (low cedrol), Texas | D2.33 |
| 61789-42-2 | Cedarwood oil acetylated | |
| 68608-32-2 | Cedarwood oil terpenes | D2.30 |
| 8023-85-6 | Cedarwood oil, Atlas | D2.12 |
| 8023-85-6 | Cedarwood oil, Atlas, rectified | D2.24 |
| 1159574-01-2 | Cedarwood oil, Chinese | D2.12 |
| 1159574-01-2 | Cedarwood oil, Chinese, rectified | D2.24 |
| 68648-34-0 | Cedarwood oil, epoxidized | |
| 68991-36-6 | Cedarwood oil, Himalaya | D2.12 |
| 68916-71-2 | Cedarwood oil, oxidized | |
| 68603-22-5 | Cedarwood oil, terpeneless | D2.29 |
| 68990-83-0 | Cedarwood oil, Texas | D2.12 |
| 68990-83-0 | Cedarwood oil, Texas, rectified | D2.24 |
| 8000-27-9 | Cedarwood oil, Virginian | D2.12 |
| 8000-27-9 | Cedarwood oil, Virginian, rectified | D2.24 |
| 1159574-01-2 | Cedarwood terpenes, Chinese | D2.30 |
| 8000-27-9 | Cedarwood terpenes, Virginia | D2.30 |
| 13567-39-0 | Cedr-8-ene epoxide | |
| 11028-42-5 | Cedrene | |
| 28231-03-0 | Cedrenol | |
| 1405-92-1 | Cedrenyl acetate | |
| 39900-38-4 | Cedrenyl formate | |
| 77-53-2 | Cedrol | |
| 19870-74-7 | Cedrol methyl ether | |
| 77-54-3 | Cedryl acetate | |
| 39900-38-4 | Cedryl formate | |
| 67874-81-1 | Cedryl methyl ether | |
| 73049-53-3 | Celery leaf oil | E2.12 |
| 8015-90-5 | Celery seed absolute | H2.1 |
| 8015-90-5 | Celery seed CO2 extract | H2.27 |
| 8015-90-5 | Celery seed extract | H2.13 |
| 8015-90-5 | Celery seed oil | H2.12 |
| 8015-90-5 | Celery seed oleoresin | H2.21 |
| 9004-34-6 | Cellulose | |
| 9004-62-0 | Cellulose, 2-hydroxyethyl ether | |
| 9004-32-4 | Cellulose, carboxymethyl ether, sodium salt | |
| 1422377-33-0 | Cellulose, carboxymethyl ether, sodium salt, polymer with bis(isocyanatomethyl)benzene, 2,2-dimethoxyacetaldehyde, ethanedial, 2-ethyl-2-(hydroxymethyl)-1,3-propanediol, 2-oxoacetic acid, 1H-1,2,4-triazole-3,5-diamine and 1,3,5-triazine-2,4,6-triamine | |
| 68916-68-7 | Chamomile absolute, Moroccan | F2.1 |
| 8002-66-2 | Chamomile flower absolute | F2.1 |
| 8015-92-7 | Chamomile flower absolute, Roman | F2.1 |
| 8002-66-2 | Chamomile flower concrete | F2.7 |
| 8002-66-2 | Chamomile flower extract | F2.13 |
| 8002-66-2 | Chamomile flower oil, blue | F2.12 |
| 8002-66-2 | Chamomile flower oil, blue | F2.51 |
| 8015-92-7 | Chamomile flower oil, Roman | F2.12 |
| 8015-92-7 | Chamomile flower oil, Roman rectified | F2.24 |
| 8015-92-7 | Chamomile flower, English, oil | F2.12 |
| 68916-68-7 | Chamomile oil, Moroccan | F2.12 |
| 8006-76-6 | Champaca absolute | F2.1 |
| 8006-76-6 | Champaca flower oil, low methyleugenol | F2.33 |
| 8006-76-6 | Champaca leaf oil | E2.12 |
| 92457-18-6 | Champaca leaf oil, low methyeugenol | E2.33 |
| 8006-76-6 | Champaca oil | F2.12 |
| 85566-22-9 | Cherry essence | G2.10 |
| 11006-34-1 | Chlorophyllin, copper sodium complex | |
| 52256-37-8 | Chromate(1-), bis[2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol --3-onato(2-)]-, hydrogen | |
| 104-55-2 | Cinnamaldehyde | |
| 621-82-9 | Cinnamic acid | |
| 4364-06-1 | Cinnamic aldehyde dimethyl acetal | |
| 8015-91-6 | Cinnamon bark CO2 extract | C2.27 |
| 8015-91-6 | Cinnamon bark extract | C2.13 |
| 8015-91-6 | Cinnamon bark oil | C2.12 |
| 97659-68-2 | Cinnamon bark oil, Laos | C2.12 |
| 8015-91-6 | Cinnamon leaf oil | E2.12 |
| 8015-91-6 | Cinnamon leaf oil, rectified | E2.24 |
| 8015-91-6 | Cinnamon leaf oil, safrol reduced | E2.33 |
| 8015-91-6 | Cinnamon leaf oleoresin | E2.21 |
| 4360-47-8 | Cinnamonitrile (isomer unspecified) | |
| 103-54-8 | Cinnamyl acetate | |
| 104-54-1 | Cinnamyl alcohol | |
| 5320-75-2 | Cinnamyl benzoate | |
| 103-61-7 | Cinnamyl butyrate | |
| 122-69-0 | Cinnamyl cinnamate | |
| 104-65-4 | Cinnamyl formate | |
| 103-59-3 | Cinnamyl isobutyrate | |
| 140-27-2 | Cinnamyl isovalerate | |
| 1885-38-7 | Cinnamyl nitrile | |
| 103-56-0 | Cinnamyl propionate | |
| 71660-03-2 | cis- and trans-p-1(7),8-Menthadien-2-yl acetate | |
| 23726-94-5 | cis-1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-Buten-1-one | |
| 59323-76-1 | cis-2-Methyl-4-propyl-1,3-oxathiane | |
| 20298-69-5 | cis-2-tert-Butylcyclohexyl acetate | |
| 933-48-2 | cis-3,5,5-Trimethylcyclohexan-1-ol | |
| 1576-78-9 | cis-3-Heptenyl acetate | |
| 3681-71-8 | cis-3-Hexen-1-yl acetate | |
| 6789-80-6 | cis-3-Hexenal | |
| 928-96-1 | cis-3-Hexenol | |
| 65405-76-7 | cis-3-Hexenyl anthranilate | |
| 25152-85-6 | cis-3-Hexenyl benzoate | |
| 16491-36-4 | cis-3-Hexenyl butyrate | |
| 61444-38-0 | cis-3-Hexenyl cis-3-hexenoate | |
| 33467-73-1 | cis-3-Hexenyl formate | |
| 31501-11-8 | cis-3-Hexenyl hexanoate | |
| 41519-23-7 | cis-3-Hexenyl isobutyrate | |
| 35154-45-1 | cis-3-Hexenyl isovalerate | |
| 61931-81-5 | cis-3-Hexenyl lactate | |
| 67633-96-9 | cis-3-Hexenyl methyl carbonate | |
| 33467-74-2 | cis-3-Hexenyl propionate | |
| 65405-77-8 | cis-3-Hexenyl salicylate | |
| 67883-79-8 | cis-3-Hexenyl tiglate | |
| 35852-46-1 | cis-3-Hexenyl valerate | |
| 10340-23-5 | cis-3-Nonen-1-ol | |
| 13049-88-2 | cis-3-Nonenyl acetate | |
| 20125-84-2 | cis-3-Octen-1-ol | |
| 94134-03-9 | cis-3-Octenyl propionate | |
| 13828-37-0 | cis-4-(Isopropyl)cyclohexanemethanol | |
| 21662-09-9 | cis-4-Decen-1-al | |
| 57074-37-0 | cis-4-Decenol | |
| 10411-92-4 | cis-4-tert-Butylcyclohexyl acetate | |
| 64275-73-6 | cis-5-Octen-1-ol | |
| 41547-22-2 | cis-5-Octenal | |
| 35854-86-5 | cis-6-Nonen-1-ol | |
| 2277-19-2 | cis-6-Nonenal | |
| 77-42-9 | cis-beta Santalol | |
| 3338-55-4 | cis-beta-Ocimene | |
| 488-10-8 | cis-Jasmone | |
| 8016-26-0 | Cistus absolute | E2.1 |
| 8016-26-0 | Cistus absolute, pyrogenated | E2.1.1 |
| 8016-26-0 | Cistus absolute, pyrogenated, rectified | E2.9.2 |
| 8016-26-0 | Cistus CO2 extract | E2.27 |
| 8016-26-0 | Cistus concrete | E2.7 |
| 8016-26-0 | Cistus extract | E2.13 |
| 8016-26-0 | Cistus oil | E2.12 |
| 8016-26-0 | Cistus oil | E2.51 |
| 8016-26-0 | Cistus oil, pyrogenated | E2.9.1 |
| 5392-40-5 | Citral | |
| 7492-66-2 | Citral diethyl acetal | |
| 7549-37-3 | Citral dimethyl acetal | |
| 10444-50-5 | Citral propylene glycol acetal | |
| 67801-47-2 | Citral-methylanthranilate (Schiff base) | |
| 77-92-9 | Citric acid | |
| 97593-31-2 | Citric and fatty acid esters of glycerol | |
| 68991-25-3 | Citron oil | G2.5 |
| 8000-29-1 | Citronella oil terpenes | E2.30 |
| 8000-29-1 | Citronella oil, Ceylon type | E2.12 |
| 8000-29-1 | Citronella oil, Java type | E2.12 |
| 68916-56-3 | Citronella oil, reduced | |
| 106-23-0 | Citronellal | |
| 67845-42-5 | Citronellal methylanthranilate Schiff base | |
| 7492-67-3 | Citronelloxyacetaldehyde | |
| 20770-40-5 | Citronellyl 3-methyl-2-butenoate | |
| 150-84-5 | Citronellyl acetate | |
| 141-16-2 | Citronellyl butyrate | |
| 68039-38-3 | Citronellyl crotonate | |
| 69929-16-4 | Citronellyl ethyl ether | |
| 60788-25-2 | Citronellyl ethyl oxalate | |
| 105-85-1 | Citronellyl formate | |
| 10580-25-3 | Citronellyl hexanoate | |
| 97-89-2 | Citronellyl isobutyrate | |
| 68922-10-1 | Citronellyl isovalerate | |
| 51566-62-2 | Citronellyl nitrile | |
| 139-70-8 | Citronellyl phenylacetate | |
| 141-14-0 | Citronellyl propionate | |
| 24717-85-9 | Citronellyl tiglate | |
| 929194-65-0 | Citrus hystrix oil | E2.12 |
| 233683-84-6 | Citrus junos extract | G2.13 |
| 233683-84-6 | Citrus junos oil | G2.5 |
| 94266-47-4 | Citrus peels extract | G2.13 |
| 68608-34-4 | Citrus terpenes | G2.30 |
| 68916-26-7 | Civet absolute | J2.1 |
| 8016-63-5 | Clary sage absolute | F2.1 |
| 8016-63-5 | Clary sage absolute | E2.1 |
| 8016-63-5 | Clary sage extract | E2.13 |
| 8016-63-5 | Clary sage oil | E2.12 |
| 8008-31-9 | Clementine oil | G2.5 |
| 68917-29-3 | Clove bud oil terpenes | F2.30 |
| 8000-34-8 | Clove bud absolute | F2.1 |
| 8000-34-8 | Clove bud extract | F2.13 |
| 8000-34-8 | Clove bud oil | F2.12 |
| 8000-34-8 | Clove leaf oil | E2.12 |
| 68917-29-3 | Clove leaf oil terpenes | E2.30 |
| 8000-34-8 | Clove leaf oil, rectified | E2.24 |
| 8000-34-8 | Clove stem oil | L2.12 |
| 91771-52-7 | Clove, extract, acetylated | |
| 84912-04-9 | Cobaltate(1-), bis[4-(hydroxy-κO)-3-[2-[2-(hydroxy-κO)-1-naphthalenyl]diazenyl-κN1]benzenesulfonamidato(2-)]-, hydrogen, compd. with 3-[(2-ethylhexyl)oxy]-1-propanamine (1:1:1) | |
| 8002-31-1 | Cocoa, ext., alkalized | H2.19 |
| 8001-31-8 | Coconut oil, fixed | G2.50 |
| 8001-31-8 | Coconut extract | G2.13 |
| 8001-67-0 | Coffee bean extract | H2.13 |
| 8001-67-0 | Coffee bean, roasted, absolute | H2.1 |
| 8001-67-0 | Coffee bean, roasted, CO2 extract | H2.27 |
| 68916-18-7 | Coffee bean, roasted, extract | H2.13 |
| 8001-67-0 | Coffee, bean, roasted, ext. | H2.19 |
| 84650-00-0 | Coffee, Coffea arabica, extract | H2.13 |
| 8013-97-6 | Copaiba balsam | K2.4 |
| 8013-97-6 | Copaiba balsam oil | K2.12 |
| 8013-97-6 | Copaiba balsam oleoresin | K2.16 |
| 8013-97-6 | Copaiba oil | K2.9 |
| 8013-97-6 | Copaiba oil, rectified | K2.24 |
| 147-14-8 | Copper, [29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]-, (SP-4-1)- | |
| 15739-09-0 | Copper, [dihydrogen 21-carboxy-14-ethyl-4,8,13,18-tetramethyl-20-oxo-9-vinyl-3-phorbinepropionato(2-)]-, 21-methyl phytyl ester, (E)- | |
| 8008-52-4 | Coriander herb oil | E2.12 |
| 8008-52-4 | Coriander herb oil terpenless | E2.29 |
| 8008-52-4 | Coriander herb oil, rectified | E2.24 |
| 8008-52-4 | Coriander oleoresin | E2.21 |
| 8008-52-4 | Coriander seed | H2.11 |
| 8008-52-4 | Coriander seed oil | H2.12 |
| 8001-30-7 | Corn oil | H2.50 |
| 8001-29-4 | Cottonseed oil | H2.50 |
| 91-64-5 | Coumarin | |
| 1319-77-3 | Cresol (Unspecified) | |
| 8007-87-2 | Cubeb CO2 extract | G2.27 |
| 8007-87-2 | Cubeb oil | G2.12 |
| 8007-87-2 | Cubeb oil, rectified | G2.24 |
| 89998-01-6 | Cucumber distillate | G2.8 |
| 89998-01-6 | Cucumber extract | G2.13 |
| 8014-13-9 | Cumin seed oil | H2.12 |
| 122-03-2 | Cuminic aldehyde | |
| 13816-33-6 | Cuminyl nitrile | |
| 876068-15-4 | Curry leaf absolute | E2.1 |
| 91-50-9 | Cyclamen aldehyde-methyl anthranilate (Schiff base) | |
| 118562-73-5 | Cyclododecaneethanol, .beta.-methyl- | |
| 59052-82-3 | Cyclododecyl formate | |
| 3100-36-5 | Cyclohexadec-8-en-1-one mixture of cis and trans isomer | |
| 2550-52-9 | Cyclohexadecanone | |
| 88642-03-9 | Cyclohexadecenone | |
| 33880-83-0 | Cyclohexane, 1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)-, (1R,2R,4S)-rel- | |
| 99-82-1 | Cyclohexane, 1-methyl-4-(1-methylethyl)- | |
| 181258-87-7 | Cyclohexane, 1-(1,1-dimethylpropyl)-4-ethoxy-, cis- | |
| 181258-89-9 | Cyclohexane, 1-(1,1-dimethylpropyl)-4-ethoxy-, trans- | |
| 14315-63-0 | Cyclohexane, 1,1′-[oxybis(methylene)]bis- | |
| 68845-33-0 | Cyclohexane, 1-ethenyl-1-methyl-2-(1-methylethenyl)-4-(1-methylethyl)-, didehydro derivative | |
| 2511-00-4 | Cyclohexaneacetic acid, .alpha.-methyl-, ethyl ester | |
| 98-89-5 | Cyclohexanecarboxylic acid | |
| 23059-38-3 | Cyclohexanecarboxylic acid, 1,4-dimethyl-, methyl ester, cis- | |
| 22471-55-2 | Cyclohexanecarboxylic acid, 2,2,6-trimethyl-, ethyl ester, (1R,6S)-rel- | |
| 7605-52-9 | Cyclohexanecarboxylic acid, 3-methyl, methyl ester, (1R,3S)-rel- | |
| 4802-20-4 | Cyclohexaneethanethiol, 3-mercapto-b,4-dimethyl- | |
| 21722-83-8 | Cyclohexaneethyl acetate | |
| 68480-15-9 | Cyclohexanemethanol, 2,4-dimethyl- | |
| 20009-20-5 | Cyclohexanemethanol, 4-(acetyloxy)-a,a,4-trimethyl-, acetate | |
| 95851-08-4 | Cyclohexanepropanol, 2,2,3,6-tetramethyl-a-propyl- | |
| 60241-52-3 | Cyclohexanepropanol, α-ethyl-2,2,6-trimethyl- | |
| 108-93-0 | Cyclohexanol | |
| 23950-98-3 | Cyclohexanol, 2-methoxy-4-propyl- | |
| 1631145-48-6 | Cyclohexanol, 4-ethylidene-2-propoxy- | |
| 2230-87-7 | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate, (1a,2a,5b)- | |
| 830322-14-0 | Cyclohexanol,4-(3-methylbutyl)- | |
| 108-94-1 | Cyclohexanone | |
| 6413-26-9 | Cyclohexanone 1,3-butylene glycol ketal | |
| 1670-47-9 | Cyclohexanone diethyl ketal | |
| 55739-89-4 | Cyclohexanone, 2-ethyl-4,4-dimethyl- | |
| 5524-05-0 | Cyclohexanone, 2-methyl-5-(1-methylethenyl)-, (2R,5R)- | |
| 19096-86-7 | Cyclohexanone,5-methyl-2-(1-methylethyl)-,oxime | |
| 9003-73-0 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, homopolymer | |
| 68921-26-6 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, sulfurized | |
| 622-45-7 | Cyclohexyl acetate | |
| 1551-44-6 | Cyclohexyl butyrate | |
| 65405-69-8 | Cyclohexyl cyclopent-2-ene-1-acetate | |
| 4927-39-3 | Cyclohexyl methyl pentanone | |
| 42288-75-5 | Cyclohexyl phenylacetate | |
| 25485-88-5 | Cyclohexyl salicylate | |
| 5552-30-7 | Cycloionone | |
| 87731-18-8 | Cyclooct-4-en-1-yl methyl carbonate | |
| 502-72-7 | Cyclopentadecanone | |
| 1266606-13-6 | Cyclopentaneacetonitrile, 2,4,4-trimethyl-α-methylene- | |
| 1465004-85-6 | Cyclopentanol, 1-ethyl-2-(3-methylbutyl)- | |
| 1245725-35-2 | Cyclopentanol, 2-methyl-5-(1-methylethyl)-, 1-propanoate | |
| 34686-67-4 | Cyclopentanol, 2-(2-hexen-1-yl)- | |
| 188570-78-7 | Cyclopropanecarboxylic acid, (3Z)-3-hexenyl ester | |
| 477218-42-1 | Cyclopropanecarboxylic acid, 2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl ester | |
| 676532-44-8 | Cyclopropanecarboxylic acid, 2-methyl-2-[(1,2,4-trimethyl-2-penten-1-yl)oxy]propyl ester | |
| 1181244-95-0 | Cyclopropanemethanol, 1-methyl-2-[[(1R,3R)-2,2,3-trimethylcyclopentyl]methyl]-, (1R,2R)- | |
| 198404-98-7 | Cyclopropanemethanol, 1-methyl-2-[(1,2,2-trimethylbicyclo[3.1.0]hex-3-yl)methyl]- | |
| 94333-69-4 | Cymbopogon nardus, ext., reaction products with acetone | |
| 84238-19-7 | Cymbopogon, ext., oxidized | |
| 8013-86-3 | Cypress | E2.11 |
| 8013-86-3 | Cypress oil | E2.12 |
| 68916-59-6 | Cypress oil, terpene-free | E2.29 |
| 68916-60-9 | Cypriol oil | A2.12 |
| 68916-60-9 | Cypriol oil, rectified | A2.24 |
| 18472-51-0 | D-Gluconic acid, compd. with N1,N14-bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide (2:1) | |
| 69-79-4 | D-Glucose, 4-O-α-D-glucopyranosyl- | |
| 491-07-6 | d,l-Isomenthone | |
| 7705-14-8 | d,l-Limonene (isomer unspecified) | |
| 1490-04-6 | d,l-Menthol (isomer unspecified) | |
| 63187-91-7 | d,l-Menthone 1,2-glycerol ketal | |
| 59-51-8 | D,L-Methionine | |
| 7785-70-8 | d-.alpha.-Pinene | |
| 7785-53-7 | d-.alpha.-Terpineol | |
| 1195-92-2 | d-8-p-Menthene-1,2-epoxide | |
| 7785-54-8 | d-alpha-Terpineol acetate | |
| 8016-03-3 | Davana oil | E2.12 |
| 464-49-3 | d-Camphor | |
| 2244-16-8 | d-Carvone | |
| 25225-10-9 | d-Cyclocitronellene acetate | |
| 825-51-4 | Decahydro-beta-naphthol | |
| 10519-11-6 | Decahydro-beta-naphthyl acetate | |
| 10519-12-7 | Decahydro-beta-naphthyl formate | |
| 68480-11-5 | Decahydrospiro[furan-2(3H),5'-[4,7]methano[5H]indene] | |
| 541-02-6 | Decamethylcyclopentasiloxane | |
| 112-31-2 | Decanal | |
| 7779-41-1 | Decanal dimethyl acetal | |
| 124-18-5 | Decane | |
| 52829-07-9 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester | |
| 129757-67-1 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester, reaction products with tert-Bu hydroperoxide and octane | |
| 1975-78-6 | Decanenitrile | |
| 334-48-5 | Decanoic acid | |
| 65381-09-1 | Decanoic acid, ester with 1,2,3-propanetriol octanoate | |
| 68583-51-7 | Decanoic acid, mixed diesters with octanoic acid and propylene glycol | |
| 112-17-4 | Decyl acetate | |
| 68515-73-1 | Decyl glucoside | |
| 7289-52-3 | Decyl methyl ether | |
| 68606-82-6 | Deertongue leaf absolute | E2.1 |
| 68606-82-6 | Deertongue leaf extract | E2.13 |
| 68606-82-6 | Deertongue leaf incolore | E2.24 |
| 68606-82-6 | Deertongue leaf pyrogenated | E2.9.1 |
| 68606-82-6 | Deertongue leaf resinoid | E2.26 |
| 57378-68-4 | delta-1-(2,6,6-Trimethyl-3-cyclohexen-1-yl)-2-buten-1-one | |
| 13466-78-9 | delta-3-Carene | |
| 705-86-2 | delta-Decalactone | |
| 713-95-1 | delta-Dodecalactone | |
| 698-76-0 | delta-Octalactone | |
| 2721-22-4 | delta-Tetradecalactone | |
| 710-04-3 | delta-Undecalactone | |
| 9004-53-9 | Dextrin | |
| 18309-32-5 | dextro-Verbenone | |
| 4695-62-9 | d-Fenchone | |
| 50-99-7 | D-Glucose | |
| 103-23-1 | Di-(2-ethylhexyl) adipate | |
| 431-03-8 | Diacetyl | |
| 103-50-4 | Dibenzyl ether | |
| 72903-27-6 | Diethyl 1,4-cyclohexane dicarboxylate | |
| 925-47-3 | Diethyl 2,2'-thiodiacetate | |
| 141-28-6 | Diethyl hexanedioate | |
| 105-53-3 | Diethyl malonate | |
| 84-66-2 | Diethyl phthalate | |
| 110-40-7 | Diethyl sebacate | |
| 123-25-1 | Diethyl succinate | |
| 87-91-2 | Diethyl tartrate | |
| 25340-17-4 | Diethylbenzene | |
| 68845-36-3 | Diethyldimethylcyclohex-2-en-1-one | |
| 111-46-6 | Diethylene glycol | |
| 112-34-5 | Diethylene glycol monobutyl ether | |
| 111-90-0 | Diethylene glycol monoethyl ether | |
| 111-77-3 | Diethylene glycol monomethyl ether | |
| 97488-91-0 | Diglycerides, vegetable-oil monoglycerides and diglycerides | |
| 19139-31-2 | Dihexyl fumarate | |
| 32480-08-3 | Dihydro farnesal | |
| 13720-12-2 | Dihydro-.gamma.-ionone | |
| 33673-62-0 | Dihydro-4-methyl-5-pentylfuran-2(3H)-one | |
| 31499-72-6 | Dihydro-alpha-ionone | |
| 498-81-7 | Dihydro-alpha-terpineol | |
| 80-25-1 | Dihydro-alpha-terpinyl acetate | |
| 3293-47-8 | Dihydro-beta-ionol | |
| 17283-81-7 | Dihydro-beta-ionone | |
| 619-01-2 | Dihydrocarveol (isomer unspecified) | |
| 20777-49-5 | Dihydrocarvyl acetate | |
| 119-84-6 | Dihydrocoumarin | |
| 1209-61-6 | Dihydroisocaryophyllene epoxide | |
| 95-41-0 | Dihydroisojasmone | |
| 2436-90-0 | Dihydromyrcene | |
| 18479-58-8 | Dihydromyrcenol | |
| 53767-93-4 | Dihydromyrcenyl acetate | |
| 20489-53-6 | Dihydronootkatone | |
| 473-55-2 | Dihydropinene | |
| 58985-18-5 | Dihydroterpinyl acetate | |
| 141-04-8 | Diisobutyl adipate | |
| 27178-16-1 | Di-isodecyl adipate | |
| 6938-94-9 | Diisopropyl adipate | |
| 8006-75-5 | Dill seed oil | H2.12 |
| 8006-75-5 | Dill weed | E2.19 |
| 8006-75-5 | Dill weed oil | E2.12 |
| 627-93-0 | Dimethyl adipate | |
| 624-92-0 | Dimethyl disulfide | |
| 131-11-3 | Dimethyl phthalate | |
| 106-65-0 | Dimethyl succinate | |
| 75-18-3 | Dimethyl sulfide | |
| 68737-61-1 | Dimethylcyclohex-3-ene-1-carbaldehyde (isomer mixture) | |
| 27939-60-2 | Dimethylcyclohex-3-ene-1-carbaldehyde (isomer unspecified) | |
| 532-87-6 | Dimyrcene | |
| 101-84-8 | Diphenyl ether | |
| 101-81-5 | Diphenylmethane | |
| 629-19-6 | Dipropyl disulfide | |
| 110-98-5 | Dipropylene glycol | |
| 25265-71-8 | Dipropylene glycol (isomer unspecified) | |
| 34590-94-8 | Dipropylene glycol monomethyl ether | |
| 64742-14-9 | Distillates (petroleum), acid-treated light | |
| 64742-52-5 | Distillates, petroleum, hydrotreated heavy naphthenic | |
| 64742-47-8 | Distillates, petroleum, hydrotreated light | |
| 7681-57-4 | Disulfurous acid, disodium salt | |
| 21368-68-3 | dl-Camphor | |
| 106-22-9 | dl-Citronellol | |
| 5989-27-5 | d-Limonene | |
| 138-86-3 | dl-Limonene (racemic) | |
| 1074-95-9 | dl-Menthone | |
| 29066-34-0 | dl-Menthyl acetate | |
| 3623-51-6 | dl-Neomenthol | |
| 69-65-8 | D-Mannitol | |
| 15356-60-2 | d-Menthol | |
| 629-97-0 | Docosane | |
| 57345-19-4 | Dodecahydro-3,8,8,11a-tetramethyl-5H-3,5a-epoxynaphth[2,1-c]oxepin | |
| 14620-52-1 | Dodecanal dimethyl acetal | |
| 112-40-3 | Dodecane | |
| 2437-25-4 | Dodecanenitrile | |
| 142-18-7 | Dodecanoic acid, 2,3-dihydroxypropyl ester | |
| 85099-51-0 | Dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5.1.11.2) henicosan-20-yl)propionate | |
| 1643-20-5 | Dodecyldimethylamine oxide | |
| 6091-50-5 | d-Piperitone | |
| 89-82-7 | d-Pulegone | |
| 50-70-4 | d-Sorbitol | |
| 124071-40-5 | E- and Z-2(+3),12-Tridecadiennitrile | |
| 112-95-8 | Eicosane | |
| 68916-55-2 | Elder flower absolute | F2.1 |
| 8023-89-0 | Elemi absolute | K2.1 |
| 8023-89-0 | Elemi CO2 extract | K2.27 |
| 8023-89-0 | Elemi gum | K2.16 |
| 8023-89-0 | Elemi oil | K2.12 |
| 8023-89-0 | Elemi oil (low methyleugenol) | K2.33 |
| 8023-89-0 | Elemi oil, rectified | K2.24 |
| 8023-89-0 | Elemi resinoid | K2.26 |
| 639-99-6 | Elemol | |
| 28462-85-3 | endo-1,2,3,3-Tetramethylbicyclo[2.2.1]heptan-2-ol | |
| 1563063-07-9 | Erospicata oil, Mentha spicata 'Erospicata' | E2.12 |
| 140-67-0 | Estragole | |
| 144-62-7 | Ethanedioic acid | |
| 111850-00-1 | Ethaneperoxoic acid, reaction products with aluminum isopropoxide and 1,5,10-trimethyl-1,5,9-cyclododecatriene | |
| 143-22-6 | Ethanol, 2-[2-(2-butoxyethoxy)ethoxy]- | |
| 72987-59-8 | Ethanol, 2-(4-methylphenoxy)-1-(2-phenylethoxy)- | |
| 105-59-9 | Ethanol, 2,2'-(methylimino)bis- | |
| 141-43-5 | Ethanol, 2-amino- | |
| 93963-23-6 | Ethanone, 1-(1,2,3,4,5,6,7,8-octahydro-3,8,8-trimethyl-2-naphthalenyl)- | |
| 854737-10-3 | Ethanone, 1-(2,3-dimethylbicyclo[2.2.1]hept-2-yl)- | |
| 32669-00-4 | Ethanone, 1-(3-cycloocten-1-yl)- | |
| 70801-04-6 | Ethanone, 1-(4,11,11,-trimethyl-8-methylenebicyclo[7.2.0]undec-4-enyl)-[1R-(1a,4E,9b] | |
| 185429-83-8 | Ethanone, 1-[(1R,2S)-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethyl-2-naphthalenyl]-, rel- | |
| 61791-12-6 | Ethoxylated castor oil | |
| 80657-64-3 | Ethyl (3a.alpha.,4.alpha.,7.alpha.,7a.alpha.)-Octahydro-4,7-methano-3aH-indene-3a-carboxylate | |
| 80623-07-0 | Ethyl (3a.alpha.,4.beta.,7.beta.,7a.alpha.)-Octahydro-4,7-methano-3aH-indene-3a-carboxylate | |
| 26553-46-8 | Ethyl (E)hex-3-enoate | |
| 687-47-8 | Ethyl (L)-lactate | |
| 67028-40-4 | Ethyl (p-tolyloxy)acetate | |
| 692-86-4 | Ethyl 10-undecenoate | |
| 77851-07-1 | Ethyl 2,3,6,6-tetramethylcyclohex-2-ene-1-carboxylate | |
| 93981-50-1 | Ethyl 2,3,6-trimethylcyclohexyl carbonate | |
| 78417-28-4 | Ethyl 2,4,7-decatrienoate | |
| 6290-17-1 | Ethyl 2,4-dimethyldioxolane-2-acetate | |
| 35044-59-8 | Ethyl 2,6,6-trimethylcyclohexa-1,3-ene-1-carboxylate | |
| 68228-09-1 | Ethyl 2-[[[2,4(or3,5)-dimethyl-3-cyclohexen-1-yl]methyl]amino]benzoate | |
| 94333-50-3 | Ethyl 2-ethyl-3,6,6-trimethylcyclohexenecarboxylate | |
| 57934-97-1 | Ethyl 2-ethyl-6,6-dimethylcyclohex-2-ene-1-carboxylate | |
| 2983-37-1 | Ethyl 2-ethylhexanoate | |
| 29214-60-6 | Ethyl 2-hexylacetoacetate | |
| 19788-49-9 | Ethyl 2-mercaptopropionate | |
| 7335-26-4 | Ethyl 2-methoxybenzoate | |
| 64988-06-3 | Ethyl 2-methoxybenzyl ether | |
| 6413-10-1 | Ethyl 2-methyl-1,3-dioxolane-2-acetate | |
| 60523-21-9 | Ethyl 2-methyl-3,4-pentadienoate | |
| 1617-23-8 | Ethyl 2-methyl-3-pentenoate | |
| 59151-19-8 | Ethyl 2-methyl-4-oxo-6-pentylcyclohex-2-ene-1-carboxylate | |
| 53399-81-8 | Ethyl 2-methyl-4-pentenoate | |
| 7452-79-1 | Ethyl 2-methylbutyrate | |
| 39255-32-8 | Ethyl 2-methylpentanoate | |
| 67801-64-3 | Ethyl 2-tert-butylcyclohexyl carbonate | |
| 10031-90-0 | Ethyl 3(2-furyl)propanoate | |
| 67707-75-9 | Ethyl 3,5,5-trimethylhexanoate | |
| 13058-12-3 | Ethyl 3,7-dimethylocta-2,6-dienoate | |
| 2396-83-0 | Ethyl 3-hexenoate | |
| 5764-85-2 | Ethyl 3-hydroxy-3-phenylpropionate | |
| 5405-41-4 | Ethyl 3-hydroxybutyrate | |
| 2305-25-1 | Ethyl 3-hydroxyhexanoate | |
| 26516-27-8 | Ethyl 3-methyl-2-oxopentanoate | |
| 13327-56-5 | Ethyl 3-methylthiopropionate | |
| 121-39-1 | Ethyl 3-phenylglycidate | |
| 2021-28-5 | Ethyl 3-phenylpropionate | |
| 1968-40-7 | Ethyl 4-pentenoate | |
| 141-78-6 | Ethyl acetate | |
| 141-97-9 | Ethyl acetoacetate | |
| 64-17-5 | Ethyl alcohol | |
| 87-25-2 | Ethyl anthranilate | |
| 93-89-0 | Ethyl benzoate | |
| 94-02-0 | Ethyl benzoylacetate | |
| 105-54-4 | Ethyl butyrate | |
| 103-36-6 | Ethyl cinnamate | |
| 34495-71-1 | Ethyl cis-4-octenoate | |
| 3289-28-9 | Ethyl cyclohexanecarboxylate | |
| 110-38-3 | Ethyl decanoate | |
| 109-94-4 | Ethyl formate | |
| 32659-21-5 | Ethyl geranate | |
| 106-30-9 | Ethyl heptanoate | |
| 123-66-0 | Ethyl hexanoate | |
| 118-60-5 | Ethyl hexyl salicylate | |
| 97-62-1 | Ethyl isobutyrate | |
| 108-64-5 | Ethyl isovalerate | |
| 97-64-3 | Ethyl lactate | |
| 106-33-2 | Ethyl laurate | |
| 539-88-8 | Ethyl levulinate | |
| 544-35-4 | Ethyl linoleate | |
| 1191-41-9 | Ethyl linolenate | |
| 4940-11-8 | Ethyl maltol | |
| 97-63-2 | Ethyl methacrylate | |
| 77-83-8 | Ethyl methylphenylglycidate | |
| 124-06-1 | Ethyl myristate | |
| 2173997-41-4 | Ethyl N,S-bis(4-oxo-4-(2,6,6-trimethylcyclohex-3-en-1-yl)butan-2-yl)cysteinate | |
| 123-29-5 | Ethyl nonanoate | |
| 2351-90-8 | Ethyl oct-2-enoate | |
| 111-61-5 | Ethyl octadecanoate | |
| 106-32-1 | Ethyl octanoate | |
| 111-62-6 | Ethyl oleate | |
| 628-97-7 | Ethyl palmitate | |
| 94-30-4 | Ethyl p-anisate | |
| 1817-90-9 | Ethyl phenethyl ether | |
| 2555-49-9 | Ethyl phenoxyacetate | |
| 101-97-3 | Ethyl phenylacetate | |
| 105-37-3 | Ethyl propionate | |
| 22719-81-9 | Ethyl p-tolyl carbonate | |
| 617-35-6 | Ethyl pyruvate | |
| 55066-53-0 | Ethyl ricinoleate | |
| 35044-57-6 | Ethyl safranate | |
| 118-61-6 | Ethyl salicylate | |
| 2396-84-1 | Ethyl sorbate | |
| 5837-78-5 | Ethyl tiglate | |
| 3025-30-7 | Ethyl trans-2,cis-4-decadienoate | |
| 10544-63-5 | Ethyl trans-2-butenoate | |
| 623-70-1 | Ethyl trans-2-butenoate | |
| 7367-88-6 | Ethyl trans-2-decenoate | |
| 27829-72-7 | Ethyl trans-2-hexenoate | |
| 76649-16-6 | Ethyl trans-4-decenoate | |
| 539-82-2 | Ethyl valerate | |
| 121-32-4 | Ethyl vanillin | |
| 188417-26-7 | Ethyl vanillin isobutyrate | |
| 68527-76-4 | Ethyl vanillin propylene glycol acetal | |
| 24937-78-8 | Ethyl vinyl acetate copolymer | |
| 67952-68-5 | Ethyl-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol | |
| 9004-57-3 | Ethylcellulose | |
| 105-95-3 | Ethylene brassylate | |
| 54982-83-1 | Ethylene dodecanedioate | |
| 107-21-1 | Ethylene glycol | |
| 111-76-2 | Ethylene glycol monobutyl ether | |
| 6381-92-6 | Ethylenediaminetetraacetic acid disodium salt | |
| 470-82-6 | Eucalyptol | |
| 8000-48-4 | Eucalyptus absolute | E2.1 |
| 85203-56-1 | Eucalyptus citriodora oil | E2.12 |
| 68991-29-7 | Eucalyptus citriodora oil, acetylated | |
| 8000-48-4 | Eucalyptus dives extract | E2.13 |
| 8000-48-4 | Eucalyptus dives oil | E2.12 |
| 8000-48-4 | Eucalyptus dives oil, rectified | E2.24 |
| 97926-40-4 | Eucalyptus globulus absolute | E2.1 |
| 97926-40-4 | Eucalyptus globulus oil | E2.12 |
| 97926-40-4 | Eucalyptus globulus oil, rectified | E2.24 |
| 8000-48-4 | Eucalyptus oil | E2.12 |
| 8000-48-4 | Eucalyptus oil, rectified | E2.24 |
| 92201-64-4 | Eucalyptus radiata oil | E2.12 |
| 68917-30-6 | Eucalyptus terpenes | E2.30 |
| 97-53-0 | Eugenol | |
| 93-28-7 | Eugenyl acetate | |
| 93-15-2 | Eugenyl methyl ether | |
| 10402-33-2 | Eugenyl phenylacetate | |
| 906655-61-6 | Euterpe precatoria extract | H2.13 |
| 1137739-11-7 | Evodia rutaecarpa oil | A2.12 |
| 7070-15-7 | exo-2-[(1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl)oxy]ethanol | |
| 19317-11-4 | Farnesal | |
| 4602-84-0 | Farnesol | |
| 29548-30-9 | Farnesyl acetate | |
| 8024-32-6 | Fats and glyceridic oils, avocado | |
| 68956-68-3 | Fats and Glyceridic oils, vegetable | |
| 72869-74-0 | Fats and glyceridic oils, vegetable-oil, glyceride and tocopherol fraction | |
| 85536-25-0 | Fatty acids, butter | |
| 71990-22-2 | Fatty acids, butter, Et esters | |
| 67762-38-3 | Fatty acids, C16-18 and C18-unsatd., Me esters | |
| 63393-93-1 | Fatty acids, lanolin, iso-Pr esters | |
| 68424-45-3 | Fatty acids, linseed-oil | |
| 1195-79-5 | Fenchone | |
| 1632-73-1 | Fenchyl alcohol | |
| 8006-84-6 | Fennel bitter oleoresin | H2.21 |
| 8006-84-6 | Fennel oil, bitter | H2.12 |
| 8006-84-6 | Fennel oil, sweet | H2.12 |
| 8006-84-6 | Fennel sweet oleoresin | H2.21 |
| 68990-15-8 | Fenugreek absolute | H2.1 |
| 68990-15-8 | Fenugreek extract | H2.13 |
| 68990-15-8 | Fenugreek oleoresin | H2.21 |
| 68990-15-8 | Fenugreek tincture | H2.31 |
| 90028-74-3 | Fig Extract | G2.13 |
| 8021-28-1 | Fir absolute | E2.1 |
| 8024-15-5 | Fir balsam absolute | K2.1 |
| 8024-15-5 | Fir balsam extract | K2.13 |
| 8024-15-5 | Fir balsam oleoresin | K2.16 |
| 8024-15-5 | Fir balsam resinoid | K2.26 |
| 8021-28-1 | Fir balsam resinoid from needles | E2.26 |
| 8024-15-5 | Fir needle oil, Canadian | E2.12 |
| 8021-28-1 | Fir needle oil, Chinese | E2.12 |
| 8021-29-2 | Fir needle oil, Siberian | E2.12 |
| 8021-29-2 | Fir needle oil, Siberian, rectified | E2.24 |
| 8021-28-1 | Fir, Abies balsamea, absolute from needles | E2.1 |
| 68916-09-6 | Flouve absolute | E2.1 |
| 68916-09-6 | Flouve oil | E2.12 |
| 58567-11-6 | Formaldehyde cyclododecyl ethyl acetal | |
| 64-18-6 | Formic acid | |
| 68855-38-9 | Formic acid, reaction products with boron trifluoride and [1S-(1.alpha.,3a.beta.,4.alpha.,8a.beta.)]-decahydro- | |
| 94350-02-4 | Frangipani absolute | F2.1 |
| 68917-51-1 | Fucus vesiculosus absolute | I2.1 |
| 68917-51-1 | Fucus vesiculosus resinoid | I2.26 |
| 1497420-94-6 | Furan, 5-(hexyloxy)tetrahydro-2,2-dimethyl- | |
| 99343-90-5 | Furan, tetrahydro-2,4-dimethyl-4-phenyl-, (2R,4R)-rel- | |
| 98-01-1 | Furfural | |
| 623-17-6 | Furfuryl acetate | |
| 98-02-2 | Furfuryl mercaptan | |
| 1438-91-1 | Furfuryl methyl sulfide | |
| 13678-68-7 | Furfuryl thioacetate | |
| 8013-75-0 | Fusel oil, refined | M2.24 |
| 8024-40-6 | Galangal root oil | A2.12 |
| 8024-40-6 | Galangal root oleoresin | A2.21 |
| 8023-91-4 | Galbanum absolute | K2.1 |
| 8023-91-4 | Galbanum CO2 extract | K2.27 |
| 8023-91-4 | Galbanum gum | K2.15 |
| 8023-91-4 | Galbanum oil | K2.12 |
| 8023-91-4 | Galbanum oil, rectified | K2.24 |
| 8023-91-4 | Galbanum oil, terpeneless | K2.29 |
| 8023-91-4 | Galbanum resin | K2.13 |
| 8023-91-4 | Galbanum resinoid | K2.26 |
| 854737-08-9 | gamma Undecenolactone - 2(3H), 5-(6-heptenyl)dihydro- | |
| 706-14-9 | gamma-Decalactone | |
| 2305-05-7 | gamma-Dodecalactone | |
| 105-21-5 | gamma-Heptalactone | |
| 695-06-7 | gamma-Hexalactone | |
| 79-76-5 | gamma-Ionone | |
| 7011-83-8 | gamma-Methyldecalactone | |
| 104-61-0 | gamma-Nonalactone | |
| 104-50-7 | gamma-Octalactone | |
| 104-67-6 | gamma-Undecalactone | |
| 108-29-2 | gamma-Valerolactone | |
| 68916-47-2 | Gardenia fruit extract | G2.13 |
| 683748-01-8 | Gardenia tahitensis absolute | F2.1 |
| 683748-01-8 | Gardenia tahitensis oil | F2.13 |
| 8000-78-0 | Garlic oil | A2.12 |
| 9000-70-8 | Gelatine | |
| 129316-65-0 | Genet absolute | E2.1 |
| 129316-65-0 | Genet absolute | F2.1 |
| 97676-22-7 | Gentian absolute | F2.1 |
| 97676-22-7 | Gentian absolute | A2.1 |
| 97676-22-7 | Gentian infusion | A2.31 |
| 97676-22-7 | Gentian root extract | A2.13 |
| 141-27-5 | Geranial | |
| 459-80-3 | Geranic acid | |
| 106-24-1 | Geraniol | |
| 8000-46-2 | Geranium absolute | E2.1 |
| 8000-46-2 | Geranium aromatic water | E2.3 |
| 8000-46-2 | Geranium concrete | E2.7 |
| 8000-46-2 | Geranium oil | E2.12 |
| 68917-31-7 | Geranium oil terpenes | E2.30 |
| 8000-46-2 | Geranium oil, African | E2.12 |
| 68916-42-7 | Geranium oil, bourbon, distn. residues | E2.8 |
| 8000-46-2 | Geranium oil, fractions rich in citronellol | E2.51 |
| 8000-46-2 | Geranium oil, rectified | E2.24 |
| 68916-43-8 | Geranium oil, saponified | |
| 68916-44-9 | Geranium oil, terpeneless | E2.29 |
| 105-87-3 | Geranyl acetate | |
| 94-48-4 | Geranyl benzoate | |
| 106-29-6 | Geranyl butyrate | |
| 56172-46-4 | Geranyl crotonate | |
| 40267-72-9 | Geranyl ethyl ether | |
| 105-86-2 | Geranyl formate | |
| 10032-02-7 | Geranyl hexanoate | |
| 2345-26-8 | Geranyl isobutyrate | |
| 109-20-6 | Geranyl isovalerate | |
| 1113-21-9 | Geranyl linalool | |
| 2565-82-4 | Geranyl methyl ether | |
| 102-22-7 | Geranyl phenylacetate | |
| 105-90-8 | Geranyl propionate | |
| 7785-33-3 | Geranyl tiglate | |
| 23986-74-5 | Germacrene D | |
| 8007-08-7 | Ginger | A2.11 |
| 8007-08-7 | Ginger absolute | A2.1 |
| 8007-08-7 | Ginger CO2 extract | A2.27 |
| 8007-08-7 | Ginger extract | A2.13 |
| 8007-08-7 | Ginger oil | A2.12 |
| 8007-08-7 | Ginger oil, rectified | A2.24 |
| 8007-08-7 | Ginger oleoresin | A2.21 |
| 8023-92-5 | Gingergrass oil | E2.12 |
| 67701-33-1 | Glycerides, C14-18 mono- and di- | |
| 68990-53-4 | Glycerides, C14-22 mono- | |
| 91744-56-8 | Glycerides, mixed C8-10 and succinyl | |
| 73398-61-5 | Glycerides, mixed decanoyl and octanoyl | |
| 68553-03-7 | Glycerids, coco Mono-, ethoxylated | |
| 56-81-5 | Glycerol | |
| 8050-31-5 | Glycerol ester of rosin | |
| 111-03-5 | Glyceryl monooleate | |
| 39668-74-1 | Glycine, N-[[5-methyl-2-(1-methylethyl)cyclohexyl]carbonyl]-, ethyl ester | |
| 64-02-8 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetrasodium salt | |
| 154248-98-3 | Glycols, 1,2-, C12-16, ethoxylated propoxylated | |
| 53956-04-0 | Glycyrrhizin, ammoniated (Glycyrrhiza spp.) | |
| 90320-21-1 | Grains of paradise extract | H2.13 |
| 8016-20-4 | Grapefruit essence oil | G2.10 |
| 8016-20-4 | Grapefruit flower oil | F2.12 |
| 8016-20-4 | Grapefruit oil | G2.55 |
| 8016-20-4 | Grapefruit oil | G2.12 |
| 8016-20-4 | Grapefruit oil | G2.5 |
| 8016-20-4 | Grapefruit oil (low furocoumarins) | G2.33 |
| 68917-32-8 | Grapefruit oil terpenes | G2.30 |
| 68916-46-1 | Grapefruit oil, folded | G2.6 |
| 8016-20-4 | Grapefruit oil, rectified | G2.24 |
| 68916-46-1 | Grapefruit oil, terpeneless | G2.29 |
| 8016-23-7 | Guaiac wood oil | D2.12 |
| 90244-88-5 | Guaiac wood oil saponified | D2.23 |
| 8016-23-7 | Guaiac wood oil, rectified | D2.24 |
| 90-05-1 | Guaiacol | |
| 61789-17-1 | Guaiacwood acetate | |
| 4112-89-4 | Guaiacyl phenylacetate | |
| 134-28-1 | Guaiyl acetate | |
| 65497-29-2 | Guar gum, 2-hydroxy-3-(trimethylammonio)propyl ether, chloride | |
| 869736-31-2 | Guava extract | G2.13 |
| 8030-55-5 | Gurjun balsam extract | K2.13 |
| 8030-55-5 | Gurjun balsam oil | K2.12 |
| 8030-55-5 | Gurjun balsam oil | K2.9 |
| 8030-55-5 | Gurjun balsam oil, rectified | K2.24 |
| 8030-55-5 | Gurjun balsam oleoresin | K2.16 |
| 8031-00-3 | Hay absolute | E2.1 |
| 8031-00-3 | Hay oil | E2.12 |
| 1902936-65-5 | Hedychium absolute | F2.1 |
| 8023-95-8 | Helichrysum absolute | F2.1 |
| 8023-95-8 | Helichrysum absolute | E2.1 |
| 8023-95-8 | Helichrysum oil | F2.12 |
| 8023-95-8 | Helichrysum oil | E2.12 |
| 8023-95-8 | Helichrysum oil, pyrogenated | E2.9.1 |
| 792933-14-3 | Heliopsis longipes CO2 extract | A2.27 |
| 792933-14-3 | Heliopsis longipes extract | A2.13 |
| 89958-21-4 | Hemp oil | E2.12 |
| 629-94-7 | Heneicosane | |
| 629-78-7 | Heptadecane | |
| 111-71-7 | Heptanal | |
| 10032-05-0 | Heptanal dimethyl acetal | |
| 62439-42-3 | Heptanal, 6-hydroxy-2,6-dimethyl- | |
| 111-14-8 | Heptanoic acid | |
| 66009-41-4 | Heptanoic acid, octadecyl ester | |
| 112-06-1 | Heptyl acetate | |
| 111-70-6 | Heptyl alcohol | |
| 1627851-18-6 | Heptyl D-glucoside | |
| 56438-09-6 | Heptylidene diacetate | |
| 1708-82-3 | Hex-3-enyl acetate | |
| 7370-44-7 | Hexadeca-1,5-lactone | |
| 544-76-3 | Hexadecane | |
| 109-29-5 | Hexadecanolide | |
| 540-10-3 | Hexadecyl palmitate | |
| 6051-03-2 | Hexahydro-3H-benzofuran-2-one | |
| 66-25-1 | Hexanal | |
| 1429808-42-3 | Hexanal, 6-(2,4,4-trimethylcyclopentylidene)-, (6E)- | |
| 123-79-5 | Hexanedioic acid, dioctyl ester | |
| 64091-34-5 | Hexanedioic acid, polymer with oxybis[propanol] | |
| 628-73-9 | Hexanenitrile | |
| 142-62-1 | Hexanoic acid | |
| 816-19-3 | Hexanoic acid, 2-ethyl-, methyl ester | |
| 1561-11-1 | Hexanoic acid, 4-methyl- | |
| 104986-28-9 | Hexanoic acid, 6-(acetyloxy)-, ethyl ester | |
| 6728-26-3 | Hexen-2-al | |
| 34687-46-2 | Hexenylcyclopentanone | |
| 20279-51-0 | Hexyl 2-hydroxypropionate | |
| 10032-15-2 | Hexyl 2-methylbutyrate | |
| 142-92-7 | Hexyl acetate | |
| 111-27-3 | Hexyl alcohol | |
| 6789-88-4 | Hexyl benzoate | |
| 2639-63-6 | Hexyl butyrate | |
| 629-33-4 | Hexyl formate | |
| 6378-65-0 | Hexyl hexanoate | |
| 2349-07-7 | Hexyl isobutyrate | |
| 10032-13-0 | Hexyl isovalerate | |
| 142-09-6 | Hexyl methacrylate | |
| 1117-55-1 | Hexyl octanoate | |
| 5421-17-0 | Hexyl phenylacetate | |
| 2445-76-3 | Hexyl propionate | |
| 6259-76-3 | Hexyl salicylate | |
| 16930-96-4 | Hexyl tiglate | |
| 68917-43-1 | Hibawood oil | D2.12 |
| 92128-62-6 | Hierochloe alpina absolute | E2.1 |
| 91745-97-0 | Hinoki leaf oil | E2.12 |
| 91745-97-0 | Hinoki root oil | A2.12 |
| 91745-97-0 | Hinoki wood oil | D2.12 |
| 8022-91-1 | Ho bark oil | C2.12 |
| 8022-91-1 | Ho leaf oil | E2.12 |
| 8022-91-1 | Ho wood | D2.11 |
| 8022-91-1 | Ho wood oil | D2.12 |
| 8022-91-1 | Ho wood oil, rectified | D2.24 |
| 118-56-9 | Homomenthyl salicylate | |
| 223749-79-9 | Honeysuckle extract | F2.13 |
| 8007-04-3 | Hop extract | G2.31 |
| 8007-04-3 | Hop oil | F2.12 |
| 8007-04-3 | Hop oil, rectified | G2.24 |
| 68956-56-9 | Hydrocarbons, terpene processing by-products | |
| 107-75-5 | Hydroxycitronellal | |
| 7779-94-4 | Hydroxycitronellal diethyl acetal | |
| 141-92-4 | Hydroxycitronellal dimethyl acetal | |
| 68908-82-7 | Hydroxycitronellal, indole condensation products | |
| 68527-79-7 | Hydroxycitronellal-Indole (Schiff base) | |
| 89-43-0 | Hydroxycitronellal-methyl anthranilate (Schiff base) | |
| 107-74-4 | Hydroxycitronellol | |
| 3301-94-8 | Hydroxynonanoic acid, delta-lactone | |
| 8006-83-5 | Hyssop oil | E2.12 |
| 647828-16-8 | Indeno[4,3a-b]furan,decahydro-2,2,7,7,8,9,9-heptamethyl- | |
| 365411-50-3 | Indeno[4,5-d]-1,3-dioxin,4,4a,5,6,7,8,9,9b-octahydro-7,7,8,9,9-pentamethyl- | |
| 120-72-9 | Indole | |
| 8013-90-9 | Ionone (mixed isomers) | |
| 8002-73-1 | Iris butter | A2.23 |
| 1048028-77-8 | Iris germanica absolute | A2.1 |
| 1048028-77-8 | Iris germanica butter | A2.23 |
| 1048028-77-8 | Iris germanica CO2 extract | A2.27 |
| 1048028-77-8 | Iris germanica concrete | A2.7 |
| 1048028-77-8 | Iris germanica extract | A2.13 |
| 8023-76-5 | Iris germanica oil | A2.12 |
| 1048028-77-8 | Iris germanica resinoid | A2.26 |
| 8002-73-1 | Iris pallida absolute | A2.1 |
| 8002-73-1 | Iris pallida concrete | A2.7 |
| 8002-73-1 | Iris pallida oil | A2.12 |
| 8002-73-1 | Iris pallida oil, rectified | A2.24 |
| 8002-73-1 | Iris pallida resinoid | A2.26 |
| 8002-73-1 | Iris pallida tincture | A2.31 |
| 9000-07-1 | Irish moss extract | I2.13 |
| 68551-16-6 | Isoalkanes, C9-11 | |
| 123-92-2 | Isoamyl acetate | |
| 123-51-3 | Isoamyl alcohol | |
| 94-46-2 | Isoamyl benzoate | |
| 106-27-4 | Isoamyl butyrate | |
| 7779-65-9 | Isoamyl cinnamate | |
| 110-45-2 | Isoamyl formate | |
| 2198-61-0 | Isoamyl hexanoate | |
| 659-70-1 | Isoamyl isovalerate | |
| 6309-51-9 | Isoamyl laurate | |
| 2035-99-6 | Isoamyl octanoate | |
| 102-19-2 | Isoamyl phenylacetate | |
| 105-68-0 | Isoamyl propionate | |
| 87-20-7 | Isoamyl salicylate | |
| 124-76-5 | Isoborneol | |
| 85586-67-0 | Isobornyl 2-methylpropionate | |
| 125-12-2 | Isobornyl acetate | |
| 7779-73-9 | Isobornyl isovalerate | |
| 5331-32-8 | Isobornyl methyl ether | |
| 2756-56-1 | Isobornyl propionate | |
| 589-66-2 | Isobutyl 2-butenoate | |
| 61692-84-0 | Isobutyl 2-methylcrotonate | |
| 105-01-1 | Isobutyl 3-(2-furan)propionate | |
| 110-19-0 | Isobutyl acetate | |
| 78-83-1 | Isobutyl alcohol | |
| 7779-81-9 | Isobutyl angelate | |
| 120-50-3 | Isobutyl benzoate | |
| 539-90-2 | Isobutyl butyrate | |
| 122-67-8 | Isobutyl cinnamate | |
| 542-55-2 | Isobutyl formate | |
| 105-79-3 | Isobutyl hexanoate | |
| 97-85-8 | Isobutyl isobutyrate | |
| 65505-24-0 | Isobutyl N-methylanthranilate | |
| 102-13-6 | Isobutyl phenylacetate | |
| 540-42-1 | Isobutyl propionate | |
| 87-19-4 | Isobutyl salicylate | |
| 78-84-2 | Isobutyraldehyde | |
| 79-31-2 | Isobutyric acid | |
| 66068-84-6 | Isocamphenyl cyclohexanol, mixed isomers | |
| 13794-73-5 | Isocedranone | |
| 1335-66-6 | Isocyclocitral | |
| 69103-24-8 | Isodecyl acetate | |
| 25339-17-7 | Isodecyl alcohol | |
| 31807-55-3 | Isododecane | |
| 97-54-1 | Isoeugenol | |
| 4194-00-7 | Isoeugenol benzoate | |
| 93-29-8 | Isoeugenyl acetate | |
| 120-11-6 | Isoeugenyl benzyl ether | |
| 7784-67-0 | Isoeugenyl ethyl ether | |
| 93-16-3 | Isoeugenyl methyl ether | |
| 120-24-1 | Isoeugenyl phenylacetate | |
| 37677-14-8 | Isohexenyl cyclohexenyl carboxaldehyde | |
| 11050-62-7 | Isojasmone | |
| 14727-47-0 | Isolongifolanone | |
| 1135-66-6 | Isolongifolene | |
| 23787-90-8 | Isolongifolene ketone | |
| 26619-69-2 | Isolongifolene oxide | |
| 79-89-0 | iso-Methyl-beta-ionone | |
| 84501-72-4 | Isononanoic acid, sodium salt | |
| 40379-24-6 | Isononyl acetate (isomer unspecified) | |
| 65155-45-5 | Isononyl propionate | |
| 27458-93-1 | Isooctadecan-1-ol | |
| 41519-18-0 | Isopentyl 2-methylcrotonate (E) | |
| 107-85-7 | Isopentylamine | |
| 470-99-5 | Isophorol | |
| 505-32-8 | Isophytol | |
| 58425-36-8 | Isophytyl acetate | |
| 79915-74-5 | Isopropoxy ethyl salicylate | |
| 66576-71-4 | Isopropyl 2-methylbutyrate | |
| 108-21-4 | Isopropyl acetate | |
| 67-63-0 | Isopropyl alcohol | |
| 638-11-9 | Isopropyl butyrate | |
| 7780-06-5 | Isopropyl cinnamate | |
| 2311-46-8 | Isopropyl hexanoate | |
| 110-27-0 | Isopropyl myristate | |
| 142-91-6 | Isopropyl palmitate | |
| 125109-85-5 | Isopropylphenylbutanal | |
| 1333-53-5 | Isopropylquinoline | |
| 89-79-2 | Isopulegol | |
| 57576-09-7 | Isopulegyl acetate | |
| 27458-92-0 | Isotridecan-1-ol | |
| 69103-23-7 | Isotridecyl acetate | |
| 503-74-2 | Isovaleric acid | |
| 90131-24-1 | Jambu absolute | F2.1 |
| 90131-24-1 | Jambu oleoresin | F2.21 |
| 8022-96-6 | Jasmine absolute | F2.1 |
| 8022-96-6 | Jasmine aromatic water | F2.3 |
| 8022-96-6 | Jasmine CO2 extract | F2.27 |
| 8022-96-6 | Jasmine concrete | F2.7 |
| 8022-96-6 | Jasmine concrete (waxes twice extracted) | F2.7 |
| 8022-96-6 | Jasmine extract | F2.13 |
| 8022-96-6 | Jasmine oil | F2.24 |
| 1034798-23-6 | Jasmine sambac absolute | F2.1 |
| 1034798-23-6 | Jasmine sambac CO2 extract | F2.27 |
| 1034798-23-6 | Jasmine sambac concrete | F2.7 |
| 1034798-23-6 | Jasmine sambac extract | F2.13 |
| 1034798-23-6 | Jasmine sambac oil | F2.24 |
| 1034798-23-6 | Jasmine sambac tincture | F2.31 |
| 8022-96-6 | Jasmine spiritus | F2.31 |
| 61789-91-1 | Jojoba oil | H2.50 |
| 8002-68-4 | Juniper berry absolute | G2.1 |
| 8002-68-4 | Juniper berry alcoholate | G2.2 |
| 8002-68-4 | Juniper berry CO2 extract | G2.27 |
| 8002-68-4 | Juniper berry extract | G2.13 |
| 8002-68-4 | Juniper berry oil | G2.12 |
| 8002-68-4 | Juniper berry oil terpeneless | G2.29 |
| 8002-68-4 | Juniper berry oil, rectified | G2.24 |
| 100209-33-4 | Juniper, Juniperus virginiana, ext., epoxidized | |
| 936843-30-0 | Kaempferia galanga root CO2 extract | A2.27 |
| 92128-82-0 | Kelp extract | I2.13 |
| 7785-26-4 | l-.alpha.-Pinene | |
| 495-61-4 | l-.beta.-Bisabolene | |
| 18172-67-3 | l-.beta.-Pinene | |
| 8016-26-0 | Labdanum absolute | E2.1 |
| 8016-26-0 | Labdanum absolute, pyrogenated | E2.9.1 |
| 8016-26-0 | Labdanum concrete | E2.7 |
| 8016-26-0 | Labdanum distillate | E2.8 |
| 8016-26-0 | Labdanum extract | E2.13 |
| 68917-77-1 | Labdanum extract ambreine | E2.1.1 |
| 8016-26-0 | Labdanum gum | E2.16 |
| 8016-26-0 | Labdanum oil | E2.12 |
| 8016-26-0 | Labdanum oleoresin | E2.21 |
| 8016-26-0 | Labdanum resinoid | E2.26 |
| 73138-66-6 | Labdanum, ext., Et esters | |
| 50-21-5 | Lactic acid | |
| 21280-29-5 | Lactoscatone | |
| 5655-61-8 | laevo-Bornyl acetate | |
| 2102-59-2 | laevo-Carveol | |
| 1205-42-1 | laevo-Carvyl acetate | |
| 1207666-16-7 | Laminaria digita algae absolute | I2.1 |
| 90046-17-6 | Lantana camara oil | E2.12 |
| 8007-48-5 | Laurel leaf absolute | E2.1 |
| 8007-48-5 | Laurel leaf oil | E2.12 |
| 8007-48-5 | Laurel leaf oil low methyleugenol | E2.24 |
| 143-07-7 | Lauric acid | |
| 112-54-9 | Lauric aldehyde | |
| 112-66-3 | Lauryl acetate | |
| 112-53-8 | Lauryl alcohol | |
| 142-90-5 | Lauryl methacrylate | |
| 8022-15-9 | Lavandin abrailis absolute | F2.1 |
| 8022-15-9 | Lavandin abrailis oil (low coumarin) | F2.33 |
| 8022-15-9 | Lavandin abrailis oil rectified | F2.24 |
| 8022-15-9 | Lavandin abrialis | F2.11 |
| 8022-15-9 | Lavandin abrialis oil | F2.12 |
| 8022-15-9 | Lavandin absolute | F2.1 |
| 8022-15-9 | Lavandin concrete | F2.7 |
| 8022-15-9 | Lavandin extract | F2.13 |
| 8022-15-9 | Lavandin grosso | F2.11 |
| 8022-15-9 | Lavandin grosso absolute | F2.1 |
| 8022-15-9 | Lavandin grosso CO2 extract | F2.27 |
| 8022-15-9 | Lavandin grosso oil | F2.12 |
| 8022-15-9 | Lavandin oil | F2.12 |
| 8022-15-9 | Lavandin oil (super low coumarins) | F2.33 |
| 68916-93-8 | Lavandin oil acetylated | |
| 25905-14-0 | Lavandulyl acetate | |
| 8000-28-0 | Lavender | F2.19 |
| 8000-28-0 | Lavender absolute | F2.1 |
| 8000-28-0 | Lavender CO2 extract | F2.27 |
| 8000-28-0 | Lavender concrete | F2.7 |
| 8000-28-0 | Lavender extract | F2.13 |
| 93165-50-5 | Lavender oil | F2.12 |
| 8000-28-0 | Lavender oil | F2.12 |
| 8000-28-0 | Lavender oil (low coumarin) | F2.33 |
| 8000-28-0 | Lavender oil terpeneless | F2.29 |
| 8000-28-0 | Lavender oil, rectified | F2.24 |
| 464-45-9 | l-Borneol | |
| 6485-40-1 | L-Carvone | |
| 7540-51-4 | l-Citronellol | |
| 25225-08-5 | l-Cyclocitronellene formate | |
| 8002-43-5 | Lecithins | |
| 84650-15-7 | Leek oil | E2.12 |
| 8008-56-8 | Lemon (steam distilled) oil | G2.12 |
| 8008-56-8 | Lemon essence oil | G2.10 |
| 8008-56-8 | Lemon oil folded (10x) | G2.6 |
| 8008-56-8 | Lemon oil folded (5X) | G2.6 |
| 68917-33-9 | Lemon oil terpenes | G2.30 |
| 8008-56-8 | Lemon oil, distilled | G2.24 |
| 8008-56-8 | Lemon oil, expressed | G2.5 |
| 68916-89-2 | Lemon oil, furocoumarin free | G2.33 |
| 68648-39-5 | Lemon oil, terpeneless | G2.29 |
| 8008-56-8 | Lemon oil, washed | G2.23 |
| 102242-62-6 | Lemon pepper CO2 extract | H2.27 |
| 102242-62-6 | Lemon pepper extract | H2.13 |
| 72869-82-0 | Lemongrass oil terpenes | E2.30 |
| 8007-02-1 | Lemongrass oil, East Indian | E2.12 |
| 8007-02-1 | Lemongrass oil, rectified | E2.24 |
| 8007-02-1 | Lemongrass oil, West Indian | E2.12 |
| 123-76-2 | Levulinic acid | |
| 7787-20-4 | l-Fenchone | |
| 97676-23-8 | Licorice root absolute | A2.1 |
| 97676-23-8 | Licorice root extract | A2.1.1 |
| 91-51-0 | Lilial-methyl anthranilate (Schiff base) | |
| 68916-85-8 | Lily absolute | F2.1 |
| 8008-26-2 | Lime oil distilled | G2.12 |
| 8008-26-2 | Lime oil folded | G2.6 |
| 68917-71-5 | Lime oil terpenes | G2.30 |
| 68916-83-6 | Lime oil, cold pressed, furocoumarin free | G2.33 |
| 8008-26-2 | Lime oil, expressed | G2.5 |
| 8008-26-2 | Lime oil, expressed, folded | G2.6 |
| 8008-26-2 | Lime oil, expressed, rectified | G2.24 |
| 68916-84-7 | Lime oil, terpeneless | G2.29 |
| 78-70-6 | Linalool | |
| 1365-19-1 | Linalool oxide | |
| 14049-11-7 | Linalool oxide pyranoid | |
| 115-95-7 | Linalyl acetate | |
| 7149-26-0 | Linalyl anthranilate | |
| 126-64-7 | Linalyl benzoate | |
| 78-36-4 | Linalyl butyrate | |
| 78-37-5 | Linalyl cinnamate | |
| 115-99-1 | Linalyl formate | |
| 7779-23-9 | Linalyl hexanoate | |
| 78-35-3 | Linalyl isobutyrate | |
| 1118-27-0 | Linalyl isovalerate | |
| 7143-69-3 | Linalyl phenylacetate | |
| 144-39-8 | Linalyl propionate | |
| 60-33-3 | Linoleic acid | |
| 463-40-1 | Linolenic acid | |
| 8001-26-1 | Linseed | H2.19 |
| 8001-26-1 | Linseed absolute | H2.1 |
| 8001-26-1 | Linseed extract | H2.13 |
| 8001-26-1 | Linseed oil | H2.12 |
| 68956-59-2 | Linseed oil Et ester | |
| 8001-26-1 | Linseed oil, fixed | H2.50 |
| 68855-99-2 | Litsea cubeba oil | G2.12 |
| 68855-99-2 | Litsea cubeba oil, rectified | G2.24 |
| 68855-99-2 | Litsea cubeba terpenes | G2.30 |
| 79-33-4 | L-Lactic acid (2-hydroxy propionic acid) | |
| 5989-54-8 | l-Limonene | |
| 126-91-0 | l-Linalool | |
| 2216-51-5 | l-Menthol | |
| 156324-78-6 | l-Menthol ethylene glycol carbonate | |
| 14073-97-3 | l-Menthone | |
| 108766-16-1 | l-Menthyl (R,S)-3-hydroxybutyrate | |
| 2623-23-6 | l-Menthyl acetate (1alpha,2beta,5alpha) | |
| 59259-38-0 | l-Menthyl D-lactate | |
| 220621-22-7 | L-Monomenthyl glutarate | |
| 475-20-7 | Longifolene | |
| 8016-31-7 | Lovage leaf oil | E2.12 |
| 8016-31-7 | Lovage root oil | A2.12 |
| 4573-50-6 | l-Piperitone | |
| 8007-12-3 | Mace absolute | G2.1 |
| 8007-12-3 | Mace oil | G2.12 |
| 8007-12-3 | Mace oleoresin | G2.21 |
| 1207666-22-5 | Macrocystis algae resinoid | I2.26 |
| 7786-30-3 | Magnesium chloride (MgCl2) | |
| 92457-18-6 | Magnolia leaf oil, rectified | E2.24 |
| 102242-62-6 | Ma-Kwaen CO2 extract | G2.27 |
| 8002-48-0 | Malt absolute | H2.1 |
| 8002-48-0 | Malt extract | H2.13 |
| 9050-36-6 | Maltodextrin | |
| 118-71-8 | Maltol | |
| 67860-01-9 | Maltyl Butyrate | |
| 65416-14-0 | Maltyl isobutyrate | |
| 8008-31-9 | Mandarin oil | G2.5 |
| 8008-31-9 | Mandarin oil | G2.12 |
| 8008-31-9 | Mandarin oil folded | G2.6 |
| 68953-04-8 | Mandarin oil terpenes | G2.30 |
| 8008-31-9 | Mandarin oil, furocoumarin reduced | G2.33 |
| 8008-31-9 | Mandarin oil, rectified | G2.24 |
| 68917-20-4 | Mandarin oil, terpeneless | G2.29 |
| 8016-33-9 | Marjoram oil, Spanish | E2.12 |
| 8015-01-8 | Marjoram oil, sweet | E2.12 |
| 336185-21-8 | Marjoram, pot, oil | E2.12 |
| 68991-39-9 | Mastic absolute | K2.1 |
| 68991-39-9 | Mastic extract | K2.13 |
| 68991-39-9 | Mastic oil | K2.12 |
| 68916-96-1 | Mate absolute | E2.1 |
| 68916-96-1 | Mate concrete | E2.7 |
| 68916-96-1 | Mate extract | E2.13 |
| 68916-96-1 | Mate oil | E2.12 |
| 108-39-4 | m-Cresol | |
| 151-10-0 | m-Dimethoxybenzene | |
| 8023-73-2 | Melilotus officinalis absolute | F2.1 |
| 8023-73-2 | Melilotus officinalis absolute, pyrogenated | F2.9.1 |
| 84082-81-5 | Melilotus officinalis oil | F2.12 |
| 8023-73-2 | Melilotus officinalis tincture | F2.31 |
| 68917-18-0 | Mentha arvensis | E2.11 |
| 68917-18-0 | Mentha arvensis oil | E2.24 |
| 68917-18-0 | Mentha arvensis oil (low menthol) | E2.33 |
| 68608-35-5 | Mentha arvensis oil terpenes | E2.30 |
| 68917-18-0 | Mentha arvensis oil, distilled | E2.12 |
| 68917-14-6 | Mentha arvensis oil, terpeneless | E2.29 |
| 68917-18-0 | Mentha arvensis, 3X | E2.33 |
| 68917-15-7 | Mentha citrata oil | E2.12 |
| 68683-20-5 | Menthadiene-7-methyl formate | |
| 89-78-1 | Menthol | |
| 15356-70-4 | Menthol racemic | |
| 10458-14-7 | Menthone | |
| 89-48-5 | Menthyl acetate (1alpha,2beta,5alpha) | |
| 16409-45-3 | Menthyl acetate (isomer unspecified) | |
| 16409-46-4 | Menthyl isovalerate | |
| 75-47-8 | Methane, triiodo- | |
| 131-56-6 | Methanone, (2,4-dihydroxyphenyl)phenyl- | |
| 131-57-7 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- | |
| 1843-05-6 | Methanone, [2-hydroxy-4-(octyloxy)phenyl]phenyl- | |
| 86803-90-9 | Methoxy dicyclopentadiene carboxaldehyde | |
| 3613-30-7 | Methoxycitronellal | |
| 2986-54-1 | Methoxycyclododecane | |
| 63450-30-6 | Methoxymethylpyrazine | |
| 3149-28-8 | Methoxypyrazine | |
| 67634-12-2 | Methyl 2-(((4-(4-hydroxy-4-methylpentyl)-3-cyclohexenyl)methylene)amino)benzoate | |
| 41270-80-8 | Methyl 2-(formylamino)benzoate | |
| 67801-44-9 | Methyl 2-(octylideneamino)benzoate | |
| 33662-58-7 | Methyl 2,4-dihydroxy-m-toluate | |
| 28371-99-5 | Methyl 2,6,10-trimethylcyclododeca-2,5,9-trien-1-yl ketone | |
| 28043-10-9 | Methyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate | |
| 67800-80-0 | Methyl 2-[(2-methylundecylidene)amino]benzoate | |
| 67801-42-7 | Methyl 2-[(3,5,5-trimethylhexylidene)amino]benzoate | |
| 39129-16-3 | Methyl 2-[(phenylmethylene)amino]benzoate | |
| 68738-99-8 | Methyl 2-[[[2,4(or 3,5)-dimethyl-3-cyclohexen-1-yl]methylene]amino]benzoate | |
| 67924-13-4 | Methyl 2-[[2-(phenylmethylene)octylidene]amino]benzoate | |
| 104037-85-6 | Methyl 2-[[3-(1,3-benzodioxol-5-yl)-2-methyl-1-propenyl]amino]benzoate | |
| 611-13-2 | Methyl 2-furoate | |
| 2396-77-2 | Methyl 2-hexenoate | |
| 868-57-5 | Methyl 2-methylbutyrate | |
| 111-79-5 | Methyl 2-nonenoate | |
| 111-80-8 | Methyl 2-nonynoate | |
| 111-12-6 | Methyl 2-octynoate | |
| 1072-83-9 | Methyl 2-pyrrolyl ketone | |
| 6386-38-5 | Methyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | |
| 52557-97-8 | Methyl 3,3-dimethylbicyclo[2.2.1]heptane-2-carboxylate | |
| 2525-16-8 | Methyl 3,4,5,6-tetrahydro-7H-azepin-2-yl ether | |
| 2270-60-2 | Methyl 3,7-dimethyl-6-octenoate | |
| 2396-78-3 | Methyl 3-hexenoate | |
| 21188-58-9 | Methyl 3-hydroxyhexanoate | |
| 13532-18-8 | Methyl 3-methylthiopropionate | |
| 13481-87-3 | Methyl 3-nonenoate | |
| 39924-52-2 | Methyl 3-oxo-2-(pent-2-enyl)cyclopentaneacetate | |
| 68966-86-9 | Methyl 4(or 1)-isopropyl-1(or 4)-methylbicyclo[2.2.2]oct-5-ene-2-carboxylate | |
| 112-62-9 | Methyl 9-octadecenoate | |
| 68186-14-1 | Methyl abietate | |
| 127-25-3 | Methyl abietate, technical | |
| 79-20-9 | Methyl acetate | |
| 105-45-3 | Methyl acetoacetate | |
| 121-98-2 | Methyl anisate | |
| 134-20-3 | Methyl anthranilate | |
| 4707-47-5 | Methyl atrarate | |
| 93-58-3 | Methyl benzoate | |
| 93-08-3 | Methyl beta-naphthyl ketone | |
| 37161-74-3 | Methyl beta-phenylglycidate | |
| 623-42-7 | Methyl butyrate | |
| 103-26-4 | Methyl cinnamate | |
| 13894-62-7 | Methyl cis-3-hexenoate | |
| 41654-15-3 | Methyl cis-5-octenoate | |
| 30640-46-1 | Methyl cyclohexadiene (mixture of isomers) | |
| 14352-61-5 | Methyl cyclohexylacetate | |
| 40203-73-4 | Methyl cyclopentylideneacetate | |
| 110-42-9 | Methyl decanoate | |
| 811412-48-3 | Methyl decenone | |
| 24851-98-7 | Methyl dihydrojasmonate | |
| 8050-15-5 | Methyl ester of rosin (partially hydrogenated) | |
| 57500-00-2 | Methyl furfuryl disulfide | |
| 106-73-0 | Methyl heptanoate | |
| 112-39-0 | Methyl hexadecanoate | |
| 106-70-7 | Methyl hexanoate | |
| 37172-53-5 | Methyl hexyl oxo cyclopentanone carboxylate | |
| 1335-46-2 | Methyl ionone (mixture of isomers) | |
| 547-63-7 | Methyl isobutyrate | |
| 556-24-1 | Methyl isovalerate | |
| 1211-29-6 | Methyl jasmonate | |
| 111-82-0 | Methyl laurate | |
| 112-63-0 | Methyl linoleate | |
| 301-00-8 | Methyl linoleate (48%) methyl linolenate (52%) mixture | |
| 74-93-1 | Methyl mercaptan | |
| 124-10-7 | Methyl myristate | |
| 2719-08-6 | Methyl N-acetylanthranilate | |
| 93-60-7 | Methyl nicotinate | |
| 85-91-6 | Methyl N-methylanthranilate | |
| 112-61-8 | Methyl octadecanoate | |
| 111-11-5 | Methyl octanoate | |
| 606-45-1 | Methyl o-methoxybenzoate | |
| 3558-60-9 | Methyl phenethyl ether | |
| 101-41-7 | Methyl phenylacetate | |
| 99-76-3 | Methyl p-hydroxybenzoate | |
| 99-75-2 | Methyl p-methylbenzoate | |
| 554-12-1 | Methyl propionate | |
| 3549-23-3 | Methyl p-tert-butylphenylacetate | |
| 119-36-8 | Methyl salicylate | |
| 689-89-4 | Methyl sorbate | |
| 2432-51-1 | Methyl thiobutyrate | |
| 2396-85-2 | Methyl trans-2-octenoate | |
| 111-81-9 | Methyl undec-10-enoate | |
| 624-24-8 | Methyl valerate | |
| 3943-74-6 | Methyl vanillate | |
| 5533-03-9 | Methyl vanillyl ether | |
| 81752-87-6 | Methyl-2,2-dimethyl-6-methylene-1-cyclohexanecarboxylate | |
| 68845-02-3 | Methyl-2-[[(2,4-dimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate | |
| 816-73-9 | Methylallyl isobutyrate | |
| 127-42-4 | Methyl-alpha-ionone | |
| 127-43-5 | Methyl-beta-ionone | |
| 61699-38-5 | Methylcyclooctyl carbonate | |
| 80-71-7 | Methylcyclopentenolone | |
| 1335-09-7 | Methylheptenol | |
| 409-02-9 | Methylheptenone (isomer unspecified) | |
| 1335-94-0 | Methylionone | |
| 8006-76-6 | Michelia alba flower extract | F2.13 |
| 8006-76-6 | Michelia alba flower oil | F2.12 |
| 8006-76-6 | Michelia alba flower oil, rectified | F2.24 |
| 8006-76-6 | Michelia alba leaf extract | E2.13 |
| 8006-76-6 | Michelia alba leaf oil | E2.12 |
| 8031-03-6 | Mimosa absolute | F2.1 |
| 8031-03-6 | Mimosa concrete | F2.7 |
| 13341-72-5 | Mintlactone | |
| 68476-78-8 | Molasses | |
| 8052-35-5 | Molasses, blackstrap | E2.13 |
| 87-28-5 | Monoglycol salicylate | |
| 77341-67-4 | mono-Menthyl succinate | |
| 84649-97-8 | Mushroom absolute | I2.1 |
| 81-14-1 | Musk ketone | |
| 72403-67-9 | Myraldyl acetate | |
| 123-35-3 | Myrcene | |
| 543-39-5 | Myrcenol | |
| 1118-39-4 | Myrcenyl acetate | |
| 544-63-8 | Myristic acid | |
| 629-63-0 | Myristo nitrile | |
| 8016-37-3 | Myrrh | K2.11 |
| 8016-37-3 | Myrrh absolute | K2.1 |
| 8016-37-3 | Myrrh CO2 extract | K2.27 |
| 8016-37-3 | Myrrh extract | K2.13 |
| 9000-45-7 | Myrrh gum | K2.16 |
| 8016-37-3 | Myrrh oil | K2.12 |
| 1082996-27-7 | Myrrh oil | K2.12 |
| 8016-37-3 | Myrrh oil rectified | K2.24 |
| 8016-37-3 | Myrrh oil washed | K2.23 |
| 1082996-27-7 | Myrrh resinoid | K2.26 |
| 8016-37-3 | Myrrh resinoid | K2.26 |
| 515-00-4 | Myrtenol | |
| 1079-01-2 | Myrtenyl acetate | |
| 8008-46-6 | Myrtle oil | E2.12 |
| 8008-46-6 | Myrtle oil (low methyleugenol) | E2.33 |
| 8008-46-6 | Myrtle oil terpeneless | E2.29 |
| 8008-46-6 | Myrtle oil, rectified | E2.24 |
| 847565-09-7 | N-(2-(Pyridin-2-yl)ethyl)-3-p-menthanecarboxamide | |
| 82493-14-9 | N-(2-Ethoxyphenyl)-N'-(4-isododecylphenyl)oxamide | |
| 84434-18-4 | N,2-Dimethyl-N-phenylbutyramide | |
| 996-97-4 | N,N-Diethyloctamide | |
| 68489-14-5 | N-[(Ethoxycarbonyl)methyl)-p-menthane-3-carboxamide | |
| 3734-33-6 | N-[2-(2,6-Dimethylphenyl)amino]-2-oxoethyl]-N,N-diethylbenzenemethana minium benzoate | |
| 744251-93-2 | N-3,7-Dimethyl-2,6-octadienylcyclopropylcarboxamide | |
| 64741-65-7 | Naphtha, petroleum, heavy alkylate | |
| 64742-48-9 | Naphtha, petroleum, hydrotreated heavy | |
| 3738-00-9 | Naphtho[2,1-b]furan, dodecahydro-3a,6,6,9a-tetramethyl- | |
| 6790-58-5 | Naphtho[2,1-b]furan, dodecahydro-3a,6,6,9a-tetramethyl-, (3aR,5aS,9aS,9bR)- | |
| 8023-75-4 | Narcissus absolute | F2.1 |
| 8023-75-4 | Narcissus jonquilla absolute | F2.1 |
| 68917-12-4 | Narcissus poeticus absolute | F2.1 |
| 68917-41-9 | Nasturtium absolute | F2.1 |
| 74113-74-9 | Natural Hickory Smoke Flavor | D2.9.2 |
| 579-93-1 | N-Benzoylanthranilic acid | |
| 15706-73-7 | n-Butyl 2-methylbutyrate | |
| 8002-65-1 | Neem seed oil | H2.50 |
| 20702-77-6 | Neohesperidin dihydrochalcone | |
| 106-25-2 | Nerol | |
| 1786-08-9 | Nerol oxide | |
| 142-50-7 | Nerolidol (cis) | |
| 7212-44-4 | Nerolidol (isomer unspecified) | |
| 2306-78-7 | Nerolidyl acetate (isomer unspecified) | |
| 141-12-8 | Neryl acetate | |
| 999-40-6 | Neryl butyrate | |
| 2142-94-1 | Neryl formate | |
| 2345-24-6 | Neryl isobutyrate | |
| 105-91-9 | Neryl propionate | |
| 39711-79-0 | N-Ethyl-2-isopropyl-5-methylcyclohexane carboxamide | |
| 179911-08-1 | N-Ethyl-N-(3-methylphenyl)propionamide | |
| 1438-94-4 | N-Furfurylpyrrole | |
| 19089-92-0 | n-Hexyl 2-butenoate | |
| 8014-68-4 | Niaouli oil | E2.12 |
| 73507-35-4 | Nigella Damascena CO2 Extract | H2.27 |
| 90064-32-7 | Nigella sativa oil | H2.5 |
| 18836-52-7 | N-Isobutyldeca-trans-2-trans-4-dienamide | |
| 10377-60-3 | Nitric acid, magnesium salt (2:1) | |
| 5422-34-4 | N-Lactoyl ethanolamine | |
| 557-48-2 | Nona-2-trans-6-cis-dienal | |
| 629-92-5 | Nonadecane | |
| 124-19-6 | Nonanal | |
| 68141-14-0 | Nonanal, 5-ethyl-2-methyl- | |
| 111-84-2 | Nonane | |
| 54815-13-3 | Nonane, 1,1-diethoxy- | |
| 4390-04-9 | Nonane, 2,2,4,4,6,8,8-heptamethyl- | |
| 39864-15-8 | Nonanediyl diacetate | |
| 112-05-0 | Nonanoic acid | |
| 2444-46-4 | Nonanoyl 4-hydroxy-3-methoxybenzylamide | |
| 29127-83-1 | Nonen acid nitrile | |
| 143-13-5 | Nonyl acetate | |
| 143-08-8 | Nonyl alcohol | |
| 4674-50-4 | Nootkatone | |
| 128-50-7 | Nopol | |
| 128-51-8 | Nopyl acetate | |
| 852379-28-3 | N-p-Benzeneacetonitrilementhanecarboxamide | |
| 8008-45-5 | Nutmeg | G2.11 |
| 8008-45-5 | Nutmeg absolute | H2.1 |
| 8008-45-5 | Nutmeg CO2 extract | H2.27 |
| 8008-45-5 | Nutmeg distillate | H2.8 |
| 8008-45-5 | Nutmeg extract | H2.13 |
| 8008-45-5 | Nutmeg oil | H2.12 |
| 8008-45-5 | Nutmeg oil (low safrol) | H2.33 |
| 8008-45-5 | Nutmeg oil terpeneless, Java | H2.29 |
| 8008-45-5 | Nutmeg oil, rectified | H2.24 |
| 8008-45-5 | Nutmeg oleoresin | H2.21 |
| 8008-45-5 | Nutmeg terpenes | H2.30 |
| 1073-29-6 | o-(Methylthio)-phenol | |
| 97676-30-7 | Oak absolute | D2.1 |
| 97676-29-4 | Oak chips (white) concrete | D2.7 |
| 97676-29-4 | Oak chips (white) extract | D2.13 |
| 97676-30-7 | Oak CO2 extract | D2.27 |
| 97676-30-7 | Oak extract | D2.13 |
| 9000-50-4 | Oakmoss absolute (low atranol & chloratranol) | B2.1.2 |
| 9000-50-4 | Oakmoss absolute (low atranol & chloratranol) | B2.1.1 |
| 68917-10-2 | Oakmoss extract | B2.13 |
| 84012-26-0 | Oat extract | H2.53 |
| 5986-38-9 | Ocimenol | |
| 72214-23-4 | Ocimenyl acetate | |
| 95-48-7 | o-Cresol | |
| 593-45-3 | Octadecane | |
| 71832-76-3 | Octahydro-2,5,5-trimethyl-2-naphthol | |
| 68845-01-2 | Octahydro-4,4,7-trimethyl-3H-naphth[1,8a-b]oxiren-7-ol | |
| 30772-79-3 | Octahydro-4,7-methano-1H-indenecarbaldehyde | |
| 30772-69-1 | Octahydro-4,7-methano-1H-indenemethyl acetate | |
| 68039-78-1 | Octahydro-4,7-methano-1H-indenemethyl formate | |
| 23333-91-7 | Octahydro-4,8a-dimethyl-4a(2H)-naphthol | |
| 68738-96-5 | Octahydro-5,5-dimethylnaphthalene-2-carbaldehyde | |
| 59056-64-3 | Octahydro-7,7,8,8-tetramethyl-2,3b-methano-3bH-cyclopenta[1,3]cyclopropa[1,2]benzene-4-methanol | |
| 59056-62-1 | Octahydro-7,7,8,8-tetramethyl-2,3b-methano-3bH-cyclopenta[1,3]cyclopropa[1,2]benzene-4-methyl acetate | |
| 41724-19-0 | Octahydro-7-methyl-1,4-methanonaphtalen-6(2H)-one | |
| 68738-94-3 | Octahydro-8,8-dimethylnaphthalene-2-carbaldehyde | |
| 4430-31-3 | Octahydrocoumarin | |
| 124-13-0 | Octanal | |
| 10022-28-3 | Octanal dimethyl acetal | |
| 929253-05-4 | Octanal, 6-methoxy-2,6-dimethyl- | |
| 124-12-9 | Octanenitrile | |
| 124-07-2 | Octanoic acid | |
| 18312-31-7 | Octanoic acid, octadecyl ester | |
| 112-14-1 | Octyl acetate | |
| 110-39-4 | Octyl butyrate | |
| 22874-79-9 | Octyl crotonate | |
| 112-32-3 | Octyl formate | |
| 109-15-9 | Octyl isobutyrate | |
| 7786-58-5 | Octyl isovalerate | |
| 68916-40-5 | Oils, geranium, acetylated | |
| 1450625-49-6 | Oils, Patchouli, patchoulol synthase-modified Saccharomyces cerevisiae-fermented, from carbohydrates | M2.19 |
| 2576531-09-2 | Oils, sandalwood, santalene synthase-modified Rhodobacter sphaeroides-fermented, from D-Glucose, oxidized | |
| 112-80-1 | Oleic acid | |
| 8016-36-2 | Olibanum absolute | K2.1 |
| 8016-36-2 | Olibanum carterii CO2 extract | K2.27 |
| 8016-36-2 | Olibanum carterii extract | K2.13 |
| 8016-36-2 | Olibanum carterii oil | K2.51 |
| 8016-36-2 | Olibanum carterii pyrogenated oil | K2.9.1 |
| 8016-36-2 | Olibanum extract | K2.13 |
| 8016-36-2 | Olibanum oil | K2.12 |
| 8016-36-2 | Olibanum oil, rectified | K2.24 |
| 8016-36-2 | Olibanum resinoid | K2.26 |
| 8016-36-2 | Olibanum serrata oil, Indian | K2.12 |
| 8001-25-0 | Olive absolute | E2.1 |
| 8001-25-0 | Olive oil | G2.50 |
| 7779-50-2 | omega-6-Hexadecenlactone | |
| 106-02-5 | omega-Pentadecalactone | |
| 135-02-4 | o-Methoxybenzaldehyde | |
| 1504-74-1 | o-Methoxycinnamaldehyde | |
| 86-26-0 | o-Phenyl anisole | |
| 8021-36-1 | Opoponax absolute | K2.1 |
| 8021-36-1 | Opoponax CO2 extract | K2.27 |
| 8021-36-1 | Opoponax extract | K2.13 |
| 8021-36-1 | Opoponax oil | K2.12 |
| 8021-36-1 | Opoponax oil, rectified | K2.24 |
| 8021-36-1 | Opoponax resinoid | K2.26 |
| 644-35-9 | o-Propylphenol | |
| 68916-04-1 | Orange blossom bitter aromatic water | F2.3 |
| 8016-38-4 | Orange blossoms absolute | F2.1 |
| 68514-75-0 | Orange essence oil | G2.10 |
| 68606-94-0 | Orange essence oil, sweet terpeneless | G2.56 |
| 8016-38-4 | Orange flower absolute, bitter (Neroli and Neroli Bigarade) | F2.1 |
| 8016-38-4 | Orange flower oil, bitter (Neroli and Neroli bigarade) | F2.12 |
| 8030-28-2 | Orange flower water absolute | F2.54 |
| 8016-38-4 | Orange flower, bitter, CO2 extract | F2.27 |
| 8016-38-4 | Orange flower, bitter, concrete | F2.7 |
| 68916-04-1 | Orange oil bitter, defurocoumarinized | G2.33 |
| 68916-04-1 | Orange oil, bitter | G2.5 |
| 68916-04-1 | Orange oil, bitter washed, rectified | G2.24 |
| 68917-07-7 | Orange oil, sweet, psoralen-free | G2.33 |
| 8008-57-9 | Orange oil, sweet, rectified | G2.24 |
| 68647-72-3 | Orange oil, sweet, terpenes | G2.30 |
| 68606-94-0 | Orange peel oil, sweet, terpeneless | G2.29 |
| 8028-48-6 | Orange peel, sweet, alcoholate | G2.2 |
| 8008-57-9 | Orange peel, sweet, extract | G2.20 |
| 8008-57-9 | Orange peel, sweet, oil | G2.5 |
| 8028-48-6 | Orange peel, sweet, tincture | G2.31 |
| 68916-04-1 | Orange tincture, bitter | G2.31 |
| 8008-57-9 | Orange, sweet, oil folded | G2.6 |
| 8008-57-9 | Orange, sweet, Valencia oil | G2.5 |
| 8007-11-2 | Origanum oil (extractive) | E2.13 |
| 8007-11-2 | Origanum oil (spp.) | E2.12 |
| 8007-11-2 | Origanum oil (Thymus capitatus) | E2.12 |
| 8007-11-2 | Origanum oil, rectified | E2.24 |
| 68917-05-5 | Osmanthus absolute | F2.1 |
| 68917-05-5 | Osmanthus concrete | F2.7 |
| 68917-05-5 | Osmanthus tincture | F2.31 |
| 137-06-4 | o-Toluenethiol | |
| 19819-98-8 | o-Tolylethanol | |
| 28645-51-4 | Oxacycloheptadec-10-ene-2-one | |
| 36508-31-3 | Oxacycloheptadec-11-en-2-one | |
| 111879-80-2 | Oxacyclohexadec-12-en-2-one, (12E)- | |
| 38223-29-9 | Oxacyclohexadecane-2,13-dione | |
| 34902-57-3 | Oxacyclohexadecen-2-one | |
| 329925-33-9 | Oxacyclopentadec-10-en-2-one, 13-methyl- | |
| 947-05-7 | Oxacyclotridecan-2-one | |
| 9087-53-0 | Oxirane, 2-methyl-, polymer with oxirane, hexadecyl ether | |
| 11111-34-5 | Oxirane, methyl-, polymer with oxirane, ether with (1,2-ethanediyldinitrilo)tetrakis[propanol](4:1) | |
| 9038-95-3 | Oxirane, methyl-, polymer with oxirane, monobutyl ether | |
| 9038-43-1 | Oxirane, methyl-, polymer with oxirane, monooctadecyl ether | |
| 6324-78-3 | p-(2,2-Dimethoxyethoxy)toluene | |
| 42866-91-1 | p-(2,2-Dimethoxyethyl)toluene | |
| 1195-32-0 | p,alpha-Dimethylstyrene | |
| 8023-79-8 | Palm kernel oil | H2.50 |
| 8002-75-3 | Palm oil, fixed | G2.50 |
| 8014-19-5 | Palmarosa oil | E2.12 |
| 57-10-3 | Palmitic acid | |
| 1197-01-9 | p-alpha,alpha-Trimethylbenzyl alcohol | |
| 104-21-2 | p-Anisyl acetate | |
| 84625-29-6 | Paprika oleoresin | G2.21 |
| 64742-46-7 | Paraffin - C15- 19 alkane | |
| 8012-95-1 | Paraffin oils | |
| 8002-74-2 | Paraffin wax | |
| 64771-72-8 | Paraffins, normal C5-C20 | |
| 123-63-7 | Paraldehyde | |
| 8000-68-8 | Parsley herb oil | E2.12 |
| 8025-95-4 | Parsley oleoresin | H2.21 |
| 8000-68-8 | Parsley seed oil | H2.12 |
| 854535-37-8 | Passionflower extract | G2.13 |
| 8014-09-3 | Patchouli | E2.19 |
| 8014-09-3 | Patchouli | E2.11 |
| 8014-09-3 | Patchouli absolute | E2.1 |
| 5986-55-0 | Patchouli alcohol | |
| 8014-09-3 | Patchouli CO2 extract | E2.27 |
| 8014-09-3 | Patchouli extract | E2.13 |
| 8014-09-3 | Patchouli oil | E2.51 |
| 8014-09-3 | Patchouli oil | E2.12 |
| 8014-09-3 | Patchouli oil (low Fe) | E2.33 |
| 8014-09-3 | Patchouli oil, rectified | E2.24 |
| 73049-85-1 | Patchouli terpenes | E2.30 |
| 106-44-5 | p-Cresol | |
| 614-34-6 | p-Cresyl benzoate | |
| 607-88-5 | p-Cresyl salicylate | |
| 99-87-6 | p-Cymene | |
| 150-78-7 | p-Dimethoxybenzene | |
| 1429493-82-2 | Peach extract | G2.13 |
| 84012-34-0 | Peach infusion | G2.31 |
| 8002-03-7 | Peanut oil | H2.50 |
| 124046-50-0 | Peg-20 Almond Glycerides | |
| 94333-77-4 | Pelargonium graveolens, ext., sapond. | |
| 8013-99-8 | Pennyroyal oil, Europe | E2.12 |
| 68917-60-2 | Pennyroyal oil, terpenes | E2.30 |
| 629-62-9 | Pentadecane | |
| 2308574-23-2 | Pentanedioic acid, 1-(4-formyl-2-methoxyphenyl) 5-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester | |
| 1119-40-0 | Pentanedioic acid, 1,5-dimethyl ester | |
| 55590-83-5 | Pentanoic acid, 2-methylbutyl ester | |
| 628-63-7 | Pentyl acetate | |
| 2049-96-9 | Pentyl benzoate | |
| 25415-62-7 | Pentyl isovalerate | |
| 5137-52-0 | Pentyl phenylacetate | |
| 624-54-4 | Pentyl propionate | |
| 68917-24-8 | Pepper oil black, terpene-free | G2.29 |
| 8006-82-4 | Pepper, black, absolute | G2.1 |
| 8006-82-4 | Pepper, black, CO2 extract | G2.27 |
| 8006-82-4 | Pepper, black, oil | G2.12 |
| 8006-82-4 | Pepper, black, oil, rectified | G2.24 |
| 8002-56-0 | Pepper, black, oleoresin | G2.21 |
| 8006-82-4 | Pepper, white, CO2 extract | G2.27 |
| 8006-82-4 | Pepper, white, oil | G2.12 |
| 8006-90-4 | Peppermint absolute | E2.1 |
| 8006-90-4 | Peppermint CO2 extract | E2.27 |
| 8006-90-4 | Peppermint leaves | E2.19 |
| 8006-90-4 | Peppermint oil | E2.12 |
| 8006-90-4 | Peppermint oil, rectified | E2.24 |
| 68606-97-3 | Peppermint oil, terpeneless | E2.29 |
| 68608-37-7 | Peppermint oil, terpenes | E2.30 |
| 68606-96-2 | Peppermint oils, reaction products with hydrogen sulfide | |
| 68132-21-8 | Perilla oil | E2.12 |
| 1155405-59-6 | Periploca sepium oil | A2.12 |
| 8008-26-2 | Persian lime oil, expressed | G2.5 |
| 444085-42-1 | Persicaria odorata oil | E2.12 |
| 91721-74-3 | Persimmon extract | G2.13 |
| 8007-00-9 | Peru balsam distillate | K2.8 |
| 123-07-9 | p-Ethylphenol | |
| 8014-17-3 | Petitgrain absolute | E2.1 |
| 8007-75-8 | Petitgrain bergamot absolute | E2.1 |
| 8014-17-3 | Petitgrain bigarade absolute | E2.1 |
| 8014-17-3 | Petitgrain bigarade oil | E2.12 |
| 8048-51-9 | Petitgrain lemon oil | E2.12 |
| 8014-17-3 | Petitgrain mandarin oil | E2.12 |
| 68915-85-5 | Petitgrain oil terpeneless, Paraguay | E2.29 |
| 68917-61-3 | Petitgrain oil terpenes, Paraguay | E2.30 |
| 8014-17-3 | Petitgrain oil, Paraguay | E2.12 |
| 8014-17-3 | Petitgrain oil, rectified, Paraguay | E2.24 |
| 68606-99-5 | Petitgrain oils, saponified | |
| 8014-17-3 | Petitgrain water absolute | E2.54 |
| 6315-04-4 | Phenethyl 2-ethylbutyrate | |
| 103-45-7 | Phenethyl acetate | |
| 60-12-8 | Phenethyl alcohol | |
| 94-47-3 | Phenethyl benzoate | |
| 103-52-6 | Phenethyl butyrate | |
| 103-53-7 | Phenethyl cinnamate | |
| 104-62-1 | Phenethyl formate | |
| 6290-37-5 | Phenethyl hexanoate | |
| 103-48-0 | Phenethyl isobutyrate | |
| 2257-09-2 | Phenethyl isothiocyanate | |
| 140-26-1 | Phenethyl isovalerate | |
| 5457-70-5 | Phenethyl octanoate | |
| 102-20-5 | Phenethyl phenylacetate | |
| 122-70-3 | Phenethyl propionate | |
| 87-22-9 | Phenethyl salicylate | |
| 55719-85-2 | Phenethyl tiglate | |
| 108-95-2 | Phenol | |
| 31195-95-6 | Phenol, (2-methylpropyl)- | |
| 52514-67-7 | Phenol, 2-ethoxy-4-(4,4,6-trimethyl-1,3-dioxan-2-yl)- | |
| 71119-07-8 | Phenol, 2-ethoxy-4-(ethoxymethyl)- | |
| 224790-80-1 | Phenol, 2-methoxy-, reaction products | |
| 52514-66-6 | Phenol, 2-methoxy-4-(4,4,6-trimethyl-1,3-dioxan-2-yl)- | |
| 88-18-6 | Phenol, 2-(1,1-dimethylethyl)- | |
| 88-60-8 | Phenol, 2-(1,1-dimethylethyl)-5-methyl- | |
| 2219-82-1 | Phenol, 2-(1,1-dimethylethyl)-6-methyl- | |
| 89-72-5 | Phenol, 2-(1-methylpropyl)- | |
| 25973-55-1 | Phenol, 2-(2H-benzotriazol-2-yl)-4,6-bis(1,1-dimethylpropyl)- | |
| 2440-22-4 | Phenol, 2-(2H-benzotriazol-2-yl)-4-methyl- | |
| 125304-04-3 | Phenol, 2-(2H-benzotriazol-2-yl)-6-dodecyl-4-methyl-, branched and linear | |
| 3896-11-5 | Phenol, 2-(5-chloro-2H-benzotriazol-2-yl)-6-(1,1-dimethylethyl)-4-methyl- | |
| 6706-82-7 | Phenol, 2,2'-[cyclohexylidenebis[(2-methyl-4,1-phenylene)azo]]bis[4-cyclohexyl- | |
| 35958-30-6 | Phenol, 2,2'-ethylidenebis[4,6-bis(1,1-dimethylethyl)- | |
| 119-47-1 | Phenol, 2,2'-methylenebis[6-(1,1-dimethylethyl)-4-methyl- | |
| 697-82-5 | Phenol, 2,3,5-trimethyl- | |
| 128-39-2 | Phenol, 2,6-bis(1,1-dimethylethyl)- | |
| 70955-71-4 | Phenol, 2-methoxy-, reaction products with 2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane, hydrogenated | |
| 99-71-8 | Phenol, 4-(1-methylpropyl)- | |
| 128489-02-1 | Phenol, 4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxy- | |
| 1638-22-8 | Phenol, 4-butyl- | |
| 88-04-0 | Phenol, 4-chloro-3,5-dimethyl- | |
| 84852-15-3 | Phenol, 4-nonyl-, branched | |
| 25154-52-3 | Phenol, nonyl- | |
| 2120-70-9 | Phenoxyacetaldehyde | |
| 118-55-8 | Phenyl salicylate | |
| 122-78-1 | Phenylacetaldehyde | |
| 67633-94-7 | Phenylacetaldehyde 2,4-dihydroxy-2-methylpentane acetal | |
| 6314-97-2 | Phenylacetaldehyde diethyl acetal | |
| 68345-22-2 | Phenylacetaldehyde diisobutyl acetal | |
| 101-48-4 | Phenylacetaldehyde dimethyl acetal | |
| 101-49-5 | Phenylacetaldehyde ethylene glycol acetal | |
| 29895-73-6 | Phenylacetaldehyde glyceryl acetal | |
| 103-82-2 | Phenylacetic acid | |
| 24817-51-4 | Phenylethyl 2-methylbutyrate | |
| 133-18-6 | Phenylethyl anthranilate | |
| 56011-02-0 | Phenylethyl isoamyl ether | |
| 2809-21-4 | Phosphonic acid, (1-hydroxyethylidene)bis- | |
| 298-07-7 | Phosphoric acid, bis(2-ethylhexyl) ester | |
| 7558-80-7 | Phosphoric acid, monosodium salt | |
| 150-86-7 | Phytol | |
| 10236-16-5 | Phytyl acetate | |
| 8006-77-7 | Pimenta leaf oil | E2.12 |
| 8006-77-7 | Pimenta leaf oil (low methyleugenol) | E2.33 |
| 8021-29-2 | Pine needle oil | E2.12 |
| 8000-26-8 | Pine needle, dwarf, oil | E2.12 |
| 8002-09-3 | Pine oil | E2.12 |
| 73049-71-5 | Pine oil | E2.12 |
| 68440-45-9 | Pine oils, acetylated | |
| 8023-99-2 | Pine Scotch, absolute | E2.1 |
| 8023-99-2 | Pine Scotch, concrete | E2.7 |
| 8023-99-2 | Pine Scotch, extract | E2.13 |
| 8023-99-2 | Pine Scotch, oil | E2.12 |
| 8023-99-2 | Pine Scotch, pyrogenated oil | E2.9.1 |
| 8023-99-2 | Pine Scotch, resinoid | E2.26 |
| 8011-48-1 | Pine tar oil | D2.9.2 |
| 8011-48-1 | Pine tar oil, rectified | M2.24 |
| 8000-26-8 | Pine, Pinus maritima, sawdust oil | D2.12 |
| 8000-26-8 | Pine, Pinus pinaster, absolute | E2.1 |
| 8000-26-8 | Pine, Pinus pinaster, oil | E2.12 |
| 97676-05-6 | Pine, Pinus pumila, extract | E2.12 |
| 97676-27-2 | Pineapple extract | G2.13 |
| 1078-95-1 | Pinocarvyl acetate | |
| 8000-26-8 | Pinus nigra oil | E2.12 |
| 90082-60-3 | Piper longum CO2 extract | G2.27 |
| 90082-60-3 | Piper longum extract | G2.13 |
| 110-89-4 | Piperidine | |
| 94-62-2 | Piperine | |
| 89-81-6 | Piperitone | |
| 120-57-0 | Piperonal | |
| 326-61-4 | Piperonyl acetate | |
| 6658-48-6 | p-Isobutyl-alpha-methyl hydrocinnamaldehyde | |
| 4395-92-0 | p-Isopropyl phenylacetaldehyde | |
| 645-13-6 | p-Isopropylacetophenone | |
| 59230-57-8 | p-Isopropylbenzyl acetate | |
| 536-60-7 | p-Isopropylbenzyl alcohol | |
| 92457-29-9 | Plumeria absolute | F2.1 |
| 10482-56-1 | p-Menth-1-en-8-ol (S) | |
| 7764-50-3 | p-Menth-8-en-2-one | |
| 99-86-5 | p-Mentha-1,3-diene | |
| 99-85-4 | p-Mentha-1,4-diene | |
| 2111-75-3 | p-Mentha-1,8-dien-7-al | |
| 536-59-4 | p-Mentha-1,8-dien-7-ol | |
| 15111-96-3 | p-Mentha-1,8-dien-7-yl acetate | |
| 38462-22-5 | p-Mentha-8-thiol-3-one | |
| 499-70-7 | p-Menthan-2-one | |
| 123-11-5 | p-Methoxybenzaldehyde | |
| 874-90-8 | p-Methoxybenzonitrile | |
| 1963-36-6 | p-Methoxycinnamaldehyde | |
| 84697-09-6 | p-Methyl-alpha-amyl cinnamic aldehyde | |
| 104-93-8 | p-Methylanisole | |
| 91-61-2 | p-Methyltetrahydroquinoline | |
| 26183-52-8 | Poly(oxy-1,2-ethanediyl), α-decyl-ω-hydroxy- | |
| 61827-42-7 | Poly(oxy-1,2-ethanediyl), α-isodecyl-ω-hydroxy- | |
| 9051-57-4 | Poly(oxy-1,2-ethanediyl), α-sulfo-ω-(nonylphenoxy)-, ammonium salt (1:1) | |
| 24938-91-8 | Poly(oxy-1,2-ethanediyl), α-tridecyl-ω-hydroxy- | |
| 127087-87-0 | Poly(oxy-1,2-ethanediyl), .alpha.-(4-nonylphenyl)-.omega.-hydroxy-,branched | |
| 9004-87-9 | Poly(oxy-1,2-ethanediyl), .alpha.-(isooctylphenyl)-.omega.-hydroxy- | |
| 68412-54-4 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy-, branched | |
| 60828-78-6 | Poly(oxy-1,2-ethanediyl), .alpha.-[3,5-dimethyl-1-(2-methylpropyl)hexyl]-.omega.-hydroxy- | |
| 9004-98-2 | Poly(oxy-1,2-ethanediyl), .alpha.-9-octadecenyl-.omega.-hydroxy-, (Z)- | |
| 25322-68-3 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- | |
| 68511-37-5 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, mono-C12-14-alkyl ethers, phosphates | |
| 9002-93-1 | Poly(oxy-1,2-ethanediyl), a-[4-(1,1,3,3-tetramethylbutyl)phenyl]-w-hydroxy- | |
| 9002-92-0 | Poly(oxy-1,2-ethanediyl), a-dodecyl-w-hydroxy- | |
| 69364-63-2 | Poly(oxy-1,2-ethanediyl), a-isohexadecyl-w-hydroxy- | |
| 69011-36-5 | Poly(oxy-1,2-ethanediyl), a-tridecyl-w-hydroxy-, branched | |
| 9036-19-5 | Poly(oxy-1,2-ethanediyl),alpha-[(1,1,3,3-tetramethylbutyl)phenyl]-omega-hydroxy- | |
| 9016-45-9 | Poly(oxy-1,2-ethanedyl), alpha-(nonylphenyl)-omega-hydroxy- | |
| 9003-13-8 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-butyl-.omega.-hydroxy- | |
| 9035-85-2 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hexadecyl-.omega.-hydroxy- | |
| 61849-72-7 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy-, ether with methyl .beta.-D-glucopyranoside (4:1) | |
| 25231-21-4 | Poly[oxy(methyl-1,2-ethanediyl)], a-octadecyl-w-hydroxy- | |
| 9002-88-4 | Polyethylene low density | |
| 84604-04-6 | Polygonum aviculare | E2.13 |
| 9003-11-6 | Polymer of 2-methyloxirane and oxirane | |
| 9005-64-5 | Polysorbate 20 | |
| 9005-67-8 | Polysorbate 60 | |
| 9005-65-6 | Polysorbate 80 | |
| 921202-04-2 | Populus nigra absolute | F2.1 |
| 104-45-0 | p-Propylanisole | |
| 645-56-7 | p-Propylphenol | |
| 1005328-84-6 | Procavia capensis extract | J2.13 |
| 1005328-84-6 | Procavia capensis, tincture | J2.31 |
| 4744-08-5 | Propanal diethyl acetal | |
| 111109-77-4 | Propane, oxybis[methoxy- | |
| 478695-70-4 | Propanedioic acid, 1-(3,3-dimethylcyclohexyl) ethyl, ethyl ester | |
| 25265-77-4 | Propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol | |
| 1584709-99-8 | Propanoic acid, 2,2-dimethyl-, (1S)-1-methyl-2-(1-methylethoxy)-2-oxoethyl ester | |
| 34451-19-9 | Propanoic acid, 2-hydroxy-, butyl ester, (2S)- | |
| 6846-50-0 | Propanoic acid, 2-methyl-, 1,1'-[2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl] ester | |
| 1129-47-1 | Propanoic acid, 2-methyl-, cyclohexyl ester | |
| 123-28-4 | Propanoic acid, 3,3'-thiobis-, didodecyl ester | |
| 55934-93-5 | Propanol, [2-(2-butoxymethylethoxy)methylethoxy]- | |
| 25498-49-1 | Propanol, [2-(2-methoxymethylethoxy)methylethoxy]- | |
| 88917-22-0 | Propanol, 1(or 2)-(2-methoxymethylethoxy)-, acetate | |
| 94-86-0 | Propenylguaethol | |
| 123-38-6 | Propionaldehyde | |
| 79-09-4 | Propionic acid | |
| 319002-92-1 | Propyl (2S)-2-(1,1-dimethylpropoxy)-propanoate | |
| 37064-20-3 | Propyl 2-methylbutyrate | |
| 109-60-4 | Propyl acetate | |
| 71-23-8 | Propyl alcohol | |
| 105-66-8 | Propyl butyrate | |
| 121-79-9 | Propyl gallate | |
| 626-77-7 | Propyl hexanoate | |
| 557-00-6 | Propyl isovalerate | |
| 7493-57-4 | Propyl phenethyl acetal | |
| 94-13-3 | Propyl p-hydroxybenzoate | |
| 106-36-5 | Propyl propionate | |
| 57-55-6 | Propylene glycol | |
| 5131-66-8 | Propylene glycol butyl ether | |
| 475291-19-1 | Protium pallidum resin | K2.25 |
| 80-54-6 | p-t-Butyl-alpha-methylhydrocinnamic aldehyde | |
| 943-27-1 | p-tert-Butylacetophenone | |
| 98-53-3 | p-tert-Butylcyclohexanone | |
| 18127-01-0 | p-tert-Butyldihydrocinnamaldehyde | |
| 104-87-0 | p-Tolualdehyde | |
| 55066-56-3 | p-Tolyl 3-methylbutyrate | |
| 24700-20-7 | p-Tolyl 3-methylcrotonate | |
| 140-39-6 | p-Tolyl acetate | |
| 589-18-4 | p-Tolyl alcohol | |
| 103-93-5 | p-Tolyl isobutyrate | |
| 59558-23-5 | p-Tolyl octanoate | |
| 101-94-0 | p-Tolyl phenylacetate | |
| 104-09-6 | p-Tolylacetaldehyde | |
| 89-82-7 | Pulegone | |
| 2628-17-3 | p-Vinylphenol | |
| 32741-11-0 | Pyrazine, (1,1-dimethylethyl)- | |
| 25680-58-4 | Pyrazine, 2-ethyl-3-methoxy- | |
| 68844-95-1 | Pyrazine, 2-methoxy-3-(4-methylpentyl)- | |
| 2882-20-4 | Pyrazine, 2-methyl-3-(methylthio)- | |
| 67952-65-2 | Pyrazine, methyl (methylthio)- | |
| 110-86-1 | Pyridine | |
| 885702-72-7 | Pyridine, 2-(2,4-dimethylcyclohexyl)- | |
| 56057-93-3 | Pyridine, 2-methyl-5-(1-methylethenyl)- | |
| 90145-47-4 | Pyridine, 3-(2,2-dimethylpropyl)- | |
| 1815-99-2 | Pyridine, 4-decyl- | |
| 862079-91-2 | Pyridine, 4-[1(4-,5 or 6)-methylbicyclo[2.2.1]hept-5-en-2-yl]- | |
| 125352-06-9 | Pyridine, 4-ethenyl-, reaction products with 3a,4,7,7a-tetrahydrodimethyl-4,7-methano-1H-indene | |
| 710-40-7 | Pyridine, 5-hexyl-2-methyl- | |
| 8030-97-5 | Pyroligneous acid | |
| 8028-47-5 | Pyroligneous acid extract | |
| 127-17-3 | Pyruvic acid | |
| 68424-85-1 | Quaternary ammonium compounds, benzyl-C12-16-alkyldimethyl, chlorides | |
| 68391-01-5 | Quaternary ammonium compounds, benzyl-C12-18-alkyldimethyl, chlorides | |
| 61789-71-7 | Quaternary ammonium compounds, benzylcoco alkyldimethyl, chlorides | |
| 1352745-21-1 | Quinoline, 5,6,7,8-tetrahydro-8-(1-methylpropyl)- | |
| 8002-13-9 | Rape oil | H2.50 |
| 8008-51-3 | Ravintsara oil | E2.12 |
| Reaction mass of butanoic acid, 2-ethyl-2,3,3-trimethyl-, ethyl ester and butanoic acid, 2,3-dimethyl-2-(1-methylethyl)-,ethyl ester and pentanoic acid, 2,2,4,4-tetramethyl-, ethyl ester and ethyl 2,2,3,3-tetramethylpentanoate and ethyl 2,2,3,4-tetramethy | ||
| 68917-51-1 | Red seaweed CO2 extract | I2.27 |
| 68648-53-3 | Resin acids and rosin acids, hydrogenated, esters with triethylene glycol | |
| 6812-78-8 | Rhodinol | |
| 141-11-7 | Rhodinyl acetate | |
| 141-15-1 | Rhodinyl butyrate | |
| 141-09-3 | Rhodinyl formate | |
| 10486-14-3 | Rhodinyl phenylacetate | |
| 68553-81-1 | Rice absolute | H2.1 |
| 8007-01-0 | Rose absolute (centifolia) | F2.1 |
| 90106-38-0 | Rose absolute (damascena) | F2.1 |
| 93334-48-6 | Rose alba oil | F2.12 |
| 8007-01-0 | Rose centifolia CO2 extract | F2.27 |
| 8007-01-0 | Rose CO2 extract | F2.27 |
| 8007-01-0 | Rose concrete (centifolia) | F2.7 |
| 90106-38-0 | Rose concrete (damascena) | F2.7 |
| 8007-01-0 | Rose extract (centifolia) | F2.13 |
| 8007-01-0 | Rose extract (damascena) | F2.13 |
| 8007-01-0 | Rose oil | F2.51 |
| 8007-01-0 | Rose oil (centifolia) | F2.12 |
| 8007-01-0 | Rose oil (damascena) | F2.12 |
| 8007-01-0 | Rose oil (low methyleugenol) | F2.33 |
| 8007-01-0 | Rose oil, folded | F2.6 |
| 3033-23-6 | Rose oxide levo | |
| 8007-01-0 | Rose tincture (centifolia) | F2.31 |
| 8007-01-0 | Rose tincture (damascena) | F2.31 |
| 8007-01-0 | Rose water oil | F2.54 |
| 8000-25-7 | Rosemary absolute | E2.1 |
| 8000-25-7 | Rosemary extract | E2.13 |
| 8000-25-7 | Rosemary oil | E2.12 |
| 8000-25-7 | Rosemary oil, rectified | E2.24 |
| 68917-54-4 | Rosemary oils, terpene-free | E2.29 |
| 8000-25-7 | Rosemary oleoresin | E2.21 |
| 8015-77-8 | Rosewood oil | D2.12 |
| 65997-06-0 | Rosin, hydrogenated | |
| 65997-05-9 | Rosin, polymd. | |
| 72379-31-8 | Rubus idaeus alcoholate | G2.2 |
| 72379-31-8 | Rubus idaeus extract | G2.10 |
| 8014-29-7 | Rue oil | E2.12 |
| 943609-24-3 | Rum absolute | E2.1 |
| 943609-24-3 | Rum CO2 extract | E2.27 |
| 943609-24-3 | Rum CO2 extract | K2.27 |
| 8030-89-5 | Rum ether | |
| 943609-24-3 | Rum extract | E2.13 |
| 34322-09-3 | S-(1-Methylpropyl) 3-methylbut-2-enethioate | |
| 34365-79-2 | S-1-Methylethyl 3-methylbut-2-enethioate | |
| 2432-91-9 | S-2-Butyl 3-methylbutanethioate | |
| 3387-41-5 | Sabinene | |
| 81-07-2 | Saccharin | |
| 128-44-9 | Saccharine, sodium salt | |
| 8001-23-8 | Safflower oil | H2.50 |
| 8022-19-3 | Saffron absolute | F2.1 |
| 8022-19-3 | Saffron distillate | F2.8 |
| 8022-19-3 | Saffron extract | F2.13 |
| 8022-56-8 | Sage Dalmatian oil | E2.12 |
| 8022-56-8 | Sage Dalmatian oil | F2.12 |
| 8022-56-8 | Sage Dalmatian oil terpeneless | F2.29 |
| 8022-56-8 | Sage oil, Spanish | E2.12 |
| 90-02-8 | Salicylaldehyde | |
| 8006-87-9 | Sandalwood CO2 extract | D2.27 |
| 1070895-66-7 | Sandalwood extract | D2.13 |
| 8006-87-9 | Sandalwood oil | D2.12 |
| 1070895-66-7 | Sandalwood oil | D2.12 |
| 8024-35-9 | Sandalwood oil, Australian | D2.12 |
| 8024-35-9 | Sandalwood oil, Australian, rectified | D2.24 |
| 11031-45-1 | Santalol | |
| 1323-00-8 | Santalyl acetate | |
| 1365254-19-8 | Sarcocaulon mossamedense extract | D2.13 |
| 1365254-19-8 | Sarcocaulon mossamedense resinoid | D2.26 |
| 8016-68-0 | Savory summer oil | E2.12 |
| 90106-57-3 | Savory winter oil | E2.12 |
| 68917-52-2 | Schinus molle absolute | G2.1 |
| 68917-52-2 | Schinus molle oil | G2.12 |
| 68917-52-2 | Schinus molle oil CO2 extract | G2.27 |
| 68917-52-2 | Schinus molle oil terpenless | G2.29 |
| 68917-52-2 | Schinus molle oil, rectified | G2.24 |
| 949495-68-5 | Schinus terebenthifolius CO2 extract | G2.27 |
| 949495-68-5 | Schinus terebinthifolius leaf oil | E2.12 |
| 949495-68-5 | Schinus terebinthifolius oil | G2.12 |
| 515-03-7 | Sclareol | |
| 564-20-5 | Sclareolide | |
| 8023-80-1 | Scotch broom absolute | F2.1 |
| 8023-80-1 | Scotch broom absolute | E2.1 |
| 8023-80-1 | Scotch broom oil | E2.13 |
| 2679-87-0 | sec-Butyl ethyl ether | |
| 68198-80-1 | sec-Butylquinoline | |
| 8008-74-0 | Sesame seed absolute | H2.1 |
| 8008-74-0 | Sesame seed CO2 extract | H2.27 |
| 8008-74-0 | Sesame seed distillate | H2.8 |
| 8008-74-0 | Sesame seed oil | H2.50 |
| 91080-23-8 | Shea butter | H2.19 |
| 102242-62-6 | Sichuan pepper CO2 extract | H2.27 |
| 68611-44-9 | Silane, dichlorodimethyl-, reaction products with silica | |
| 7631-86-9 | Silica | |
| 112926-00-8 | Silica gel, pptd., cryst.-free | |
| 63148-62-9 | Siloxanes and silicones, di-Me | |
| 845276-94-0 | Siparuna guianensis oil | E2.12 |
| 34322-06-0 | S-Isopropyl 3-methylthiobutyrate | |
| 83-34-1 | Skatole | |
| 127-09-3 | Sodium acetate | |
| 532-32-1 | Sodium benzoate | |
| 7647-14-5 | Sodium chloride | |
| 68-04-2 | Sodium citrate | |
| 1310-73-2 | Sodium hydroxide | |
| 7757-82-6 | Sodium sulphate | |
| 1338-43-8 | Sorbitan monooleate | |
| 26266-58-0 | Sorbitan, tri-(9Z)-9-octadecenoate | |
| 8001-22-7 | Soybean oil | H2.50 |
| 8008-79-5 | Spearmint absolute | E2.1 |
| 8008-79-5 | Spearmint CO2 extract | E2.27 |
| 8008-79-5 | Spearmint extract | E2.13 |
| 8008-79-5 | Spearmint oil | E2.12 |
| 8008-79-5 | Spearmint oil terpenes | E2.30 |
| 91770-24-0 | Spearmint oil, 60% | E2.24 |
| 8008-79-5 | Spearmint oil, rectified | E2.24 |
| 91770-24-0 | Spearmint oil, Scotch | E2.12 |
| 91770-24-0 | Spearmint oil, Scotch, rectified | E2.24 |
| 68917-46-4 | Spearmint oil, terpeneless | E2.29 |
| 8016-78-2 | Spike lavender oil | F2.12 |
| 8022-22-8 | Spikenard oil | A2.12 |
| 68917-48-6 | Spinach absolute | E2.1 |
| 154171-76-3 | Spiro[1,3-dioxolane-2,8'(5'H)-[2H-2,4a]methanonaphthalene], hexahydro-1',1',5',5'-tetramethyl- | |
| 154171-77-4 | Spiro[1,3-dioxolane-2,8'(5'H)-[2H-2,4a]methanonaphthalene],hexahydro-1',1',5',5'-tetramethyl-, [2'S-(2'.alpha.,4'a.alpha.,8'a.alpha.)]- | |
| 744266-61-3 | Spiro[5.5]undec-8-en-1-ol, 2, 2, 9, 11-tetramethyl-, acetate, (6R,11R)-rel-(9CI) | |
| 502847-01-0 | Spiro[5.5]undec-8-en-1-one, 2,2,7,9-tetramethyl- | |
| 188199-50-0 | Spiro[bicyclo[2.2.1]heptane-s,4'-[1,2]dioxane], 1,7,7-trimethyl-2'-(methylethyl)-, (1R,2S,2'S,4R) | |
| 121251-67-0 | Spiro[bicyclo[4.1.0]heptane-2,5'-[1,3]dioxane], 2',2',3,7,7-pentamethyl-, (1.alpha.,3.alpha.,6.alpha.)- | |
| 121251-68-1 | Spiro[bicyclo[4.1.0]heptane-2,5'-[1,3]dioxane], 2',2',3,7,7-pentamethyl-, (1.alpha.,3.beta.,6.alpha.)- | |
| 678981-31-2 | Spiro{5.5}undec-8-en-1-ol,2,2,9,11-tetramethyl-,1-acetate | |
| 8008-80-8 | Spruce oil, Black | E2.12 |
| 111-02-4 | Squalene | |
| 68952-43-2 | Star anise CO2 extract | H2.27 |
| 68952-43-2 | Star anise extract | H2.13 |
| 68952-43-2 | Star anise oil | H2.12 |
| 68952-43-2 | Star anise oil terpenes | H2.30 |
| 68952-43-2 | Star anise oil, rectified | H2.24 |
| 9005-25-8 | Starch | |
| 52906-93-1 | Starch, hydrogen octenylbutanedioate | |
| 57-11-4 | Stearic acid | |
| 1406-57-1 | Stearoptenes | E2.19 |
| 68555-08-8 | Steroids, hydroxy | |
| 84012-40-8 | Stinging nettle absolute | F2.1 |
| 91845-51-1 | Storax (balsam), American, saponified | |
| 4719-04-4 | s-Triazine-1,3,5(2H,4H,6H)-triethanol | |
| 8024-01-9 | Styrax absolute | K2.1 |
| 8046-19-3 | Styrax absolute (low sytrene) | K2.33 |
| 8046-19-3 | Styrax absolute, Honduras | K2.1 |
| 8024-01-9 | Styrax distillate | K2.8 |
| 8046-19-3 | Styrax essence pyrogenated | K2.9.1 |
| 8046-19-3 | Styrax extract | K2.13 |
| 8046-19-3 | Styrax oil | K2.12 |
| 8046-19-3 | Styrax oil, Honduras | K2.9 |
| 8024-01-9 | Styrax oil, Oriental | K2.12 |
| 8024-01-9 | Styrax oil, Oriental | K2.9 |
| 8024-01-9 | Styrax oil, pyrogenated | K2.9.1 |
| 8024-01-9 | Styrax oil, pyrogenated, distilled | K2.9.2 |
| 8046-19-3 | Styrax resin | K2.16 |
| 8024-01-9 | Styrax resinoid | K2.26 |
| 8046-19-3 | Styrax resinoid | K2.26 |
| 104376-75-2 | Styrenated alpha-hydro-omega-phenoxypoly(oxyethylene) | |
| 100-42-5 | Styrene | |
| 10521-96-7 | Styryl acetate | |
| 110-15-6 | Succinic acid | |
| 8013-17-0 | Sugar, invert | |
| 91722-22-4 | Sugarcane extract | E2.1.1 |
| 91722-22-4 | Sugarcane oil (distillate) | E2.12 |
| 91770-72-8 | Sugarcane, fermented, ext | |
| 7446-09-5 | Sulfur dioxide | |
| 7664-93-9 | Sulfuric acid | |
| 7757-83-7 | Sulfurous acid, sodium salt (1:2) | |
| 8001-21-6 | Sunflower oil | F2.12 |
| 666723-01-9 | Sunflower oil | F2.12 |
| 8001-21-6 | Sunflower oil | H2.50 |
| 8001-21-6 | Sunflower oil, expressed | H2.50 |
| 8029-43-4 | Syrups, hydrolyzed starch | |
| 8016-84-0 | Tagetes minuta absolute | F2.1 |
| 8016-84-0 | Tagetes minuta oil | F2.12 |
| 8016-84-0 | Tagetes minuta oil, rectified | F2.24 |
| 8016-84-0 | Tagetes minute extract | F2.13 |
| 8016-84-0 | Tagetes oil, low tertiophene | F2.33 |
| 91722-29-1 | Tagetes patula absolute | F2.1 |
| 72968-49-1 | Tamarind extract | G2.13 |
| 39386-78-2 | Tamarind seed gum | H2.15 |
| 72869-73-9 | Tangelo oil, expressed | G2.5 |
| 8016-85-1 | Tangerine oil | G2.5 |
| 8016-85-1 | Tangerine oil | G2.12 |
| 68608-38-8 | Tangerine oil terpenes | G2.30 |
| 8016-85-1 | Tangerine oil, folded | G2.6 |
| 8008-31-9 | Tangerine oil, washed | G2.23 |
| 8016-88-4 | Tarragon absolute | E2.1 |
| 8016-88-4 | Tarragon oil | E2.12 |
| 8016-88-4 | Tarragon oil (low methyleugenol) | E2.33 |
| 133-37-9 | Tartaric acid (d-, l-, dl-, meso-) | |
| 183815-52-3 | Tasmania berry CO2 extract | E2.27 |
| 950854-40-7 | Tea leaf absolute | E2.1 |
| 950854-40-7 | Tea leaf CO2 extract | E2.27 |
| 950854-40-7 | Tea leaf extract | E2.13 |
| 950854-40-7 | Tea leaf infusion | E2.31 |
| 950854-40-7 | Tea leaf oil | E2.12 |
| 68647-73-4 | Tea tree oil | E2.12 |
| 15356-74-8 | Tealactone | |
| 72230-85-4 | Terpenes and terpenoids, copaiba-oil, hydroxy, acetates | |
| 68917-57-7 | Terpenes and terpenoids, mixed sour and sweet orange oil | M2.30 |
| 1442462-94-3 | Terpenes and Terpenoids, patchouli-oil, a-guaiene fraction, oxidized | |
| 68917-63-5 | Terpenes and Terpenoids, sinpine | |
| 8000-41-7 | Terpineol | |
| 58985-02-7 | Terpineol, dihydro- | |
| 586-62-9 | Terpinolene | |
| 8007-35-0 | Terpinyl acetate (Isomer mixture) | |
| 2153-28-8 | Terpinyl butyrate | |
| 2153-26-6 | Terpinyl formate | |
| 7774-65-4 | Terpinyl isobutyrate | |
| 80-27-3 | Terpinyl propionate | |
| 629-59-4 | Tetradecane | |
| 3234-81-9 | Tetradecanoic acid, octadecyl ester | |
| 67634-08-6 | Tetrahydro-.alpha.-pentylfurfuryl acetate | |
| 13481-09-9 | Tetrahydro-2-(p-tolyloxy)-2H-pyrane | |
| 13477-62-8 | Tetrahydro-2-isobutyl-4-methyl-2H-pyrane | |
| 30310-41-9 | Tetrahydro-2-methyl-4-methylene-6-phenyl-2H-pyrane | |
| 16409-43-1 | Tetrahydro-4-methyl-2-(2-methylpropen-1-yl)pyran | |
| 94201-73-7 | Tetrahydro-4-methyl-2-phenyl-2H-pyran | |
| 131766-73-9 | Tetrahydro-4-methyl-2-propyl-2H-pyran-4-yl acetate | |
| 34686-71-0 | Tetrahydro-6-(2-pentenyl)-2H-pyran-2-one | |
| 32764-98-0 | Tetrahydro-6-(3-pentenyl)-2H-pyran-2-one | |
| 5988-91-0 | Tetrahydrogeranial | |
| 78-69-3 | Tetrahydrolinalool | |
| 20780-48-7 | Tetrahydrolinalyl acetate | |
| 41678-36-8 | Tetrahydromuguol | |
| 18479-57-7 | Tetrahydromyrcenol | |
| 1322-58-3 | Tetrahydro-pseudo-ionone | |
| 2131091-72-8 | Tetrapleura resinoid | G2.26 |
| 53850-34-3 | Thaumatin | |
| 36431-72-8 | Theaspirane | |
| 39067-80-6 | Thiogeraniol | |
| 8007-46-3 | Thyme absolute | E2.1 |
| 8007-46-3 | Thyme absolute | E2.1 |
| 8007-46-3 | Thyme oil, red | E2.12 |
| 8007-46-3 | Thyme oil, white | E2.24 |
| 85085-75-2 | Thyme, Thymus zygis, absolute | E2.1 |
| 85085-75-2 | Thyme, Thymus zygis, oil | E2.12 |
| 89-83-8 | Thymol | |
| 91770-90-0 | Timur pepper CO2 extract | G2.27 |
| 91770-90-0 | Timut pepper oil | G2.12 |
| 13463-67-7 | Titanium oxide (TiO2) | |
| 8037-19-2 | Tobacco extract | E2.13 |
| 73138-76-8 | Tobacco extract, nicotine-free | E2.13 |
| 8037-19-2 | Tobacco leaf absolute | E2.1 |
| 73138-76-8 | Tobacco oils, nicotine-free | E2.33 |
| 8024-03-1 | Tolu, balsam, extract | K2.13 |
| 8024-03-1 | Tolu, balsam, gum | K2.16 |
| 8024-03-1 | Tolu, balsam, resinoid | K2.26 |
| 1334-78-7 | Tolualdehydes (mixed o,m,p) | |
| 8024-04-2 | Tonka bean absolute | H2.1 |
| 8024-04-2 | Tonka bean CO2 extract | H2.27 |
| 8024-04-2 | Tonka bean extract | H2.13 |
| 8024-04-2 | Tonka bean resinoid | H2.26 |
| 8024-04-2 | Tonka bean tincture | H2.31 |
| 1370711-06-0 | trans-1-Ethyl-2-methyl propyl 2-butenoate | |
| 3913-81-3 | trans-2-Decenal | |
| 13419-69-7 | trans-2-Hexenoic acid | |
| 928-95-0 | trans-2-Hexenol | |
| 2497-18-9 | trans-2-Hexenyl acetate | |
| 53398-83-7 | trans-2-Hexenyl butyrate | |
| 53398-86-0 | trans-2-Hexenyl hexanoate | |
| 53398-80-4 | trans-2-Hexenyl propionate | |
| 59324-17-3 | trans-2-Methyl-4-propyl-1,3-oxathiane | |
| 31502-14-4 | trans-2-Nonen-1-ol | |
| 18829-56-6 | trans-2-Nonenal | |
| 2548-87-0 | trans-2-Octenal | |
| 7069-41-2 | trans-2-Tridecenal | |
| 53448-07-0 | trans-2-Undecenal | |
| 67801-45-0 | trans-3-Heptenyl 2-methylpropanoate | |
| 3681-82-1 | trans-3-Hexenyl acetate | |
| 65405-70-1 | trans-4-Decen-1-al | |
| 21862-63-5 | trans-4-tert-Butylcyclohexanol | |
| 4180-23-8 | trans-Anethole | |
| 140-10-3 | trans-Cinnamic acid | |
| 928-97-2 | trans-Hex-3-en-1-ol | |
| 1189-09-9 | trans-Methylgeranate | |
| 40716-66-3 | trans-Nerolidol | |
| 89-80-5 | trans-p-Menthan-3-one | |
| 68648-41-9 | Treemoss absolute low atranol | B2.1.2 |
| 77-90-7 | Tributyl acetylcitrate | |
| 90-17-5 | Trichloromethyl phenyl carbinyl acetate | |
| 638-67-5 | Tricosane | |
| 122760-84-3 | Tricyclo[3.3.1.1.(3.7)]decan-2-ol, 4-methyl-8-methylene- | |
| 2500-83-6 | Tricyclo[5.2.1.02,6]dec-4-en-8-yl acetate | |
| 13380-94-4 | Tricyclo[5.2.1.02,6]decan-8-one | |
| 26896-48-0 | Tricyclo[5.2.1.02,7]decane-4,8-dimethanol | |
| 64001-15-6 | Tricyclodecanyl acetate | |
| 5413-60-5 | Tricyclodecenyl acetate | |
| 17511-60-3 | Tricyclodecenyl propionate | |
| 10486-19-8 | Tridecanal | |
| 629-50-5 | Tridecane | |
| 22629-49-8 | Tridecene-2-nitrile | |
| 102-71-6 | Triethanolamine | |
| 77-93-0 | Triethyl citrate | |
| 112-27-6 | Triethyleneglycol | |
| 68845-35-2 | Triethyltrimethyl-2-cyclohexen-1-one | |
| 71735-79-0 | Trimethyl-13-oxabicyclo[10.1.0]trideca-4,8-diene | |
| 133636-82-5 | Trimethyl-bicyclo-heptane-spirocyclohexenone | |
| 538-23-8 | Trioctanoin | |
| 31570-04-4 | Tris(2,4-di-(tert)-butylphenyl) phosphate | |
| 220410-74-2 | Tris(tetramethylhydroxypiperidinol) citrate | |
| 8024-05-3 | Tuberose absolute | F2.1 |
| 8024-05-3 | Tuberose concrete | F2.7 |
| 8024-05-3 | Tuberose extract | F2.13 |
| 8024-05-3 | Tuberose oil | F2.12 |
| 8024-05-3 | Tuberose tincture | F2.31 |
| 8024-37-1 | Turmeric | A2.19 |
| 8024-37-1 | Turmeric leaf oil | E2.12 |
| 8024-37-1 | Turmeric oil | A2.12 |
| 8024-37-1 | Turmeric oil CO2 extract | A2.27 |
| 8024-37-1 | Turmeric oleoresin | A2.21 |
| 9005-90-7 | Turpentine gum | K2.16 |
| 8006-64-2 | Turpentine oil | K2.12 |
| 8006-64-2 | Turpentine oil, rectified | K2.24 |
| 53179-04-7 | Undec-10-enonitrile | |
| 112-44-7 | Undecanal | |
| 1120-21-4 | Undecane | |
| 2244-07-7 | Undecanenitrile | |
| 112-37-8 | Undecanoic acid | |
| 30207-98-8 | Undecanol | |
| 112-43-6 | Undecen-1-ol | |
| 1337-83-3 | Undecenal | |
| 112-42-5 | Undecyl alcohol | |
| 57-13-6 | Urea | |
| 4630-07-3 | Valencene | |
| 110-62-3 | Valeraldehyde | |
| 8008-88-6 | Valerian root oil | A2.12 |
| 109-52-4 | Valeric acid | |
| 8024-06-4 | Vanilla absolute | G2.1 |
| 8024-06-4 | Vanilla CO2 extract | G2.27 |
| 8024-06-4 | Vanilla extract | G2.13 |
| 8024-06-4 | Vanilla oleoresin | G2.21 |
| 953789-39-4 | Vanilla tahitensis absolute | G2.1 |
| 953789-39-4 | Vanilla tahitensis CO2 extract | G2.27 |
| 953789-39-4 | Vanilla tahitensis infusion | G2.31 |
| 8047-24-3 | Vanilla tincture | G2.31 |
| 121-33-5 | Vanillin | |
| 20665-85-4 | Vanillin isobutyrate | |
| 68527-74-2 | Vanillin propylene glycol acetal | |
| 82654-98-6 | Vanillyl butyl ether | |
| 13184-86-6 | Vanillyl ethyl ether | |
| 120-14-9 | Veratraldehyde | |
| 8024-12-2 | Verbena absolute | E2.1 |
| 8016-96-4 | Vetiver CO2 extract | A2.27 |
| 8016-96-4 | Vetiver extract | A2.13 |
| 8016-96-4 | Vetiver oil | A2.12 |
| 68917-65-7 | Vetiver oil terpenes | A2.30 |
| 68917-34-0 | Vetiver oil, acetylated, distilled. | |
| 8016-96-4 | Vetiver oil, JAVA (low Furfural) | A2.33 |
| 8016-96-4 | Vetiver oil, rectified | A2.24 |
| 84082-84-8 | Vetiveria zizanioides, ext., acetylated | |
| 68129-81-7 | Vetiverol | |
| 73246-97-6 | Vetiverol acetate, distilled | |
| 62563-80-8 | Vetiverol, acetate | |
| 117-98-6 | Vetiveryl acetate | |
| 8024-08-6 | Violet leaf absolute | E2.1 |
| 8024-08-6 | Violet leaf extract | E2.13 |
| 7732-18-5 | Water | |
| 84012-44-2 | Wheat extract | H2.13 |
| 84012-44-2 | Wheat oil | H2.50 |
| 8042-47-5 | White mineral oil, petroleum | |
| 8016-21-5 | Wine lees CO2 extract | G2.27 |
| 8016-21-5 | Wine lees oil, green | G2.12 |
| 8016-21-5 | Wine lees oil, white | G2.12 |
| 8016-21-5 | Wine lees oil, white, rectified | G2.24 |
| 68917-75-9 | Wintergreen extract | E2.13 |
| 68917-75-9 | Wintergreen oil | E2.12 |
| 8008-93-3 | Wormwood oil | E2.12 |
| 73138-77-9 | Wormwood oil, terpeneless | E2.29 |
| 11138-66-2 | Xanthan gum | |
| 3520-42-1 | Xanthylium, 3,6-bis(diethylamino)-9-(2,4-disulfophenyl)-, inner salt, sodium salt (1:1) | |
| 1330-20-7 | Xylene (mixed) | |
| 8002-09-3 | Yarmor pine oil terpenes | E2.30 |
| 8002-09-3 | Yarmor Pine oil, synthetic | |
| 8022-07-9 | Yarrow oil | E2.12 |
| 8006-81-3 | Ylang ylang absolute | F2.1 |
| 8006-81-3 | Ylang ylang oil | F2.12 |
| 8006-81-3 | Ylang ylang oil (low para cresol methylether) | F2.33 |
| 8006-81-3 | Ylang ylang oil extra | F2.12 X |
| 8006-81-3 | Ylang ylang oil I | F2.12.1 |
| 8006-81-3 | Ylang ylang oil II | F2.12.2 |
| 8006-81-3 | Ylang ylang oil III | F2.12.3 |
| 8006-81-3 | Ylang ylang oil, rectified | F2.24 |
| 68952-44-3 | Ylang ylang oil, terpene-free | F2.29 |
| 8006-81-3 | Ylang-ylang extract | F2.13 |
| 8006-81-3 | Ylang-ylang infusion | F2.31 |
| 1009814-14-5 | Yuzunone | |
| 102242-62-6 | Zanthoxylum piperitum extract | G2.13 |
| 1314-13-2 | Zinc oxide (zno) | |
| 122-48-5 | Zingerone | |
| 546-80-5 | α-Thujone |
