

The IFRA Transparency List is an ordered register of all fragrance ingredients used in consumer goods by the fragrance industry’s customers worldwide.
It represents a snapshot of all the ingredients used in active formulas at the time of publication. This also includes those used in very small quantities or only in certain countries or regions.
Scroll down to find out more and view the List
There are two main types of ingredient on the List.
Fragrance ingredients are basic substances used for odor or malodor coverage.
Functional ingredients are substances that are not used to provide odor or malodor coverage, but which are essential for the functionality or durability of a fragrance compound – such as an antioxidant, preservative, diluent, solvent or color.
The IFRA Transparency List is based on reporting provided by IFRA Members in the ‘Volume of Use Survey’, which is compiled every five years. This reporting comprises all ingredients going into fragrance compounding for a given year.
In line with our anti-trust obligations, the Survey is anonymous and confidential. As well as helping us to develop the IFRA Transparency List, the data provided by the Survey is used for the industry’s safety assessment program managed by the Research Institute for Fragrance Materials (RIFM).
The number of ingredients on this List is greater than in previous years largely due to the introduction of a new, more refined nomenclature system for natural products. These products can have various geographical origins, be extracted via different processes, and come from different parts of the plant.
We therefore employ a system that provides greater detail and transparency than the Chemical Abstracts Service (CAS) number system.
In addition, general increases or decreases in the Transparency List should be expected as it is based on a single year of industry activity.
Manufacturers are responsible for the safety of the ingredients they use in their products.
The ingredients reported in the Volume of Use Survey appear on the IFRA Transparency List and are also used for the industry’s safety assessment program, managed by RIFM. As part of this program, RIFM manages a list of ‘non-supported’ materials.
It is important to note that a material being non-supported does not mean that it is unsafe. Instead, it means that RIFM has not received a sample or concentration data, and so cannot conduct its own safety assessment. For non-supported materials a number may no longer be in use as such (the current list having been based on use in 2015).
Once a material is on the non-supported list, RIFM takes a series of steps to gather data from the primary user or the industry at large.
Should the information not be provided, the material is removed from the safety assessment program and has its RIFM identity number removed. IFRA is informed, and may or may not implement risk management measures.
In all cases, companies must demonstrate safety of the products they place on the market. This can be shown via a company safety assessment.
However, as the representative body of the global fragrance industry, IFRA encourages members to have as many materials as possible assessed in the RIFM program as a way of reinforcing the risk assessment and management process.
CAS number | Principal name | Additional information |
---|---|---|
854373-70-9 | ||
5365-06-0 | ||
854373-71-0 | ||
5120-20-7 | ||
93821-14-8 | ||
4221-98-1 | (-)-(R)-.alpha.-Phellandrene | |
512-13-0 | (-)-.alpha.-Fenchol | |
489-40-7 | (-)-.alpha.-Gurjunene | |
36275-29-3 | (-)-1,7,7-Trimethyl-3-(phenylmethylene)bicyclo(2.2.1)heptane-2-one | |
23986-74-5 | (-)-Germacrene D | |
489-86-1 | (-)-Guaiol | |
13837-56-4 | (.+-.)-Tetrahydro-2,6,6-trimethyl-2-vinyl-2H-pyrane | |
1117-61-9 | (+)-(R)-Citronellol | |
4610-11-1 | (+)-cis-Rose oxide | |
888021-82-7 | (+-)-Ethyl 3-mercapto-2-methylbutanoate | |
17957-94-7 | (+)-Menthofuran | |
2216-52-6 | (+)-Neomenthol | |
87-69-4 | (+)-Tartaric acid | |
67663-01-8 | (+/-) 3-Methyl-gamma-decalactone | |
156472-94-5 | (+/-) Ethyl 3-mercaptobutyrate | |
258823-39-1 | (+/-)2-Mercapto-2-methylpentan-1-ol | |
58475-04-0 | (+/-)-4-Ethyloctanal | |
1120363-98-5 | (+/-)-5-Isopropyl-2,6-diethyl-2-methyltetrahydro-2H-pyran | |
1120363-98-5 | (+/-)-5-Isopropyl-2,6-diethyl-2-methyltetrahydro-2H-pyran | |
15892-23-6 | (+/-)-Butan-2-ol | |
15932-80-6 | (+/-)-Pulegone | |
10138-32-6 | (±)-Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, ethyl ester | |
68877-29-2 | (1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol | |
35145-02-9 | (1a,2a,5a)-2,5-dimethylcyclohex-3-ene-1-carbaldehyde | |
94400-98-3 | (1a.alpha.,4.alpha.,7a.alpha.)-1a,3,3,4,6,6-Hexamethyl-1a,2,3,4,5,6,7,7a-octahydronapth[3,3-b]oxirene | |
389083-83-4 | (1-Ethoxyethoxy)-cyclododecane | |
35836-73-8 | (1R)-Nopol | |
35836-72-7 | (1R)-Nopyl acetate | |
68489-09-8 | (1R,2S,5R)-N-(4-Methoxyphenyl)-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide | |
29461-13-0 | (2.alpha.,4a.alpha.,8.beta.)-Hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalene-8(5H)-one | |
5331-14-6 | (2-Butoxyethyl)benzene | |
23726-93-4 | (2E)-1-(2,6,6-Trimethyl-1,3-cyclohexadien-1-yl)-2-buten-1-one | |
23726-91-2 | (2E)-1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one | |
67674-47-9 | (2E,6E)-Nona-2,6-dienyl acetate | |
28069-72-9 | (2E,6Z)-Nona-2,6-dien-1-ol | |
116044-44-1 | (2-endo,3-exo)-Ethyl 3-(1-methylethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate | |
61826-52-6 | (2S)-1,3,4,5,6,7-Hexahydro-1,1,5,5-tetramethyl-2H-2,4a-methanonaphthalene-8-methyl formate | |
59739-63-8 | (2Z)-1-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)-2-Buten-1-one, | |
67674-37-7 | (2Z,6Z)-1,1-Diethoxynona-2,6-diene | |
81836-13-7 | (3a.alpha.,4.alpha.,6.alpha.,7.alpha.,7a.alpha.)-3a,4,5,6,7,7a-Hexahydro-3-methyl-5-methylene-4,7-methano-1H-inden-6-yl acetate | |
120811-92-9 | (3-Methoxy-2-methylpropyl)benzene | |
124071-43-8 | (3-Z)-3,12-Tridecadienenitrile | |
92046-48-5 | (4-Ethylbicyclo[2.2.1]hept-2-yl)-cyclohexanol | |
71172-26-4 | (4-Methoxyphenyl)methyl isobutyrate | |
67845-46-9 | (4-Methylphenoxy)acetaldehyde | |
3288-99-1 | (4-tert-Butylphenyl)acetonitrile | |
1071801-01-8 | (4Z)-4-Dodecenenitrile | |
79-77-6 | (E)-.beta.-Ionone | |
97358-54-8 | (E)-1-(1-Methoxypropoxy)hex-3-ene | |
39872-57-6 | (E)-1-(2,4,4-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one | |
24720-09-0 | (E)-1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one | |
22882-91-3 | (E)-1-Ethoxy-3,7-dimethylocta-2,6-diene | |
65737-52-2 | (E)-2-(2-Octenyl)cyclopentanone | |
58001-88-0 | (E)-2,6,10-Trimethylundeca-5,9-dienol | |
18409-17-1 | (E)-2-Octen-1-ol | |
37973-51-6 | (E)-2-Phenylpropenyl acetate | |
81786-74-5 | (E)-3,4,5,6,6-Pentamethylhept-3-en-2-one | |
3681-73-0 | (E)-3,7-Dimethyl-2,6-octadienyl-hexadecanoate | |
1309389-73-8 | (E)-3-Benzo[1,3]dioxol-5-yl-N,N-diphenyl-2-propenamide | |
53243-60-0 | (E)-3-Methyl-5-phenylpent-2-enenitrile | |
3239-35-8 | (E)-6,10-Dimethylundeca-5,9-dien-2-yl acetate | |
33046-81-0 | (E)-7-Methyl-3-octen-2-one | |
19093-20-0 | (E)-Oct-5-en-2-one | |
68555-65-7 | (E,Z)-2,6-Nonadien-1-ol acetate | |
14898-79-4 | (R)-Butan-2-ol | |
4221-99-2 | (S)-Butan-2-ol | |
400052-49-5 | (S1)-Methoxy-3-heptanethiol | |
102-76-1 | (tri-)Acetin | |
97358-55-9 | (Z)-1-(1-Methoxypropoxy)hex-3-ene | |
22882-89-9 | (Z)1-Ethoxy-3,7-dimethylocta-2,6-diene | |
1576-95-0 | (Z)-2-Penten-1-ol | |
37973-52-7 | (Z)-2-Phenylpropenyl acetate | |
81786-73-4 | (Z)-3,4,5,6,6-Pentamethylhept-3-en-2-one | |
84060-80-0 | (Z)-3-Hexenyl angelate | |
53243-59-7 | (Z)-3-Methyl-5-phenylpent-2-enenitrile | |
21944-98-9 | (Z)-4-Dodecenal | |
6191-71-5 | (Z)-4-Hepten-1-ol | |
63095-33-0 | (Z)-5-(3-Hexenyl)dihydrofuran-2(3H)-one | |
3239-37-0 | (Z)-6,10-Dimethylundeca-5,9-dien-2-yl acetate | |
23726-92-3 | (Z)-beta-1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one | |
53398-85-9 | (Z)-Hex-3-enyl 2-methylbutyrate | |
76238-22-7 | (Z)-Non-6-enyl acetate | |
143-28-2 | (Z)-Octadec-9-enol | |
63449-64-9 | (Z,Z)-1,1'-[Ethylidenebis(oxy)]di(hex-3-ene) | |
20834-59-7 | .alpha.,.alpha.,4-Trimethylphenethyl alcohol | |
33885-52-8 | .alpha.,.alpha.,6,6-Tetramethylbicyclo[3.1.1]hept-2-ene-2-propionaldehyde | |
93917-67-0 | .alpha.,.gamma.,.gamma.-Trimethylcyclohexylpropyl acetate | |
66062-78-0 | .alpha.,3,3-Trimethylbicyclo[2.2.1]heptane-2-methanol | |
515-69-5 | .alpha.-Bisabolol | |
63767-86-2 | .alpha.-Methyl-4-(1-methylethyl)-cyclohexanemethanol | |
13487-27-9 | .alpha.-Methylcyclohexylmethyl acetate | |
103694-68-4 | .beta.,.beta.,3-Trimethyl benzenepropanol | |
7235-40-7 | .beta.,.beta.-Carotene | |
6784-13-0 | .beta.,4-Dimethylcyclohex-3-ene-1-propan-1-al | |
472-97-9 | .beta.-Caryophyllene alcohol | |
67801-36-9 | .Eta.-1H-Indol-1-yl-.alpha.,.alpha.,.epsilon.-trimethyl-1H-indole-1-heptanol | |
94248-38-1 | [(3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5(or 6)-yl)oxy]acetaldehyde | |
68039-73-6 | [1,1'-Bicyclopentyl]-2-yl 2-butenoate | |
71048-82-3 | [1.alpha.(E),2.beta.]-1-(2,6,6-Trimethyl-3-cyclohexen-1-yl)-2-buten-1-one | |
80858-47-5 | [2-(Cyclohexyloxy)ethyl]benzene | |
68555-28-2 | [2,2-Bis(3-methylbutoxy)ethyl]benzene | |
67634-02-0 | [2,2-Bis[(3,7-dimethyl-2,6-octadienyl)oxy]ethyl]benzene | |
67634-04-2 | [2,2-Bis[(3,7-dimethyloct-6-enyl)oxy]ethyl]benzene | |
68039-47-4 | [2-Isopropoxyethyl]benzene | |
1378867-81-2 | 1-Cyclohexene-1-propanal, 4-(1-methylethyl)-, (4R) | |
1378867-81-2 | 1-Cyclohexene-1-propanal, 4-(1-methylethyl)-, (4R) | |
2425-77-6 | 1-Decanol, 2-hexyl- | |
661-19-8 | 1-Docosanol | |
3567-69-9 | 1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-(4-sulfo-1-naphthalenyl)diazenyl]-, sodium salt (1:2) | |
1958027-44-5 | 1-Nonen-3-ol, 8-methoxy-4,8-dimethyl- | |
84398-38-9 | 1-Penten-3-ol, 1-(6-ethenylbicyclo[2.2.1]hept-2-yl)-2-methyl- | |
54464-57-2 | 1-(1,2,3,4,5,6,7,8-Octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)ethanone | |
68155-67-9 | 1-(1,2,3,4,6,7,8,8a-Octahydro-2,3,8,8-tetramethyl-2-naphthyl)ethan-1-one | |
74499-60-8 | 1-(1,2,3,4-Tetrahydro-4,4-dimethyl-1-naphthyl)propan-1-one | |
68155-66-8 | 1-(1,2,3,5,6,7,8,8a-Octahydro-2,3,8,8-tetramethyl-2-naphthyl)ethan-1-one | |
29911-27-1 | 1-(1-Methyl-2-propoxyethoxy)propan-2-ol | |
941-98-0 | 1-(1-Naphthyl)ethanone | |
70788-30-6 | 1-(2,2,6-Trimethylcyclohexyl)-3-hexanol | |
35087-49-1 | 1-(2,2-Dimethyl-6-methylenecyclohexyl)but-2-en-1-one | |
68039-35-0 | 1-(2,3,4,7,8,8a-Hexahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-5-yl)ethan-1-one | |
13144-88-2 | 1-(2,4,4,5,5-Pentamethyl-1-cyclopenten-1-yl)ethan-1-one | |
70266-48-7 | 1-(2,4,4-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one | |
33673-71-1 | 1-(2,4,4-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one | |
69929-17-5 | 1-(2,4-Dimethyl-3-cyclohexenyl)-2,2-dimethylpropan-1-one | |
7779-30-8 | 1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)pent-1-en-3-one | |
23696-85-7 | 1-(2,6,6-Trimethylcyclohexa-1,3-dienyl)-2-buten-1-one | |
1646-26-0 | 1-(2-Benzofuranyl)ethanone | |
29911-28-2 | 1-(2-Butoxypropoxy)-propan-2-ol | |
526218-21-3 | 1-(2-Methylprop-2-enoloxy)-2,2,4-trimethylpentan-3-ol | |
139504-68-0 | 1-(2-tert.-Butyl cyclohexyloxy)-2-butanol | |
42370-07-0 | 1-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)ethane-1-one | |
25304-14-7 | 1-(3,3-Dimethylcyclohexyl)ethan-1-one | |
25225-09-6 | 1-(3,3-Dimethylcyclohexyl)ethanol | |
56973-87-6 | 1-(3,3-Dimethylcyclohexyl)pent-4-en-1-one | |
68480-14-8 | 1-(3,5,6-Trimethyl-3-cyclohexen-1-yl)ethan-1-one | |
23911-56-0 | 1-(3-Methyl-2-benzofuranyl)ethanone | |
27113-22-0 | 1-(4-Hydroxy-3-methoxyphenyl)decan-3-one | |
27113-22-0 | 1-(4-Hydroxy-3-methoxyphenyl)decan-3-one | |
16556-48-2 | 1-(4-Methoxy-2,2,6,6-tetramethyl-3-cyclohexen-1-yl)ethan-1-one | |
56973-85-4 | 1-(5,5-Dimethyl-1-cyclohexen-1-yl)pent-4-en-1-one | |
774-55-0 | 1-(5,6,7,8-tetrahydro-2-naphthalenyl)ethanone | |
1506-02-1 | 1-(5,6,7,8-Tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthyl)ethan-1-one (Fixolid) | |
10152-77-9 | 1-(Methylthio)-1-propene | |
1333-52-4 | 1-(Naphthyl)ethan-1-one | |
31375-17-4 | 1-(para-Menthen-6-yl)-1-propanone | |
122-84-9 | 1-(p-Methoxyphenyl)-2-propanone | |
5343-92-0 | 1,2-Pentanediol | |
70445-33-9 | 1,2-Propanediol, 3-[(2-ethylhexyl)oxy]- | |
18996-35-5 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, sodium salt (1:1) | |
72152-84-2 | 1,3-Cyclohexadiene-1-carbonitrile, 2,6,6-trimethyl- | |
100520-15-8 | 1,3-Cyclohexadiene-1-carboxylic acid, 4,6,6-trimethyl-, ethyl ester | |
6358-69-6 | 1,3,6-Pyrenetrisulfonic acid, 8-hydroxy-, sodium salt (1:3) | |
900779-74-0 | 1,5-Cyclododecadiene, 9-methoxy-1,6,10-trimethyl- | |
947237-75-4 | 1,5-Cyclododecadiene, 9-methoxy-1,6,10-trimethyl- | |
53834-70-1 | 1,5,7-Octatrien-3-ol, 3,7-dimethyl-, (5E)- | |
39707-47-6 | 1,6-Octadiene-3-thiol, 3,7-dimethyl- | |
67801-37-0 | 1,1'-(2-Phenylethylidene)bis(1H-indole) | |
3910-35-8 | 1,1,3-Trimethyl-3-phenylindane | |
86198-35-8 | 1,1-Diethoxy-3,5,5-trimethylhexane | |
34764-02-8 | 1,1-Diethoxydecane | |
688-82-4 | 1,1-Diethoxyheptane | |
3658-93-3 | 1,1-Diethoxyhexane | |
69178-43-4 | 1,1-Diethoxyisooctane | |
33673-65-3 | 1,1-Dihexyloxyhexane | |
950-33-4 | 1,1-Dimethoxycyclododecane | |
534-15-6 | 1,1-Dimethoxyethane | |
151-05-3 | 1,1-Dimethyl-2-phenylethyl acetate | |
59354-71-1 | 1,1-Dimethyl-2-phenylethyl isobutyrate | |
89-88-3 | 1,2,3,3a,4,5,6,8a-Octahydro-4,8-dimethyl-2-(1-methylethylidene)-6-azulenol | |
41199-19-3 | 1,2,3,4,4a,5,6,7-Octahydro-2,5,5-trimethyl-2-naphthalenol | |
65405-72-3 | 1,2,3,4,4a,7,8,8a-Octahydro-2,4a,5,8a-tetramethyl-1-naphthyl formate | |
22690-27-3 | 1,2,3,4,5,6,7,8,9,10-Decahydro-5,9-methanobenzocycloocten-11-one | |
68991-96-8 | 1,2,3,4,5,6,7,8-Octahydro-5,5-dimethylnaphthalene-2-carbaldehyde | |
68991-97-9 | 1,2,3,4,5,6,7,8-Octahydro-8,8-dimethyl-2-naphthaldehyde | |
172820-60-9 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ethyl ester | |
866-84-2 | 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, tripotassium salt | |
25395-31-7 | 1,2,3-Propanetriol, diacetate | |
28553-12-0 | 1,2-Benzenedicarboxylic acid, 1,2-diisononyl ester | |
71888-89-6 | 1,2-Benzenedicarboxylic acid, di-C6-8-branched alkyl esters, C7-rich | |
68515-48-0 | 1,2-Benzenedicarboxylic acid, diisononyl ester | |
98-29-3 | 1,2-Benzenediol, 4-(1,1-dimethylethyl)- | |
2634-33-5 | 1,2-Benzisothiazol-3(2H)-one | |
33079-56-0 | 1,2-Cyclopentanedione, 3,4,4-trimethyl- | |
1119-86-4 | 1,2-Decanediol | |
67715-79-1 | 1,2-Di((1'-ethoxy)ethoxy)propane | |
91-16-7 | 1,2-Dimethoxybenzene | |
6920-22-5 | 1,2-Hexanediol | |
1117-86-8 | 1,2-Octanediol | |
13851-11-1 | 1,3,3-Trimethyl-2-norbornanyl acetate | |
1222-05-5 | 1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylcyclopenta-gamma-2-benzopyran | |
40601-76-1 | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris[[4-(1,1-dimethylethyl)-3-hydroxy-2,6-dimethylphenyl]methyl]- | |
9003-08-1 | 1,3,5-Triazine-2,4,6-triamine, polymer with formaldehyde | |
91-76-9 | 1,3,5-Triazine-2,4-diamine, 6-phenyl- | |
16356-11-9 | 1,3,5-Undecatriene | |
2051-85-6 | 1,3-Benzenediol, 4-(2-phenyldiazenyl)- | |
40527-42-2 | 1,3-Benzodioxole, 5-(diethoxymethyl)- | |
495-76-1 | 1,3-Benzodioxole-5-methanol | |
68844-96-2 | 1,3-Benzodioxole-5-propanol, alpha-methyl-, 5-acetate | |
107-88-0 | 1,3-Butanediol | |
1117-31-3 | 1,3-Butanediol, 1,3-diacetate | |
63270-14-4 | 1,3-Diacetoxynonane | |
80118-10-1 | 1,3-Dimethyl-3-butenyl salicylate | |
68083-58-9 | 1,3-Dimethyl-3-phenylbutyl acetate | |
80118-06-5 | 1,3-Dimethylbut-3-enyl isobutyrate | |
35206-51-0 | 1,3-Dimethylbutyl 2-butenoate | |
117933-89-8 | 1,3-Dioxane, 2-(2,4-dimethyl-3-cyclohexene-1-yl)-5-methyl-5-(1-methylpropyl)- | |
166301-22-0 | 1,3-Dioxane, 5-methyl-2-(2-methylpropyl)-cis- | |
108-32-7 | 1,3-Dioxolan-2-one, 4-methyl- | |
131812-48-1 | 1,3-Dioxolane, 2,4-dimethyl-2-(5,6,7,8-tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthalenyl)- | |
131812-52-7 | 1,3-Dioxolane, 2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-, trans- | |
100-79-8 | 1,3-Dioxolane-4-methanol, 2,2-dimethyl | |
1708-35-6 | 1,3-Dioxolane-4-methanol, 2-hexyl- | |
1322-17-4 | 1,3-Nonanediol acetate (mixed esters) | |
444880-09-5 | 1,3-Oxathiane,2-ethyl-4,4-dimethyl- | |
504-63-2 | 1,3-Propanediol | |
2163-42-0 | 1,3-Propanediol, 2-methyl- | |
70356-09-1 | 1,3-Propanedione, 1-[4-(1,1-dimethylethyl)phenyl]-3-(4-methoxyphenyl)- | |
166432-52-6 | 1,3-Undecadien-5-yne | |
124-20-9 | 1,4-Butanediamine, N-(3-aminopropyl)- | |
470-67-7 | 1,4-Cineole | |
21112-37-8 | 1,4-Dimethoxy-2-tert-butylbenzene | |
18679-18-0 | 1,4-Dodec-6-enolactone | |
13786-79-3 | 1,5,9-Trimethylcyclododeca-1,5,9-triene epoxide | |
75147-23-8 | 1,5-Dimethylbicyclo[3.2.1]octan-8-one-oxime | |
67952-57-2 | 1,5-Dimethylhexyl acetate | |
68931-30-6 | 1,6,10,14-Hexadecatetraen-3-ol, 3,7,11,15- tetramethyl- | |
68298-33-9 | 1,6,7,8-Tetrahydro-1,4,6,6,8,8-hexamethyl-as-indacene-3(2H)-one | |
313973-37-4 | 1,6-Heptadien-3-one, 2-cyclohexyl- | |
73018-51-6 | 1,6-Octadien-3-ol, 3,7-dimethyl-, acid-isomerized | |
72869-31-9 | 1,6-Octadiene, 7-methyl-3-methylene-, acid-hydrated, .alpha.-terpineol fractions | |
70131-51-0 | 1,6-Octadiene, 7-methyl-3-methylene-, acid-hydrated, geraniol fractions, distn. residues | |
15087-24-8 | 1,7,7-Trimethyl-3-(phenylmethylene)bicyclo[2.2.1]heptan-2-one | |
76-22-2 | 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one | |
24238-95-7 | 1,7,7-Trimethylbicyclo[4.4.0]dec-3-yl acetate | |
3526-75-8 | 1.alpha.,5.alpha.-Dihydroguaiol | |
68259-33-6 | 1-[5(Or 6)-Methyl-7(or 8)-(1-methylethyl)bicyclo[2.2.2]oct-5-en-2-yl]ethan-1-one | |
68922-12-3 | 10-Dodecen-3-one, 5-hydroxy-7,11-dimethyl- | |
1725-01-5 | 10-Oxahexadecanolide | |
112-19-6 | 10-Undecen-1-yl acetate | |
112-45-8 | 10-Undecenal | |
72894-14-5 | 10-Undecenal, 2-ethylidene- | |
112-38-9 | 10-Undecenoic acid | |
68141-27-5 | 10-Undecenoic acid, heptyl ester | |
3391-83-1 | 11-Oxahexadecanolide | |
68141-18-4 | 11-Tridecen-6-one, 8,12-dimethyl- | |
6707-60-4 | 12-Oxahexadecanolide | |
868846-58-6 | 13-Methyloxacyclopentadecan-2-one | |
6829-22-7 | 14H-Benz[4,5]isoquino[2,1-a]perimidin-14-one | |
123-69-3 | 16-Hydroxy-7-hexadecenoic acid lactone | |
65416-21-9 | 1-Bicyclo[2.2.1]hept-5-en-2-ylethan-1-one-oxime | |
543724-31-8 | 1-Butanone, 3-(dodecylthio)-1-(2,6,6-trimethyl-3-cyclohexen-1-yl)- | |
18294-87-6 | 1-Cyclohexene-1-acetic acid | |
1049017-68-6 | 1-Cyclohexene-1-carboxaldehyde, 4-ethenyl- | |
850997-10-3 | 1-Cyclohexene-1-propanal, 4,4-dimethyl- | |
1193-81-3 | 1-Cyclohexylethanol | |
68039-69-0 | 1-Cyclohexylethyl 2-butenoate | |
63449-88-7 | 1-Cyclohexylethyl butyrate | |
16510-27-3 | 1-Cyclopropylmethyl-4-methoxybenzene | |
112-30-1 | 1-Decanol | |
51100-54-0 | 1-Decen-3-ol | |
61668-40-4 | 1-Ethoxy 1-decene | |
36306-86-2 | 1-Ethoxy-4-(1-ethoxyvinyl)-3,3,5,5-tetramethylcyclohexene | |
31996-78-8 | 1-Ethyl-3-methoxytricyclo[2.2.1.02,6]heptane | |
5240-32-4 | 1-Ethynylcyclohexyl acetate | |
66327-54-6 | 1-Formyl-1-methyl-4-(4-methyl-pentyl)-3-cyclohexene | |
27503-81-7 | 1H-Benzimidazole-6-sulfonic acid, 2-phenyl- | |
1639-09-4 | 1-Heptanethiol | |
36653-82-4 | 1-Hexadecanol | |
4798-44-1 | 1-Hexen-3-ol | |
107-54-0 | 1-Hexyn-3-ol, 3,5-dimethyl- | |
31089-96-0 | 1H-Inden-1-one, 3a,4,5,6,7,7a-hexahydro-3,3a,7,7-tetramethyl- | |
285977-85-7 | 1H-Indende-2-methanol, 2,3-dihydro-2,5-dimethyl- | |
95-13-6 | 1H-Indene | |
60899-29-8 | 1H-Indene, 1-ethyl-2,3-dihydro-1,3,3-trimethyl- | |
351343-77-6 | 1H-Indene, 2,3,3a,4,5,7a-hexahydro-1,1,2,3,3-pentamethyl-6-(2-propenyl)- | |
1203-17-4 | 1H-Indene, 2,3-dihydro-1,1,2,3,3-pentamethyl- | |
67860-00-8 | 1H-Indole,3-heptanol,eta-1H-indol-3-yl-a,a,e-trimethyl ,8-bis-(2,3-dihydroindol)-2,6-dimethyl-2-octanol | |
1934-21-0 | 1H-Pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-1-(4-sulfophenyl)-4-[(4-sulfophenyl)azo]-, trisodium salt | |
67920-94-9 | 1-Isopropyl-4-methylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde | |
1565-76-0 | 1-Menthyl methylether | |
4747-07-3 | 1-Methoxyhexane | |
94291-50-6 | 1-Methoxyhexane-3-thiol | |
107-98-2 | 1-Methoxypropan-2-ol | |
72183-75-6 | 1-Methyl-2-(1-methylpropyl)cyclohexyl acetate | |
3008-43-3 | 1-Methyl-2,3-cyclohexadione | |
215231-33-7 | 1-methyl-3-(2-methylpropyl)cyclohexan-1-ol | |
52474-60-9 | 1-Methyl-3-(4-methyl-3-pentenyl)cyclohex-3-ene-1-carbaldehyde | |
1076-56-8 | 1-Methyl-3-methoxy-4-isopropylbenzene | |
10198-23-9 | 1-Methyl-4-(1-methylvinyl)cyclohexyl acetate | |
139539-67-6 | 1-Methyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-oxabicyclo[2.2.2]octane | |
52475-86-2 | 1-Methyl-4-(4-methyl-3-pentenyl)cyclohex-3-ene-1-carbaldehyde | |
21129-27-1 | 1-Methyl-4-(isopropyl)cyclohexan-1-ol | |
37514-30-0 | 1-Methylcyclododecyl methyl ether | |
90-12-0 | 1-Methylnaphthalene | |
4548-53-2 | 1-Naphthalenesulfonic acid, 3-[(2,4-dimethyl-5-sulfophenyl)azo]-4-hydroxy-, disodium salt | |
103614-86-4 | 1-Naphthalenol, 1,2,3,4,4a,5,8,8a-octahydro-2,2,6,8-tetramethyl- | |
6535-42-8 | 1-Naphthalenol, 4-[(4-ethoxyphenyl)azo]- | |
68922-14-5 | 1-Nonanol, 2,4,6,8-tetramethyl-,acetate | |
21964-44-3 | 1-Nonen-3-ol | |
111-87-5 | 1-Octanol | |
3391-86-4 | 1-Octen-3-ol | |
4312-99-6 | 1-Octen-3-one | |
2442-10-6 | 1-Octen-3-yl acetate | |
111-66-0 | 1-Octene | |
71078-31-4 | 1-Oxaspiro[4.5]deca-3,6-diene, 2,6,9,10-tetramethyl- | |
89079-92-5 | 1-Oxaspiro[4.5]deca-3,6-diene, 2,7-dimethyl-10-(1-methylethyl)- | |
79893-63-3 | 1-Oxaspiro[4.5]deca-3,6-diene, 6-ethyl-2,10,10-trimethyl- | |
4625-90-5 | 1-Oxaspiro[4.5]decan-2-one, 8-(1-methylethyl)-, trans- | |
91069-40-8 | 1-Oxaspiro[4.5]decan-2-one, 8-ethyl-, trans- | |
94201-19-1 | 1-Oxaspiro[4.5]decan-2-one, 8-methyl- | |
91069-37-3 | 1-Oxaspiro[4.5]decan-2-one, 8-methyl-, cis- | |
57967-68-7 | 1-Oxaspiro[4.5]decan-6-ol, 2,6,10,10-tetramethyl-, (2R,5S,6S)-rel- | |
72541-09-4 | 1-Oxaspiro[4.5]decan-6-ol, 2,6,10,10-tetramethyl-, acetate | |
616-25-1 | 1-Penten-3-ol | |
67739-11-1 | 1-Penten-3-ol, 2-methyl-1-(methylbicyclo[2.2.1]hept-5-en-2-yl)- | |
1629-58-9 | 1-Penten-3-one | |
68555-94-2 | 1-Penten-3-one, 2-methyl-1-(2,2,6-trimethylcyclohexenyl)- | |
579-07-7 | 1-Phenyl-1,2-propanedione | |
10415-87-9 | 1-Phenyl-3-methyl-3-pentanol | |
72007-81-9 | 1-Phenyl-3-methyl-3-pentyl acetate | |
3240-29-7 | 1-Phenyl-4-penten-1-one | |
71159-90-5 | 1-p-Menthene-8-thiol | |
75150-29-7 | 1-Propanaminium, N,N,N-trimethyl-3-[(1-oxo-2-propenyl)amino]-, chloride, polymer with 2-propenamide | |
128119-70-0 | 1-Propanol, 2-methyl-3-[(1,7,7-trimethylbicyclo-[2.2.1]hept-2-yl)oxy]- | |
50390-51-7 | 1-Propanone, 2-methyl-1-(4-methylphenyl)- | |
1569-01-3 | 1-Propoxypropan-2-ol | |
112-72-1 | 1-Tetradecanol | |
112-70-9 | 1-Tridecanol | |
2682-20-4 | 2 - Methyl - 2H - isothiazol - 3 - one | |
811436-82-5 | 2 Propenoic acid, 2-[1-[(1R)-3,3-dimethylcyclohexyl]ethoxy]-2-methylpropyl ester | |
107-93-7 | 2-Butenoic acid, (2E)- | |
1401065-88-0 | 2-Cyclohexen-1-ol, 2,6-dimethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)- | |
1447712-18-6 | 2-Cyclohexen-1-one, 2-methyl-5-propyl- | |
15848-49-4 | 2-Cyclopentene-1-acetic acid, ethyl ester | |
16874-34-3 | 2-Furancarboxylic acid, tetrahydro-, ethyl ester | |
1247790-47-1 | 2-Heptanol, 3,6-dimethyl- | |
6410-41-9 | 2-Naphthalenecarboxamide, N-(5-chloro-2,4-dimethoxyphenyl)-4-[2-[5-[(diethylamino)sulfonyl]-2-methoxyphenyl]diazenyl]-3-hydroxy- | |
2371-13-3 | 2-Octen-1-ol, 1-acetate | |
947237-95-8 | 2-Octenenitrile, 3,5,7-trimethyl- | |
76649-17-7 | 2-Pentenoic acid, 2-methyl-, (3Z)-3-hexen-1-yl ester | |
6197-30-4 | 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 2-ethylhexyl ester | |
25987-30-8 | 2-Propenoic acid, polymer with 2-propenamide, sodium salt | |
2810-04-0 | 2-Thiophenecarboxylic acid, ethyl ester | |
68480-25-1 | 2-Tridecen-1-ol | |
141773-73-1 | 2-(1-(3',3'-Dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate | |
1217-08-9 | 2-(1,1,2,3,3-Pentamethylindan-5-yl)-1-propanol | |
67634-11-1 | 2-(1,1-Dimethylethyl)-4-methylcyclohexan-1-ol | |
5947-36-4 | 2(10)-Pinen-3-ol | |
7399-50-0 | 2-(1-Ethylpropyl)pyridine | |
37172-02-4 | 2-(1-Methylpropyl)-1-vinylcyclohexyl acetate | |
3147-75-9 | 2-(2 Hydroxy-5-tert-oxyphenyl) benzotriazole | |
929625-08-1 | 2-(2,2,7,7-Tetramethyltricyclo[6.2.1.01,6]undec-5-en-5-yl)propan-1-ol | |
2226-05-3 | 2-(3,3-Dimethylbicyclo[2.2.1]hept-2-ylidene)ethanol | |
68133-79-9 | 2-(3,7-Dimethyl-2,6-octadienyl)cyclopentanone | |
66094-79-9 | 2(3H)-Furanone, 3-ethyldihydro-5,5-dimethyl- | |
92015-65-1 | 2(3H)-Benzofuranone, hexahydro-3,6-dimethyl- | |
4359-47-1 | 2-(3-Heptyl)-1,3-dioxolane | |
2110-18-1 | 2-(3-Phenylpropyl)pyridine | |
3208-40-0 | 2-(3-Phenylpropyl)tetrahydrofuran | |
80417-97-6 | 2(4H)-Benzofuranone, 5,6-dihydro-3,6-dimethyl- | |
34291-99-1 | 2-(4-Isopropylphenyl)propionaldehyde | |
80819-94-9 | 2-(4-Methyl-1-phenyl)-2-propanethiol | |
65817-24-5 | 2-(4-Methyl-2-hydroxyphenyl)propionic acid-gamma-lactone | |
94159-31-6 | 2-(4-Methyl-5-thiazolyl)ethyl butanoate | |
15149-10-7 | 2-(4-Methylphenoxy)ethanol | |
1374760-95-8 | 2-(4-Methylphenoxy)-N-(1H-pyrazol-3-yl)-N-(thiophen-2-ylmethyl)acetamide | |
68228-11-5 | 2-(ar-Ethylphenyl)butyraldehyde | |
1333-58-0 | 2-(Methylpropyl)quinoline | |
95962-14-4 | 2-(p-Menth-1-ene-10-yl)cyclopentanone | |
99-72-9 | 2-(p-Tolyl)propionaldehyde | |
6807-11-0 | 2-(p-Tolyloxy)ethyl acetate | |
60047-17-8 | 2-(Tetrahydro-5-methyl-5-vinyl-2-furyl)propan-2-ol | |
51608-18-5 | 2-(trans-2-Pentenyl)cyclopentanone | |
1958028-28-8 | 2,10-Tetradecadienal, (2E,10Z)- | |
1958026-97-5 | 2,10-Tetradecadienenitrile, (2E,10Z)- | |
118635-60-2 | 2,11-Dodecadienal, (E)- (9CI) | |
24634-61-5 | 2,4-Hexadienoic acid, potassium salt (1:1), (2E,4E)- | |
197098-61-6 | 2,5,7-Octatrien-1-ol, 2,6-dimethyl-, 1-acetate | |
76917-23-2 | 2,6-Octadienal, (2E,6Z)- | |
1891-67-4 | 2,6-Octadienal, 3,6,7-trimethyl- | |
52711-52-1 | 2,7-Decadienal, (2E,7Z)- | |
1801275-25-1 | 2,7-Decadienenitrile | |
1801275-26-2 | 2,7-Decadienenitrile, (2E,7Z)- | |
3734-67-6 | 2,7-Naphthalenedisulfonic acid, 5-(acetylamino)-4-hydroxy-3-(2-phenyldiazenyl)-, sodium salt (1:2) | |
21662-22-6 | 2,7-Nonadienal, (2E,7Z)- | |
6931-54-0 | 2,10-Epoxypinane | |
72894-15-6 | 2,12-Tridecadienal | |
4437-20-1 | 2,2'-(Dithiodimethylene)-difuran | |
4501-58-0 | 2,2,3-Trimethyl-3-Cyclopentene-1-acetaldehyde | |
15373-31-6 | 2,2,3-Trimethylcyclopent-3-enylacetonitrile | |
131-55-5 | 2,2',4,4'-Tetrahydroxybenzophenone | |
13475-82-6 | 2,2,4,6,6-Pentamethylheptane | |
75490-39-0 | 2,2,4-Trimethyl-4-phenyl-butane-nitrile | |
65443-14-3 | 2,2,5-Trimethyl-5-pentylcyclopentanone | |
7392-19-0 | 2,2,6-Trimethyl-6-vinyltetrahydropyran | |
2408-37-9 | 2,2,6-Trimethylcyclohexanone | |
69103-20-4 | 2,2-Dimethyl-3-(3-methyl-2,4-pentadienyl)oxirane | |
104468-21-5 | 2,2-Dimethyl-3-methyl-3-butenyl propanoate | |
13351-61-6 | 2,2-Dimethyl-3-phenylpropanol | |
7416-35-5 | 2,2-Dimethyl-5-(1-methylpropen-1-yl)tetrahydrofuran | |
54440-17-4 | 2,3,3-Trimethylindanone | |
643-53-8 | 2,3,4,4a,5,6,7,8-Octahydro-2,5,5-trimethyl-2-naphtol | |
68433-81-8 | 2,3,4,4a,5,6-hexahydro-2,2-dimethyl-1,3-methanonaphthalen-7(1H)-one | |
3054-92-0 | 2,3,4-Trimethyl-3-pentanol | |
1124-11-4 | 2,3,5,6-Tetramethylpyrazine | |
14667-55-1 | 2,3,5-Trimethylpyrazine | |
2416-94-6 | 2,3,6-Trimethylphenol | |
513-85-9 | 2,3-Butanediol | |
18138-04-0 | 2,3-Diethyl-5-methylpyrazine | |
15707-24-1 | 2,3-Diethylpyrazine | |
300371-33-9 | 2,3-Dihydro-1,1-dimethyl-1H-indene-ar-propanal | |
71850-78-7 | 2,3-Dimethyl-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2-butenal | |
3782-00-1 | 2,3-Dimethylbenzofuran | |
526-75-0 | 2,3-Dimethylphenol | |
5910-89-4 | 2,3-Dimethylpyrazine | |
96-04-8 | 2,3-Heptanedione | |
3848-24-6 | 2,3-Hexanedione | |
74338-72-0 | 2,4,4,7-Tetramethyl-6-octen-3-one | |
81782-89-0 | 2,4,4,7-Tetramethylnona-6,8-dien-3-one | |
81783-01-9 | 2,4,4,7-Tetramethylnona-6,8-diene-3-one-oxime | |
13623-11-5 | 2,4,5-Trimethylthiazole | |
499-44-5 | 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-4-(1-methylethyl)- | |
17387-01-8 | 2,4,6-Cycloheptatrien-1-one, 2-hydroxy-4-(1-methylethyl)-, sodium salt | |
68527-77-5 | 2,4,6-Trimethyl-3-cyclohexene-1-methanol | |
5182-36-5 | 2,4,6-Trimethyl-4-phenyl-1,3-dioxane | |
1423-46-7 | 2,4,6-Trimethylcyclohex-3-enecarbaldehyde | |
527-60-6 | 2,4,6-Trimethylphenol | |
18409-21-7 | 2,4-Decadien-1-ol | |
131812-67-4 | 2,4-Dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolane | |
68039-49-6 | 2,4-Dimethyl-3-cyclohexen-1-carboxaldehyde | |
27606-09-3 | 2,4-Dimethyl-4,4a,5,9b-tetrahydroindeno[1,2-d]-1,3-dioxin | |
82461-14-1 | 2,4-Dimethyl-4-phenyltetrahydrofuran | |
62346-96-7 | 2,4-Dimethylbenzyl acetate | |
67634-17-7 | 2,4-Dimethylcyclohex-3-ene-1-methanol | |
67634-26-8 | 2,4-Dimethylcyclohex-3-ene-1-methyl acetate | |
67634-22-4 | 2,4-Dimethylcyclohexylmethyl acetate | |
108-47-4 | 2,4-Dimethylpyridine | |
16930-93-1 | 2,4-Hexadienyl butyrate | |
16491-24-0 | 2,4-Hexadienyl isobutyrate | |
6440-58-0 | 2,4-Imidazolidinedione, 1,3-bis(hydroxymethyl)-5,5-dimethyl- | |
63450-36-2 | 2,4-Nonadienol-1 | |
105-67-9 | 2,4-Xylenol | |
68378-13-2 | 2,5 or 6-Methoxy-3-methylpyrazine (mixture of isomers) | |
5406-58-6 | 2,5,5-Trimethyl-2-phenyl-1,3-dioxane | |
82784-84-7 | 2,5,6-Trimethyl-4-heptenal | |
13851-06-4 | 2,5,7-Trimethyl-2-decene-6,8-dione | |
41239-48-9 | 2,5-Diethyltetrahydrofuran | |
4077-47-8 | 2,5-Dimethyl-4-methoxy-3(2H)-furanone | |
123-32-0 | 2,5-Dimethylpyrazine | |
847144-75-6 | 2,5-Octadien-4-one, 5,6,7-trimethyl-, (2E,5E)- | |
357650-26-1 | 2,5-Octadien-4-one, 5,6,7-trimethyl-, (2E,5Z)- | |
95-87-4 | 2,5-Xylenol | |
141-13-9 | 2,6,10-Trimethyl-9-undecenal | |
54082-68-7 | 2,6,10-Trimethylundeca-5,9-dienal | |
24048-13-3 | 2,6,10-Trimethylundeca-5,9-dienal (dihydroapofarnesal) | |
24048-14-4 | 2,6,10-Trimethylundeca-5,9-dienol | |
432-25-7 | 2,6,6-Trimethyl-1&2-cyclohexen-1-carboxaldehyde | |
472-66-2 | 2,6,6-Trimethyl-1-cyclohexen-1-acetaldehyde | |
473-54-1 | 2,6,6-Trimethylbicyclo[3.1.1]heptan-3-ol | |
1125-21-9 | 2,6,6-Trimethylcyclohex-2-ene-1,4-dione | |
116-26-7 | 2,6,6-Trimethylcyclohexa-1,3-dienyl methanal | |
123-18-2 | 2,6,8-Trimethylnonan-4-one | |
91-10-1 | 2,6-Dimethoxyphenol | |
17909-77-2 | 2,6-Dimethyl-10-methylene-2,6,11-dodecatrienal | |
3016-19-1 | 2,6-Dimethyl-2,4,6-octatriene | |
13254-34-7 | 2,6-Dimethyl-2-heptanol | |
68480-08-0 | 2,6-Dimethyl-2-octyl acetate | |
108-82-7 | 2,6-Dimethyl-4-heptanol | |
108-83-8 | 2,6-Dimethyl-4-heptanone | |
106-72-9 | 2,6-Dimethyl-5-heptenal | |
25279-09-8 | 2,6-Dimethyloct-7-en-2-yl formate | |
1879-00-1 | 2,6-Dimethyloct-7-en-4-one | |
673-84-7 | 2,6-Dimethylocta-2,4,6-triene | |
108-50-9 | 2,6-Dimethylpyrazine | |
108-48-5 | 2,6-Dimethylpyridine | |
127474-91-3 | 2,6-Naphthalenedicarboxylic acid, bis(2-ethylhexyl) ester | |
7786-44-9 | 2,6-Nonadien-1-ol | |
67674-36-6 | 2,6-Nonadienal diethyl acetal | |
67019-89-0 | 2,6-Nonadienenitrile | |
90480-35-6 | 2,6-Octadienal, 3,7-dimethyl-, acid-isomerized | |
147060-73-9 | 2,6-Octadienal, 3,7-dimethyl-, reaction products with Et alc. | |
38237-00-2 | 2,6-Octadiene-1-thiol, 3,7-dimethyl- | |
576-26-1 | 2,6-Xylenol | |
68419-46-5 | 2,7-Dimethyloct-5-en-4-one | |
3567-66-6 | 2,7-Naphthalenedisulfonic acid, 5-amino-4-hydroxy-3-(phenylazo)-, disodium salt | |
84642-57-9 | 2-[(3,3,5-Trimethylcyclohexyl)acetyl]cyclopentan-1-one | |
94087-23-7 | 2-[7-Isopropyl-5-methylbicyclo[2.2.2]oct-5-en-2-yl]-1,3-dioxolane | |
68901-32-6 | 2-[8-Isopropyl-6-methylbicyclo[2.2.2]oct-5-en-2-yl]-1,3-dioxolane | |
108982-45-2 | 2'-Acetonaphthone, 1',2',3',4',5',6',7',8'-octahydro-1',2',8',8'-tetramethyl- | |
32974-92-8 | 2-Acetyl-3-ethylpyrazine | |
23787-80-6 | 2-Acetyl-3-methylpyrazine | |
1193-79-9 | 2-Acetyl-5-methylfuran | |
1122-62-9 | 2-Acetylpyridine | |
24295-03-2 | 2-Acetylthiazole | |
88-15-3 | 2-Acetylthiophene | |
77-86-1 | 2-Amino-2-(hydroxymethyl)-1,3-propanediol | |
115-69-5 | 2-Amino-2-methylpropane-1,3-diol | |
551-93-9 | 2-Aminoacetophenone | |
4740-79-8 | 2-Benzyl-1,3-dioxan-5-ol | |
97384-48-0 | 2-Benzyl-2-methylbut-3-enenitrile | |
92368-90-6 | 2-Benzylheptanol | |
20279-25-8 | 2-Bornyl propionate | |
78-92-2 | 2-Butanol | |
78-93-3 | 2-Butanone | |
1129-62-0 | 2-Butanone, phenylhydrazone | |
71048-83-4 | 2-Buten-1-one, 1-(2,6,6-trimethyl-3-cyclohexen-1-yl)-, [1alpha(E),alpha]- (9CI) | |
54533-29-8 | 2-Buten-1-one, 2-methyl-1-(1-piperidinyl)- | |
3724-65-0 | 2-Butenoic acid | |
54546-26-8 | 2-Butyl-4,4,6-trimethyl-1,3-dioxane | |
62062-85-5 | 2-Butyl-5,6-dihydro-2,4-dimethyl-2H-pyran | |
24237-02-3 | 2-Butyltetrahydro-6-methyl-4-methylene-2H-pyrane | |
90-42-6 | 2-Cyclohexylcyclohexanone | |
4442-79-9 | 2-Cyclohexylethyl alcohol | |
916887-53-1 | 2-Cyclohexylidene-2-o-tolylacetonitrile | |
2109-22-0 | 2-Cyclohexylpropanal | |
21835-00-7 | 2-Cyclopenten-1-one, 2-hydroxy-3,4-dimethyl- | |
4884-24-6 | 2-Cyclopentylcyclopentanone | |
693-54-9 | 2-Decanone | |
3913-71-1 | 2-Decenal | |
6175-49-1 | 2-Dodecanone | |
4826-62-4 | 2-Dodecenal | |
68845-00-1 | 2-Ethoxy-2,6,6-trimethyl-9-methylenebicyclo[3.3.1]nonane | |
5595-79-9 | 2-Ethoxy-4-(methoxymethyl)phenol | |
96840-56-1 | 2-Ethoxy-4-[(1-methylethoxy)methyl] phenol | |
2563-07-7 | 2-Ethoxy-4-methylphenol | |
18368-91-7 | 2-Ethyl-1,3,3-trimethyl-2-norbornanol | |
97-95-0 | 2-Ethyl-1-butanol | |
104-76-7 | 2-Ethyl-1-hexanol | |
15707-23-0 | 2-Ethyl-3-methylpyrazine | |
28219-61-6 | 2-Ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-buten-1-ol | |
27538-09-6 | 2-Ethyl-4-hydroxy-5-methyl-3(2H)-furanone | |
27538-10-9 | 2-Ethyl-4-hydroxy-5-methylfuran-3(2H)-one | |
15679-12-6 | 2-Ethyl-4-methylthiazole | |
122795-41-9 | 2-Ethyl-5-methoxybicyclo[2.2.1]heptane | |
13360-64-0 | 2-Ethyl-5-methylpyrazine | |
10031-87-5 | 2-Ethylbutyl acetate | |
68092-41-1 | 2-Ethylbutyl cyclopent-1-ene-1-acetate | |
94278-39-4 | 2-Ethylbutyl cyclopent-2-ene-1-acetate | |
88-09-5 | 2-Ethylbutyric acid | |
27043-05-6 | 2-Ethyl-dimethylpyrazine (isomer unspecified) | |
3208-16-0 | 2-Ethylfuran | |
123-05-7 | 2-Ethylhexanal | |
103-09-3 | 2-Ethylhexyl acetate | |
64825-20-3 | 2-Ethylidenedecan-1-al | |
90-00-6 | 2-Ethylphenol | |
13925-00-3 | 2-Ethylpyrazine | |
564-94-3 | 2-Formyl-6,6-dimethylbicyclo(3.1.1)hept-2-ene | |
59020-90-5 | 2-Furanmethanethiol formate | |
67801-17-6 | 2-Furfuryleneoctanal | |
1192-62-7 | 2-Furyl methyl ketone | |
58-95-7 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, 6-acetate, (2R)- | |
1392277-05-2 | 2H-2,4a-Methanonaphthalen-1(5H)-one, hexahydro-5,5-dimethyl-2-propyl- | |
676125-00-1 | 2H-2,4a-Methanonaphthalene, 1,3,4,5,6,7-hexahydro-7-methoxy-1,1,5,5-tetramethyl- | |
1127890-59-8 | 2H-Cyclopenta[b]furan, hexahydro-6,6,6a-trimethyl-2-(1-methylpropyl)- | |
875471-31-1 | 2H-Pyran-2-one, tetrahydro-5-pentyl- | |
214335-70-3 | 2H-Pyran-2-one, tetrahydro-5-propyl- | |
1099648-69-7 | 2H-Pyran-4-ol, 2-(1-ethylpropyl)tetrahydro-4-methyl- | |
854737-09-0 | 2H-Pyran, 3-heptyltetrahydro- | |
60335-74-2 | 2H-Pyran, tetrahydro-4-methylene-2-phenyl- | |
195251-91-3 | 2H-1,5-Benzodioxepin-3(4H)-one, 7-(1,1-dimethylethyl)- | |
950919-28-5 | 2H-1,5-Benzodioxepin-3(4H)-one, 7-(1-methylethyl)- | |
10191-41-0 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)- | |
7695-91-2 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-, acetate | |
59-02-9 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)- | |
54-28-4 | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,7,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)- | |
32539-83-6 | 2H-Cyclododeca[b]pyran, 3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro- | |
543-49-7 | 2-Heptanol | |
110-43-0 | 2-Heptanone | |
5921-82-4 | 2-Heptyl acetate | |
4359-57-3 | 2-Heptyl-1,3-dioxolane | |
137-03-1 | 2-Heptylcyclopentanone | |
39189-74-7 | 2-Heptylidenecyclopentan-1-one | |
2435-16-7 | 2-Heptyltetrahydrofuran | |
7541-49-3 | 2-Hexadecen-1-ol, 3,7,11,15-tetramethyl- | |
626-93-7 | 2-Hexanol | |
2305-21-7 | 2-Hexen-1-ol | |
341017-24-1 | 2-Hexen-1-ol, 3-methyl-, 1-acetate | |
505-57-7 | 2-Hexenal | |
16493-96-2 | 2-Hexenoic acid, 2-methyl-, methyl ester, (2E)- | |
165184-98-5 | 2-Hexyl-(E)-cinnamaldehyde | |
1708-34-5 | 2-Hexyl-1,3-dioxolane | |
13074-65-2 | 2-Hexylcyclopentanone | |
17373-89-6 | 2-Hexylidene cyclopentanone | |
16429-07-5 | 2-Hexylidenecyclohexan-1-one | |
615-13-4 | 2H-Inden-2-one, 1,3-dihydro- | |
476332-65-7 | 2H-Indeno[4,5b] furan, decahydro-2,2,6,6,7,8,8-heptamethyl | |
149713-24-6 | 2H-Pyran, tetrahydro-4-methyl-2-phenyl-, (2R,4R)-rel- | |
149713-23-5 | 2H-Pyran, tetrahydro-4-methyl-2-phenyl-,(2R,4S)-rel | |
118-93-4 | 2-Hydroxyacetophenone | |
42822-86-6 | 2-Hydroxy-alpha,alpha,4-trimethylcyclohexanemethanol | |
69-72-7 | 2-Hydroxybenzoic acid | |
1984-60-7 | 2-Hydroxyethyl phenoxyacetate | |
87-41-2 | 2-Hydroxymethylbenzoic acid gamma lactone | |
490-03-9 | 2-Hydroxypiperitone | |
120-93-4 | 2-Imidazolidinone | |
24683-00-9 | 2-Isobutyl-3-methoxypyrazine | |
13925-06-9 | 2-Isobutyl-3-methylpyrazine | |
63500-71-0 | 2-Isobutyl-4-methyltetrahydro-2H-pyran-4-ol | |
93-19-6 | 2-Isobutylquinoline | |
18640-74-9 | 2-Isobutylthiazole | |
31574-44-4 | 2-Isopropyl-4-methylanisole | |
15679-13-7 | 2-Isopropyl-4-methylthiazole | |
35158-25-9 | 2-Isopropyl-5-methyl-2-hexenal | |
67801-23-4 | 2-Isopropyl-5-methylcyclohexyl 2-methylbut-2-enoate | |
51115-67-4 | 2-Isopropyl-N,2,3-trimethylbutyramide | |
4427-56-9 | 2-Isopropyl-p-cresol | |
88-69-7 | 2-Isopropylphenol | |
79-42-5 | 2-Mercaptopropionic acid | |
24168-70-5 | 2-Methoxy-3-(1-methylpropyl)pyrazine | |
25773-40-4 | 2-Methoxy-3(5 and 6)-isopropylpyrazine | |
2847-30-5 | 2-Methoxy-3-methylpyrazine | |
128489-04-3 | 2-Methoxy-4-(tetrahydro-4-methylene-2H-pyran-2-yl)phenol | |
93-51-6 | 2-Methoxy-4-methylphenol | |
2785-87-7 | 2-Methoxy-4-propylphenol | |
7786-61-0 | 2-Methoxy-4-vinylphenol | |
91-63-4 | 2-Methyl quinoline | |
1489-57-2 | 2-Methyl-1,3-cyclohexadiene | |
107-41-5 | 2-Methyl-2,4-pentandiol | |
75-85-4 | 2-Methyl-2-butanol | |
497-03-0 | 2-Methyl-2-butenal | |
1569-60-4 | 2-Methyl-2-hepten-6-ol | |
623-36-9 | 2-Methyl-2-pentenal | |
16957-70-3 | 2-Methyl-2-pentenoic acid | |
75-65-0 | 2-Methyl-2-propanol | |
68555-63-5 | 2-Methyl-3-(1-oxopropoxy)-4H-pyran-4-one | |
103-95-7 | 2-Methyl-3-(p-isopropylphenyl)propionaldehyde | |
65530-53-2 | 2-Methyl-3-,5 or 6-(furfurylthio)pyrazine (mixture of isomers) | |
32737-14-7 | 2-Methyl-3,5 or 6-ethoxypyrazine | |
115-18-4 | 2-Methyl-3-buten-2-ol | |
28588-74-1 | 2-Methyl-3-furanthiol | |
37674-63-8 | 2-Methyl-3-pentenoic acid | |
41496-43-9 | 2-Methyl-3-tolylpropionaldehyde | |
28219-60-5 | 2-Methyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-2-buten-1-ol | |
104864-90-6 | 2-Methyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-4-penten-1-ol | |
72089-08-8 | 2-Methyl-4(2,2,3-trimethyl-3-cyclopentenyl)butanol | |
68555-62-4 | 2-Methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-2-butenal | |
58102-02-6 | 2-Methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-3-butenal | |
3155-71-3 | 2-Methyl-4-(2,6,6-trimethylcyclohex-1-en-1-yl)-2-butenal | |
68901-22-4 | 2-Methyl-4-(camphenyl-8)-cyclohexanone | |
33941-99-0 | 2-Methyl-4-phenyl-1,3-dioxolane | |
103-05-9 | 2-Methyl-4-phenyl-2-butanol | |
103-07-1 | 2-Methyl-4-phenyl-2-butyl acetate | |
10031-71-7 | 2-Methyl-4-phenyl-2-butyl isobutyrate | |
40654-82-8 | 2-Methyl-4-phenylbutyraldehyde | |
92585-24-5 | 2-Methyl-4-phenylpentanol | |
67715-80-4 | 2-Methyl-4-propyl-1,3-oxathiane | |
13678-59-6 | 2-Methyl-5-(methylthio)furan | |
25634-93-9 | 2-Methyl-5-phenylpentanol | |
61692-78-2 | 2-Methylallyl 2-methylisocrotonate | |
95-21-6 | 2-Methylbenzoxazole | |
137-32-6 | 2-Methylbutanol | |
2445-78-5 | 2-Methylbutyl 2-methylbutyrate | |
2445-77-4 | 2-Methylbutyl 3-methylbutanoate | |
624-41-9 | 2-Methylbutyl acetate | |
51115-64-1 | 2-Methylbutyl butyrate | |
96-17-3 | 2-Methylbutyraldehyde | |
116-53-0 | 2-Methylbutyric acid | |
19009-56-4 | 2-Methyldecanal | |
69300-15-8 | 2-Methyldecanenitrile | |
1188-02-9 | 2-Methylheptanoic acid | |
4536-23-6 | 2-Methylhexanoic acid | |
91-57-6 | 2-Methylnaphthalene | |
7786-29-0 | 2-Methyloctanal | |
67634-09-7 | 2-Methyloctane-1,3-diyl diacetate | |
3142-72-1 | 2-Methylpent-2-en-1-oic acid | |
1838-88-6 | 2-Methylpent-2-en-1-yl acetate | |
123-15-9 | 2-Methylpentanal | |
50607-64-2 | 2-Methylpentanal-methyl anthranilate (Schiff base) | |
90397-38-9 | 2-Methylpentyl 2-methylvalerate | |
1741-41-9 | 2-Methylpropanal diethyl acetal | |
2445-67-2 | 2-Methylpropyl 2-methylbutyrate | |
589-59-3 | 2-Methylpropyl 3-methylbutyrate | |
5461-06-3 | 2-Methylpropyl octanoate | |
10588-10-0 | 2-Methylpropyl pentanoate | |
109-08-0 | 2-Methylpyrazine | |
3188-00-9 | 2-Methyltetrahydrofuran-3-one | |
80-59-1 | 2-Methyl-trans-2-butenoic acid | |
110-41-8 | 2-Methylundecanal | |
68141-17-3 | 2-Methylundecanal dimethyl acetal | |
24323-25-9 | 2-Methylundecanoic acid | |
10522-26-6 | 2-Methylundecanol | |
97-61-0 | 2-Methylvaleric acid | |
127459-79-4 | 2-Naphthalenecarboxaldehyde, 5,6,7,8-tetrahydro-3,5,5,6,7,8,8-heptamethyl- | |
25956-17-6 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[(2-methoxy-5-methyl-4-sulfophenyl)azo]-, disodium salt | |
2783-94-0 | 2-Naphthalenesulfonic acid, 6-hydroxy-5-[(4-sulfophenyl)azo]-, disodium salt | |
85-86-9 | 2-Naphthalenol, 1-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]- | |
628-99-9 | 2-Nonanol | |
821-55-6 | 2-Nonanone | |
22104-79-6 | 2-Nonen-1-ol | |
2463-53-8 | 2-Nonenal | |
21963-26-8 | 2-Nonenoic acid gamma-lactone | |
13257-44-8 | 2-Nonyn-1-al dimethylacetal | |
123-96-6 | 2-Octanol | |
111-13-7 | 2-Octanone | |
4643-27-0 | 2-Octen-4-one | |
2363-89-5 | 2-Octenal | |
60308-76-1 | 2-Octenoic acid, 4-ethyl-, (2E)- | |
60308-75-0 | 2-Octenoic acid, 4-ethyl-, (2Z)- | |
5333-42-6 | 2-Octyldodecan-1-ol | |
600-18-0 | 2-Oxobutyric acid | |
2345-28-0 | 2-Pentadecanone | |
6032-29-7 | 2-Pentanol | |
107-87-9 | 2-Pentanone | |
764-39-6 | 2-Pentenal | |
21016-46-6 | 2-Pentenoic acid, 2,4-dimethyl-, ethyl ester, (2E)- | |
626-38-0 | 2-Pentyl acetate | |
84560-00-9 | 2-Pentylcyclopentan-1-ol | |
4819-67-4 | 2-Pentylcyclopentan-1-one | |
3777-69-3 | 2-Pentylfuran | |
68141-20-8 | 2-Phenethyl crotonate | |
122-99-6 | 2-Phenoxyethanol | |
103-60-6 | 2-Phenoxyethyl isobutyrate | |
23495-12-7 | 2-Phenoxyethyl propionate | |
4411-89-6 | 2-Phenyl-2-butenal | |
617-94-7 | 2-Phenyl-2-propanol | |
67662-96-8 | 2-Phenylethyl pivalate | |
7460-74-4 | 2-Phenylethyl valerate | |
3508-98-3 | 2-Phenylhexanenitrile | |
96-09-3 | 2-Phenyl-oxirane | |
93-53-8 | 2-Phenylpropionaldehyde | |
90-87-9 | 2-Phenylpropionaldehyde dimethyl acetal | |
2520-60-7 | 2-Prenylcyclopentanone | |
102-60-3 | 2-Propanol, 1,1',1',1'-(1,2-ethanediyldinitrilo)tetrakis- | |
401913-53-9 | 2-Propanol, 1-[1-(2,3-dimethylbicyclo[2.2.1] hept-2-yl) ethoxy]- | |
90530-04-4 | 2-Propanol, reaction products with boron trifluoride and 5-ethylidenebicyclo[2.2.1]hept-2-ene | |
26590-05-6 | 2-Propen-1-aminium, N,N-dimethyl-N-2-propenyl-, chloride, polymer with 2-propenamide | |
56138-10-4 | 2-Propen-1-ol, 2-methyl-3-(4-methylphenyl)-, (2E)- | |
820975-49-3 | 2-Propenoic acid, 2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl ester | |
238402-46-5 | 2-Propenoic acid, 3-(2-hydroxyphenyl)-, 9-decen-1-yl ester, (2E)- | |
5466-77-3 | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester | |
208041-98-9 | 2-Propyl heptanenitrile | |
699-02-5 | 2-p-Tolylethanol | |
2524-52-9 | 2-Pyridinecarboxylic acid, ethyl ester | |
9003-39-8 | 2-Pyrrolidinone, 1-ethenyl-, homopolymer | |
14765-30-1 | 2-sec-Butylcyclohexanone | |
121-00-6 | 2-tert-Butyl-4-methoxyphenol | |
13491-79-7 | 2-tert-Butylcyclohexanol | |
1728-46-7 | 2-tert-Butylcyclohexanone | |
88-41-5 | 2-tert-Butylcyclohexyl acetate | |
40702-13-4 | 2-tert-Butylcyclohexyl propionate | |
1948-33-0 | 2-tert-Butylhydroquinone | |
2409-55-4 | 2-tert-Butyl-p-cresol | |
21662-13-5 | 2-trans-6-cis-Dodecadienal | |
56767-18-1 | 2-trans-6-trans-Octadienal | |
20407-84-5 | 2-trans-Dodecenal | |
593-08-8 | 2-Tridecanone | |
68480-26-2 | 2-Tridecen-1-ol, 1-acetate | |
7774-82-5 | 2-Tridecenal | |
1653-30-1 | 2-Undecanol | |
112-12-9 | 2-Undecanone | |
2463-77-6 | 2-Undecenal | |
22629-48-7 | 2-Undecenenitrile | |
31906-04-4 | 3 and 4-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde | |
1708-81-2 | 3-Hepten-1-ol, (3Z)- | |
56922-80-6 | 3-Hexen-1-ol, 1-formate, (3E)- | |
1577-18-0 | 3-Hexenoic acid, (3E)- | |
85508-08-3 | 3-Pentenoic acid, 2-methyl-, hexyl ester | |
72214-33-6 | 3-(2,6,6-Trimethyl-1-cyclohexen-1-yl)acrylonitrile | |
55965-84-9 | 3(2H)-Isothiazolone, 5-chloro-2-methyl-, mixt. with 2-methyl-3(2H)-isothiazolone | |
26172-55-4 | 3(2H)-Isothiazolone, 5-chloro-2-methyl- | |
40942-73-2 | 3-(2-Oxopropyl)-2-pentylcyclopentanone | |
68804-00-2 | 3-(4,7,7-Trimethylbicyclo[4.1.0]hept-3-yl)acrylonitrile | |
68804-02-4 | 3-(4,7,7-Trimethylbicyclo[4.1.0]hept-3-ylidene)propiononitrile | |
51414-25-6 | 3-(4-Hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde | |
15760-18-6 | 3-(4-Methyl-3-cyclohexenyl)butanol | |
68084-04-8 | 3-(4-Methyl-3-pentenyl)-3-cyclohexene-1-carbonitrile | |
52475-89-5 | 3-(4-Methyl-3-pentenyl)cyclohex-3-ene-1-carbaldehyde | |
6819-19-8 | 3-(4-Methylcyclohex-3-enyl)-3-butenyl acetate | |
3407-42-9 | 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexan-1-ol | |
53253-09-1 | 3-(cis-3-hexenyl)-2-cyclopentenone | |
142653-61-0 | 3-(cis-3-Hexenyloxy)propanenitrile | |
14250-95-4 | 3-(Dimethoxymethyl)heptane | |
59191-78-5 | 3-(Hydroxymethyl)-2-octanone | |
67801-33-6 | 3-(Hydroxymethyl)nonan-2-one | |
51755-66-9 | 3-(Methylthio)-1-hexanol | |
51755-85-2 | 3-(Methylthio)hexyl acetate | |
505-10-2 | 3-(Methylthio)propanol | |
3268-49-3 | 3-(Methylthio)propionaldehyde | |
62518-65-4 | 3-(m-tert-Butylphenyl)-2-methylpropionaldehyde | |
67634-14-4 | 3-(o-Ethylphenyl)-2,2-dimethylpropionaldehyde | |
130066-44-3 | 3(or 4)-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde | |
7775-00-0 | 3-(p-Isopropylphenyl)propionaldehyde | |
56107-04-1 | 3-(p-tert-Butylphenyl)-2-methylpropanol | |
86611-09-8 | 3,5-Heptadien-1-ol, 1-acetate, (3Z,5E)- | |
1958027-16-1 | 3,5-Heptadien-1-ol, 1-acetate, (3Z,5E)- | |
76649-26-8 | 3,6-Nonadien-1-ol, 1-acetate | |
134769-33-8 | 3,12-Tridecadienenitrile | |
124071-42-7 | 3,12-Tridecadienenitrile, (3E)- | |
36306-87-3 | 3,3,5,5-Tetramethyl-4-ethoxyvinylcyclohexanone | |
3213-73-8 | 3,3,5-Trimethylcyclohexaneacetic acid | |
67859-96-5 | 3,3,5-Trimethylcyclohexyl acetate | |
67583-77-1 | 3,3,5-Trimethylcyclohexyl ethyl ether | |
707-29-9 | 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecane | |
107898-54-4 | 3,3-Dimethyl-5-(2,2,3-trimethyl-3-cyclopenten-1-yl)-4-penten-2-ol | |
72429-08-4 | 3,4,4a,5,8,8a(Or 3,4,4a,7,8,8a)-Hexahydro-3,3,6,7-tetramethyl-1H-2-benzopyran | |
41723-98-2 | 3,4,4a,5,8,8a-Hexahydro-3',6-dimethylspiro[1,4-methanonaphtalene-2(1H),2'-oxirane] | |
41816-03-9 | 3,4,4a,5,8,8a-Hexahydro-3',7-dimethylspiro[1,4-methanonaphthalene-2(1H),2'-oxirane] | |
86115-11-9 | 3,4,5,6,6-Pentamethylhept-3-en-2-one | |
87118-95-4 | 3,4,5,6,6-Pentamethylheptan-2-ol | |
6939-35-1 | 3,4-Dihydro-5-methylnaphthalen-1(2H)-one | |
13494-06-9 | 3,4-Dimethyl-1,2-cyclopentadione | |
632-15-5 | 3,4-Dimethylthiophene | |
4437-51-8 | 3,4-Hexanedione | |
95-65-8 | 3,4-Xylenol | |
3452-97-9 | 3,5,5-Trimethyl-1-hexanol | |
116-02-9 | 3,5,5-Trimethylcyclohexanol | |
5435-64-3 | 3,5,5-Trimethylhexanal | |
58430-94-7 | 3,5,5-Trimethylhexyl acetate | |
67355-38-8 | 3,5,5-Trimethylhexyl formate | |
81787-06-6 | 3,5,6,6-Tetramethyl-4-methyleneheptan-2-ol | |
81786-75-6 | 3,5,6,6-Tetramethyl-4-methyleneheptan-2-one | |
65416-17-3 | 3,5-Diethyl-2,6-dimethylcyclohex-2-en-1-one | |
4179-19-5 | 3,5-Dimethoxytoluene | |
13494-07-0 | 3,5-Dimethyl-1,2-cyclopentadione | |
68039-48-5 | 3,5-Dimethylcyclohex-3-ene-1-carbaldehyde | |
67634-25-7 | 3,5-Dimethylcyclohex-3-ene-1-methyl acetate | |
67634-16-6 | 3,5-Dimethylcyclohexene-1-methanol | |
68213-86-5 | 3,5-Dimethylcyclohexylmethyl acetate | |
108-68-9 | 3,5-Dimethylphenol | |
5274-68-0 | 3,6,9,12-Tetraoxatetracosan-1-ol | |
68039-40-7 | 3,6-Dihydro-2,4-dimethyl-6-phenyl-2H-pyran | |
68039-41-8 | 3,6-Dihydro-4,6-dimethyl-2-phenyl-2H-pyran | |
60335-71-9 | 3,6-Dihydro-4-methyl-2-phenyl-2H-pyran | |
67801-65-4 | 3,6-Dimethyl-3-cyclohexene-1-carboxaldehyde | |
60763-42-0 | 3,6-Dimethyl-3-octanyl acetate | |
76649-25-7 | 3,6-Nonadien-1-ol | |
6753-98-6 | 3,7,10-Humulatriene | |
13877-91-3 | 3,7-Dimethyl-1,3,6-octatriene | |
10339-55-6 | 3,7-Dimethyl-1,6-nonadien-3-ol | |
61931-80-4 | 3,7-Dimethyl-1,6-nonadien-3-yl acetate | |
106-21-8 | 3,7-Dimethyl-1-octanol | |
20780-49-8 | 3,7-Dimethyl-1-octanyl acetate | |
41448-29-7 | 3,7-Dimethyl-2,6-nonadien-1-al | |
61792-11-8 | 3,7-Dimethyl-2,6-nonadienenitrile | |
624-15-7 | 3,7-Dimethyl-2,6-octadien-1-ol | |
22418-66-2 | 3,7-Dimethyl-2-methylenocta-6-enal | |
55722-59-3 | 3,7-Dimethyl-3,6-octadienal | |
18479-54-4 | 3,7-Dimethyl-4,6-octadien-3-ol | |
502-47-6 | 3,7-Dimethyl-6-octenoic acid | |
41890-92-0 | 3,7-Dimethyl-7-methoxyoctan-2-ol | |
18479-49-7 | 3,7-Dimethyloct-1-en-3-ol | |
18479-51-1 | 3,7-Dimethyloct-6-en-3-ol | |
67601-05-2 | 3,7-Dimethyloct-6-enyl acetate | |
141-25-3 | 3,7-Dimethyloct-7-en-1-ol | |
22460-95-3 | 3,7-Dimethyloct-7-ene-1,6-diol | |
40188-41-8 | 3,7-Dimethyloctanenitrile | |
22810-10-2 | 3,7-Dimethyloctyl ethyl ether | |
831213-72-0 | 3,9-Dimethyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decan-2-one | |
68480-10-4 | 3,9-Undecadien-2-one, 3,6,10-trimethyl- | |
1315250-65-7 | 3-[cis-4-(2-methylpropyl)cyclohexyl]propanal | |
1315250-67-9 | 3-[trans-4-(2-methylpropyl)cyclohexyl]propanal | |
7158-25-0 | 3a,4,4a,5,8,8a,9,9a-Octahydro-4,9:5,8-dimethano-1H-benz[f]indene | |
94248-21-2 | 3a,4,5,6,7,7a-Hexahydro-2,6(or 3,6)-dimethyl-4,7-methano-1H-inden-5-ol | |
67634-20-2 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-yl isobutyrate | |
68039-45-2 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-yl pivalate | |
67634-24-6 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-yl propionate | |
68039-39-4 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-yl isobutyrate | |
68039-44-1 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-yl pivalate | |
68912-13-0 | 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-indenyl propionate (mixture of isomers) | |
53018-24-9 | 3a,4,5,6,7,7a-Hexahydro-5-methoxy-4,7-methano-1H-indene | |
27135-90-6 | 3a,4,5,6,7,7a-Hexahydromethoxy-4,7-methano-1H-indene (isomer unspecified) | |
58096-47-2 | 3a,7-Methano-3aH-cyclopentacycloocten-3-ol, decahydro-1,1,7-trimethyl-, formate | |
10599-70-9 | 3-Acetyl-2,5-dimethylfuran | |
136954-25-1 | 3-Acetylmercaptohexyl acetate | |
350-03-8 | 3-Acetylpyridine | |
60466-73-1 | 3-Benzyltetrahydropyran | |
54992-90-4 | 3-Buten-2-one, 4-(2,2,3,6-tetramethylcyclohexyl)- | |
54992-91-5 | 3-Buten-2-one, 4-[2,5,6,6-tetramethyl-1(or 2)-cyclohexen-1-yl]- | |
551-08-6 | 3-Butylidenephthalide | |
66848-40-6 | 3-Cyclohexene-1-carbonitrile, 3,5(2,4)-dimethyl- | |
21690-43-7 | 3-Cyclohexene-1-carbonitrile, 4-(4-methyl-3-pentenyl)- | |
1049017-63-1 | 3-Cyclohexene-1-carboxaldehyde, 1-ethenyl- | |
58911-05-0 | 3-Cyclohexene-1-carboxlic acid, 1,4-dimethyl-, methyl ester | |
65652-28-0 | 3-Cyclohexene-1-carboxylic acid, 1-methyl-3-(4-methyl-3-pentenyl)-,methyl ester | |
815580-59-7 | 3-Cyclohexene-1-carboxylic acid, 2,6,6-trimethyl-, methyl ester | |
426218-78-2 | 3-Cyclohexene-1-methanol, 3(or 4)-methyl-1-(2,2,3-trimethyl-3-cyclopenten-1-yl)-, acid-isomerized | |
681433-04-5 | 3-Cyclooctene-1-methanol, alpha-ethyl- | |
166432-53-7 | 3-Cyclopentene-1-butanal, alpha,2,2,3-tetramethyl-.gamma.-methylene | |
10519-33-2 | 3-Decen-2-one | |
68083-57-8 | 3-Dodecenal | |
73263-36-2 | 3-Dodecyldihydrofuran-2(3H)-one | |
13360-65-1 | 3-Ethyl-2,5-dimethylpyrazine | |
13925-07-0 | 3-Ethyl-2,6-dimethylpyrazine | |
21835-01-8 | 3-Ethyl-2-hydroxy-2-cyclopenten-1-one | |
54491-17-7 | 3-Ethylhexahydro-2(3H)-benzofuranone | |
620-17-7 | 3-Ethylphenol | |
536-78-7 | 3-Ethylpyridine | |
106-35-4 | 3-Heptanone | |
623-37-0 | 3-Hexanol | |
589-38-8 | 3-Hexanone | |
86460-54-0 | 3-Hexanone, 2-methyl-, oxime | |
851768-51-9 | 3-Hexanone, 5-mercapto-5-methyl- | |
544-12-7 | 3-Hexen-1-ol (isomer unspecified) | |
4440-65-7 | 3-Hexenal | |
888744-18-1 | 3-Hexene, 1-(2-buten-1-yloxy)-, (3Z)- | |
215305-10-5 | 3-Hexene, 1,1',''-[ethylidynestris(oxy)]tris-, (3Z, 3'Z,3"Z)- | |
292605-05-1 | 3-Hexene, 1-[(2-methyl-2-propenyl)oxy]- (3Z)- | |
4219-24-3 | 3-Hexenoic acid | |
10094-41-4 | 3-Hexenyl 2-methylbutanoate | |
68133-76-6 | 3-Hexenyl 2-oxopropionate | |
42436-07-7 | 3-Hexenyl phenylacetate | |
18436-37-8 | 3-Hexyldihydrofuran-2(3H)-one | |
4314-14-1 | 3H-Pyrazol-3-one, 2,4-dihydro-5-methyl-2-phenyl-4-(phenylazo)- | |
4702-90-3 | 3H-Pyrazol-3-one, 4-[(1,5-dihydro-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-ylidene)methyl]-2,4-dihydro-5-methyl-2-phenyl- | |
87061-04-9 | 3-l-Menthoxypropane-1,2-diol | |
67633-97-0 | 3-Mercapto-2-pentanone | |
34300-94-2 | 3-Mercapto-3-methyl-1-butanol | |
1020152-51-5 | 3-Mercapto-4-methyl-2-hexanone | |
75832-79-0 | 3-Mercapto-4-methyl-2-pentanone | |
1020152-52-6 | 3-Mercapto-6-methyl-2-heptanone | |
51755-83-0 | 3-Mercaptohexanol | |
136954-20-6 | 3-Mercaptohexyl acetate | |
56539-66-3 | 3-Methoxy-3-methyl-1-butanol | |
3209-13-0 | 3-Methoxy-5-cresol | |
541-91-3 | 3-Methyl-1-cyclopentadecanone | |
589-35-5 | 3-Methyl-1-pentanol | |
1128-08-1 | 3-Methyl-2-(n-pentanyl)-2-cyclopenten-1-one | |
68922-13-4 | 3-Methyl-2-(pentyloxy)cyclopent-2-en-1-one | |
113486-29-6 | 3-Methyl-2,4-nonedione | |
556-82-1 | 3-Methyl-2-buten-1-ol | |
107-86-8 | 3-Methyl-2-butenal | |
1191-16-8 | 3-Methyl-2-butenyl acetate | |
5205-11-8 | 3-Methyl-2-butenyl benzoate | |
68555-58-8 | 3-Methyl-2-butenyl salicylate | |
1193-18-6 | 3-Methyl-2-cyclohexen-1-one | |
50652-80-7 | 3-Methyl-2-hexenoic acid methyl ester | |
13074-63-0 | 3-Methyl-2-pentylcyclopentan-1-one | |
5205-07-2 | 3-Methyl-3-butenyl acetate | |
67801-29-0 | 3-Methyl-4-(2,4,6-trimethyl-3-cyclohexen-1-yl)-3-buten-2-one | |
65113-95-3 | 3-Methyl-5-(2,2,3-trimethyl-3-cyclopenten-1-yl)pent-3-en-2-one | |
67801-20-1 | 3-Methyl-5-(2,2,3-trimethyl-3-cyclopenten-1-yl)pent-4-en-2-ol | |
63314-79-4 | 3-Methyl-5-cyclopentadecen-1-one | |
93893-89-1 | 3-Methyl-5-phenylpent-2-enenitrile | |
54089-83-7 | 3-Methyl-5-phenylpentanenitrile | |
55066-48-3 | 3-Methyl-5-phenylpentanol | |
3720-16-9 | 3-Methyl-5-propyl-2-cyclohexen-1-one | |
763-32-6 | 3-Methylbut-3-en-1-ol | |
3842-03-3 | 3-Methylbutanal diethyl acetal | |
25415-77-4 | 3-Methylbutyl 2-butenoate | |
19329-89-6 | 3-Methylbutyl 2-hydroxypropionate | |
10482-55-0 | 3-Methylbutyl 2-methyl-2-butenoate | |
27625-35-0 | 3-Methylbutyl 2-methylbutanoate | |
2050-01-3 | 3-Methylbutyl 2-methylpropanoate | |
2050-09-1 | 3-Methylbutyl valerate | |
590-86-3 | 3-Methylbutyraldehyde | |
541-47-9 | 3-Methylcrotonic acid | |
82356-51-2 | 3-Methylcyclopentadecenone | |
765-70-8 | 3-Methylcyclopentane-1,2-dione | |
85351-07-1 | 3-Methyldodecanonitrile | |
565-62-8 | 3-Methylpent-3-en-2-one | |
105-43-1 | 3-Methylpentanoic acid | |
53082-58-9 | 3-Methylpentyl 2-methylisocrotonate | |
624-51-1 | 3-Nonanol | |
925-78-0 | 3-Nonanone | |
14309-57-0 | 3-Nonen-2-one | |
589-98-0 | 3-Octanol | |
106-68-3 | 3-Octanone | |
1669-44-9 | 3-Octen-2-one | |
4864-61-3 | 3-Octyl acetate | |
40785-62-4 | 3-Oxabicyclo[10.3.0]pentadec-6-ene | |
68611-23-4 | 3-Pentanone, 1-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, reaction products with 2-propyn-1-ol | |
122-97-4 | 3-Phenyl-1-propanol | |
7306-12-9 | 3-Phenyl-3-buten-1-yl acetate | |
16251-77-7 | 3-Phenylbutanal | |
104-53-0 | 3-Phenylpropionaldehyde | |
501-52-0 | 3-Phenylpropionic acid | |
122-72-5 | 3-Phenylpropyl acetate | |
122-68-9 | 3-Phenylpropyl cinnamate | |
103-58-2 | 3-Phenylpropyl isobutyrate | |
39067-39-5 | 3-Propylbicyclo[2.2.1]hept-5-ene-2-carboxaldehyde | |
17369-59-4 | 3-Propylidenephthalide | |
621-27-2 | 3-Propylphenol | |
31846-06-7 | 3-tert-Butylcyclohexyl acetate | |
585-34-2 | 3-tert-Butylphenol | |
25966-79-4 | 3-Thujopsanone | |
68141-19-5 | 3-Undecen-2-one, 10-hydroxy-3,6,10-trimethyl- | |
23267-57-4 | 4-(1,2-Epoxy-2,6,6-trimethylcyclohexyl)-3-buten-2-one | |
66072-32-0 | 4-(1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl)-cyclohexanol | |
14576-08-0 | 4-(1-Methoxy-1-methylethyl)-1-methylcyclohexene | |
67801-38-1 | 4-(2,4,6-Trimethyl-3-cyclohexen-1-yl)-3-buten-2-one | |
65405-84-7 | 4-(2,6,6-Trimethyl-2-cyclohexen)-2-methylbutanal | |
60241-53-4 | 4-(2,6,6-Trimethylcyclohexyl)-3-methylbutan-2-ol | |
13215-88-8 | 4-(2-Butenylidene)-3,5,5-trimethylcyclohex-2-en-1-one | |
55418-52-5 | 4-(3,4-Methylenedioxyphenyl)-2-butanone | |
126646-06-8 | 4(3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-6-yl)-3-methyl-3-buten-2-ol | |
2057-49-0 | 4-(3-Phenylpropyl)pyridine | |
38462-23-6 | 4-(4,8-Dimethylnona-3,7-dienyl)pyridine | |
67828-19-7 | 4-(4-Methoxyphenyl)-3-methylbutan-2-one | |
67634-03-1 | 4-(Isopropyl)-.beta.-methylcyclohexanethanol | |
63449-95-6 | 4-(Isopropyl)cyclohexyl propionate | |
23550-40-5 | 4-(Methylthio)-4-methyl-2-pentanone | |
5471-51-2 | 4-(p-Hydroxyphenyl)-2-butanone | |
104-20-1 | 4-(p-Methoxyphenyl)-2-butanone | |
934534-30-2 | 4,7-Decadienal | |
1338815-87-4 | 4,7-Methano-1H-indene-5-carboxaldehyde, octahydro-6-methyl- | |
129520-41-8 | 4,7-Methano-3aH-indene-3a-carboxylic acid, octahydro-, ethyl ester | |
1958027-35-4 | 4,8-Decadienal, (4Z,8Z)- | |
1882830-62-7 | 4,8-Undecadienal, (4Z,8Z)- | |
1882830-61-6 | 4,8-Undecadienenitrile, (4Z,8Z)- | |
1801275-28-4 | 4,9-Dodecadienal, (4Z,9Z)- | |
1882830-66-1 | 4,9-Dodecadienenitrile, (4Z,9Z)- | |
58096-46-1 | 4,4,8-Trimethyltricyclo[6.3.1.02,5]dodecan-1-yl formate | |
18096-62-3 | 4,4a,5,9b-Tetrahydroindeno[1,2-d]-1,3-dioxine | |
51519-65-4 | 4,4a,6,7,8,8a-Hexahydro-1,4-methanonaphthalen-5(1H)-one | |
38303-23-0 | 4,5,6,7,8,9,10,11,12,13-Decahydrocyclododecaoxazole | |
494-90-6 | 4,5,6,7-Tetrahydro-3,6-dimethylbenzofuran | |
76788-46-0 | 4,5-Dimethyl-2-ethyl-3-thiazoline | |
53498-32-1 | 4,5-Dimethyl-2-isobutylthiazole | |
28664-35-9 | 4,5-Dimethyl-3-hydroxy-2,5-dihydrofuran-2-one | |
675-09-2 | 4,6-Dimethyl-2H-pyran-2-one | |
36635-35-5 | 4,6-Dimethylcyclohex-3-ene-1-carbaldehyde | |
74499-58-4 | 4,7,7-Trimethyl-2-(3-methyl-2-butenyl)bicyclo[4.1.0]heptan-3-one | |
6784-08-3 | 4,7,7-Trimethyl-6-thiabicyclo[3.2.1]oct-3-ene | |
68398-18-5 | 4,7,7-Trimethyl-6-thiabicyclo[3.2.1]octane | |
53338-05-9 | 4,7-Dihydro-2-methyl-2-(3-methylbutyl)-1,3-dioxepin | |
2550-11-0 | 4,7-Dimethyloct-6-en-3-one | |
79771-15-6 | 4,7-Methano-1H-inden-5-ol, 3a,4,5,6,7,7a-hexahydrodimethyl- | |
26912-64-1 | 4,7-Methano-1H-indene, 3a,4,5,6,7,7a-hexahydro- 5(or 6)-(2-propenyloxy)- | |
28132-01-6 | 4,7-Methano-1H-indene-2,5-dimethanol, octahydro- | |
1339119-15-1 | 4,7-Methano-1H-indene-5-acetaldehyde, octahydro- | |
727414-17-7 | 4,7-Methano-1H-indenecarboxaldehyde, 3a,4,5,6,7,7a-hexahydro-, reaction product with Me Et ketone, acid-isomerized, reduced | |
189440-77-5 | 4,7-Octadienoic acid, methyl ester, (4E)- | |
67845-50-5 | 4,8-Dimethyl-3-7-nonadien-2-ol | |
71077-31-1 | 4,8-Dimethyl-4,9-decadienal | |
40596-76-7 | 4,8-Dimethyl-7-nonen-2-ol | |
57963-77-6 | 4a(2H)-Naphthalenol, octahydro-4,4,8a-trimethyl-, cis- | |
4166-20-5 | 4-Acetoxy-2,5-dimethyl-3(2H)furanone | |
72207-94-4 | 4-Acetoxy-3-ethoxybenzaldehyde | |
18871-14-2 | 4-Acetoxy-3-pentyltetrahydropyran | |
13171-00-1 | 4-Acetyl-6-t-butyl-1,1-dimethylindan | |
57371-42-3 | 4-Allyl-2-methoxyphenyl benzyl ether | |
501-92-8 | 4-Allylphenol | |
562-74-3 | 4-Carvomenthenol | |
83926-73-2 | 4-Cyclohexyl-2-methyl-2-butanol | |
35720-57-1 | 4-Cyclopentadecen-1-one | |
14595-54-1 | 4-Cyclopentadecen-1-one, (Z)- | |
90411-73-7 | 4-Ethyl-6-(2,6,6-trimethylyclohex-2-en-1-yl)hex-2-ene-1,4-diol, cyclized | |
4748-78-1 | 4-Ethylbenzaldehyde | |
2785-89-9 | 4-Ethylguaiacol | |
16493-80-4 | 4-Ethyloctanoic acid | |
1373821-23-8 | 4H-1,3-Benzodioxin, hexahydro-4-methyl-2-(phenylmethyl)- | |
1357064-95-9 | 4H-4a,9-Methanoazuleno[5,6-d]-1,3-dioxole, octahydro-2,5,8,8,9a-pentamethyl-2-propyl-, (3aS,4aR,5R,7aS,9R,9aR)- | |
1357064-95-9 | 4H-4a,9-Methanoazuleno[5,6-d]-1,3-dioxole, octahydro-2,5,8,8,9a-pentamethyl-2-propyl-, (3aS,4aR,5R,7aS,9R,9aR)- | |
211299-54-6 | 4H-4a,9-Methanoazuleno[5,6-d]-1,3-dioxole, octahydro-2,2,5,8,8,9a-hexamethyl-, (4aR,5R,7aS,9R)- | |
10250-45-0 | 4-Heptanol, 2,6-dimethyl-,acetate | |
123-19-3 | 4-Heptanone | |
6728-31-0 | 4-Heptenal | |
18492-65-4 | 4-Heptenal diethyl acetal | |
928-91-6 | 4-Hexen-1-ol, (4Z)- | |
58461-27-1 | 4-Hexen-1-ol, 5-methyl-2-(1-methylethenyl)- | |
498-16-8 | 4-Hexen-1-ol, 5-methyl-2-(1-methylethenyl)-, (R)- | |
97384-47-9 | 4-Hexenenitrile, 2-ethenyl-2,5-dimethyl- | |
823178-41-2 | 4H-Indeno[4,5-D]-1,3-dioxole, 3a,5,6,7,8,8b-hexahydro-2,2,6,6,7,8,8-heptamethyl- | |
3658-77-3 | 4-Hydroxy-2,5-dimethyl-3(2H)-furanone | |
68141-16-2 | 4-Hydroxy-3,6,10-trimethylundec-9-en-2-one | |
498-02-2 | 4'-Hydroxy-3'-methoxyacetophenone | |
39212-23-2 | 4-Hydroxy-3-methyloctanoic acid lactone | |
591-12-8 | 4-Hydroxy-3-pentenoic acid lactone | |
99-93-4 | 4-Hydroxyacetophenone | |
99-93-4 | 4-Hydroxyacetophenone | |
123-08-0 | 4-Hydroxybenzaldehyde | |
96-48-0 | 4-Hydroxybutanoic acid lactone | |
831-97-0 | 4-Isopropyl-.alpha.-methylcinnamaldehyde | |
14374-92-6 | 4-Isopropyl-1-methyl-2-propenylbenzene | |
67890-79-3 | 4-Isopropyl-1-methylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde | |
29350-67-2 | 4-Isopropyl-1-methylcyclohexene | |
500-02-7 | 4-Isopropyl-2-cyclohexenone | |
6379-73-3 | 4-Isopropyl-2-methoxy-1-methylbenzene | |
3583-00-4 | 4-Isopropyl-5,5-dimethyl-1,3-dioxane | |
4621-04-9 | 4-Isopropylcyclohexanol | |
99-89-8 | 4-Isopropylphenol | |
19872-52-7 | 4-Mercapto-4-methyl-2-pentanone | |
94087-83-9 | 4-Methoxy-2-methyl-2-butanethiol | |
5462-06-6 | 4-Methoxy-alpha-methylbenzenepropanal | |
2403-58-9 | 4-Methoxybenzaldehyde diethyl acetal | |
100-09-4 | 4-Methoxybenzoic acid | |
57094-40-3 | 4-Methyl-1-oxaspiro[5.5]undecan-4-ol | |
68228-06-8 | 4-Methyl-1-oxaspiro[5.5]undecene | |
67634-23-5 | 4-Methyl-2-(1-phenylethyl)-1,3-dioxolane | |
108-11-2 | 4-Methyl-2-pentanol | |
108-10-1 | 4-Methyl-2-pentanone | |
26643-91-4 | 4-Methyl-2-phenyl-2-pentenal | |
81782-77-6 | 4-Methyl-3-decen-5-ol | |
141-79-7 | 4-Methyl-3-penten-2-one | |
7403-42-1 | 4-Methyl-4-phenyl-2-pentanone | |
137-00-8 | 4-Methyl-5-thiazoleethanol | |
656-53-1 | 4-Methyl-5-thiazoleethanol acetate | |
1759-28-0 | 4-Methyl-5-vinylthiazole | |
122760-85-4 | 4-Methyl-8-methylenetricyclo[3.3.1.(3,7)]decan-2-yl acetate | |
122-00-9 | 4'-Methylacetophenone | |
2216-45-7 | 4-Methylbenzyl acetate | |
36861-47-9 | 4-methylbenzylidene camphor; 1,7,7-Trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | |
45019-28-1 | 4-Methylnonanoic acid | |
54947-74-9 | 4-Methyloctanoic acid | |
646-07-1 | 4-Methylpentanoic acid | |
491-35-0 | 4-Methylquinoline | |
123-17-1 | 4-Nonanol, 2,6,8-trimethyl- | |
78989-37-4 | 4-Octenoic acid, ethyl ester, (4E)- | |
224031-71-4 | 4-Penten-1-one, 1-spiro[4.5]dec-6-en-7-yl- | |
224031-70-3 | 4-Penten-1-one, 1-spiro[4.5]dec-7-en-7-yl- | |
20962-70-3 | 4-Pentenoic acid, 2-acetyl-4-methyl-, ethyl ester | |
2344-70-9 | 4-Phenyl-2-butanol | |
17488-65-2 | 4-Phenyl-3-buten-2-ol | |
16587-71-6 | 4-t-Amylcyclohexanone | |
2040-10-0 | 4'-tert-Butyl-2',6'-dimethylacetophenone | |
98-52-2 | 4-tert-Butylcyclohexanol | |
32210-23-4 | 4-tert-Butylcyclohexyl acetate | |
98-51-1 | 4-tert-Butyltoluene | |
546-79-2 | 4-Thujanol | |
30168-23-1 | 4-Tricyclodecylidene butanal | |
72881-27-7 | 5- and 6-Decenoic acid | |
54088-65-2 | 5-Heptenenitrile, 2,6-dimethyl- | |
65113-99-7 | 5-(2,2,3-Trimethyl-3-cyclopentenyl)-3-methylpentan-2-ol | |
70851-61-5 | 5-(cis-3-Hexenyl)dihydro-5-methyl-2(3H)furanone | |
67633-92-5 | 5-(Diethoxymethyl)-3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene | |
68259-31-4 | 5(Or 6)-Methyl-7(or 8)-(1-methylethyl)bicyclo[2.2.2]oct-5-ene-2-carbaldehyde | |
85700-02-3 | 5,8-Methano-2H-1-benzopyran, 6-ethylideneoctahydro-, (4aα,5β,6E,8β,8aα)- | |
34413-35-9 | 5,6,7,8-Tetrahydroquinoxaline | |
358331-95-0 | 5,6,7-Trimethylocta-2,5-dien-4-one | |
36267-71-7 | 5,7-Dihydro-2-methylthieno(3,4-d)pyrimidine | |
943723-15-7 | 5,8-Methano-2H-1-benzopyran, 6(or 7)-ethylideneoctahydro-, [4aR,5S,8S,8aS(or 4aR,5R,8S,8aR)]-rel- | |
85633-08-5 | 5,8-Methano-2H-1-benzopyran, 6-ethylideneoctahydro-, (4aalpha,5beta,6Z,8beta,8aalpha)- | |
85700-01-2 | 5,8-Methano-2H-1-benzopyran, 6-ethylideneoctahydro-, (4aalpha,5beta,7E,8beta,8aalpha)- | |
85633-07-4 | 5,8-Methano-2H-1-benzopyran, 6-ethylideneoctahydro-, (4aalpha,5beta,7Z,8beta,8aalpha)- | |
69486-14-2 | 5,8-Methano-2H-1-benzopyran-2-one, 6- ethylideneoctahydro- | |
762-26-5 | 5,9-Dimethyl-4,8-decadienal | |
91482-37-0 | 5,9-Undecadien-2-ol,6,10-dimethyl-,acetate | |
15323-35-0 | 5-Acetyl-1,1,2,3,3,6-hexamethylindan | |
68140-48-7 | 5-Acetyl-3-isopropyl-1,1,2,6-tetramethylindane | |
68188-98-7 | 5-Butyl-5-ethyldihydrofuran-2(3H)-one | |
67770-79-0 | 5-Butyl-5-ethyltetrahydro-2H-pyran-2-one | |
37609-25-9 | 5-Cyclohexadecen-1-one | |
259854-71-2 | 5-Cyclotetradecen-1-one, 3-methyl-, (5Z)- | |
259854-70-1 | 5-Cyclotetradecen-1-one, 3-methyl-,(5E)- | |
2833-30-9 | 5-Ethoxy-2(5H)-furanone | |
17369-60-7 | 5-Ethyl-2,3,4,5-tetramethylcyclohexen-1-one | |
104-90-5 | 5-Ethyl-2-methylpyridine | |
698-10-2 | 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone | |
73347-77-0 | 5-Ethylidenebicyclo[2.2.1]hept-2-yl propionate | |
23747-48-0 | 5H-5-Methyl-6,7-dihydrocyclopenta(b)pyrazine | |
109-49-9 | 5-Hexen-2-one | |
27593-23-3 | 5-Hydroxy-2,4-decadienoic acid delta-lactone | |
10413-18-0 | 5-Hydroxy-4-methylhexanoic acid delta-lactone | |
25524-95-2 | 5-Hydroxy-7-decenoic acid delta-lactone | |
13679-86-2 | 5-Isopropenyl-2-methyl-2-vinyltetrahydrofuran | |
139539-66-5 | 5-Methyl-1-(2,2,3-trimethyl-3-cyclopenten-1-yl)-6-oxabicyclo[3.2.1]octane | |
17162-29-7 | 5-Methyl-2-(1-methylethyl)cyclohexyl lactate | |
81925-81-7 | 5-Methyl-2-hepten-4-one | |
21834-92-4 | 5-Methyl-2-phenyl-2-hexenal | |
13679-70-4 | 5-Methyl-2-thiophenecarboxaldehyde | |
38285-49-3 | 5-Methyl-3-butyltetrahydropyran-4-yl acetate | |
541-85-5 | 5-Methyl-3-heptanone | |
22457-23-4 | 5-Methyl-3-heptanone oxime | |
4927-36-0 | 5-Methyl-5-phenyl-3-hexanone | |
80480-24-6 | 5-Methyl-5-propyl-2-(1-methylbutyl)-1,3-dioxan | |
620-02-0 | 5-Methylfurfural | |
13708-12-8 | 5-Methylquinoxaline | |
60405-50-7 | 5-Phenylhex-3-en-2-one | |
35151-11-2 | 5-Phenylhex-4-en-2-one | |
2277-20-5 | 6-Nonenal, (6E)- | |
80639-54-9 | 6-Nonenenitrile, (Z)- (9CI) | |
68141-26-4 | 6-(2-Methylpropyl)quinoline | |
68959-28-4 | 6-(3Z)-3-hexen-1-yltetrahydro-2H-Pyran-2-one, | |
67633-93-6 | 6-(Diethoxymethyl)-3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene | |
502-69-2 | 6,10,14-Trimethyl-2-pentadecanone | |
3796-70-1 | 6,10-Dimethyl-5,9-undecadien-2-one | |
689-67-8 | 6,10-Dimethylundeca-5,9-dien-2-one | |
62406-73-9 | 6,10-Dioxaspiro[4.5]decane, 8,8-dimethyl-7-(1-methylethyl)- | |
67674-46-8 | 6,6-Dimethoxy-2,5,5-trimethylhex-2-ene | |
33885-51-7 | 6,6-Dimethylbicyclo[3.1.1]hept-2-ene-2-propionaldehyde | |
33704-61-9 | 6,7-Dihydro-1,1,2,3,3-pentamethyl-4(5H)-indanone | |
70214-77-6 | 6,8-Dimethylnonan-2-ol | |
21145-77-7 | 6-Acetyl-1,1,2,4,4,7-hexamethyltetraline | |
24237-00-1 | 6-Butyl-2,4-dimethyldihydropyrane | |
26330-65-4 | 6-Ethyl-3-methyloct-6-en-1-ol | |
93939-86-7 | 6-Ethylideneoctahydro-5,8-methano-2H-benzo-1-pyran | |
34131-98-1 | 6-Isopropyl-2(1H)-octahydronaphthalenone | |
135-79-5 | 6-Isopropylquinoline | |
62439-41-2 | 6-Methoxy-2,6-dimethylheptan-1-al | |
79-70-9 | 6-Methyl-.beta.-ionone | |
1604-28-0 | 6-Methyl-3,5-heptadien-2-one | |
110-93-0 | 6-Methyl-5-hepten-2-one | |
165261-13-2 | 6-Methyl-7oxa-1-thia-4-azaspiro(4,4)nonane | |
91-62-3 | 6-Methylquinoline | |
26489-01-0 | 6-Octen-1-ol, 3,7-dimethyl-,(+/-)- | |
5949-05-3 | 6-Octenal, 3,7-dimethyl-, (3S)- | |
65442-31-1 | 6-sec-Butylquinoline | |
21661-97-2 | 7-Decenal, (7Z)- | |
899810-84-5 | 7-Nonenal, 6,8-dimethyl- | |
83863-64-3 | 7,9-Dimethylspiro[5.5]undecan-3-one | |
50542-90-0 | 7-[(3,7-Dimethyl-2,6-octadienyl)oxy]-4-methyl-2H-1-benzopyran-2-one | |
2550-59-6 | 7-Cyclohexadecen-1-one | |
489-84-9 | 7-Isopropyl-1,4-dimethylazulene | |
68311-05-7 | 7-Isopropyl-5-methylbicyclo[2.2.2]oct-5-ene-2-carbonitrile | |
53767-86-5 | 7-Methoxy-3,7-dimethyloct-1-ene | |
28940-11-6 | 7-Methyl-2H-benzo-1,5-dioxepin-3(4H)-one | |
55050-40-3 | 7-Methyl-3-methyleneoct-6-enal | |
53219-21-9 | 7-Octen-2-ol, 2-methyl-6-methylene-, dihydro deriv. | |
207228-93-1 | 7-Propyl-2H-1,5-benzodioxepin-3(4H)-one | |
67634-06-4 | 8-(sec-Butyl)quinoline | |
57566-26-4 | 8aH-2, 4a-Methanonaphthalen-8a-ol, octahydro-1,1,5,5-tetramethyl-(2S,4aR,8aS)- | |
88644-30-8 | 8aH-2,4a-Methanonaphthalen-8a-ol, octahydro-1,1,5,5-tetramethyl- | |
84681-92-5 | 8-Ethyl-1,5-dimethylbicyclo[3.2.1]octan-8-ol | |
338735-71-0 | 8H-Indeno(4,5-B)furan,2,3,3a,4,5,5a,6,7,8a,9-decahydro-2,6,6,7,8,8-hexamethyl Mixture of isomers | |
67845-30-1 | 8-Isopropyl-6-methylbicyclo[2.2.2]oct-5-ene-2-carbaldehyde | |
39770-04-2 | 8-Nonenal | |
58296-81-4 | 8-Undecenal | |
89319-68-6 | 9-Hexadecyn-8-one | |
109-28-4 | 9-Octadecenamide, N-[3-(dimethylamino)propyl]-, (9Z)- | |
17354-14-2 | 9,10-Anthracenedione, 1,4-bis(butylamino)- | |
116-75-6 | 9,10-Anthracenedione, 1,4-bis[(2,4,6-trimethylphenyl)amino]- | |
28198-05-2 | 9,10-Anthracenedione, 1,4-bis[(4-butylphenyl)amino]-5,8-dihydroxy- | |
128-80-3 | 9,10-Anthracenedione, 1,4-bis[(4-methylphenyl)amino]- | |
6408-72-6 | 9,10-Anthracenedione, 1,4-diamino-2,3-diphenoxy- | |
71701-33-2 | 9,10-Anthracenedione, 1-amino-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-4-[(2,4,6-trimethylphenyl)amino]- | |
81-48-1 | 9,10-Anthracenedione, 1-hydroxy-4-[(4-methylphenyl)amino]- | |
542-46-1 | 9-Cycloheptadecen-1-one | |
13019-22-2 | 9-Decen-1-ol | |
35194-30-0 | 9-Decen-2-one | |
39770-05-3 | 9-Decenal | |
14436-32-9 | 9-Decenoic acid | |
50816-18-7 | 9-Decenyl acetate | |
68480-06-8 | 9-Decenyl propionate | |
25496-72-4 | 9-Octadecenoic acid (Z)-, monoester with 1,2,3-propanetriol | |
141-24-2 | 9-Octadecenoic acid, 12-hydroxy-, methyl ester | |
13040-19-2 | 9-Octadecenoic acid, 12-hydroxy-, zinc salt (2:1), [R-(Z)]- | |
143-14-6 | 9-Undecenal | |
131379-26-5 | 9-Undecenenitrile, (E)- | |
362467-67-2 | a2H-1,5-Benzodioxepin-3(4H)-one,7-7-(3-methylbutyl)- | |
8021-27-0 | Abies alba needle oil | |
8021-28-1 | Abies sachalinensis oil | |
54200-50-9 | Abietyl acetate | |
9000-01-5 | Acacia gum | |
105-57-7 | Acetal | |
75-07-0 | Acetaldehyde | |
3390-12-3 | Acetaldehyde cyclic propylene glycol acetal | |
5405-58-3 | Acetaldehyde dihexyl acetal | |
28069-74-1 | Acetaldehyde ethyl cis-3-hexenyl acetal | |
54484-73-0 | Acetaldehyde ethyl hexyl acetal | |
40910-49-4 | Acetaldehyde ethyl linalyl acetal | |
2556-10-7 | Acetaldehyde ethyl phenylethyl acetal | |
72927-85-6 | Acetaldehyde, [(3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl)oxy]- | |
122-71-4 | Acetaldehyde, diphenethyl acetal | |
103-84-4 | Acetanilide | |
100-06-1 | Acetanisole | |
64-19-7 | Acetic acid | |
236391-76-7 | Acetic acid, (1-oxopropoxy)-, 1-(3,3-dimethylcyclohexyl)ethyl ester | |
71549-77-4 | Acetic acid, anhydride, reaction products with (1S,3aR,4S,8aS)-decahydro-4,8,8-trimethyl-9-methylene-1,4-methanoazulene | |
144020-22-4 | Acetic acid, anhydride, reaction products with 1,5,10-trimethyl-1,5,9-cyclododecatriene | |
862107-86-6 | Acetic acid, anhydride, reaction products with 2-methylbutene dimer, hydrogenated | |
68610-78-6 | Acetic acid, anhydride, reaction products with boron trifluoride and 1,5,9-trimethyl-1,5,9-cyclododecatriene | |
108419-35-8 | Acetic acid, C11-14-branched alkyl esters, C13-rich | |
108419-32-5 | Acetic acid, C7-9-branched alkyl esters, C8-rich | |
108419-33-6 | Acetic acid, C8-10-branched alkyl esters, C9-rich | |
124358-45-8 | Acetic acid, cyano-, reaction products with 10-undecenal | |
68478-36-4 | Acetic acid, decyl ester, branched | |
69103-01-1 | Acetic acid, esters with turpentine-oil myrcene fraction terpene alcs. | |
513-86-0 | Acetoin | |
67-64-1 | Acetone | |
1392276-61-7 | Acetonitrile, 2-(2,4,4-trimethylcyclopentylidene)- | |
98-86-2 | Acetophenone | |
54830-99-8 | Acetoxydihydrodicyclopentadiene (Mixture of Isomers) | |
32388-55-9 | Acetyl cedrene | |
600-14-6 | Acetyl propionyl | |
77-89-4 | Acetyl triethyl citrate | |
3608-11-5 | Acetylcarene | |
22047-25-2 | Acetylpyrazine | |
85480-47-3 | Acorus calamus, ext., hydrogenated | |
25085-02-3 | Acrylamide/sodium acrylate copolymer | |
9002-18-0 | Agar gum | |
94350-09-1 | Agarwood extract | |
958663-49-5 | Agarwood extract, Vietnamese | |
94350-09-1 | Agarwood oil | |
1333524-00-7 | Agarwood oil, Indonesia | |
958663-49-5 | Agarwood oil, Vietnamese | |
8001-99-8 | Ajowan oil | |
943609-24-3 | Alcoholic beverages, rum, CO2 extract, nonalc. | |
943609-24-3 | Alcoholic beverages, rum, extract, nonalc. | |
943609-24-3 | Alcoholic beverages, rum, nonalc., distillate | |
78330-21-9 | Alcohols, C11-14-isoalcohols, C13-rich, ethoxylated | |
68526-86-3 | Alcohols, C11-14-iso-, C13-rich | |
68131-40-8 | Alcohols, C11-15-secondary, ethoxylated | |
75782-86-4 | Alcohols, C12-13 | |
68439-50-9 | Alcohols, C12-14, ethoxylated | |
68131-39-5 | Alcohols, C12-15, ethoxylated | |
68213-23-0 | Alcohols, C12-18, ethoxylated | |
66455-14-9 | Alcohols, C12-13, ethoxylated | |
84133-50-6 | Alcohols, C12-14-secondary, ethoxylated | |
106232-83-1 | Alcohols, C12-15-branched and linear, ethoxylated | |
68855-56-1 | Alcohols, C12-16 | |
68002-94-8 | Alcohols, C16-18 and C18-unsaturated | |
68987-81-5 | Alcohols, C6-10, ethoxylated propoxylated | |
68439-45-2 | Alcohols, C6-12, ethoxylated (5 > EO < 20) | |
68526-84-1 | Alcohols, C8-10-iso-, C9-rich | |
68439-46-3 | Alcohols, C9-11, ethoxylated | |
93821-11-5 | Alcohols, C9-11-branched and linear, C10-rich | |
68526-85-2 | Alcohols, C9-11-iso-, C10-rich | |
73049-35-1 | Alcohols, sesquiterpenoidal, citronella-oil | |
130169-57-2 | Aldehydes, C13-15-branched and linear | |
130169-57-2 | Aldehydes, C13-15-branched and linear | |
84082-36-0 | Alfalfa extract | |
9005-38-3 | Algin (Laminaria spp. and other kelps) | |
90622-46-1 | Alkances, C14-C16 | |
68551-17-7 | Alkanes, C10-13-iso- | |
68551-19-9 | Alkanes, C12-14-iso- | |
97-59-6 | Allantoin | |
8006-77-7 | Allspice oil | |
67634-01-9 | Allyl (2-methylbutoxy)acetate | |
67634-00-8 | Allyl (3-methylbutoxy)acetate | |
68901-15-5 | Allyl (cyclohexyloxy)acetate | |
71500-37-3 | Allyl 3,5,5-trimethylhexanoate | |
79-78-7 | Allyl alpha-ionone | |
2051-78-7 | Allyl butyrate | |
1866-31-5 | Allyl cinnamate | |
4728-82-9 | Allyl cyclohexaneacetate | |
2705-87-5 | Allyl cyclohexanepropionate | |
57856-81-2 | Allyl decanoate | |
2179-57-9 | Allyl disulfide | |
142-19-8 | Allyl heptanoate | |
123-68-2 | Allyl hexanoate | |
7493-72-3 | Allyl nonanoate | |
4230-97-1 | Allyl octanoate | |
7493-74-5 | Allyl phenoxyacetate | |
1797-74-6 | Allyl phenylacetate | |
2408-20-0 | Allyl propionate | |
592-88-1 | Allyl sulfide | |
68132-80-9 | Allyl trimethylhexanoate | |
8013-76-1 | Almond oil, bitter | |
8007-69-0 | Almond oil, sweet | |
8001-97-6 | Aloe extract | |
65114-03-6 | alpha,2,2,3-tetramethylcyclopent-3-ene-1-butyraldehyde | |
67634-15-5 | alpha,alpha-Dimethyl-p-ethylphenylpropanal | |
100-86-7 | alpha,alpha-Dimethylphenethyl alcohol | |
10094-34-5 | alpha,alpha-Dimethylphenethyl butyrate | |
10058-43-2 | alpha,alpha-Dimethylphenethyl formate | |
67785-77-7 | alpha,alpha-Dimethylphenylethyl propionate | |
43052-87-5 | alpha-1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-buten-1-one | |
60763-41-9 | alpha-Amyl cinnamic aldehyde diethyl acetal | |
78605-96-6 | alpha-Amyl trans-Cinnamaldehyde | |
122-40-7 | alpha-Amylcinnamaldehyde | |
91-87-2 | alpha-Amylcinnamaldehyde dimethyl acetal | |
68527-78-6 | alpha-Amylcinnamaldehyde-methyl anthranilate (Schiff base) | |
101-85-9 | alpha-Amylcinnamyl alcohol | |
17627-44-0 | alpha-Bisabolene | |
7492-44-6 | alpha-Butylcinnamaldehyde | |
4586-22-5 | alpha-Caryophyllene alcohol | |
469-61-4 | alpha-Cedrene | |
10461-98-0 | alpha-Cyclohexylidene benzeneacetonitrile | |
57-50-1 | alpha-D-Glucopyranoside, beta-D-fructofuranosyl | |
502-61-4 | alpha-Farnesene | |
3691-12-1 | alpha-Guaiene | |
101-86-0 | alpha-Hexylcinnamaldehyde | |
25322-69-4 | Alpha-hydro-omega-hydroxypoly(oxy(methyl-1,2-ethanediyl)) | |
25312-34-9 | alpha-Ionol | |
127-41-3 | alpha-Ionone | |
79-69-6 | alpha-Irone | |
7779-78-4 | alpha-Isobutylphenethyl alcohol | |
127-51-5 | alpha-iso-Methylionone | |
1205-17-0 | alpha-Methyl-1,3-benzodioxole-5-propionaldehyde | |
93-92-5 | alpha-Methylbenzyl acetate | |
98-85-1 | alpha-Methylbenzyl alcohol | |
3460-44-4 | alpha-Methylbenzyl butyrate | |
7775-39-5 | alpha-Methylbenzyl isobutyrate | |
120-45-6 | alpha-Methylbenzyl propionate | |
101-39-3 | alpha-Methylcinnamaldehyde | |
1504-55-8 | alpha-Methylcinnamic alcohol | |
10528-67-3 | alpha-Methyl-cyclohexanepropanol | |
99-83-2 | alpha-Phellandrene | |
80-56-8 | alpha-Pinene | |
705-73-7 | alpha-Propylphenethyl alcohol | |
98-55-5 | alpha-Terpineol | |
80-26-2 | alpha-Terpineol acetate | |
8038-65-1 | Ambergris tincture | |
8015-62-1 | Ambrette seed absolute | |
8015-62-1 | Ambrette seed extract | |
8015-62-1 | Ambrette seed oil | |
8015-62-1 | Ambrette seed oil | |
8015-62-1 | Ambrette tincture | |
201363-52-2 | Amides, coco, N-(hydroxyethyl), propoxylated | |
70592-80-2 | Amine oxides, C10-16-alkyldimethyl | |
68955-55-5 | Amine oxides, C12-18-alkyldimethyl | |
61788-90-7 | Amines, coco alkyldimethyl, N-oxides | |
71-41-0 | Amyl alcohol | |
540-18-1 | Amyl butyrate | |
3487-99-8 | Amyl cinnamate | |
638-49-3 | Amyl formate | |
540-07-8 | Amyl hexanoate | |
2445-72-9 | Amyl isobutyrate | |
638-25-5 | Amyl octanoate | |
2050-08-0 | Amyl salicylate | |
2173-56-0 | Amyl valerate | |
67874-72-0 | Amylcyclohexyl acetate (mixed isomers) | |
113894-85-2 | Amylopectin, acid-hydrolyzed, 1-octenylbutanedioate | |
8015-65-4 | Amyris oil | |
68916-14-3 | Amyris oil, acetylated | |
8015-65-4 | Amyris oil, rectified | |
4075-07-4 | Androsta-4,16-dien-3-one | |
104-46-1 | Anethole (isomer unspecified) | |
8015-64-3 | Angelica root oil | |
8015-64-3 | Angelica seed absolute | |
8015-64-3 | Angelica seed extract | |
8015-64-3 | Angelica seed oil | |
8007-70-3 | Anise seed oil | |
100-66-3 | Anisole | |
1331-83-5 | Anisyl acetate (isomer unspecified) | |
105-13-5 | Anisyl alcohol | |
1331-81-3 | Anisyl alcohol (o-,m-,p-) | |
122-91-8 | Anisyl formate | |
102-17-0 | Anisyl phenylacetate | |
7549-33-9 | Anisyl propionate | |
883111-87-3 | Apple alcoholate | |
883111-87-3 | Apple distillate | |
883111-87-3 | Apple essence oil | |
883111-87-3 | Apple extract | |
883111-87-3 | Apple oil, rectified | |
883111-87-3 | Apple tincture | |
85251-63-4 | Apple, Malus sylvestris, ext. | |
72869-69-3 | Apricot absolute | |
72869-69-3 | Apricot kernel oil | |
72869-69-3 | Apricot tincture | |
92704-37-5 | Aralia Canadensis extract | |
223747-87-3 | Argania spinosa oil, expressed | |
68991-20-8 | Armoise vulgaris oil | |
8057-65-6 | Arnica distillate | |
8057-65-6 | Arnica resinoid | |
8057-65-6 | Arnica resinoid | |
84775-75-7 | Artemisia herba-alba oil | |
9000-04-8 | Asafetida oil | |
50-81-7 | Ascorbic acid | |
137-66-6 | Ascorbyl 6-palmitate | |
68916-62-1 | Baccartol | |
84082-61-1 | Balm leaves extract | |
8007-00-9 | Balsam absolute, Peru | |
8007-00-9 | Balsam absolute, Peru, pyrogenated | |
8007-00-9 | Balsam extract, Peru | |
85085-34-3 | Balsam fir oleoresin | |
8007-00-9 | Balsam oil, Peru | |
8007-00-9 | Balsam oil, Peru | |
8007-00-9 | Balsam resinoid, Peru | |
8007-00-9 | Balsam, Peru | |
8007-47-4 | Balsams, Canada | |
8015-73-4 | Basil absolute, chemotype linalool | |
8015-73-4 | Basil oil, chemotype estragole | |
8015-73-4 | Basil oil, chemotype estragole, rectified | |
8015-73-4 | Basil oil, chemotype linalool | |
8015-73-4 | Basil oleoresin, chemotype estragole | |
8006-78-8 | Bay leaves oil, West Indian, rectified | |
8006-78-8 | Bay leaves, West Indian, CO2 extract | |
8006-78-8 | Bay leaves, West Indian, extract | |
68916-05-2 | Bay leaves, West Indian, oil | |
8006-78-8 | Bay leaves, West Indian, oil | |
68916-05-2 | Bay oil, terpeneless | |
8021-39-4 | Beechwood creosote | |
8012-89-3 | Beeswax absolute | |
8012-89-3 | Beeswax CO2 extract | |
8012-89-3 | Beeswax concrete | |
8012-89-3 | Beeswax resinoid | |
1302-78-9 | Bentonite | |
100-52-7 | Benzaldehyde | |
1125-88-8 | Benzaldehyde dimethyl acetal | |
1319-88-6 | Benzaldehyde glyceryl acetal | |
37837-44-8 | Benzaldehyde methyl anthranilate (Schiff base) | |
2568-25-4 | Benzaldehyde propylene glycol acetal | |
2186-92-7 | Benzene, 1-(dimethoxymethyl)-4-methoxy- | |
637-69-4 | Benzene, 1-ethenyl-4-methoxy- | |
834-25-3 | Benzene, 1-methyl-4-(phenylmethoxy)- | |
621-23-8 | Benzene, 1,3,5-trimethoxy- | |
119345-04-9 | Benzene, 1,1'-oxybis-, tetrapropylene derivs., sulfonated, sodium salts | |
634-36-6 | Benzene, 1,2,3-trimethoxy- | |
95-63-6 | Benzene, 1,2,4-trimethyl- | |
41424-36-6 | Benzene, 1,3,5-tribromo-2-methoxy-4-methyl- | |
108-67-8 | Benzene, 1,3,5-trimethyl- | |
67774-74-7 | Benzene, C10-13-alkyl derivs. | |
66070-58-4 | Benzene, ethenyl-, polymer with 1,3-butadiene, hydrogenated | |
129813-58-7 | Benzene, mono-C10-13-alkyl derivs. | |
68083-55-6 | Benzeneacetaldehyde, 2,4-dimethyl- | |
68844-97-3 | Benzeneacetaldehyde, 3,4-dimethyl- | |
68083-54-5 | Benzeneacetaldehyde, 4-ethyl- | |
130786-09-3 | Benzeneacetonitrile, a-butylidene-, (Z) | |
10099-57-7 | Benzeneethanol, 4-(1-methylethyl)- | |
2353-45-9 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](4-hydroxy-2-sulfophenyl)methylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, sodium salt (1:2) | |
3844-45-9 | Benzenemethanaminium, N-ethyl-N-[4-[[4-[ethyl[(3-sulfophenyl)methyl]amino]phenyl](2-sulfophenyl)met -hylene]-2,5-cyclohexadien-1-ylidene]-3-sulfo-, inner salt, disodium salt | |
2206-94-2 | Benzenemethanol, alpha-methylene-, acetate | |
134123-93-6 | Benzenepropanenitrile, 4-ethyl-.alpha.,.alpha.-dimethyl- | |
127519-17-9 | Benzenepropanoic acid, 3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxy-, C7-9-branched and linear alkyl esters | |
6683-19-8 | Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2,2-bis[[3-[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropoxy]methyl]- -1,3-propanediyl ester | |
125643-61-0 | Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, C7-9-branched alkyl esters | |
2082-79-3 | Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, octadecyl ester | |
56836-93-2 | Benzenepropanol, a,ß-dimethyl- | |
2035-93-0 | Benzenepropanol, alpha, gamma, gamma-trimethyl- | |
4403-90-1 | Benzenesulfonic acid, 2,2'-[(9,10-dihydro-9,10-dioxo-1,4-anthracenediyl)diimino]bis[5-methyl-, sodium salt (1:2) | |
4430-18-6 | Benzenesulfonic acid, 2-[(9,10-dihydro-4-hydroxy-9,10-dioxo-1-anthracenyl)amino]-5-methyl-, monosodium salt | |
92484-48-5 | Benzenesulfonic acid, 3-(2H-benzotriazol-2-yl)-4-hydroxy-5-(1-methylpropyl)-, monosodium salt | |
4474-24-2 | Benzenesulfonic acid, 3,3'-[(9,10-dihydro-9,10-dioxo-1,4-anthracenediyl)diimino]bis[2,4,6-trimethyl-, sodium salt (1:2) | |
633-96-5 | Benzenesulfonic acid, 4-[2-(2-hydroxy-1-naphthalenyl)diazenyl]-, sodium salt (1:1) | |
4065-45-6 | Benzenesulfonic acid, 5-benzoyl-4-hydroxy-2-methoxy- | |
36445-71-3 | Benzenesulfonic acid, decyl(sulfophenoxy)-, sodium salt (1:2) | |
28519-02-0 | Benzenesulfonic acid, dodecyl(sulfophenoxy)-, disodium salt | |
65143-89-7 | Benzenesulfonic acid, hexadecyl(sulfophenoxy)-, disodium salt | |
70146-13-3 | Benzenesulfonic acid, oxybis[decyl-, sodium salt (1:2) | |
25167-32-2 | Benzenesulfonic acid, oxybis[dodecyl-, disodium salt | |
2379-74-0 | Benzo[b]thiophen-3(2H)-one, 6-chloro-2-(6-chloro-4-methyl-3-oxobenzo[b]thien-2(3H)-ylidene)-4-methyl- | |
65-85-0 | Benzoic acid | |
67785-76-6 | Benzoic acid, 2-[(2-phenylethylidene)amino]-, methyl ester | |
606-27-9 | Benzoic acid, 2-nitro-, methyl ester | |
111753-60-7 | Benzoic acid, 2-((3-(1,3-benzodioxol-5-yl)-2-methylpropylidene)amino)-, methyl ester | |
68480-21-7 | Benzoic acid, 2-(dimethylamino)-, 2-methylpropyl ester | |
14735-72-9 | Benzoic acid, 2-.(..(.(4-methoxyphenyl)methylene.).amino.).-,methyl ester | |
144761-91-1 | Benzoic acid, 2-[(1-hydroxy-3-phenylbutyl)amino], methyl ester | |
25628-84-6 | Benzoic acid, 2-[(1-oxopropyl)amino]-, methyl ester | |
94248-34-7 | Benzoic acid, 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]-, methyl ester | |
68039-34-9 | Benzoic acid, 2-[[[3-(4-hydroxy-4-methylpentyl)-3-cyclohexen-1-yl]methylene]amino],methyl ester | |
111753-62-9 | Benzoic acid, 2-[[3-(4-methoxyphenyl)-2-methylpropylidene]amino]-, methyl ester | |
302776-68-7 | Benzoic acid, 2-[4-(diethylamino)-2-hydroxybenzoyl]-, hexyl ester | |
873888-84-7 | Benzoic acid, 2-hydroxy-, (3Z)-1-methyl-3-hexen-1-yl ester | |
51115-63-0 | Benzoic acid, 2-hydroxy-, 2-methylbutyl ester | |
610271-60-8 | Benzoic acid, 2-hydroxy-, 3-methyl-2-hexen-1-yl ester | |
22717-57-3 | Benzoic acid, 2-hydroxy-5-methyl-, methyl ester | |
89-71-4 | Benzoic acid, 2-methyl-, methyl ester | |
67845-93-6 | Benzoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, hexadecyl ester | |
96682-10-9 | Benzoic acid, 4-(benzoyloxy)-, phenylmethyl ester | |
119-53-9 | Benzoin | |
9000-72-0 | Benzoin CO2 extract, Siam | |
9000-72-0 | Benzoin extract, Siam | |
9000-05-9 | Benzoin extract, Sumatra | |
9000-72-0 | Benzoin gum, Siam | |
9000-05-9 | Benzoin gum, Sumatra | |
9000-05-9 | Benzoin infusion | |
9000-72-0 | Benzoin resinoid, Siam | |
9000-05-9 | Benzoin resinoid, Sumatra | |
100-47-0 | Benzonitrile | |
22884-95-3 | Benzonitrile, 3,4-dimethyl- | |
22884-95-3 | Benzonitrile, 3,4-dimethyl- | |
119-61-9 | Benzophenone | |
95-16-9 | Benzothiazole | |
2094-69-1 | Benzyl 2,2-dimethylpropanoate | |
2051-96-9 | Benzyl 2-hydroxypropionate | |
56423-40-6 | Benzyl 2-methylbutyrate | |
140-11-4 | Benzyl acetate | |
2550-26-7 | Benzyl acetone | |
100-51-6 | Benzyl alcohol | |
120-51-4 | Benzyl benzoate | |
103-37-7 | Benzyl butyrate | |
103-41-3 | Benzyl cinnamate | |
104-57-4 | Benzyl formate | |
6938-45-0 | Benzyl hexanoate | |
122-73-6 | Benzyl isoamyl ether | |
103-28-6 | Benzyl isobutyrate | |
103-38-8 | Benzyl isovalerate | |
140-25-0 | Benzyl laurate | |
100-53-8 | Benzyl mercaptan | |
538-86-3 | Benzyl methyl ether | |
10276-85-4 | Benzyl octanoate | |
102-16-9 | Benzyl phenylacetate | |
122-63-4 | Benzyl propionate | |
118-58-1 | Benzyl salicylate | |
37526-88-8 | Benzyl trans-2-methyl-2-butenoate | |
10361-39-4 | Benzyl valerate | |
622-78-6 | Benzylisothiocyanate | |
8007-75-8 | Bergamot oil | |
68917-80-6 | Bergamot oil terpenes | |
8007-75-8 | Bergamot oil, expressed | |
68648-33-9 | Bergamot oil, furocoumarin free | |
8007-75-8 | Bergamot oil, rectified | |
8007-75-8 | Bergamot oil, terpeneless | |
35044-68-9 | beta-1-(2,6,6-Trimethyl-1-cyclohexen-1-yl)-2-buten-1-one | |
87-44-5 | beta-Caryophyllene | |
18794-84-8 | beta-Farnesene | |
88-84-6 | beta-Guaiene | |
68424-94-2 | Betaines, coco alkyldimethyl | |
22029-76-1 | beta-Ionol | |
14901-07-6 | beta-Ionone | |
22030-19-9 | beta-Ionyl acetate | |
55066-49-4 | beta-Methyl-benzenepentanal | |
1123-85-9 | beta-Methylphenethyl alcohol | |
63449-68-3 | beta-Naphthyl anthranilate | |
93-18-5 | beta-Naphthyl ethyl ether | |
2173-57-1 | beta-Naphthyl isobutyl ether | |
93-04-9 | beta-Naphthyl methyl ether | |
514-51-2 | beta-Patchoulene | |
555-10-2 | beta-Phellandrene | |
127-91-3 | beta-Pinene | |
60066-88-8 | beta-Sinensal | |
464-48-2 | Bicyclo(2.2.1)heptan-2-one, 1,7,7-trimethyl-, (1S)- | |
116126-82-0 | Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(1-methylethyl)-, ethyl ester, (2-exo,3-endo)- | |
55066-54-1 | Bicyclo[2.2.1]heptan-2-ol, 1,3,3-trimethyl-, benzoate | |
137255-07-3 | Bicyclo[2.2.1]heptan-2-ol, 2-ethyl-1,3,3-trimethyl-, (1R,2R,4S)- | |
67800-86-6 | Bicyclo[2.2.1]heptane, 2-ethoxy-1,3,3-trimethyl- | |
862111-34-0 | Bicyclo[2.2.1]heptane, 2-ethyl-6-methoxy- | |
104516-97-4 | Bicyclo[2.2.1]heptane-2-carbonitrile, 1,3-dimethyl- | |
4747-61-9 | Bicyclo[3.1.1]heptane-2-ethanol, 6,6-dimethyl- | |
35227-16-8 | Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene-, polymer with 1-methyl-4-(1-methylethenyl)cyclohexene | |
30897-75-7 | Bicyclo[3.1.1]hept-2-ene-2-acetaldehyde, 6,6-dimethyl- | |
1196-01-6 | Bicyclo[3.1.1]hept-3-en-2-one, 4,6,6-trimethyl-, (1S,5S)- | |
216970-21-7 | Bicyclo[4,3,1]decane, 3-methoxy-7,7-dimethyl-10-methylene | |
92-52-4 | Biphenyl | |
8001-88-5 | Birch tar oil, rectified | |
27923-56-4 | Bis(1-methylethyl)phenol | |
122-62-3 | Bis(2-ethylhexyl) sebacate | |
6422-86-2 | Bis(2-ethylhexyl) terephthalate | |
26160-83-8 | Bis(hydroxymethyl)tricyclo[5.2.1.02,6]decane | |
1618-26-4 | bis-(Methylthio)methane | |
495-62-5 | Bisabolene | |
507-70-0 | Borneol | |
76-49-3 | Bornyl acetate | |
76-50-6 | Bornyl isovalerate | |
8053-33-6 | Boronia absolute | |
68916-76-7 | Bran absolute | |
68650-46-4 | Bucchu absolute, betulina | |
68650-46-4 | Bucchu oil, betulina | |
92346-85-5 | Bucchu oil, crenulata | |
68650-46-4 | Bucchu oil, rectified, betulina | |
68650-46-4 | Bucchu resinoid, betulina | |
94333-88-7 | Bulnesia sarmienti, ext., acetate | |
959130-05-3 | Bursera graveolens wood oil | |
16485-10-2 | Butanamide, 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethyl- | |
406488-30-0 | Butanamide, 2-ethyl-N-methyl-N-(3-methylphenyl)- | |
2568-90-3 | Butane, 1,1'-[methylenebis(oxy)]bis- | |
2373-38-8 | Butanedioic acid, sulfo-, 1,4-bis(1,3-dimethylbutyl) ester, sodium salt | |
577-11-7 | Butanedioic acid, sulfo-, 1,4-bis(2-ethylhexyl) ester, sodium salt | |
155514-23-1 | Butanoic acid, 2-methyl-, 5-hexen-1-yl ester | |
1266606-26-1 | Butanoic acid, 2-methyl-5-(1-methylethyl)cyclopentyl ester | |
68039-26-9 | Butanoic acid, 2-methyl-, pentyl ester | |
34322-08-2 | Butanoic acid, 2-methyl, S-(1-methylpropyl) ester | |
113889-23-9 | Butanoic acid, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indenyl ester | |
9003-29-6 | Butene, homopolymer | |
91745-88-9 | Butter acids | |
97926-23-3 | Butter esters | |
109-42-2 | Butyl 10-undecenoate | |
7785-66-2 | Butyl 2-methylcrotonate (E) | |
7785-64-0 | Butyl 2-methylcrotonate (Z) | |
6297-41-2 | Butyl 2-methylvalerate | |
123-86-4 | Butyl acetate | |
71-36-3 | Butyl alcohol | |
7756-96-9 | Butyl anthranilate | |
136-60-7 | Butyl benzoate | |
109-21-7 | Butyl butyrate | |
7492-70-8 | Butyl butyryllactate | |
538-65-8 | Butyl cinnamate | |
592-84-7 | Butyl formate | |
626-82-4 | Butyl hexanoate | |
97-87-0 | Butyl isobutyrate | |
109-19-3 | Butyl isovalerate | |
138-22-7 | Butyl lactate | |
2052-15-5 | Butyl levulinate | |
97-88-1 | Butyl methacrylate | |
589-75-3 | Butyl octanoate | |
122-43-0 | Butyl phenylacetate | |
94-26-8 | Butyl p-hydroxy benzoate | |
590-01-2 | Butyl propionate | |
2052-14-4 | Butyl salicylate | |
123-95-5 | Butyl stearate | |
544-40-1 | Butyl sulfide | |
109-73-9 | Butylamine | |
25013-16-5 | Butylated hydroxyanisole | |
128-37-0 | Butylated hydroxytoluene | |
123-72-8 | Butyraldehyde | |
107-92-6 | Butyric acid | |
495-40-9 | Butyrophenone | |
84012-17-9 | Buxus sempervirens absolute | |
8004-92-0 | C.I. Acid Yellow 3 | |
8049-84-1 | C.I. Natural green 3 | |
1393-63-1 | C.I. Natural Orange C | |
1328-53-6 | C.I. Pigment Green 7 | |
51274-00-1 | C.I. Pigment Yellow 42 | |
37229-23-5 | C.I. Solvent Blue 45 | |
12227-55-3 | C.I. Solvent Red 122 | |
8003-22-3 | C.I. Solvent yellow 33 | |
68989-91-3 | C10 Methoxylated hydrocarbons | |
90622-58-5 | C11-15-Isoalkanes | |
90622-57-4 | C9-12-Iso-alkanes | |
68188-03-4 | Cabreuva oil | |
8002-31-1 | Cacao absolute | |
8002-31-1 | Cacao extract | |
8002-31-1 | Cacao infusion and tincture | |
8002-31-1 | Cacao oil | |
8013-10-3 | Cade oil | |
8013-10-3 | Cade oil | |
8013-10-3 | Cade oil, rectified | |
29350-73-0 | Cadinene | |
8008-98-8 | Cajuput oil | |
8015-79-0 | Calamus oil | |
10035-04-8 | Calcium chloride, dihydrate | |
1069136-34-0 | Callitropsis nootkatensis oil | |
1069136-34-0 | Callitropsis nootkatensis oil, rectified | |
68916-73-4 | Camellia leaf extract | |
68916-73-4 | Camillia leaf concentrate | |
68916-73-4 | Camillia leaf distillate | |
79-92-5 | Camphene | |
8008-51-3 | Camphor oil, white | |
8008-51-3 | Camphor oil, white, rectified | |
68606-83-7 | Cananga oil | |
120962-03-0 | Canola oil | |
8023-77-6 | Capsicum oleoresin | |
97675-54-2 | Carambola alcoholate | |
8028-89-5 | Caramel color | |
8000-42-8 | Caraway seed oil | |
8000-42-8 | Caraway seed oil, rectified | |
67643-70-3 | Carbamic acid, N,N-dimethyl-, 1-ethenyl-1,5-dimethyl-4-hexen-1-yl ester | |
144-55-8 | Carbonic acid monosodium salt | |
260781-16-6 | Carbonic acid, 2-hydroxypropyl (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester | |
156679-39-9 | Carbonic acid, 2-hydroxyethyl 5-methyl-2-(1-methylethyl)cyclohexyl ester | |
132638-45-0 | Carbonic acid, 2-methoxy-4-methylphenyl methyl ester | |
10361-29-2 | Carbonic acid, ammonium salt | |
1403495-60-2 | Carbonic acid, compd. with guanidine (1:2), polymer with bis(isocyanatomethyl)benzene and 2-ethyl-2-(hydroxymethyl)-1,3-propanediol | |
506-87-6 | Carbonic acid, diammonium salt | |
8000-66-6 | Cardamom seed absolute | |
8000-66-6 | Cardamom seed CO2 extract | |
8000-66-6 | Cardamom seed distillate | |
8000-66-6 | Cardamom seed extract | |
8000-66-6 | Cardamom seed oil | |
8000-66-6 | Cardamon seed | |
8021-43-0 | Carnation absolute | |
79070-15-8 | Carob absolute | |
79070-15-8 | Carob bean extract | |
9000-40-2 | Carob gum | |
8015-88-1 | Carrot seed | |
8015-88-1 | Carrot seed absolute | |
8015-88-1 | Carrot seed oil | |
8015-88-1 | Carrot seed oil terpenless | |
8015-88-1 | Carrot seed oil, rectified | |
499-75-2 | Carvacrol | |
99-48-9 | Carveol | |
97-42-7 | Carvyl acetate | |
97-45-0 | Carvyl propionate | |
57082-24-3 | Caryophyllene acetate | |
75975-83-6 | Caryophyllene acetylated | |
32214-91-8 | Caryophyllene alcohol acetate | |
1139-30-6 | Caryophyllene oxide | |
8007-06-5 | Cascarilla bark extract | |
8007-06-5 | Cascarilla bark oil | |
8007-80-5 | Cassia backs terpenes | |
8007-80-5 | Cassia bark extract | |
8007-80-5 | Cassia bark oil | |
8007-80-5 | Cassia oil | |
8007-80-5 | Cassia oil, (low coumarin) | |
8007-80-5 | Cassia oil, rectified | |
8023-82-3 | Cassie absolute | |
97676-19-2 | Cassis bud absolute | |
97676-19-2 | Cassis bud CO2 extract | |
97676-19-2 | Cassis bud oil | |
97676-19-2 | Cassis bud oil, terpeneless | |
97676-19-2 | Cassis essence oil | |
97676-19-2 | Cassis tincture | |
871465-49-5 | Cassyrane | |
8001-79-4 | Castor oil | |
8001-78-3 | Castor oil, hydrogenated | |
61788-85-0 | Castor oil, hydrogenated, ethoxylated | |
8023-83-4 | Castoreum absolute | |
8023-83-4 | Castoreum concrete | |
8023-83-4 | Castoreum extract | |
8023-83-4 | Castoreum resinoid | |
8023-83-4 | Castoreum tincture | |
8001-76-1 | Catechu extract | |
8007-20-3 | Cedar leaf oil | |
91770-83-1 | Cedar leaf oil, China | |
68917-35-1 | Cedar leaf oil, East Canada | |
8007-20-3 | Cedar leaf oil, rectified | |
8023-85-6 | Cedarwood extract, Atlas | |
68990-83-0 | Cedarwood oil (low cedrol), Texas | |
61789-42-2 | Cedarwood oil acetylated | |
68608-32-2 | Cedarwood oil terpenes | |
8023-85-6 | Cedarwood oil, Atlas | |
8023-85-6 | Cedarwood oil, Atlas, rectified | |
1159574-01-2 | Cedarwood oil, Chinese | |
1159574-01-2 | Cedarwood oil, Chinese, rectified | |
68648-34-0 | Cedarwood oil, epoxidized | |
68991-36-6 | Cedarwood oil, Himalaya | |
68916-71-2 | Cedarwood oil, oxidized | |
68603-22-5 | Cedarwood oil, terpeneless | |
68990-83-0 | Cedarwood oil, Texas | |
68990-83-0 | Cedarwood oil, Texas, rectified | |
8000-27-9 | Cedarwood oil, Virginian | |
8000-27-9 | Cedarwood oil, Virginian, rectified | |
1159574-01-2 | Cedarwood terpenes, Chinese | |
8000-27-9 | Cedarwood terpenes, Virginia | |
68990-83-0 | Cedarwood extract, Texas | |
13567-39-0 | Cedr-8-ene epoxide | |
11028-42-5 | Cedrene | |
28231-03-0 | Cedrenol | |
30960-39-5 | Cedrenone | |
1405-92-1 | Cedrenyl acetate | |
39900-38-4 | Cedrenyl formate | |
77-53-2 | Cedrol | |
19870-74-7 | Cedrol methyl ether | |
77-54-3 | Cedryl acetate | |
39900-38-4 | Cedryl formate | |
67874-81-1 | Cedryl methyl ether | |
8015-90-5 | Celery seed absolute | |
8015-90-5 | Celery seed CO2 extract | |
8015-90-5 | Celery seed extract | |
8015-90-5 | Celery seed oil | |
8015-90-5 | Celery seed oleoresin | |
9004-34-6 | Cellulose | |
9004-62-0 | Cellulose, 2-hydroxyethyl ether | |
1422377-33-0 | Cellulose, carboxymethyl ether, sodium salt, polymer with bis(isocyanatomethyl)benzene, 2,2-dimethoxyacetaldehyde, ethanedial, 2-ethyl-2-(hydroxymethyl)-1,3-propanediol, 2-oxoacetic acid, 1H-1,2,4-triazole-3,5-diamine and 1,3,5-triazine-2,4,6-triamine | |
629-70-9 | Cetyl acetate | |
95912-87-1 | Cetyl palmitate | |
8002-66-2 | Chamomile flower absolute | |
8002-66-2 | Chamomile flower oil, blue | |
8002-66-2 | Chamomile flower oil, blue | |
8015-92-7 | Chamomile flower oil, Roman | |
8015-92-7 | Chamomile flower, English, oil | |
68916-68-7 | Chamomile oil, Moroccan | |
8006-76-6 | Champaca absolute | |
8006-76-6 | Champaca leaf oil | |
8006-76-6 | Champaca oil | |
84604-07-9 | Cherry bark, wild, extract | |
90604-50-5 | Chirata oil | |
11006-34-1 | Chlorophyllin, copper sodium complex | |
57-88-5 | Cholest-5-en-3-ol (3b)- | |
52256-37-8 | Chromate(1-), bis[2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol --3-onato(2-)]-, hydrogen | |
68990-12-5 | Cinchona bark red extract | |
104-55-2 | Cinnamaldehyde | |
621-82-9 | Cinnamic acid | |
4364-06-1 | Cinnamic aldehyde dimethyl acetal | |
8015-91-6 | Cinnamon bark CO2 extract | |
8015-91-6 | Cinnamon bark extract | |
8015-91-6 | Cinnamon bark oil | |
97659-68-2 | Cinnamon bark oil, Laos | |
8015-91-6 | Cinnamon leaf oil | |
8015-91-6 | Cinnamon leaf oil, rectified | |
8015-91-6 | Cinnamon leaf oleoresin | |
4360-47-8 | Cinnamonitrile (isomer unspecified) | |
103-54-8 | Cinnamyl acetate | |
104-54-1 | Cinnamyl alcohol | |
5320-75-2 | Cinnamyl benzoate | |
103-61-7 | Cinnamyl butyrate | |
122-69-0 | Cinnamyl cinnamate | |
104-65-4 | Cinnamyl formate | |
103-59-3 | Cinnamyl isobutyrate | |
140-27-2 | Cinnamyl isovalerate | |
1885-38-7 | Cinnamyl nitrile | |
103-56-0 | Cinnamyl propionate | |
71660-03-2 | cis- and trans-p-1(7),8-Menthadien-2-yl acetate | |
23726-94-5 | cis-1-(2,6,6-Trimethyl-2-cyclohexen-1-yl)-2-Buten-1-one | |
59323-76-1 | cis-2-Methyl-4-propyl-1,3-oxathiane | |
7214-18-8 | cis-2-tert-Butylcyclohexan-1-ol | |
20298-69-5 | cis-2-tert-Butylcyclohexyl acetate | |
933-48-2 | cis-3,5,5-Trimethylcyclohexan-1-ol | |
1576-78-9 | cis-3-Heptenyl acetate | |
3681-71-8 | cis-3-Hexen-1-yl acetate | |
6789-80-6 | cis-3-Hexenal | |
928-96-1 | cis-3-Hexenol | |
65405-76-7 | cis-3-Hexenyl anthranilate | |
25152-85-6 | cis-3-Hexenyl benzoate | |
16491-36-4 | cis-3-Hexenyl butyrate | |
68133-75-5 | cis-3-Hexenyl cinnamate | |
61444-38-0 | cis-3-Hexenyl cis-3-hexenoate | |
33467-73-1 | cis-3-Hexenyl formate | |
31501-11-8 | cis-3-Hexenyl hexanoate | |
41519-23-7 | cis-3-Hexenyl isobutyrate | |
35154-45-1 | cis-3-Hexenyl isovalerate | |
61931-81-5 | cis-3-Hexenyl lactate | |
67633-96-9 | cis-3-Hexenyl methyl carbonate | |
33467-74-2 | cis-3-Hexenyl propionate | |
65405-77-8 | cis-3-Hexenyl salicylate | |
67883-79-8 | cis-3-Hexenyl tiglate | |
35852-46-1 | cis-3-Hexenyl valerate | |
10340-23-5 | cis-3-Nonen-1-ol | |
13049-88-2 | cis-3-Nonenyl acetate | |
20125-84-2 | cis-3-Octen-1-ol | |
94134-03-9 | cis-3-Octenyl propionate | |
13828-37-0 | cis-4-(Isopropyl)cyclohexanemethanol | |
21662-09-9 | cis-4-Decen-1-al | |
57074-37-0 | cis-4-Decenol | |
4634-89-3 | cis-4-Hexenal | |
10411-92-4 | cis-4-tert-Butylcyclohexyl acetate | |
64275-73-6 | cis-5-Octen-1-ol | |
41547-22-2 | cis-5-Octenal | |
35854-86-5 | cis-6-Nonen-1-ol | |
2277-19-2 | cis-6-Nonenal | |
693-80-1 | cis-9-Octadecenyl acetate | |
115-71-9 | cis-alpha-Santalol | |
77-42-9 | cis-beta Santalol | |
3338-55-4 | cis-beta-Ocimene | |
488-10-8 | cis-Jasmone | |
5989-33-3 | cis-Linalool oxide 3,6-oxide | |
65418-69-1 | cis-Tetrahydro-2-isobutyl-4-methylpyran-4-ol | |
8016-26-0 | Cistus absolute | |
8016-26-0 | Cistus CO2 extract | |
8016-26-0 | Cistus concrete | |
8016-26-0 | Cistus extract | |
8016-26-0 | Cistus oil | |
8016-26-0 | Cistus oil | |
8016-26-0 | Cistus oil, pyrogenated | |
5392-40-5 | Citral | |
7492-66-2 | Citral diethyl acetal | |
7549-37-3 | Citral dimethyl acetal | |
66408-78-4 | Citral ethylene glycol acetal | |
10444-50-5 | Citral propylene glycol acetal | |
67801-47-2 | Citral-methylanthranilate (Schiff base) | |
77-92-9 | Citric acid | |
97593-31-2 | Citric and fatty acid esters of glycerol | |
68991-25-3 | Citron oil | |
68991-25-3 | Citron oil | |
68991-25-3 | Citron oil, rectified | |
8000-29-1 | Citronella oil terpenes | |
8000-29-1 | Citronella oil, Ceylon type | |
8000-29-1 | Citronella oil, Java type | |
68916-56-3 | Citronella oil, reduced | |
106-23-0 | Citronellal | |
67845-42-5 | Citronellal methylanthranilate Schiff base | |
7492-67-3 | Citronelloxyacetaldehyde | |
20770-40-5 | Citronellyl 3-methyl-2-butenoate | |
150-84-5 | Citronellyl acetate | |
141-16-2 | Citronellyl butyrate | |
68039-38-3 | Citronellyl crotonate | |
69929-16-4 | Citronellyl ethyl ether | |
60788-25-2 | Citronellyl ethyl oxalate | |
105-85-1 | Citronellyl formate | |
10580-25-3 | Citronellyl hexanoate | |
97-89-2 | Citronellyl isobutyrate | |
68922-10-1 | Citronellyl isovalerate | |
51566-62-2 | Citronellyl nitrile | |
139-70-8 | Citronellyl phenylacetate | |
141-14-0 | Citronellyl propionate | |
24717-85-9 | Citronellyl tiglate | |
7540-53-6 | Citronellyl valerate | |
91771-50-5 | Citrus hystrix extract | |
233683-84-6 | Citrus junos oil | |
94266-47-4 | Citrus peels extract | |
68608-34-4 | Citrus terpenes | |
68916-26-7 | Civet absolute | |
68916-26-7 | Civet tincture | |
8016-63-5 | Clary sage absolute | |
8016-63-5 | Clary sage absolute | |
8016-63-5 | Clary sage extract | |
8016-63-5 | Clary sage oil | |
8000-34-8 | Clove bud absolute | |
8000-34-8 | Clove bud extract | |
8000-34-8 | Clove bud oil | |
8000-34-8 | Clove leaf oil | |
68917-29-3 | Clove leaf oil terpenes | |
8000-34-8 | Clove leaf oil, rectified | |
8000-34-8 | Clove stem oil | |
68917-29-3 | Clove bud oil terpenes | |
91771-52-7 | Clove, extract, acetylated | |
84912-04-9 | Cobaltate(1-), bis[4-(hydroxy-κO)-3-[2-[2-(hydroxy-κO)-1-naphthalenyl]diazenyl-κN1]benzenesulfonamidato(2-)]-, hydrogen, compd. with 3-[(2-ethylhexyl)oxy]-1-propanamine (1:1:1) | |
1343-78-8 | Cochineal | |
8001-31-8 | Coconut absolute | |
8001-31-8 | Coconut extract | |
90989-95-0 | Coconut fatacid ethylester | |
8001-31-8 | Coconut infusion | |
8001-31-8 | Coconut oil, fixed | |
8001-69-2 | Cod liver oil | |
8001-67-0 | Coffee bean, roasted, absolute | |
8001-67-0 | Coffee bean, roasted, CO2 extract | |
68916-18-7 | Coffee bean, roasted, extract | |
8001-67-0 | Coffee oil | |
84650-00-0 | Coffee, Coffea arabica, extract | |
8013-97-6 | Copaiba balsam | |
8013-97-6 | Copaiba balsam oil | |
8013-97-6 | Copaiba balsam oleoresin | |
8013-97-6 | Copaiba oil | |
8013-97-6 | Copaiba oil, rectified | |
147-14-8 | Copper, [29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]-, (SP-4-1)- | |
15739-09-0 | Copper, [dihydrogen 21-carboxy-14-ethyl-4,8,13,18-tetramethyl-20-oxo-9-vinyl-3-phorbinepropionato(2-)]-, 21-methyl phytyl ester, (E)- | |
8008-52-4 | Coriander herb oil | |
8008-52-4 | Coriander herb oil terpenless | |
8008-52-4 | Coriander herb oil, rectified | |
8008-52-4 | Coriander oleoresin | |
8008-52-4 | Coriander seed | |
8008-52-4 | Coriander seed oil | |
8001-30-7 | Corn oil | |
8001-29-4 | Cottonseed oil | |
91-64-5 | Coumarin | |
1319-77-3 | Cresol (mixed isomers) | |
8007-87-2 | Cubeb oil | |
8007-87-2 | Cubeb oil, rectified | |
89998-01-6 | Cucumber distillate | |
89998-01-6 | Cucumber extract | |
8014-13-9 | Cumin seed oil | |
1335-44-0 | Cuminacetaldehyde | |
122-03-2 | Cuminaldehyde | |
13816-33-6 | Cuminyl nitrile | |
876068-15-4 | Curry leaf absolute | |
91-50-9 | Cyclamen aldehyde-methyl anthranilate (Schiff base) | |
118562-73-5 | Cyclododecaneethanol, .beta.-methyl- | |
59052-82-3 | Cyclododecyl formate | |
3100-36-5 | Cyclohexadec-8-en-1-one mixture of cis and trans isomer | |
2550-52-9 | Cyclohexadecanone | |
88642-03-9 | Cyclohexadecenone | |
33880-83-0 | Cyclohexane, 1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)-, (1R,2R,4S)-rel- | |
99-82-1 | Cyclohexane, 1-methyl-4-(1-methylethyl)- | |
181258-87-7 | Cyclohexane, 1-(1,1-dimethylpropyl)-4-ethoxy-, cis- | |
181258-89-9 | Cyclohexane, 1-(1,1-dimethylpropyl)-4-ethoxy-, trans- | |
68845-33-0 | Cyclohexane, 1-ethenyl-1-methyl-2-(1-methylethenyl)-4-(1-methylethyl)-, didehydro derivative | |
5292-21-7 | Cyclohexaneacetic acid | |
2511-00-4 | Cyclohexaneacetic acid, .alpha.-methyl-, ethyl ester | |
98-89-5 | Cyclohexanecarboxylic acid | |
23059-38-3 | Cyclohexanecarboxylic acid, 1,4-dimethyl-, methyl ester, cis- | |
23250-42-2 | Cyclohexanecarboxylic acid, 1,4-dimethyl-, methyl ester, trans- | |
22471-55-2 | Cyclohexanecarboxylic acid, 2,2,6-trimethyl-, ethyl ester, (1R,6S)-rel- | |
7605-52-9 | Cyclohexanecarboxylic acid, 3-methyl, methyl ester, (1R,3S)-rel- | |
4802-20-4 | Cyclohexaneethanethiol, 3-mercapto-b,4-dimethyl- | |
21722-83-8 | Cyclohexaneethyl acetate | |
68480-15-9 | Cyclohexanemethanol, 2,4-dimethyl- | |
20009-20-5 | Cyclohexanemethanol, 4-(acetyloxy)-a,a,4-trimethyl-, acetate | |
95851-08-4 | Cyclohexanepropanol, 2,2,3,6-tetramethyl-a-propyl- | |
60241-52-3 | Cyclohexanepropanol, a-ethyl-2,2,6-trimethyl- | |
699-61-6 | Cyclohexanepropionic acid, 1-hydroxy-, g-lactone | |
108-93-0 | Cyclohexanol | |
23950-98-3 | Cyclohexanol, 2-methoxy-4-propyl- | |
15876-32-1 | Cyclohexanol, 4-(1-methylethyl)-, acetate, trans- | |
38649-18-2 | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, 1-benzoate, (1R,2S,5R)-rel- | |
2230-87-7 | Cyclohexanol, 5-methyl-2-(1-methylethyl)-, acetate, (1a,2a,5b)- | |
830322-14-0 | Cyclohexanol,4-(3-methylbutyl)- | |
108-94-1 | Cyclohexanone | |
6413-26-9 | Cyclohexanone 1,3-butylene glycol ketal | |
1670-47-9 | Cyclohexanone diethyl ketal | |
59471-80-6 | Cyclohexanone, 2-methyl-5-(1-methylethyl)- | |
13019-04-0 | Cyclohexanone, 2,4-bis(1,1-dimethylethyl)- | |
55739-89-4 | Cyclohexanone, 2-ethyl-4,4-dimethyl- | |
5524-05-0 | Cyclohexanone, 2-methyl-5-(1-methylethenyl)-, (2R,5R)- | |
19096-86-7 | Cyclohexanone,5-methyl-2-(1-methylethyl)-,oxime | |
9003-73-0 | Cyclohexene, 1-methyl-4-(1-methylethenyl)-, homopolymer | |
1888-90-0 | Cyclohexene, 3-methylene- | |
500-00-5 | Cyclohexene, 4-methyl-1-(1-methylethyl)- | |
68084-52-6 | Cyclohexenecarboxaldehyde, dimethyl- | |
622-45-7 | Cyclohexyl acetate | |
1551-44-6 | Cyclohexyl butyrate | |
65405-69-8 | Cyclohexyl cyclopent-2-ene-1-acetate | |
4927-39-3 | Cyclohexyl methyl pentanone | |
42288-75-5 | Cyclohexyl phenylacetate | |
25485-88-5 | Cyclohexyl salicylate | |
5552-30-7 | Cycloionone | |
5552-30-7 | Cycloionone | |
87731-18-8 | Cyclooct-4-en-1-yl methyl carbonate | |
502-72-7 | Cyclopentadecanone | |
1266606-13-6 | Cyclopentaneacetonitrile, 2,4,4-trimethyl-α-methylene- | |
72402-00-7 | Cyclopentanol, 1,2-dimethyl-3-(1-methylethenyl)- | |
94346-09-5 | Cyclopentanol, 1,2-dimethyl-3-(1-methylethenyl)-, acetate | |
1245725-35-2 | Cyclopentanol, 2-methyl-5-(1-methylethyl)-, 1-propanoate | |
34686-67-4 | Cyclopentanol, 2-(2-hexen-1-yl)- | |
120-92-3 | Cyclopentanone | |
932019-29-9 | Cyclopentene, 2-(ethoxymethyl)-1-methyl-3-(1-methylethenyl)- | |
932019-29-9 | Cyclopentene, 2-(ethoxymethyl)-1-methyl-3-(1-methylethenyl)- | |
188570-78-7 | Cyclopropanecarboxylic acid, (3Z)-3-hexenyl ester | |
477218-42-1 | Cyclopropanecarboxylic acid, 2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-methylpropyl ester | |
676532-44-8 | Cyclopropanecarboxylic acid, 2-methyl-2-[(1,2,4-trimethyl-2-penten-1-yl)oxy]propyl ester | |
1181244-95-0 | Cyclopropanemethanol, 1-methyl-2-[[(1R,3R)-2,2,3-trimethylcyclopentyl]methyl]-, (1R,2R)- | |
198404-98-7 | Cyclopropanemethanol, 1-methyl-2-[(1,2,2-trimethylbicyclo[3.1.0]hex-3-yl)methyl]- | |
94333-69-4 | Cymbopogon nardus, ext., reaction products with acetone | |
84238-19-7 | Cymbopogon, ext., oxidized | |
8013-86-3 | Cypress | |
8013-86-3 | Cypress oil | |
68916-59-6 | Cypress oil, terpene-free | |
68916-60-9 | Cypriol oil | |
68916-60-9 | Cypriol oil, rectified | |
18472-51-0 | D-Gluconic acid, compd. with N1,N14-bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide (2:1) | |
161074-97-1 | D-Glucopyranose, oligomeric, C8-10-alkyl glycosides | |
69-79-4 | D-Glucose, 4-O-α-D-glucopyranosyl- | |
491-07-6 | d,l-Isomenthone | |
7705-14-8 | d,l-Limonene (isomer unspecified) | |
1490-04-6 | d,l-Menthol (isomer unspecified) | |
63187-91-7 | d,l-Menthone 1,2-glycerol ketal | |
59-51-8 | D,L-Methionine | |
7785-70-8 | d-.alpha.-Pinene | |
7785-53-7 | d-.alpha.-Terpineol | |
1195-92-2 | d-8-p-Menthene-1,2-epoxide | |
7785-54-8 | d-alpha-Terpineol acetate | |
8016-03-3 | Davana oil | |
464-49-3 | d-Camphor | |
2244-16-8 | d-Carvone | |
25225-10-9 | d-Cyclocitronellene acetate | |
825-51-4 | Decahydro-beta-naphthol | |
10519-11-6 | Decahydro-beta-naphthyl acetate | |
10519-12-7 | Decahydro-beta-naphthyl formate | |
68480-11-5 | Decahydrospiro[furan-2(3H),5'-[4,7]methano[5H]indene] | |
541-02-6 | Decamethylcyclopentasiloxane | |
141-62-8 | Decamethyltetrasiloxane | |
112-31-2 | Decanal | |
7779-41-1 | Decanal dimethyl acetal | |
67874-67-3 | Decanal-methylanthranilate (Schiff base) | |
124-18-5 | Decane | |
7491-02-3 | Decanedioic acid, 1,10-bis(1-methylethyl) ester | |
52829-07-9 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester | |
129757-67-1 | Decanedioic acid, 1,10-bis(2,2,6,6-tetramethyl-4-piperidinyl) ester, reaction products with tert-Bu hydroperoxide and octane | |
1975-78-6 | Decanenitrile | |
334-48-5 | Decanoic acid | |
65381-09-1 | Decanoic acid, ester with 1,2,3-propanetriol octanoate | |
68583-51-7 | Decanoic acid, mixed diesters with octanoic acid and propylene glycol | |
112-17-4 | Decyl acetate | |
18189-07-6 | Decyl anthranilate | |
7289-52-3 | Decyl methyl ether | |
5454-19-3 | Decyl propionate | |
68606-82-6 | Deer tongue pyrogenated | |
68606-82-6 | Deertongue leaf absolute | |
68606-82-6 | Deertongue leaf extract | |
68606-82-6 | Deertongue leaf incolore | |
57378-68-4 | delta-1-(2,6,6-Trimethyl-3-cyclohexen-1-yl)-2-buten-1-one | |
13466-78-9 | delta-3-Carene | |
705-86-2 | delta-Decalactone | |
713-95-1 | delta-Dodecalactone | |
823-22-3 | delta-Hexalactone | |
698-76-0 | delta-Octalactone | |
2721-22-4 | delta-Tetradecalactone | |
710-04-3 | delta-Undecalactone | |
9004-53-9 | Dextrin | |
18309-32-5 | dextro-Verbenone | |
4695-62-9 | d-Fenchone | |
50-99-7 | D-Glucose | |
63-42-3 | D-Glucose, 4-O-.beta.-D-galactopyranosyl- | |
103-23-1 | Di-(2-ethylhexyl) adipate | |
117-81-7 | Di(2-ethylhexyl) phthalate | |
431-03-8 | Diacetyl | |
103-50-4 | Dibenzyl ether | |
84-74-2 | Dibutyl phthalate | |
109-43-3 | Dibutyl sebacate | |
7173-51-5 | Didecyldimethylammoniumchloride | |
72903-27-6 | Diethyl 1,4-cyclohexane dicarboxylate | |
925-47-3 | Diethyl 2,2'-thiodiacetate | |
141-28-6 | Diethyl hexanedioate | |
96-22-0 | Diethyl ketone | |
105-53-3 | Diethyl malonate | |
84-66-2 | Diethyl phthalate | |
110-40-7 | Diethyl sebacate | |
123-25-1 | Diethyl succinate | |
87-91-2 | Diethyl tartrate | |
25340-17-4 | Diethylbenzene | |
68845-36-3 | Diethyldimethylcyclohex-2-en-1-one | |
111-46-6 | Diethylene glycol | |
112-34-5 | Diethylene glycol monobutyl ether | |
111-90-0 | Diethylene glycol monoethyl ether | |
111-77-3 | Diethylene glycol monomethyl ether | |
97488-91-0 | Diglycerides, vegetable-oil monoglycerides and diglycerides | |
19139-31-2 | Dihexyl fumarate | |
32480-08-3 | Dihydro farnesal | |
26252-11-9 | Dihydro-.beta.-terpinyl acetate | |
13720-12-2 | Dihydro-.gamma.-ionone | |
33673-62-0 | Dihydro-4-methyl-5-pentylfuran-2(3H)-one | |
31499-72-6 | Dihydro-alpha-ionone | |
498-81-7 | Dihydro-alpha-terpineol | |
80-25-1 | Dihydro-alpha-terpinyl acetate | |
3293-47-8 | Dihydro-beta-ionol | |
17283-81-7 | Dihydro-beta-ionone | |
619-01-2 | Dihydrocarveol (isomer unspecified) | |
38049-26-2 | Dihydrocarveol (R,R,R) | |
20777-49-5 | Dihydrocarvyl acetate | |
119-84-6 | Dihydrocoumarin | |
1209-61-6 | Dihydroisocaryophyllene epoxide | |
95-41-0 | Dihydroisojasmone | |
2436-90-0 | Dihydromyrcene | |
18479-58-8 | Dihydromyrcenol | |
53767-93-4 | Dihydromyrcenyl acetate | |
20489-53-6 | Dihydronootkatone | |
473-55-2 | Dihydropinene | |
94-58-6 | Dihydrosafrole | |
58985-18-5 | Dihydroterpinyl acetate | |
141-04-8 | Diisobutyl adipate | |
27178-16-1 | Di-isodecyl adipate | |
6938-94-9 | Diisopropyl adipate | |
8006-75-5 | Dill seed oil | |
8006-75-5 | Dill seed oleoresin | |
8006-75-5 | Dill weed | |
8006-75-5 | Dill weed oil | |
627-93-0 | Dimethyl adipate | |
624-92-0 | Dimethyl disulfide | |
131-11-3 | Dimethyl phthalate | |
106-65-0 | Dimethyl succinate | |
75-18-3 | Dimethyl sulfide | |
3658-80-8 | Dimethyl trisulfide | |
68737-61-1 | Dimethylcyclohex-3-ene-1-carbaldehyde (isomer mixture) | |
27939-60-2 | Dimethylcyclohex-3-ene-1-carbaldehyde (isomer unspecified) | |
532-87-6 | Dimyrcene | |
117-84-0 | Dioctyl phthalate | |
101-84-8 | Diphenyl ether | |
101-81-5 | Diphenylmethane | |
629-19-6 | Dipropyl disulfide | |
110-98-5 | Dipropylene glycol | |
25265-71-8 | Dipropylene glycol (isomer unspecified) | |
34590-94-8 | Dipropylene glycol monomethyl ether | |
4691-65-0 | Disodium 5-inosinate | |
150-90-3 | Disodium succinate | |
64742-14-9 | Distillates (petroleum), acid-treated light | |
64742-52-5 | Distillates, petroleum, hydrotreated heavy naphthenic | |
64742-47-8 | Distillates, petroleum, hydrotreated light | |
7681-57-4 | Disulfurous acid, disodium salt | |
21368-68-3 | dl-Camphor | |
106-22-9 | dl-Citronellol | |
5989-27-5 | d-Limonene | |
126-90-9 | d-Linalool | |
138-86-3 | dl-Limonene (racemic) | |
1074-95-9 | dl-Menthone | |
29066-34-0 | dl-Menthyl acetate | |
3623-51-6 | dl-Neomenthol | |
69-65-8 | D-Mannitol | |
15356-60-2 | d-Menthol | |
629-97-0 | Docosane | |
22104-81-0 | Dodec-2-en-1-ol | |
57345-19-4 | Dodecahydro-3,8,8,11a-tetramethyl-5H-3,5a-epoxynaphth[2,1-c]oxepin | |
14620-52-1 | Dodecanal dimethyl acetal | |
112-40-3 | Dodecane | |
1731-79-9 | Dodecanedioic acid, 1,12-dimethyl ester | |
2437-25-4 | Dodecanenitrile | |
142-18-7 | Dodecanoic acid, 2,3-dihydroxypropyl ester | |
27194-74-7 | Dodecanoic acid, monoester with 1,2-propanediol | |
68527-06-0 | Dodecene, hydroformylation products | |
85099-51-0 | Dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5.1.11.2) henicosan-20-yl)propionate | |
6283-92-7 | Dodecyl lactate | |
1643-20-5 | Dodecyldimethylamine oxide | |
6091-50-5 | d-Piperitone | |
89-82-7 | d-Pulegone | |
50-70-4 | d-Sorbitol | |
124071-40-5 | E- and Z-2(+3),12-Tridecadiennitrile | |
112-95-8 | Eicosane | |
8023-89-0 | Elemi absolute | |
8023-89-0 | Elemi CO2 extract | |
8023-89-0 | Elemi gum | |
8023-89-0 | Elemi oil | |
8023-89-0 | ELEMI oil (low methyleugenol) | |
8023-89-0 | Elemi oil, rectified | |
8023-89-0 | Elemi resinoid | |
639-99-6 | Elemol | |
28462-85-3 | endo-1,2,3,3-Tetramethylbicyclo[2.2.1]heptan-2-ol | |
5579-78-2 | epsilon-Decalactone | |
140-67-0 | Estragole | |
144-62-7 | Ethanedioic acid | |
111850-00-1 | Ethaneperoxoic acid, reaction products with aluminum isopropoxide and 1,5,10-trimethyl-1,5,9-cyclododecatriene | |
143-22-6 | Ethanol, 2-[2-(2-butoxyethoxy)ethoxy]- | |
72987-59-8 | Ethanol, 2-(4-methylphenoxy)-1-(2-phenylethoxy)- | |
105-59-9 | Ethanol, 2,2'-(methylimino)bis- | |
141-43-5 | Ethanol, 2-amino- | |
93963-23-6 | Ethanone, 1-(1,2,3,4,5,6,7,8-octahydro-3,8,8-trimethyl-2-naphthalenyl)- | |
854737-10-3 | Ethanone, 1-(2,3-dimethylbicyclo[2.2.1]hept-2-yl)- | |
32669-00-4 | Ethanone, 1-(3-cycloocten-1-yl)- | |
70801-04-6 | Ethanone, 1-(4,11,11,-trimethyl-8-methylenebicyclo[7.2.0]undec-4-enyl)-[1R-(1a,4E,9b] | |
185429-83-8 | Ethanone, 1-[(1R,2S)-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethyl-2-naphthalenyl]-, rel- | |
68551-12-2 | Ethoxylated C12-16 Alcohols | |
61791-12-6 | Ethoxylated castor oil | |
80657-64-3 | Ethyl (3a.alpha.,4.alpha.,7.alpha.,7a.alpha.)-Octahydro-4,7-methano-3aH-indene-3a-carboxylate | |
80623-07-0 | Ethyl (3a.alpha.,4.beta.,7.beta.,7a.alpha.)-Octahydro-4,7-methano-3aH-indene-3a-carboxylate | |
26553-46-8 | Ethyl (E)hex-3-enoate | |
687-47-8 | Ethyl (L)-lactate | |
67028-40-4 | Ethyl (p-tolyloxy)acetate | |
692-86-4 | Ethyl 10-undecenoate | |
97-41-6 | Ethyl 2,2,-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | |
77851-07-1 | Ethyl 2,3,6,6-tetramethylcyclohex-2-ene-1-carboxylate | |
93981-50-1 | Ethyl 2,3,6-trimethylcyclohexyl carbonate | |
78417-28-4 | Ethyl 2,4,7-decatrienoate | |
6290-17-1 | Ethyl 2,4-dimethyldioxolane-2-acetate | |
35044-59-8 | Ethyl 2,6,6-trimethylcyclohexa-1,3-ene-1-carboxylate | |
68228-09-1 | Ethyl 2-[[[2,4(or3,5)-dimethyl-3-cyclohexen-1-yl]methyl]amino]benzoate | |
94108-09-5 | Ethyl 2-[[[4-(1,1-dimethylethyl)phenyl]methylene]amino]benzoate | |
94333-50-3 | Ethyl 2-ethyl-3,6,6-trimethylcyclohexenecarboxylate | |
57934-97-1 | Ethyl 2-ethyl-6,6-dimethylcyclohex-2-ene-1-carboxylate | |
2983-37-1 | Ethyl 2-ethylhexanoate | |
29214-60-6 | Ethyl 2-hexylacetoacetate | |
19788-49-9 | Ethyl 2-mercaptopropionate | |
7335-26-4 | Ethyl 2-methoxybenzoate | |
64988-06-3 | Ethyl 2-methoxybenzyl ether | |
6413-10-1 | Ethyl 2-methyl-1,3-dioxolane-2-acetate | |
55514-48-2 | Ethyl 2-methyl-2-butenoate | |
60523-21-9 | Ethyl 2-methyl-3,4-pentadienoate | |
1617-23-8 | Ethyl 2-methyl-3-pentenoate | |
59151-19-8 | Ethyl 2-methyl-4-oxo-6-pentylcyclohex-2-ene-1-carboxylate | |
53399-81-8 | Ethyl 2-methyl-4-pentenoate | |
7452-79-1 | Ethyl 2-methylbutyrate | |
39255-32-8 | Ethyl 2-methylpentanoate | |
67801-64-3 | Ethyl 2-tert-butylcyclohexyl carbonate | |
10031-90-0 | Ethyl 3(2-furyl)propanoate | |
67707-75-9 | Ethyl 3,5,5-trimethylhexanoate | |
13058-12-3 | Ethyl 3,7-dimethylocta-2,6-dienoate | |
2396-83-0 | Ethyl 3-hexenoate | |
5764-85-2 | Ethyl 3-hydroxy-3-phenylpropionate | |
5405-41-4 | Ethyl 3-hydroxybutyrate | |
2305-25-1 | Ethyl 3-hydroxyhexanoate | |
13327-56-5 | Ethyl 3-methylthiopropionate | |
121-39-1 | Ethyl 3-phenylglycidate | |
2021-28-5 | Ethyl 3-phenylpropionate | |
120-47-8 | Ethyl 4-hydroxybenzoate | |
1968-40-7 | Ethyl 4-pentenoate | |
35044-58-7 | Ethyl 6,6-dimethyl-2-methylenecyclohex-3-enecarboxylate | |
141-78-6 | Ethyl acetate | |
141-97-9 | Ethyl acetoacetate | |
64-17-5 | Ethyl alcohol | |
87-25-2 | Ethyl anthranilate | |
93-89-0 | Ethyl benzoate | |
94-02-0 | Ethyl benzoylacetate | |
105-54-4 | Ethyl butyrate | |
103-36-6 | Ethyl cinnamate | |
34495-71-1 | Ethyl cis-4-octenoate | |
5452-75-5 | Ethyl cyclohexylacetate | |
110-38-3 | Ethyl decanoate | |
109-94-4 | Ethyl formate | |
32659-21-5 | Ethyl geranate | |
106-30-9 | Ethyl heptanoate | |
123-66-0 | Ethyl hexanoate | |
118-60-5 | Ethyl hexyl salicylate | |
97-62-1 | Ethyl isobutyrate | |
108-64-5 | Ethyl isovalerate | |
97-64-3 | Ethyl lactate | |
106-33-2 | Ethyl laurate | |
539-88-8 | Ethyl levulinate | |
544-35-4 | Ethyl linoleate | |
1191-41-9 | Ethyl linolenate | |
4940-11-8 | Ethyl maltol | |
97-63-2 | Ethyl methacrylate | |
77-83-8 | Ethyl methylphenylglycidate | |
124-06-1 | Ethyl myristate | |
123-29-5 | Ethyl nonanoate | |
2351-90-8 | Ethyl oct-2-enoate | |
111-61-5 | Ethyl octadecanoate | |
106-32-1 | Ethyl octanoate | |
111-62-6 | Ethyl oleate | |
628-97-7 | Ethyl palmitate | |
94-30-4 | Ethyl p-anisate | |
1817-90-9 | Ethyl phenethyl ether | |
2555-49-9 | Ethyl phenoxyacetate | |
2114-29-6 | Ethyl phenyl carbinyl acetate | |
101-97-3 | Ethyl phenylacetate | |
105-37-3 | Ethyl propionate | |
22719-81-9 | Ethyl p-tolyl carbonate | |
617-35-6 | Ethyl pyruvate | |
55066-53-0 | Ethyl ricinoleate | |
35044-57-6 | Ethyl safranate | |
118-61-6 | Ethyl salicylate | |
2396-84-1 | Ethyl sorbate | |
5837-78-5 | Ethyl tiglate | |
3025-30-7 | Ethyl trans-2,cis-4-decadienoate | |
10544-63-5 | Ethyl trans-2-butenoate | |
623-70-1 | Ethyl trans-2-butenoate | |
7367-88-6 | Ethyl trans-2-decenoate | |
27829-72-7 | Ethyl trans-2-hexenoate | |
76649-16-6 | Ethyl trans-4-decenoate | |
539-82-2 | Ethyl valerate | |
121-32-4 | Ethyl vanillin | |
188417-26-7 | Ethyl vanillin isobutyrate | |
68527-76-4 | Ethyl vanillin propylene glycol acetal | |
24937-78-8 | Ethyl vinyl acetate copolymer | |
67952-68-5 | Ethyl-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol | |
9004-57-3 | Ethylcellulose | |
105-95-3 | Ethylene brassylate | |
54982-83-1 | Ethylene dodecanedioate | |
107-21-1 | Ethylene glycol | |
111-76-2 | Ethylene glycol monobutyl ether | |
6381-92-6 | Ethylenediaminetetraacetic acid disodium salt | |
470-82-6 | Eucalyptol | |
8000-48-4 | Eucalyptus absolute | |
85203-56-1 | Eucalyptus citriodora oil | |
68991-29-7 | Eucalyptus citriodora oil, acetylated | |
85203-56-1 | Eucalyptus citriodora terpenes | |
8000-48-4 | Eucalyptus dives extract | |
8000-48-4 | Eucalyptus dives oil | |
8000-48-4 | Eucalyptus dives oil, rectified | |
97926-40-4 | Eucalyptus globulus absolute | |
97926-40-4 | Eucalyptus globulus oil | |
97926-40-4 | Eucalyptus globulus oil, rectified | |
8000-48-4 | Eucalyptus oil | |
8000-48-4 | Eucalyptus oil, rectified | |
92201-64-4 | Eucalyptus radiata oil | |
97-53-0 | Eugenol | |
93-28-7 | Eugenyl acetate | |
93-15-2 | Eugenyl methyl ether | |
10402-33-2 | Eugenyl phenylacetate | |
906655-61-6 | Euterpe precatoria extract | |
1137739-11-7 | Evodia rutaecarpa oil | |
7070-15-7 | exo-2-[(1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl)oxy]ethanol | |
19317-11-4 | Farnesal | |
4602-84-0 | Farnesol | |
29548-30-9 | Farnesyl acetate | |
8024-32-6 | Fats and glyceridic oils, avocado | |
68956-68-3 | Fats and Glyceridic oils, vegetable | |
72869-74-0 | Fats and glyceridic oils, vegetable-oil, glyceride and tocopherol fraction | |
85536-25-0 | Fatty acids, butter | |
71990-22-2 | Fatty acids, butter, Et esters | |
67762-38-3 | Fatty acids, C16-18 and C18-unsatd., Me esters | |
95912-86-0 | Fatty acids, C8-10, C12-18-alkyl esters | |
61791-29-5 | Fatty acids, coco, ethoxylated | |
63393-93-1 | Fatty acids, lanolin, iso-Pr esters | |
68424-45-3 | Fatty acids, linseed-oil | |
68440-15-3 | Fatty acids, palm-oil | |
1195-79-5 | Fenchone | |
1632-73-1 | Fenchyl alcohol | |
8006-84-6 | Fennel bitter oleoresin | |
8006-84-6 | Fennel oil, bitter | |
8006-84-6 | Fennel oil, sweet | |
8006-84-6 | Fennel sweet oleoresin | |
68990-15-8 | Fenugreek absolute | |
68990-15-8 | Fenugreek extract | |
68990-15-8 | Fenugreek oleoresin | |
68990-15-8 | Fenugreek tincture | |
8021-28-1 | Fir absolute | |
8024-15-5 | Fir balsam | |
8024-15-5 | Fir balsam absolute | |
8024-15-5 | Fir balsam resinoid | |
8021-28-1 | Fir balsam resinoid from needles | |
8024-15-5 | Fir needle oil, Canadian | |
8021-28-1 | Fir needle oil, Chinese | |
8021-29-2 | Fir needle oil, Siberian | |
8021-29-2 | Fir needle oil, Siberian, rectified | |
85085-34-3 | Fir, Abies balsamea extract | |
8021-28-1 | Fir, Abies balsamea, absolute | |
92128-34-2 | Fir, Abies pectinata, concrete | |
68916-09-6 | Flouve absolute | |
68916-09-6 | Flouve oil | |
58567-11-6 | Formaldehyde cyclododecyl ethyl acetal | |
64-18-6 | Formic acid | |
68855-38-9 | Formic acid, reaction products with boron trifluoride and [1S-(1.alpha.,3a.beta.,4.alpha.,8a.beta.)]-decahydro- | |
68917-51-1 | Fucus vesiculosus absolute | |
68917-51-1 | Fucus vesiculosus resinoid | |
99343-90-5 | Furan, tetrahydro-2,4-dimethyl-4-phenyl-, (2R,4R)-rel- | |
98-01-1 | Furfural | |
623-17-6 | Furfuryl acetate | |
98-02-2 | Furfuryl mercaptan | |
1438-91-1 | Furfuryl methyl sulfide | |
13678-68-7 | Furfuryl thioacetate | |
8013-75-0 | Fusel oil, refined | |
8024-40-6 | Galangal root extract | |
8024-40-6 | Galangal root oleoresin | |
8023-91-4 | Galbanum absolute | |
8023-91-4 | Galbanum CO2 extract | |
8023-91-4 | Galbanum gum | |
8023-91-4 | Galbanum oil | |
8023-91-4 | Galbanum oil, rectified | |
8023-91-4 | Galbanum resin | |
8023-91-4 | Galbanum resinoid | |
854737-08-9 | gamma Undecenolactone - 2(3H), 5-(6-heptenyl)dihydro- | |
706-14-9 | gamma-Decalactone | |
2305-05-7 | gamma-Dodecalactone | |
105-21-5 | gamma-Heptalactone | |
695-06-7 | gamma-Hexalactone | |
79-76-5 | gamma-Ionone | |
7011-83-8 | gamma-Methyldecalactone | |
104-61-0 | gamma-Nonalactone | |
104-50-7 | gamma-Octalactone | |
104-67-6 | gamma-Undecalactone | |
108-29-2 | gamma-Valerolactone | |
683748-01-8 | Gardenia tahitensis absolute | |
683748-01-8 | Gardenia tahitensis oil | |
8000-78-0 | Garlic oil | |
9000-70-8 | Gelatine | |
129316-65-0 | Genet absolute | |
97676-22-7 | Gentian absolute | |
97676-22-7 | Gentian root extract | |
141-27-5 | Geranial | |
459-80-3 | Geranic acid | |
106-24-1 | Geraniol | |
8000-46-2 | Geranium absolute | |
68916-42-7 | Geranium absolute, bourbon | |
8000-46-2 | Geranium concrete | |
8000-46-2 | Geranium oil | |
68917-31-7 | Geranium oil terpenes | |
8000-46-2 | Geranium oil, African | |
68916-42-7 | Geranium oil, bourbon, distn. residues | |
68916-44-9 | Geranium oil, rectified | |
8000-46-2 | Geranium oil, rectified | |
68916-43-8 | Geranium oil, saponified | |
105-87-3 | Geranyl acetate | |
94-48-4 | Geranyl benzoate | |
106-29-6 | Geranyl butyrate | |
56172-46-4 | Geranyl crotonate | |
70851-60-4 | Geranyl dihydrolinalool | |
40267-72-9 | Geranyl ethyl ether | |
105-86-2 | Geranyl formate | |
10032-02-7 | Geranyl hexanoate | |
2345-26-8 | Geranyl isobutyrate | |
109-20-6 | Geranyl isovalerate | |
1113-21-9 | Geranyl linalool | |
2565-82-4 | Geranyl methyl ether | |
65405-73-4 | Geranyl oxyacetaldehyde | |
10402-47-8 | Geranyl pentanoate | |
102-22-7 | Geranyl phenylacetate | |
105-90-8 | Geranyl propionate | |
7785-33-3 | Geranyl tiglate | |
8007-08-7 | Ginger | |
8007-08-7 | Ginger absolute | |
8007-08-7 | Ginger CO2 extract | |
8007-08-7 | Ginger extract | |
8007-08-7 | Ginger oil | |
8007-08-7 | Ginger oil, rectified | |
8007-08-7 | Ginger oleoresin | |
8007-08-7 | Ginger terpeneless | |
8023-92-5 | Gingergrass oil | |
67701-33-1 | Glycerides, C14-18 mono- and di- | |
68990-53-4 | Glycerides, C14-22 mono- | |
91744-56-8 | Glycerides, mixed C8-10 and succinyl | |
73398-61-5 | Glycerides, mixed decanoyl and octanoyl | |
127281-18-9 | Glycerides, mixed decanoyl and octanoyl, reaction products with oxirane | |
68990-07-8 | Glycerides, wheat germ-oil mono-, di- and tri- | |
68553-03-7 | Glycerids, coco Mono-, ethoxylated | |
56-81-5 | Glycerol | |
8050-31-5 | Glycerol ester of rosin | |
111-03-5 | Glyceryl monooleate | |
39668-74-1 | Glycine, N-[[5-methyl-2-(1-methylethyl)cyclohexyl]carbonyl]-, ethyl ester | |
64-02-8 | Glycine, N,N'-1,2-ethanediylbis[N-(carboxymethyl)-, tetrasodium salt | |
154248-98-3 | Glycols, 1,2-, C12-16, ethoxylated propoxylated | |
53956-04-0 | Glycyrrhizin, ammoniated (Glycyrrhiza spp.) | |
90320-21-1 | Grains of paradise extract | |
8016-20-4 | Grapefruit absolute, white | |
8016-20-4 | Grapefruit essence oil | |
8016-20-4 | Grapefruit extract | |
8016-20-4 | Grapefruit flower oil | |
8016-20-4 | Grapefruit oil | |
8016-20-4 | Grapefruit oil | |
68917-32-8 | Grapefruit oil terpenes | |
68916-46-1 | Grapefruit oil, folded | |
8016-20-4 | Grapefruit oil, rectified | |
68916-46-1 | Grapefruit oil, terpeneless | |
8016-20-4 | Grapefruit oil, (low furocoumarins) | |
8016-23-7 | Guaiac wood oil | |
90244-88-5 | Guaiac wood oil saponified | |
8016-23-7 | Guaiac wood oil, rectified | |
90-05-1 | Guaiacol | |
4125-43-3 | Guaiacol allyl ether | |
61789-17-1 | Guaiacwood acetate | |
61789-17-1 | Guaiacwood acetate | |
613-70-7 | Guaiacyl acetate | |
4112-89-4 | Guaiacyl phenylacetate | |
134-28-1 | Guaiyl acetate | |
869736-31-2 | Guava extract | |
8030-55-5 | Gurjun balsam | |
8030-55-5 | Gurjun balsam oil | |
8030-55-5 | Gurjun extract | |
8030-55-5 | Gurjun oil | |
8030-55-5 | Gurjun oil, rectified | |
8031-00-3 | Hay absolute | |
8031-00-3 | Hay oil | |
8023-95-8 | Helichrysum absolute | |
85665-35-6 | Helichrysum arenarium, ext. | |
8023-95-8 | Helichrysum extract | |
8023-95-8 | Helichrysum oil | |
8023-95-8 | Helichrysum oil, pyrogenated | |
792933-14-3 | Heliopsis longipes extract | |
629-94-7 | Heneicosane | |
629-78-7 | Heptadecane | |
111-71-7 | Heptanal | |
10032-05-0 | Heptanal dimethyl acetal | |
62439-42-3 | Heptanal, 6-hydroxy-2,6-dimethyl- | |
22174-70-5 | Heptane, 3,3'-[methylenebis(oxymethylene)]bis- | |
111-14-8 | Heptanoic acid | |
66009-41-4 | Heptanoic acid, octadecyl ester | |
112-06-1 | Heptyl acetate | |
111-70-6 | Heptyl alcohol | |
5870-93-9 | Heptyl butyrate | |
56438-09-6 | Heptylidene diacetate | |
10094-40-3 | Hex-2-enyl acetate (isomer unspecified) | |
1708-82-3 | Hex-3-enyl acetate | |
7370-44-7 | Hexadeca-1,5-lactone | |
544-76-3 | Hexadecane | |
109-29-5 | Hexadecanolide | |
540-10-3 | Hexadecyl palmitate | |
6051-03-2 | Hexahydro-3H-benzofuran-2-one | |
66-25-1 | Hexanal | |
1429808-42-3 | Hexanal, 6-(2,4,4-trimethylcyclopentylidene)-, (6E)- | |
123-79-5 | Hexanedioic acid, dioctyl ester | |
64091-34-5 | Hexanedioic acid, polymer with oxybis[propanol] | |
628-73-9 | Hexanenitrile | |
142-62-1 | Hexanoic acid | |
90411-68-0 | Hexanoic acid, 2-ethyl-, C16-18-alkyl esters | |
816-19-3 | Hexanoic acid, 2-ethyl-, methyl ester | |
1561-11-1 | Hexanoic acid, 4-methyl- | |
68141-11-7 | Hexanoic acid, 4-methylphenyl ester | |
104986-28-9 | Hexanoic acid, 6-(acetyloxy)-, ethyl ester | |
6728-26-3 | Hexen-2-al | |
34687-46-2 | Hexenylcyclopentanone | |
72968-69-5 | Hexyl 2-(ethylideneamino)benzoate | |
5434-57-1 | Hexyl 2,2-dimethylpropanoate | |
20279-51-0 | Hexyl 2-hydroxypropionate | |
10032-15-2 | Hexyl 2-methylbutyrate | |
142-92-7 | Hexyl acetate | |
111-27-3 | Hexyl alcohol | |
6789-88-4 | Hexyl benzoate | |
2639-63-6 | Hexyl butyrate | |
629-33-4 | Hexyl formate | |
6378-65-0 | Hexyl hexanoate | |
2349-07-7 | Hexyl isobutyrate | |
10032-13-0 | Hexyl isovalerate | |
142-09-6 | Hexyl methacrylate | |
1117-55-1 | Hexyl octanoate | |
5421-17-0 | Hexyl phenylacetate | |
2445-76-3 | Hexyl propionate | |
6259-76-3 | Hexyl salicylate | |
16930-96-4 | Hexyl tiglate | |
68917-43-1 | Hibawood oil | |
92128-62-6 | Hierochloe alpina absolute | |
91745-97-0 | Hinoiki root oil | |
91745-97-0 | Hinoki leaf oil | |
8022-91-1 | Ho bark oil | |
8022-91-1 | Ho leaf oil | |
8022-91-1 | Ho wood | |
8022-91-1 | Ho wood oil | |
118-56-9 | Homomenthyl salicylate | |
91052-92-5 | Honey distillate | |
8023-93-6 | Honeysuckle absolute | |
8060-28-4 | Hop extract | |
8060-28-4 | Hop extract solid | |
8007-04-3 | Hop oil | |
8020-83-5 | Hydrocarbon oils | |
93685-81-5 | Hydrocarbons, C4, 1,3-butadiene-free, polymd., triisobutylene fraction, hydrogenated | |
68956-56-9 | Hydrocarbons, terpene processing by-products | |
116-09-6 | Hydroxyacetone | |
107-75-5 | Hydroxycitronellal | |
7779-94-4 | Hydroxycitronellal diethyl acetal | |
141-92-4 | Hydroxycitronellal dimethyl acetal | |
68908-82-7 | Hydroxycitronellal, indole condensation products | |
68527-79-7 | Hydroxycitronellal-Indole (Schiff base) | |
89-43-0 | Hydroxycitronellal-methyl anthranilate (Schiff base) | |
107-74-4 | Hydroxycitronellol | |
3301-94-8 | Hydroxynonanoic acid, delta-lactone | |
8006-83-5 | Hyssop oil | |
647828-16-8 | Indeno[4,3a-b]furan,decahydro-2,2,7,7,8,9,9-heptamethyl- | |
365411-50-3 | Indeno[4,5-d]-1,3-dioxin,4,4a,5,6,7,8,9,9b-octahydro-7,7,8,9,9-pentamethyl- | |
120-72-9 | Indole | |
8013-90-9 | Ionone (mixed isomers) | |
1048028-77-8 | Iris germanica absolute | |
1048028-77-8 | Iris germanica CO2 extract | |
1048028-77-8 | Iris germanica concrete | |
1048028-77-8 | Iris germanica extract | |
1048028-77-8 | Iris germanica resinoid | |
8002-73-1 | Iris pallida absolute | |
8002-73-1 | Iris pallida concrete | |
8002-73-1 | Iris pallida oil | |
8002-73-1 | Iris pallida oil, rectified | |
8002-73-1 | Iris pallida resinoid | |
8002-73-1 | Iris pallida tincture | |
90045-91-3 | Iris pseudacorus extract | |
1335-94-0 | Irone | |
123-92-2 | Isoamyl acetate | |
2308-18-1 | Isoamyl acetoacetate | |
123-51-3 | Isoamyl alcohol | |
94-46-2 | Isoamyl benzoate | |
106-27-4 | Isoamyl butyrate | |
7779-65-9 | Isoamyl cinnamate | |
110-45-2 | Isoamyl formate | |
2198-61-0 | Isoamyl hexanoate | |
659-70-1 | Isoamyl isovalerate | |
6309-51-9 | Isoamyl laurate | |
2035-99-6 | Isoamyl octanoate | |
102-19-2 | Isoamyl phenylacetate | |
105-68-0 | Isoamyl propionate | |
87-20-7 | Isoamyl salicylate | |
124-76-5 | Isoborneol | |
85586-67-0 | Isobornyl 2-methylpropionate | |
125-12-2 | Isobornyl acetate | |
1200-67-5 | Isobornyl formate | |
7779-73-9 | Isobornyl isovalerate | |
5331-32-8 | Isobornyl methyl ether | |
2756-56-1 | Isobornyl propionate | |
589-66-2 | Isobutyl 2-butenoate | |
61692-84-0 | Isobutyl 2-methylcrotonate | |
105-01-1 | Isobutyl 3-(2-furan)propionate | |
110-19-0 | Isobutyl acetate | |
78-83-1 | Isobutyl alcohol | |
7779-81-9 | Isobutyl angelate | |
7779-77-3 | Isobutyl anthranilate | |
120-50-3 | Isobutyl benzoate | |
539-90-2 | Isobutyl butyrate | |
122-67-8 | Isobutyl cinnamate | |
542-55-2 | Isobutyl formate | |
105-79-3 | Isobutyl hexanoate | |
97-85-8 | Isobutyl isobutyrate | |
65505-24-0 | Isobutyl N-methylanthranilate | |
102-13-6 | Isobutyl phenylacetate | |
540-42-1 | Isobutyl propionate | |
87-19-4 | Isobutyl salicylate | |
78-84-2 | Isobutyraldehyde | |
79-31-2 | Isobutyric acid | |
66068-84-6 | Isocamphenyl cyclohexanol, mixed isomers | |
13794-73-5 | Isocedranone | |
1335-66-6 | Isocyclocitral | |
69103-24-8 | Isodecyl acetate | |
25339-17-7 | Isodecyl alcohol | |
31807-55-3 | Isododecane | |
97-54-1 | Isoeugenol | |
4194-00-7 | Isoeugenol benzoate | |
93-29-8 | Isoeugenyl acetate | |
120-11-6 | Isoeugenyl benzyl ether | |
7784-67-0 | Isoeugenyl ethyl ether | |
93-16-3 | Isoeugenyl methyl ether | |
120-24-1 | Isoeugenyl phenylacetate | |
37677-14-8 | Isohexenyl cyclohexenyl carboxaldehyde | |
11050-62-7 | Isojasmone | |
14727-47-0 | Isolongifolanone | |
1135-66-6 | Isolongifolene | |
23787-90-8 | Isolongifolene ketone | |
33407-62-4 | Isolongifolene ketone | |
26619-69-2 | Isolongifolene oxide | |
79-89-0 | iso-Methyl-beta-ionone | |
67923-83-5 | Isononal diethyl acetal | |
40379-24-6 | Isononyl acetate (isomer unspecified) | |
27458-94-2 | Isononyl alcohol (isomer unspecified) | |
65155-45-5 | Isononyl propionate | |
27458-93-1 | Isooctadecan-1-ol | |
41519-18-0 | Isopentyl 2-methylcrotonate (E) | |
107-85-7 | Isopentylamine | |
470-99-5 | Isophorol | |
505-32-8 | Isophytol | |
58425-36-8 | Isophytyl acetate | |
79915-74-5 | Isopropoxy ethyl salicylate | |
66576-71-4 | Isopropyl 2-methylbutyrate | |
108-21-4 | Isopropyl acetate | |
67-63-0 | Isopropyl alcohol | |
939-48-0 | Isopropyl benzoate | |
638-11-9 | Isopropyl butyrate | |
7780-06-5 | Isopropyl cinnamate | |
2311-46-8 | Isopropyl hexanoate | |
32665-23-9 | Isopropyl isovalerate | |
110-27-0 | Isopropyl myristate | |
142-91-6 | Isopropyl palmitate | |
125109-85-5 | Isopropylphenylbutanal | |
1333-53-5 | Isopropylquinoline | |
89-79-2 | Isopulegol | |
57576-09-7 | Isopulegyl acetate | |
120-58-1 | Isosafrole | |
27458-92-0 | Isotridecan-1-ol | |
69103-23-7 | Isotridecyl acetate | |
503-74-2 | Isovaleric acid | |
90131-24-1 | Jambu oleoresin | |
8022-96-6 | Jasmine absolute | |
8022-96-6 | Jasmine CO2 extract | |
8022-96-6 | Jasmine concrete | |
8022-96-6 | Jasmine concrete (waxes twice extracted) | |
8022-96-6 | Jasmine oil | |
1034798-23-6 | Jasmine sambac absolute | |
1034798-23-6 | Jasmine sambac CO2 extract | |
1034798-23-6 | Jasmine sambac oil | |
1034798-23-6 | Jasmine sambac tincture | |
8022-96-6 | Jasmine spiritus | |
61789-91-1 | Jojoba oil | |
8002-68-4 | Juniper berry absolute | |
8002-68-4 | Juniper berry CO2 extract | |
8002-68-4 | Juniper berry extract | |
8002-68-4 | Juniper berry oil | |
8002-68-4 | Juniper berry oil, rectified | |
91053-31-5 | Juniper, Juniperus mexicana, ext., acetylated | |
100209-33-4 | Juniper, Juniperus virginiana, ext., epoxidized | |
936843-30-0 | Kaempferia galanga root CO2 extract | |
92128-82-0 | Kelp extract | |
68458-86-6 | Ketones, C14 | |
1330-84-3 | L-Ascorbic acid, monohexadecanoate | |
134-03-2 | L-Ascorbic acid, sodium salt (1:1) | |
7785-26-4 | l-.alpha.-Pinene | |
18172-67-3 | l-.beta.-Pinene | |
8016-26-0 | Labdanum absolute | |
8016-26-0 | Labdanum absolute, pyrogenated | |
8016-26-0 | Labdanum concrete | |
8016-26-0 | Labdanum distillate | |
8016-26-0 | Labdanum extract | |
68917-77-1 | Labdanum extract ambreine | |
8016-26-0 | Labdanum gum | |
8016-26-0 | Labdanum oil | |
8016-26-0 | Labdanum oleoresin | |
8016-26-0 | Labdanum resinoid | |
73138-66-6 | Labdanum, ext., Et esters | |
598-82-3 | Lactic acid | |
50-21-5 | Lactic acid | |
21280-29-5 | Lactoscatone | |
5655-61-8 | laevo-Bornyl acetate | |
2102-59-2 | laevo-Carveol | |
1205-42-1 | laevo-Carvyl acetate | |
90046-17-6 | Lantana camara oil | |
8007-48-5 | Laurel leaf absolute | |
8007-48-5 | Laurel leaf oil | |
143-07-7 | Lauric acid | |
112-54-9 | Lauric aldehyde | |
112-66-3 | Lauryl acetate | |
112-53-8 | Lauryl alcohol | |
142-90-5 | Lauryl methacrylate | |
8022-15-9 | Lavandin abrailis oil (low coumarin) | |
8022-15-9 | Lavandin abrialis | |
8022-15-9 | Lavandin abrialis oil | |
8022-15-9 | Lavandin absolute | |
8022-15-9 | Lavandin concrete | |
8022-15-9 | Lavandin extract | |
8022-15-9 | Lavandin grosso | |
8022-15-9 | Lavandin grosso absolute | |
8022-15-9 | Lavandin grosso concrete | |
8022-15-9 | Lavandin grosso oil | |
8022-15-9 | Lavandin oil | |
8022-15-9 | Lavandin oil (super low coumarins) | |
68916-93-8 | Lavandin oil acetylated | |
25905-14-0 | Lavandulyl acetate | |
93165-50-5 | Lavendar oil | |
8000-28-0 | Lavender | |
8000-28-0 | Lavender absolute | |
8000-28-0 | Lavender concrete | |
8000-28-0 | Lavender extract | |
8000-28-0 | Lavender oil | |
8000-28-0 | Lavender oil (low coumarin) | |
8000-28-0 | Lavender oil, rectified | |
464-45-9 | l-Borneol | |
5794-04-7 | l-Camphene | |
6485-40-1 | L-Carvone | |
7540-51-4 | l-Citronellol | |
25225-08-5 | l-Cyclocitronellene formate | |
8002-43-5 | Lecithins | |
8008-56-8 | Lemon absolute folded (5X) | |
8008-56-8 | Lemon essence oil | |
8008-56-8 | Lemon oil | |
8008-56-8 | Lemon oil folded (10x) | |
8008-56-8 | Lemon oil folded (5X) | |
68917-33-9 | Lemon oil terpenes | |
8008-56-8 | Lemon oil, distilled | |
8008-56-8 | Lemon oil, expressed | |
68916-89-2 | Lemon oil, furocoumarin free | |
68648-39-5 | Lemon oil, terpeneless | |
8008-56-8 | Lemon oil, washed | |
102242-62-6 | Lemon pepper CO2 Extract | |
102242-62-6 | Lemon pepper extract | |
72869-82-0 | Lemongrass oil terpenes | |
8007-02-1 | Lemongrass oil, East Indian | |
8007-02-1 | Lemongrass oil, rectified | |
8007-02-1 | Lemongrass oil, West Indian | |
123-76-2 | Levulinic acid | |
7787-20-4 | l-Fenchone | |
97676-23-8 | Licorice root absolute | |
97676-23-8 | Licorice root extract | |
91-51-0 | Lilial-methyl anthranilate (Schiff base) | |
8008-26-2 | Lime oil | |
8008-26-2 | Lime oil folded | |
68917-71-5 | Lime oil terpenes | |
68916-83-6 | Lime oil, cold pressed, furocoumarin free | |
8008-26-2 | Lime oil, expressed | |
8008-26-2 | Lime oil, expressed, rectified | |
68916-84-7 | Lime oil, terpeneless | |
78-70-6 | Linalool | |
1365-19-1 | Linalool oxide | |
14049-11-7 | Linalool oxide pyranoid | |
115-95-7 | Linalyl acetate | |
7149-26-0 | Linalyl anthranilate | |
126-64-7 | Linalyl benzoate | |
78-36-4 | Linalyl butyrate | |
78-37-5 | Linalyl cinnamate | |
115-99-1 | Linalyl formate | |
7779-23-9 | Linalyl hexanoate | |
78-35-3 | Linalyl isobutyrate | |
1118-27-0 | Linalyl isovalerate | |
7143-69-3 | Linalyl phenylacetate | |
144-39-8 | Linalyl propionate | |
90063-53-9 | Linden flowers | |
60-33-3 | Linoleic acid | |
463-40-1 | Linolenic acid | |
8001-26-1 | Linseed | |
8001-26-1 | Linseed absolute | |
8001-26-1 | Linseed extract | |
8001-26-1 | Linseed oil | |
68956-59-2 | Linseed oil Et ester | |
8001-26-1 | Linseed oil, fixed | |
68855-99-2 | Litsea cubeba oil | |
68855-99-2 | Litsea cubeba oil, rectified | |
68855-99-2 | Litsea cubeba terpenes | |
79-33-4 | L-Lactic acid (2-hydroxy propionic acid) | |
5989-54-8 | l-Limonene | |
126-91-0 | l-Linalool | |
6915-15-7 | l-Malic acid | |
10030-85-0 | L-Mannose, 6-deoxy-,hydrate | |
2216-51-5 | l-Menthol | |
14073-97-3 | l-Menthone | |
108766-16-1 | l-Menthyl (R,S)-3-hydroxybutyrate | |
2623-23-6 | l-Menthyl acetate (1alpha,2beta,5alpha) | |
59259-38-0 | l-Menthyl lactate | |
220621-22-7 | L-Monomenthyl glutarate | |
475-20-7 | Longifolene | |
8016-31-7 | Lovage leaf oil | |
8016-31-7 | Lovage root oil | |
4573-50-6 | l-Piperitone | |
8007-12-3 | Mace absolute | |
8007-12-3 | Mace oil | |
8007-12-3 | Mace oleoresin | |
7786-30-3 | Magnesium chloride (MgCl2) | |
246536-69-6 | Magnolia liliflora extract | |
8002-48-0 | Malt absolute | |
9050-36-6 | Maltodextrin | |
118-71-8 | Maltol | |
65416-14-0 | Maltyl isobutyrate | |
8008-31-9 | Mandarin oil | |
8008-31-9 | Mandarin oil | |
8008-31-9 | Mandarin oil folded | |
68953-04-8 | Mandarin oil terpenes | |
8008-31-9 | Mandarin oil, rectified | |
68917-20-4 | Mandarin oil, terpeneless | |
90063-86-8 | Mango alcoholate | |
8016-33-9 | Marjoram oil, Spanish | |
8015-01-8 | Marjoram oil, sweet | |
84012-24-8 | Marjoram, pot | |
336185-21-8 | Marjoram, pot, oil | |
68991-39-9 | Mastic absolute | |
68991-39-9 | Mastic extract | |
68991-39-9 | Mastic oil | |
68991-39-9 | Mastic resinoid | |
68916-96-1 | Mate absolute | |
68916-96-1 | Mate extract | |
68916-96-1 | Mate oil | |
108-39-4 | m-Cresol | |
151-10-0 | m-Dimethoxybenzene | |
8023-73-2 | Melilotus officinalis absolute | |
8023-73-2 | Melilotus officinalis absolute, pyrogenated | |
8023-73-2 | Melilotus officinalis tincture | |
68917-18-0 | Mentha arvensis | |
68917-18-0 | Mentha arvensis oil | |
68917-18-0 | Mentha arvensis oil (low menthol) | |
68608-35-5 | Mentha arvensis oil terpenes | |
68917-18-0 | Mentha arvensis oil, distilled | |
68917-14-6 | Mentha arvensis oil, terpeneless | |
68917-18-0 | Mentha arvensis, 3X | |
68917-15-7 | Mentha citrata oil | |
68683-20-5 | Menthadiene-7-methyl formate | |
89-78-1 | Menthol | |
15356-70-4 | Menthol racemic | |
10458-14-7 | Menthone | |
89-48-5 | Menthyl acetate (1alpha,2beta,5alpha) | |
16409-45-3 | Menthyl acetate (isomer unspecified) | |
16409-46-4 | Menthyl isovalerate | |
75-47-8 | Methane, triiodo- | |
131-56-6 | Methanone, (2,4-dihydroxyphenyl)phenyl- | |
131-57-7 | Methanone, (2-hydroxy-4-methoxyphenyl)phenyl- | |
1843-05-6 | Methanone, [2-hydroxy-4-(octyloxy)phenyl]phenyl- | |
86803-90-9 | Methoxy dicyclopentadiene carboxaldehyde | |
1320-67-8 | Methoxy-1-propanol-2 + methoxy-2-propanol-1 | |
3613-30-7 | Methoxycitronellal | |
2986-54-1 | Methoxycyclododecane | |
63450-30-6 | Methoxymethylpyrazine | |
3149-28-8 | Methoxypyrazine | |
67634-12-2 | Methyl 2-(((4-(4-hydroxy-4-methylpentyl)-3-cyclohexenyl)methylene)amino)benzoate | |
67924-14-5 | Methyl 2-(dodecylideneamino)benzoate | |
41270-80-8 | Methyl 2-(formylamino)benzoate | |
67801-44-9 | Methyl 2-(octylideneamino)benzoate | |
33662-58-7 | Methyl 2,4-dihydroxy-m-toluate | |
28371-99-5 | Methyl 2,6,10-trimethylcyclododeca-2,5,9-trien-1-yl ketone | |
28043-10-9 | Methyl 2,6,6-trimethylcyclohex-2-ene-1-carboxylate | |
67800-80-0 | Methyl 2-[(2-methylundecylidene)amino]benzoate | |
67801-42-7 | Methyl 2-[(3,5,5-trimethylhexylidene)amino]benzoate | |
39129-16-3 | Methyl 2-[(phenylmethylene)amino]benzoate | |
68738-99-8 | Methyl 2-[[[2,4(or 3,5)-dimethyl-3-cyclohexen-1-yl]methylene]amino]benzoate | |
67924-13-4 | Methyl 2-[[2-(phenylmethylene)octylidene]amino]benzoate | |
104037-85-6 | Methyl 2-[[3-(1,3-benzodioxol-5-yl)-2-methyl-1-propenyl]amino]benzoate | |
611-13-2 | Methyl 2-furoate | |
2396-77-2 | Methyl 2-hexenoate | |
868-57-5 | Methyl 2-methylbutyrate | |
42075-45-6 | Methyl 2-methylthiobutyrate | |
111-79-5 | Methyl 2-nonenoate | |
111-80-8 | Methyl 2-nonynoate | |
111-12-6 | Methyl 2-octynoate | |
1072-83-9 | Methyl 2-pyrrolyl ketone | |
6386-38-5 | Methyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | |
52557-97-8 | Methyl 3,3-dimethylbicyclo[2.2.1]heptane-2-carboxylate | |
2525-16-8 | Methyl 3,4,5,6-tetrahydro-7H-azepin-2-yl ether | |
2270-60-2 | Methyl 3,7-dimethyl-6-octenoate | |
72175-33-8 | Methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate | |
2396-78-3 | Methyl 3-hexenoate | |
21188-58-9 | Methyl 3-hydroxyhexanoate | |
21188-58-9 | Methyl 3-hydroxyhexanoate | |
13532-18-8 | Methyl 3-methylthiopropionate | |
13481-87-3 | Methyl 3-nonenoate | |
39924-52-2 | Methyl 3-oxo-2-(pent-2-enyl)cyclopentaneacetate | |
68966-86-9 | Methyl 4(or 1)-isopropyl-1(or 4)-methylbicyclo[2.2.2]oct-5-ene-2-carboxylate | |
112-62-9 | Methyl 9-octadecenoate | |
5760-50-9 | Methyl 9-undecenoate | |
68186-14-1 | Methyl abietate | |
127-25-3 | Methyl abietate, technical | |
79-20-9 | Methyl acetate | |
105-45-3 | Methyl acetoacetate | |
67905-40-2 | Methyl alpha-ionone glycidate | |
121-98-2 | Methyl anisate | |
134-20-3 | Methyl anthranilate | |
4707-47-5 | Methyl atrarate | |
93-58-3 | Methyl benzoate | |
93-08-3 | Methyl beta-naphthyl ketone | |
37161-74-3 | Methyl beta-phenylglycidate | |
623-42-7 | Methyl butyrate | |
103-26-4 | Methyl cinnamate | |
13894-62-7 | Methyl cis-3-hexenoate | |
41654-15-3 | Methyl cis-5-octenoate | |
30640-46-1 | Methyl cyclohexadiene (mixture of isomers) | |
14352-61-5 | Methyl cyclohexylacetate | |
40203-73-4 | Methyl cyclopentylideneacetate | |
110-42-9 | Methyl decanoate | |
811412-48-3 | Methyl decenone | |
24851-98-7 | Methyl dihydrojasmonate | |
8050-15-5 | Methyl ester of rosin (partially hydrogenated) | |
57500-00-2 | Methyl furfuryl disulfide | |
106-73-0 | Methyl heptanoate | |
112-39-0 | Methyl hexadecanoate | |
106-70-7 | Methyl hexanoate | |
37172-53-5 | Methyl hexyl oxo cyclopentanone carboxylate | |
1335-46-2 | Methyl ionone (mixture of isomers) | |
68937-31-5 | Methyl ionone tails | |
547-63-7 | Methyl isobutyrate | |
556-24-1 | Methyl isovalerate | |
1211-29-6 | Methyl jasmonate | |
111-82-0 | Methyl laurate | |
67633-95-8 | Methyl lavender ketone | |
112-63-0 | Methyl linoleate | |
301-00-8 | Methyl linoleate (48%) methyl linolenate (52%) mixture | |
74-93-1 | Methyl mercaptan | |
124-10-7 | Methyl myristate | |
2719-08-6 | Methyl N-acetylanthranilate | |
93-60-7 | Methyl nicotinate | |
85-91-6 | Methyl N-methylanthranilate | |
112-61-8 | Methyl octadecanoate | |
111-11-5 | Methyl octanoate | |
606-45-1 | Methyl o-methoxybenzoate | |
3558-60-9 | Methyl phenethyl ether | |
101-41-7 | Methyl phenylacetate | |
99-76-3 | Methyl p-hydroxybenzoate | |
99-75-2 | Methyl p-methylbenzoate | |
554-12-1 | Methyl propionate | |
3549-23-3 | Methyl p-tert-butylphenylacetate | |
119-36-8 | Methyl salicylate | |
689-89-4 | Methyl sorbate | |
689-89-4 | Methyl sorbate | |
2432-51-1 | Methyl thiobutyrate | |
2396-85-2 | Methyl trans-2-octenoate | |
111-81-9 | Methyl undec-10-enoate | |
624-24-8 | Methyl valerate | |
3943-74-6 | Methyl vanillate | |
5533-03-9 | Methyl vanillyl ether | |
81752-87-6 | Methyl-2,2-dimethyl-6-methylene-1-cyclohexanecarboxylate | |
68845-02-3 | Methyl-2-[[(2,4-dimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate | |
816-73-9 | Methylallyl isobutyrate | |
127-42-4 | Methyl-alpha-ionone | |
127-43-5 | Methyl-beta-ionone | |
61699-38-5 | Methylcyclooctyl carbonate | |
80-71-7 | Methylcyclopentenolone | |
1335-09-7 | Methylheptenol | |
409-02-9 | Methylheptenone (isomer unspecified) | |
67-68-5 | Methylsulfinylmethane | |
12001-26-2 | Mica | |
92457-18-6 | Michelia alba extract | |
8006-76-6 | Michelia alba flower oil | |
8006-76-6 | Michelia alba leaf extract | |
8006-76-6 | Michelia alba leaf oil | |
8006-76-6 | Michelia alba oil, rectified | |
8031-03-6 | Mimosa absolute | |
8031-03-6 | Mimosa concrete | |
13341-72-5 | Mintlactone | |
68476-78-8 | Molasses | |
8052-35-5 | Molasses, blackstrap | |
67701-32-0 | Mono- and diglycerides of fatty acids | |
87-28-5 | Monoglycol salicylate | |
77341-67-4 | mono-Menthyl succinate | |
84649-97-8 | Mushroom absolute | |
84649-97-8 | Mushroom resinoid | |
81-14-1 | Musk ketone | |
72403-67-9 | Myraldyl acetate | |
123-35-3 | Myrcene | |
543-39-5 | Myrcenol | |
1118-39-4 | Myrcenyl acetate | |
124-25-4 | Myristaldehyde | |
544-63-8 | Myristic acid | |
629-63-0 | Myristo nitrile | |
8016-37-3 | Myrrh | |
8016-37-3 | Myrrh absolute | |
8016-37-3 | Myrrh CO2 extract | |
8016-37-3 | Myrrh extract | |
9000-45-7 | Myrrh gum | |
8016-37-3 | Myrrh oil | |
8016-37-3 | Myrrh oil rectified | |
8016-37-3 | Myrrh resinoid | |
515-00-4 | Myrtenol | |
1079-01-2 | Myrtenyl acetate | |
8008-46-6 | Myrtle oil | |
8008-46-6 | Myrtle oil (low methyleugenol) | |
8008-46-6 | Myrtle oil terpeneless | |
8008-46-6 | Myrtle oil, rectified | |
847565-09-7 | N-(2-(Pyridin-2-yl)ethyl)-3-p-menthanecarboxamide | |
82493-14-9 | N-(2-Ethoxyphenyl)-N'-(4-isododecylphenyl)oxamide | |
84434-18-4 | N,2-Dimethyl-N-phenylbutyramide | |
996-97-4 | N,N-Diethyloctamide | |
3332-27-2 | N,N-dimethyltetradecylamine N-oxide; 25% solution in Water | |
68489-14-5 | N-[(Ethoxycarbonyl)methyl)-p-menthane-3-carboxamide | |
3734-33-6 | N-[2-(2,6-Dimethylphenyl)amino]-2-oxoethyl]-N,N-diethylbenzenemethana minium benzoate | |
744251-93-2 | N-3,7-Dimethyl-2,6-octadienylcyclopropylcarboxamide | |
64741-65-7 | Naphtha, petroleum, heavy alkylate | |
64742-48-9 | Naphtha, petroleum, hydrotreated heavy | |
91-20-3 | Naphthalene | |
68480-07-9 | Naphthalene, 2-(2,2-dimethoxyethoxy)- | |
3738-00-9 | Naphtho[2,1-b]furan, dodecahydro-3a,6,6,9a-tetramethyl- | |
6790-58-5 | Naphtho[2,1-b]furan, dodecahydro-3a,6,6,9a-tetramethyl-, (3aR,5aS,9aS,9bR)- | |
8023-75-4 | Narcissus absolute | |
8023-75-4 | Narcissus jonquilla absolute | |
68917-12-4 | Narcissus poeticus absolute | |
74113-74-9 | Natural Hickory Smoke Flavor | |
579-93-1 | N-Benzoylanthranilic acid | |
579-93-1 | N-Benzoylanthranilic acid | |
15706-73-7 | n-Butyl 2-methylbutyrate | |
8002-65-1 | Neem seed oil | |
20702-77-6 | Neohesperidin dihydrochalcone | |
106-26-3 | Neral | |
106-25-2 | Nerol | |
1786-08-9 | Nerol oxide | |
142-50-7 | Nerolidol (cis) | |
7212-44-4 | Nerolidol (isomer unspecified) | |
2306-78-7 | Nerolidyl acetate (isomer unspecified) | |
56001-43-5 | Nerolidyl acetate (S,Z) | |
141-12-8 | Neryl acetate | |
999-40-6 | Neryl butyrate | |
2142-94-1 | Neryl formate | |
2345-24-6 | Neryl isobutyrate | |
3915-83-1 | Neryl isovalerate | |
105-91-9 | Neryl propionate | |
39711-79-0 | N-Ethyl-2-isopropyl-5-methylcyclohexane carboxamide | |
179911-08-1 | N-Ethyl-N-(3-methylphenyl)propionamide | |
1438-94-4 | N-Furfurylpyrrole | |
142-82-5 | n-Heptane | |
110-54-3 | n-Hexane | |
19089-92-0 | n-Hexyl 2-butenoate | |
8014-68-4 | Niaouli oil | |
73507-35-4 | Nigella Damascena absolute | |
73507-35-4 | Nigella Damascena CO2 Extract | |
18836-52-7 | N-Isobutyldeca-trans-2-trans-4-dienamide | |
10377-60-3 | Nitric acid, magnesium salt (2:1) | |
5422-34-4 | N-Lactoyl ethanolamine | |
557-48-2 | Nona-2-trans-6-cis-dienal | |
629-92-5 | Nonadecane | |
124-19-6 | Nonanal | |
18824-63-0 | Nonanal dimethyl acetal | |
68141-14-0 | Nonanal, 5-ethyl-2-methyl- | |
111-84-2 | Nonane | |
54815-13-3 | Nonane, 1,1-diethoxy- | |
4390-04-9 | Nonane, 2,2,4,4,6,8,8-heptamethyl- | |
39864-15-8 | Nonanediyl diacetate | |
112-05-0 | Nonanoic acid | |
2444-46-4 | Nonanoyl 4-hydroxy-3-methoxybenzylamide | |
29127-83-1 | Nonen acid nitrile | |
68526-90-9 | Nonene, hydroformylation products, high-boiling | |
143-13-5 | Nonyl acetate | |
143-08-8 | Nonyl alcohol | |
4674-50-4 | Nootkatone | |
128-50-7 | Nopol | |
128-51-8 | Nopyl acetate | |
852379-28-3 | N-p-Benzeneacetonitrilementhanecarboxamide | |
8008-45-5 | Nutmeg | |
8008-45-5 | Nutmeg absolute | |
8008-45-5 | Nutmeg CO2 extract | |
8008-45-5 | Nutmeg distillate | |
8008-45-5 | Nutmeg extract | |
8008-45-5 | Nutmeg oil | |
8008-45-5 | Nutmeg oil (low safrol) | |
8008-45-5 | Nutmeg oil terpeneless, JAVA | |
8008-45-5 | Nutmeg oil, rectified | |
8008-45-5 | Nutmeg oleoresin | |
1073-29-6 | o-(Methylthio)-phenol | |
97676-29-4 | Oak chips (white) extract | |
97676-30-7 | Oak chips CO2 extract | |
97676-30-7 | Oak chips extract | |
9000-50-4 | Oakmoss absolute | |
9000-50-4 | Oakmoss absolute (low atranol & chloratranol) | |
68917-10-2 | Oakmoss extract | |
5986-38-9 | Ocimenol | |
72214-23-4 | Ocimenyl acetate | |
68917-09-9 | Ocotea cymbarum oil | |
95-48-7 | o-Cresol | |
593-45-3 | Octadecane | |
29710-25-6 | Octadecanoic acid, 12-hydroxy-, 2-ethylhexyl ester | |
822-16-2 | Octadecanoic acid, sodium salt | |
33704-60-8 | Octahydro-1,1,2,3,3-pentamethyl-1H-indene | |
71832-76-3 | Octahydro-2,5,5-trimethyl-2-naphthol | |
68845-01-2 | Octahydro-4,4,7-trimethyl-3H-naphth[1,8a-b]oxiren-7-ol | |
51115-88-9 | Octahydro-4,4,7-trimethyl-4a,7-ethano-4aH-naphth[1,8a-b]oxirene | |
13380-89-7 | Octahydro-4,7-methano-1H-indene-5-ol | |
30772-79-3 | Octahydro-4,7-methano-1H-indenecarbaldehyde | |
30772-69-1 | Octahydro-4,7-methano-1H-indenemethyl acetate | |
68039-78-1 | Octahydro-4,7-methano-1H-indenemethyl formate | |
23333-91-7 | Octahydro-4,8a-dimethyl-4a(2H)-naphthol | |
68738-96-5 | Octahydro-5,5-dimethylnaphthalene-2-carbaldehyde | |
59056-64-3 | Octahydro-7,7,8,8-tetramethyl-2,3b-methano-3bH-cyclopenta[1,3]cyclopropa[1,2]benzene-4-methanol | |
59056-62-1 | Octahydro-7,7,8,8-tetramethyl-2,3b-methano-3bH-cyclopenta[1,3]cyclopropa[1,2]benzene-4-methyl acetate | |
41724-19-0 | Octahydro-7-methyl-1,4-methanonaphtalen-6(2H)-one | |
68738-94-3 | Octahydro-8,8-dimethylnaphthalene-2-carbaldehyde | |
4430-31-3 | Octahydrocoumarin | |
124-13-0 | Octanal | |
54889-48-4 | Octanal diethyl acetal | |
10022-28-3 | Octanal dimethyl acetal | |
929253-05-4 | Octanal, 6-methoxy-2,6-dimethyl- | |
69102-96-1 | Octanal, 7-hydroxy-3,7-dimethyl-, distn. residues, nonvolatile | |
68527-82-2 | Octane, 1,1-bis(octyloxy)- | |
124-12-9 | Octanenitrile | |
124-07-2 | Octanoic acid | |
18312-31-7 | Octanoic acid, octadecyl ester | |
112-14-1 | Octyl acetate | |
110-39-4 | Octyl butyrate | |
22874-79-9 | Octyl crotonate | |
112-32-3 | Octyl formate | |
109-15-9 | Octyl isobutyrate | |
7786-58-5 | Octyl isovalerate | |
68916-40-5 | Oils, geranium, acetylated | |
1450625-49-6 | Oils, Patchouli, patchoulol synthase-modified Saccharomyces cerevisiae-fermented, from carbohydrates | |
1450625-49-6 | Oils, Patchouli, patchoulol synthase-modified Saccharomyces cerevisiae-fermented, from carbohydrates | |
112-80-1 | Oleic acid | |
8016-36-2 | Olibanum absolute | |
8016-36-2 | Olibanum carterii absolute | |
8016-36-2 | Olibanum carterii CO2 extract | |
8016-36-2 | Olibanum carterii extract | |
8016-36-2 | Olibanum carterii oil | |
8016-36-2 | Olibanum carterii oil | |
8016-36-2 | Olibanum carterii oil, rectified | |
8016-36-2 | Olibanum carterii pyrogenated oil | |
8016-36-2 | Olibanum carterii resinoid | |
8016-36-2 | Olibanum extract | |
8016-36-2 | Olibanum oil | |
8016-36-2 | Olibanum oil, rectified | |
8016-36-2 | Olibanum resinoid | |
8016-36-2 | Olibanum serrata oil, Indian | |
8001-25-0 | Olive absolute | |
8001-25-0 | Olive extract | |
8001-25-0 | Olive oil | |
7779-50-2 | omega-6-Hexadecenlactone | |
106-02-5 | omega-Pentadecalactone | |
135-02-4 | o-Methoxybenzaldehyde | |
1504-74-1 | o-Methoxycinnamaldehyde | |
86-26-0 | o-Phenyl anisole | |
8021-36-1 | Opoponax absolute | |
8021-36-1 | Opoponax CO2 extract | |
8021-36-1 | Opoponax extract | |
8021-36-1 | Opoponax oil | |
8021-36-1 | Opoponax resinoid | |
644-35-9 | o-Propylphenol | |
8030-28-2 | Orange blossoms absolute | |
68514-75-0 | Orange essence oil | |
8016-38-4 | Orange flower absolute, bitter (Neroli and Neroli Bigarade) | |
8016-38-4 | Orange flower oil, bitter (Neroli and Neroli bigarade) | |
8030-28-2 | Orange flower water absolute | |
8016-38-4 | Orange flower, bitter, absolute | |
8016-38-4 | Orange flower, bitter, CO2 extract | |
8016-38-4 | Orange flower, bitter, concrete | |
8016-38-4 | Orange flower, bitter, extract | |
8030-28-2 | Orange flowers | |
8030-28-2 | Orange leaf absolute | |
68916-04-1 | Orange oil, bitter | |
68916-04-1 | Orange oil, bitter | |
68916-04-1 | Orange oil, bitter washed, rectified | |
8016-38-4 | Orange oil, peel, bitter | |
8008-57-9 | Orange oil, sweet | |
68606-94-0 | Orange oil, sweet terpeneless | |
68917-07-7 | Orange oil, sweet, psoralen-free | |
8008-57-9 | Orange oil, sweet, rectified | |
68647-72-3 | Orange oil, sweet, terpenes | |
68606-94-0 | Orange peel oil, sweet terpeneless | |
8008-57-9 | Orange peel, sweet oil | |
8028-48-6 | Orange peel, sweet, extract | |
8008-57-9 | Orange sweet oil folded | |
8008-57-9 | Orange sweet, Valencia oil | |
91079-33-3 | Orange, sour, ext., sapond. | |
8008-57-9 | Orange, sweet, oil | |
8008-57-9 | Orange, sweet, oil fixed | |
8008-57-9 | Orange, sweet, resinoid | |
8007-11-2 | Origanum oil | |
8007-11-2 | Origanum oil (extractive) | |
68917-05-5 | Osmanthus absolute | |
68917-05-5 | Osmanthus concrete | |
68917-05-5 | Osmanthus tincture | |
137-06-4 | o-Toluenethiol | |
533-18-6 | o-Tolyl acetate | |
19819-98-8 | o-Tolylethanol | |
28645-51-4 | Oxacycloheptadec-10-ene-2-one | |
36508-31-3 | Oxacycloheptadec-11-en-2-one | |
111879-80-2 | Oxacyclohexadec-12-en-2-one, (12E)- | |
111879-79-9 | Oxacyclohexadec-12-en-2-one, (12Z)- | |
99219-32-6 | Oxacyclohexadec-13-en-2-one, (13E)- | |
111879-81-3 | Oxacyclohexadec-13-en-2-one, (13Z)- | |
38223-29-9 | Oxacyclohexadecane-2,13-dione | |
34902-57-3 | Oxacyclohexadecen-2-one | |
329925-33-9 | Oxacyclopentadec-10-en-2-one, 13-methyl- | |
947-05-7 | Oxacyclotridecan-2-one | |
6153-56-6 | Oxalic acid dihydrate | |
9087-53-0 | Oxirane, 2-methyl-, polymer with oxirane, hexadecyl ether | |
11111-34-5 | Oxirane, methyl-, polymer with oxirane, ether with (1,2-ethanediyldinitrilo)tetrakis[propanol](4:1) | |
9038-95-3 | Oxirane, methyl-, polymer with oxirane, monobutyl ether | |
9038-43-1 | Oxirane, methyl-, polymer with oxirane, monooctadecyl ether | |
6324-78-3 | p-(2,2-Dimethoxyethoxy)toluene | |
42866-91-1 | p-(2,2-Dimethoxyethyl)toluene | |
80314-58-5 | p-(2-Methoxyethyl)anisole | |
1195-32-0 | p,alpha-Dimethylstyrene | |
8023-79-8 | Palm kernel oil | |
8002-75-3 | Palm oil, fixed | |
8002-75-3 | Palm olein oil | |
8014-19-5 | Palmarosa oil | |
57-10-3 | Palmitic acid | |
1197-01-9 | p-alpha,alpha-Trimethylbenzyl alcohol | |
104-21-2 | p-Anisyl acetate | |
84625-29-6 | Paprika oleoresin | |
64742-46-7 | Paraffin - C15- 19 alkane | |
8012-95-1 | Paraffin oils | |
8002-74-2 | Paraffin wax | |
64771-72-8 | Paraffins, normal C5-C20 | |
123-63-7 | Paraldehyde | |
8000-68-8 | Parsley herb oil | |
8025-95-4 | Parsley oleoresin | |
8000-68-8 | Parsley seed oil | |
854535-37-8 | Passionflower extract | |
8014-09-3 | Patchouli | |
8014-09-3 | Patchouli | |
8014-09-3 | Patchouli absolute | |
5986-55-0 | Patchouli alcohol | |
8014-09-3 | Patchouli CO2 extract | |
8014-09-3 | Patchouli extract | |
8014-09-3 | Patchouli oil | |
8014-09-3 | Patchouli oil | |
8014-09-3 | Patchouli oil (low Fe) | |
8014-09-3 | Patchouli oil, rectified | |
73049-67-9 | Patchouli oil, terpene-free | |
106-44-5 | p-Cresol | |
614-34-6 | p-Cresyl benzoate | |
607-88-5 | p-Cresyl salicylate | |
99-87-6 | p-Cymene | |
150-78-7 | p-Dimethoxybenzene | |
1429493-82-2 | Peach extract | |
8002-03-7 | Peanut oil | |
90082-43-2 | Pear distillate | |
124046-50-0 | Peg-20 Almond Glycerides | |
94333-77-4 | Pelargonium graveolens, ext., sapond. | |
8013-99-8 | Pennyroyal oil, Europe | |
68917-60-2 | Pennyroyal oil, terpenes | |
629-62-9 | Pentadecane | |
1119-40-0 | Pentanedioic acid, 1,5-dimethyl ester | |
55590-83-5 | Pentanoic acid, 2-methylbutyl ester | |
26516-27-8 | Pentanoic acid, 3-methyl-2-oxo-, ethyl ester | |
628-63-7 | Pentyl acetate | |
2049-96-9 | Pentyl benzoate | |
25415-62-7 | Pentyl isovalerate | |
5137-52-0 | Pentyl phenylacetate | |
624-54-4 | Pentyl propionate | |
68917-24-8 | Pepper oil black, terpene-free | |
8006-82-4 | Pepper, black, absolute | |
8006-82-4 | Pepper, black, CO2 extract | |
8006-82-4 | Pepper, black, oil | |
8006-82-4 | Pepper, black, oil, rectified | |
8002-56-0 | Pepper, black, oleoresin | |
72869-79-5 | Pepper, black, terpenes | |
8006-82-4 | Pepper, white, CO2 extract | |
8006-82-4 | Pepper, white, oil | |
8006-90-4 | Peppermint absolute | |
8006-90-4 | Peppermint CO2 extract | |
8006-90-4 | Peppermint leaves | |
8006-90-4 | Peppermint oil | |
8006-90-4 | Peppermint oil, rectified | |
68606-97-3 | Peppermint oil, terpeneless | |
68608-37-7 | Peppermint oil, terpenes | |
68606-96-2 | Peppermint oils, reaction products with hydrogen sulfide | |
68132-21-8 | Perilla oil | |
1155405-59-6 | Periploca sepium oil | |
8008-26-2 | Persian lime oil, expressed | |
444085-42-1 | Persicaria odorata oil | |
8007-00-9 | Peru balsam distillate | |
123-07-9 | p-Ethylphenol | |
8007-75-8 | Petitgrain bergamot oil | |
8014-17-3 | Petitgrain bigarade oil | |
8048-51-9 | Petitgrain lemon oil | |
8014-17-3 | Petitgrain mandarin oil | |
68915-85-5 | Petitgrain oil terpeneless, Paraguay | |
68917-61-3 | Petitgrain oil terpenes, Paraguay | |
8014-17-3 | Petitgrain oil, Paraguay | |
8014-17-3 | Petitgrain oil, rectified, Paraguay | |
68606-99-5 | Petitgrain oils, saponified | |
8014-17-3 | Petitgrain orange leaf oil, bitter, rectified | |
8014-17-3 | Petitgrain water absolute, Paraguay | |
1329-99-3 | Phellandrene | |
6315-04-4 | Phenethyl 2-ethylbutyrate | |
103-45-7 | Phenethyl acetate | |
60-12-8 | Phenethyl alcohol | |
94-47-3 | Phenethyl benzoate | |
103-52-6 | Phenethyl butyrate | |
103-53-7 | Phenethyl cinnamate | |
104-62-1 | Phenethyl formate | |
6290-37-5 | Phenethyl hexanoate | |
103-48-0 | Phenethyl isobutyrate | |
2257-09-2 | Phenethyl isothiocyanate | |
140-26-1 | Phenethyl isovalerate | |
5457-70-5 | Phenethyl octanoate | |
102-20-5 | Phenethyl phenylacetate | |
122-70-3 | Phenethyl propionate | |
87-22-9 | Phenethyl salicylate | |
55719-85-2 | Phenethyl tiglate | |
108-95-2 | Phenol | |
31195-95-6 | Phenol, (2-methylpropyl)- | |
52514-67-7 | Phenol, 2-ethoxy-4-(4,4,6-trimethyl-1,3-dioxan-2-yl)- | |
71119-07-8 | Phenol, 2-ethoxy-4-(ethoxymethyl)- | |
224790-80-1 | Phenol, 2-methoxy-, reaction products | |
52514-66-6 | Phenol, 2-methoxy-4-(4,4,6-trimethyl-1,3-dioxan-2-yl)- | |
88-18-6 | Phenol, 2-(1,1-dimethylethyl)- | |
88-60-8 | Phenol, 2-(1,1-dimethylethyl)-5-methyl- | |
2219-82-1 | Phenol, 2-(1,1-dimethylethyl)-6-methyl- | |
89-72-5 | Phenol, 2-(1-methylpropyl)- | |
25973-55-1 | Phenol, 2-(2H-benzotriazol-2-yl)-4,6-bis(1,1-dimethylpropyl)- | |
2440-22-4 | Phenol, 2-(2H-benzotriazol-2-yl)-4-methyl- | |
125304-04-3 | Phenol, 2-(2H-benzotriazol-2-yl)-6-dodecyl-4-methyl-, branched and linear | |
3896-11-5 | Phenol, 2-(5-chloro-2H-benzotriazol-2-yl)-6-(1,1-dimethylethyl)-4-methyl- | |
6706-82-7 | Phenol, 2,2'-[cyclohexylidenebis[(2-methyl-4,1-phenylene)azo]]bis[4-cyclohexyl- | |
35958-30-6 | Phenol, 2,2'-ethylidenebis[4,6-bis(1,1-dimethylethyl)- | |
119-47-1 | Phenol, 2,2'-methylenebis[6-(1,1-dimethylethyl)-4-methyl- | |
697-82-5 | Phenol, 2,3,5-trimethyl- | |
128-39-2 | Phenol, 2,6-bis(1,1-dimethylethyl)- | |
70955-71-4 | Phenol, 2-methoxy-, reaction products with 2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane, hydrogenated | |
879-67-4 | Phenol, 2-methoxy-4-methyl-, 1-acetate | |
13746-57-1 | Phenol, 2-methoxy-5-[(1R,2S,4R,6S)-5,5,6-trimethylbicyclo[2.2.1]hept-2-yl]-, rel- | |
618-45-1 | Phenol, 3-(1-methylethyl)- | |
99-71-8 | Phenol, 4-(1-methylpropyl)- | |
128489-02-1 | Phenol, 4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxy- | |
1638-22-8 | Phenol, 4-butyl- | |
88-04-0 | Phenol, 4-chloro-3,5-dimethyl- | |
3245-23-6 | Phenol, 4-ethyl-, 1-acetate | |
84852-15-3 | Phenol, 4-nonyl-, branched | |
25154-52-3 | Phenol, nonyl- | |
2120-70-9 | Phenoxyacetaldehyde | |
118-55-8 | Phenyl salicylate | |
122-78-1 | Phenylacetaldehyde | |
67633-94-7 | Phenylacetaldehyde 2,4-dihydroxy-2-methylpentane acetal | |
6314-97-2 | Phenylacetaldehyde diethyl acetal | |
68345-22-2 | Phenylacetaldehyde diisobutyl acetal | |
101-48-4 | Phenylacetaldehyde dimethyl acetal | |
101-49-5 | Phenylacetaldehyde ethylene glycol acetal | |
29895-73-6 | Phenylacetaldehyde glyceryl acetal | |
7028-48-0 | Phenylacetaldehyde oxime | |
103-82-2 | Phenylacetic acid | |
24817-51-4 | Phenylethyl 2-methylbutyrate | |
133-18-6 | Phenylethyl anthranilate | |
56011-02-0 | Phenylethyl isoamyl ether | |
1335-12-2 | Phenylpropanol | |
1335-10-0 | Phenylpropionaldehyde | |
2809-21-4 | Phosphonic acid, (1-hydroxyethylidene)bis- | |
298-07-7 | Phosphoric acid, bis(2-ethylhexyl) ester | |
7558-80-7 | Phosphoric acid, monosodium salt | |
150-86-7 | Phytol | |
10236-16-5 | Phytyl acetate | |
8006-77-7 | Pimenta leaf oil | |
8006-77-7 | Pimenta leaf oil (low methyleugenol) | |
8021-29-2 | Pine needle oil | |
8000-26-8 | Pine needle, dwarf, oil | |
8002-09-3 | Pine oil | |
68440-45-9 | Pine oils, acetylated | |
8023-99-2 | Pine Scotch absolute | |
8023-99-2 | Pine Scotch oil | |
8023-99-2 | Pine Scotch resinoid | |
8023-99-2 | Pine Scotch, concrete | |
8023-99-2 | Pine Scotch, extract | |
8023-99-2 | Pine Scotch, pyrogenated oil | |
8011-48-1 | Pine tar oil | |
8011-48-1 | Pine tar oil, rectified | |
73049-71-5 | Pine, extract | |
8000-26-8 | Pine, Pinus maritima, sawdust oil | |
8000-26-8 | Pine, Pinus pinaster, absolute | |
8000-26-8 | Pine, Pinus pinaster, extract | |
97676-05-6 | Pine, Pinus pumila, extract | |
68917-26-0 | Pineapple alcoholate | |
97676-27-2 | Pineapple extract | |
1078-95-1 | Pinocarvyl acetate | |
8000-26-8 | Pinus nigra oil | |
90082-60-3 | Piper longum CO2 extract | |
90082-60-3 | Piper longum extract | |
90082-60-3 | Piper longum oil | |
110-89-4 | Piperidine | |
94-62-2 | Piperine | |
89-81-6 | Piperitone | |
120-57-0 | Piperonal | |
326-61-4 | Piperonyl acetate | |
6658-48-6 | p-Isobutyl-alpha-methyl hydrocinnamaldehyde | |
4395-92-0 | p-Isopropyl phenylacetaldehyde | |
645-13-6 | p-Isopropylacetophenone | |
59230-57-8 | p-Isopropylbenzyl acetate | |
536-60-7 | p-Isopropylbenzyl alcohol | |
92457-29-9 | Plumeria absolute | |
10482-56-1 | p-Menth-1-en-8-ol (S) | |
138-87-4 | p-Menth-8-en-1-ol | |
7764-50-3 | p-Menth-8-en-2-one | |
99-86-5 | p-Mentha-1,3-diene | |
99-85-4 | p-Mentha-1,4-diene | |
3269-90-7 | p-Mentha-1,8[10]-dien-9-ol | |
2111-75-3 | p-Mentha-1,8-dien-7-al | |
536-59-4 | p-Mentha-1,8-dien-7-ol | |
15111-96-3 | p-Mentha-1,8-dien-7-yl acetate | |
38462-22-5 | p-Mentha-8-thiol-3-one | |
499-70-7 | p-Menthan-2-one | |
68921-26-6 | p-Menthylene sulfide 1% in limonene | |
123-11-5 | p-Methoxybenzaldehyde | |
874-90-8 | p-Methoxybenzonitrile | |
1963-36-6 | p-Methoxycinnamaldehyde | |
84697-09-6 | p-Methyl-alpha-amyl cinnamic aldehyde | |
104-93-8 | p-Methylanisole | |
91-61-2 | p-Methyltetrahydroquinoline | |
26183-52-8 | Poly(oxy-1,2-ethanediyl), α-decyl-ω-hydroxy- | |
61827-42-7 | Poly(oxy-1,2-ethanediyl), α-isodecyl-ω-hydroxy- | |
9051-57-4 | Poly(oxy-1,2-ethanediyl), α-sulfo-ω-(nonylphenoxy)-, ammonium salt (1:1) | |
24938-91-8 | Poly(oxy-1,2-ethanediyl), α-tridecyl-ω-hydroxy- | |
31694-55-0 | Poly(oxy-1,2-ethanediyl), α,α',α''-1,2,3-propanetriyltris[ω-hydroxy- | |
9004-99-3 | Poly(oxy-1,2-ethanediyl), .alpha.-(1-oxooctadecyl)-.omega.-hydroxy- | |
127087-87-0 | Poly(oxy-1,2-ethanediyl), .alpha.-(4-nonylphenyl)-.omega.-hydroxy-,branched | |
9004-87-9 | Poly(oxy-1,2-ethanediyl), .alpha.-(isooctylphenyl)-.omega.-hydroxy- | |
68412-54-4 | Poly(oxy-1,2-ethanediyl), .alpha.-(nonylphenyl)-.omega.-hydroxy-, branched | |
68987-90-6 | Poly(oxy-1,2-ethanediyl), .alpha.-(octylphenyl)-.omega.-hydroxy-, branched | |
60828-78-6 | Poly(oxy-1,2-ethanediyl), .alpha.-[3,5-dimethyl-1-(2-methylpropyl)hexyl]-.omega.-hydroxy- | |
9004-98-2 | Poly(oxy-1,2-ethanediyl), .alpha.-9-octadecenyl-.omega.-hydroxy-, (Z)- | |
25322-68-3 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy- | |
68511-37-5 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, mono-C12-14-alkyl ethers, phosphates | |
37205-87-1 | Poly(oxy-1,2-ethanediyl), a-(isononylphenyl)-w-hydroxy- | |
9002-93-1 | Poly(oxy-1,2-ethanediyl), a-[4-(1,1,3,3-tetramethylbutyl)phenyl]-w-hydroxy- | |
9002-92-0 | Poly(oxy-1,2-ethanediyl), a-dodecyl-w-hydroxy- | |
69364-63-2 | Poly(oxy-1,2-ethanediyl), a-isohexadecyl-w-hydroxy- | |
9004-82-4 | Poly(oxy-1,2-ethanediyl), a-sulfo-w-(dodecyloxy)-, sodium salt | |
68585-34-2 | Poly(oxy-1,2-ethanediyl), a-sulfo-w-hydroxy-, C10-16-alkyl ethers, sodium salts | |
69011-36-5 | Poly(oxy-1,2-ethanediyl), a-tridecyl-w-hydroxy-, branched | |
34398-01-1 | Poly(oxy-1,2-ethanediyl), a-undecyl-w-hydroxy- | |
9036-19-5 | Poly(oxy-1,2-ethanediyl),alpha-[(1,1,3,3-tetramethylbutyl)phenyl]-omega-hydroxy- | |
9016-45-9 | Poly(oxy-1,2-ethanedyl), alpha-(nonylphenyl)-omega-hydroxy- | |
9003-13-8 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-butyl-.omega.-hydroxy- | |
9035-85-2 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hexadecyl-.omega.-hydroxy- | |
61849-72-7 | Poly[oxy(methyl-1,2-ethanediyl)], .alpha.-hydro-.omega.-hydroxy-, ether with methyl .beta.-D-glucopyranoside (4:1) | |
25231-21-4 | Poly[oxy(methyl-1,2-ethanediyl)], a-octadecyl-w-hydroxy- | |
68424-04-4 | Polydextrose | |
9002-88-4 | Polyethylene low density | |
9005-64-5 | Polysorbate 20 | |
9005-67-8 | Polysorbate 60 | |
9005-65-6 | Polysorbate 80 | |
921202-04-2 | Populus nigra absolute | |
16731-55-8 | Potassium metabisulfite | |
104-45-0 | p-Propylanisole | |
645-56-7 | p-Propylphenol | |
76649-23-5 | Prenyl isobutyrate | |
1005328-84-6 | Procavia capensis extract | |
1005328-84-6 | Procavia capensis, tincture | |
4744-08-5 | Propanal diethyl acetal | |
163702-06-5 | Propane, 2-(ethoxydifluoromethyl)-1,1,1,2,3,3,3-heptafluoro- | |
111109-77-4 | Propane, oxybis[methoxy- | |
478695-70-4 | Propanedioic acid, 1-(3,3-dimethylcyclohexyl) ethyl, ethyl ester | |
609-08-5 | Propanedioic acid, 2-methyl-, 1,3-diethyl ester | |
107-03-9 | Propanethiol | |
25265-77-4 | Propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol | |
34451-19-9 | Propanoic acid, 2-hydroxy-, butyl ester, (2S)- | |
6846-50-0 | Propanoic acid, 2-methyl-, 1,1'-[2,2-dimethyl-1-(1-methylethyl)-1,3-propanediyl] ester | |
10595-72-9 | Propanoic acid, 3,3'-thiobis-, 1,1'-ditridecyl ester | |
123-28-4 | Propanoic acid, 3,3'-thiobis-, didodecyl ester | |
55934-93-5 | Propanol, [2-(2-butoxymethylethoxy)methylethoxy]- | |
25498-49-1 | Propanol, [2-(2-methoxymethylethoxy)methylethoxy]- | |
88917-22-0 | Propanol, 1(or 2)-(2-methoxymethylethoxy)-, acetate | |
94-86-0 | Propenylguaethol | |
123-38-6 | Propionaldehyde | |
79-09-4 | Propionic acid | |
319002-92-1 | Propyl (2S)-2-(1,1-dimethylpropoxy)-propanoate | |
37064-20-3 | Propyl 2-methylbutyrate | |
109-60-4 | Propyl acetate | |
71-23-8 | Propyl alcohol | |
105-66-8 | Propyl butyrate | |
121-79-9 | Propyl gallate | |
626-77-7 | Propyl hexanoate | |
557-00-6 | Propyl isovalerate | |
7493-57-4 | Propyl phenethyl acetal | |
4606-15-9 | Propyl phenylacetate | |
94-13-3 | Propyl p-hydroxybenzoate | |
106-36-5 | Propyl propionate | |
57-55-6 | Propylene glycol | |
9005-37-2 | Propylene glycol alginate | |
5131-66-8 | Propylene glycol butyl ether | |
19224-26-1 | Propylene glycol dibenzoate | |
68412-04-4 | Pseudo linalyl acetate | |
80-54-6 | p-t-Butyl-alpha-methylhydrocinnamic aldehyde | |
943-27-1 | p-tert-Butylacetophenone | |
5396-38-3 | p-tert-Butylanisole | |
98-53-3 | p-tert-Butylcyclohexanone | |
18127-01-0 | p-tert-Butyldihydrocinnamaldehyde | |
104-87-0 | p-Tolualdehyde | |
55066-56-3 | p-Tolyl 3-methylbutyrate | |
24700-20-7 | p-Tolyl 3-methylcrotonate | |
67801-43-8 | p-Tolyl 3-oxo-3-phenylpropionate | |
140-39-6 | p-Tolyl acetate | |
589-18-4 | p-Tolyl alcohol | |
103-93-5 | p-Tolyl isobutyrate | |
59558-23-5 | p-Tolyl octanoate | |
101-94-0 | p-Tolyl phenylacetate | |
104-09-6 | p-Tolylacetaldehyde | |
89-82-7 | Pulegone | |
2628-17-3 | p-Vinylphenol | |
32741-11-0 | Pyrazine, (1,1-dimethylethyl)- | |
25680-58-4 | Pyrazine, 2-ethyl-3-methoxy- | |
68844-95-1 | Pyrazine, 2-methoxy-3-(4-methylpentyl)- | |
2882-20-4 | Pyrazine, 2-methyl-3-(methylthio)- | |
67952-65-2 | Pyrazine, methyl (methylthio)- | |
110-86-1 | Pyridine | |
885702-72-7 | Pyridine, 2-(2,4-dimethylcyclohexyl)- | |
56057-93-3 | Pyridine, 2-methyl-5-(1-methylethenyl)- | |
90145-47-4 | Pyridine, 3-(2,2-dimethylpropyl)- | |
1815-99-2 | Pyridine, 4-decyl- | |
862079-91-2 | Pyridine, 4-[1(4-,5 or 6)-methylbicyclo[2.2.1]hept-5-en-2-yl]- | |
125352-06-9 | Pyridine, 4-ethenyl-, reaction products with 3a,4,7,7a-tetrahydrodimethyl-4,7-methano-1H-indene | |
710-40-7 | Pyridine, 5-hexyl-2-methyl- | |
8030-97-5 | Pyroligneous acid | |
8028-47-5 | Pyroligneous acid extract | |
123-75-1 | Pyrrolidine | |
127-17-3 | Pyruvic acid | |
68391-01-5 | Quaternary ammonium compounds, benzyl-C12-18-alkyldimethyl, chlorides | |
61789-71-7 | Quaternary ammonium compounds, benzylcoco alkyldimethyl, chlorides | |
68990-67-0 | Quillaja bark extract | |
68141-13-9 | Quinoline, 6-(1,1-dimethylethyl)- | |
8002-13-9 | Rape oil | |
68648-53-3 | Resin acids and rosin acids, hydrogenated, esters with triethylene glycol | |
68917-78-2 | Resins, oleo-, paprika | |
108-46-3 | Resorcinol | |
6812-78-8 | Rhodinol | |
141-11-7 | Rhodinyl acetate | |
141-15-1 | Rhodinyl butyrate | |
141-09-3 | Rhodinyl formate | |
10486-14-3 | Rhodinyl phenylacetate | |
105-89-5 | Rhodinyl propionate | |
68553-81-1 | Rice absolute | |
8007-01-0 | Rose | |
90106-38-0 | Rose absolute | |
8007-01-0 | Rose absolute | |
8007-01-0 | Rose centifolia alcoholate | |
8007-01-0 | Rose centifolia CO2 extract | |
8007-01-0 | Rose centifolia oil expressed (low methyleugenol) | |
8007-01-0 | Rose CO2 extract | |
8007-01-0 | Rose concrete | |
8007-01-0 | Rose extract | |
8007-01-0 | Rose extract | |
8007-01-0 | Rose oil | |
8007-01-0 | Rose oil | |
8007-01-0 | Rose oil (low methyleugenol) | |
8007-01-0 | Rose oil, folded | |
3033-23-6 | Rose oxide levo | |
8007-01-0 | Rose tincture | |
8007-01-0 | Rose tincture | |
8007-01-0 | Rose water oil | |
8000-25-7 | Rosemary absolute | |
8000-25-7 | Rosemary extract | |
8000-25-7 | Rosemary oil | |
8000-25-7 | Rosemary oil, rectified | |
68917-54-4 | Rosemary oils, terpene-free | |
8015-77-8 | Rosewood oil | |
65997-06-0 | Rosin, hydrogenated | |
65997-05-9 | Rosin, polymd. | |
72379-31-8 | Rubus idaeus absolute | |
72379-31-8 | Rubus idaeus alcoholate | |
72379-31-8 | Rubus idaeus extract | |
8014-29-7 | Rue oil | |
943609-24-3 | Rum (non-concentrated) extract | |
943609-24-3 | Rum absolute | |
943609-24-3 | Rum CO2 extract | |
943609-24-3 | Rum CO2 extract | |
8030-89-5 | Rum ether | |
943609-24-3 | Rum extract | |
34322-09-3 | S-(1-Methylpropyl) 3-methylbut-2-enethioate | |
34365-79-2 | S-1-Methylethyl 3-methylbut-2-enethioate | |
2432-91-9 | S-2-Butyl 3-methylbutanethioate | |
3387-41-5 | Sabinene | |
81-07-2 | Saccharin | |
128-44-9 | Saccharine, sodium salt | |
8001-23-8 | Safflower oil | |
8022-19-3 | Saffron absolute | |
8022-19-3 | Saffron distillate | |
8022-19-3 | Saffron extract | |
8022-56-8 | Sage Dalmatian oil | |
8022-56-8 | Sage oil, Spanish | |
90-02-8 | Salicylaldehyde | |
1070895-66-7 | Sandalwood absolute | |
1070895-66-7 | Sandalwood extract | |
8006-87-9 | Sandalwood oil | |
68917-53-3 | Sandalwood oil, acetylated | |
8024-35-9 | Sandalwood oil, Australian | |
8024-35-9 | Sandalwood oil, Australian, rectified | |
1070895-66-7 | Sandalwood oil, rectified | |
11031-45-1 | Santalol | |
1323-00-8 | Santalyl acetate | |
1365254-19-8 | Sarcocaulon mossamedense extract | |
85085-28-5 | Sarcodactylis oil | |
8006-80-2 | Sassafras oil | |
8016-68-0 | Savory summer oil | |
90106-57-3 | Savory winter oil | |
68917-52-2 | Schinus molle oil | |
68917-52-2 | Schinus molle oil CO2 extract | |
68917-52-2 | Schinus molle oil terpenless | |
68917-52-2 | Schinus molle oil, rectified | |
949495-68-5 | Schinus terebenthifolius CO2 extract | |
949495-68-5 | Schinus terebinthifolius oil | |
515-03-7 | Sclareol | |
564-20-5 | Sclareolide | |
8023-80-1 | Scotch broom absolute | |
8023-80-1 | Scotch broom oil | |
2679-87-0 | sec-Butyl ethyl ether | |
68198-80-1 | sec-Butylquinoline | |
8008-74-0 | Sesame seed CO2 extract | |
8008-74-0 | Sesame seed distillate | |
8008-74-0 | Sesame seed extract | |
8008-74-0 | Sesame seed oil | |
102242-62-6 | Sichuan pepper CO2 extract | |
68611-44-9 | Silane, dichlorodimethyl-, reaction products with silica | |
7631-86-9 | Silica | |
112926-00-8 | Silica gel, pptd., cryst.-free | |
63148-62-9 | Siloxanes and silicones, di-Me | |
845276-94-0 | Siparuna guianensis oil | |
34322-06-0 | S-Isopropyl 3-methylthiobutyrate | |
83-34-1 | Skatole | |
90105-94-5 | Sloe berries | |
127-09-3 | Sodium acetate | |
532-32-1 | Sodium benzoate | |
7647-14-5 | Sodium chloride | |
68-04-2 | Sodium citrate | |
126-96-5 | Sodium diacetate | |
1310-73-2 | Sodium hydroxide | |
7757-82-6 | Sodium sulphate | |
7772-98-7 | Sodium thiosulfate | |
1338-43-8 | Sorbitan monooleate | |
26266-58-0 | Sorbitan, tri-(9Z)-9-octadecenoate | |
8001-22-7 | Soybean oil | |
8016-70-4 | Soybean oil, hydrogenated | |
8008-79-5 | Spearmint absolute | |
8008-79-5 | Spearmint CO2 extract | |
8008-79-5 | Spearmint extract | |
8008-79-5 | Spearmint oil | |
8008-79-5 | Spearmint oil terpenes | |
91770-24-0 | Spearmint oil, 60% | |
8008-79-5 | Spearmint oil, rectified | |
91770-24-0 | Spearmint oil, Scotch | |
91770-24-0 | Spearmint oil, Scotch, rectified | |
68917-46-4 | Spearmint oil, terpeneless | |
8016-78-2 | Spike lavender oil | |
8022-22-8 | Spikenard oil | |
678981-31-2 | Spiro [5.5]unec-8en-1-ol, 2,2,9,11-tetramethyl-,acetate, (6R,11R-rel- | CAS number corrected on 24 Nov 2020 |
154171-76-3 | Spiro[1,3-dioxolane-2,8'(5'H)-[2H-2,4a]methanonaphthalene], hexahydro-1',1',5',5'-tetramethyl- | |
154171-77-4 | Spiro[1,3-dioxolane-2,8'(5'H)-[2H-2,4a]methanonaphthalene],hexahydro-1',1',5',5'-tetramethyl-, [2'S-(2'.alpha.,4'a.alpha.,8'a.alpha.)]- | |
678981-31-2 | Spiro[5.5]undec-8-en-1-ol,2,2,9,11-tetramethyl-,1-acetate | CAS number corrected on 25 Aug 2020 |
502847-01-0 | Spiro[5.5]undec-8-en-1-one, 2,2,7,9-tetramethyl- | |
188199-50-0 | Spiro[bicyclo[2.2.1]heptane-s,4'-[1,2]dioxane], 1,7,7-trimethyl-2'-(methylethyl)-, (1R,2S,2'S,4R) | |
121251-67-0 | Spiro[bicyclo[4.1.0]heptane-2,5'-[1,3]dioxane], 2',2',3,7,7-pentamethyl-, (1.alpha.,3.alpha.,6.alpha.)- | |
121251-68-1 | Spiro[bicyclo[4.1.0]heptane-2,5'-[1,3]dioxane], 2',2',3,7,7-pentamethyl-, (1.alpha.,3.beta.,6.alpha.)- | |
8008-80-8 | Spruce oil, Black | |
68952-43-2 | Star anise CO2 extract | |
68952-43-2 | Star anise extract | |
68952-43-2 | Star anise oil | |
72869-72-8 | Star anise oil terpeneless | |
68952-43-2 | Star anise oil terpenes | |
9005-25-8 | Starch | |
52906-93-1 | Starch, hydrogen octenylbutanedioate | |
57-11-4 | Stearic acid | |
1406-57-1 | Stearoptenes | |
68555-08-8 | Steroids, hydroxy | |
91845-51-1 | Storax (balsam), American, saponified | |
90131-36-5 | Strawberry extract | |
4845-99-2 | Strychnidin-10-one, 2,3-dimethoxy-, sulfate (2:1) | |
8024-01-9 | Styrax absolute | |
8046-19-3 | Styrax absolute (low sytrene) | |
8046-19-3 | Styrax absolute, Honduras | |
8024-01-9 | Styrax distillate | |
8046-19-3 | Styrax essence pyrogenated | |
8046-19-3 | Styrax extract | |
8046-19-3 | Styrax oil | |
8046-19-3 | Styrax oil, Honduras | |
8024-01-9 | Styrax oil, Oriental | |
8024-01-9 | Styrax oil, Oriental | |
8024-01-9 | Styrax oil, pyrogenated | |
8024-01-9 | Styrax oil, pyrogenated, distilled | |
8046-19-3 | Styrax resin | |
8046-19-3 | Styrax resinoid | |
100-42-5 | Styrene | |
10521-96-7 | Styryl acetate | |
110-15-6 | Succinic acid | |
56038-13-2 | Sucralose | |
8013-17-0 | Sugar, invert | |
91722-22-4 | Sugarcane extract | |
91770-72-8 | Sugarcane, fermented, ext | |
7446-09-5 | Sulfur dioxide | |
7664-93-9 | Sulfuric acid | |
7757-83-7 | Sulfurous acid, sodium salt (1:2) | |
8001-21-6 | Sunflower oil | |
8001-21-6 | Sunflower oil | |
8001-21-6 | Sunflower oil, expressed | |
8029-43-4 | Syrups, hydrolyzed starch | |
8016-84-0 | Tagetes erecta absolute | |
8016-84-0 | Tagetes erecta extract | |
8016-84-0 | Tagetes erecta oil | |
8016-84-0 | Tagetes minuta absolute | |
8016-84-0 | Tagetes minuta oil | |
8016-84-0 | Tagetes minuta oil, rectified | |
91722-29-1 | Tagetes patula absolute | |
72968-49-1 | Tamarind extract | |
39386-78-2 | Tamarind seed gum | |
72869-73-9 | Tangelo oil, expressed | |
8016-85-1 | Tangerine oil | |
8016-85-1 | Tangerine oil | |
68608-38-8 | Tangerine oil terpenes | |
8016-85-1 | Tangerine oil, folded | |
8016-87-3 | Tansy oil | |
93924-73-3 | Tar wood oil, distilled | |
8016-88-4 | Tarragon oil | |
8016-88-4 | Tarragon oil (low methyleugenol) | |
133-37-9 | Tartaric acid (d-, l-, dl-, meso-) | |
950854-40-7 | Tea leaf absolute | |
950854-40-7 | Tea leaf oil | |
68647-73-4 | Tea tree oil | |
15356-74-8 | Tealactone | |
68188-04-5 | Terpenes and terpenoids, clove-oil, reaction products with formaldehyde | |
72230-85-4 | Terpenes and terpenoids, copaiba-oil, hydroxy, acetates | |
65996-98-7 | Terpenes and Terpenoids, limonene fraction | |
68608-36-6 | Terpenes and terpenoids, litsea cubeba-oil, hydrogenated | |
68917-57-7 | Terpenes and terpenoids, mixed sour and sweet orange oil | |
1442462-94-3 | Terpenes and Terpenoids, patchouli-oil, a-guaiene fraction, oxidized | |
68917-63-5 | Terpenes and Terpenoids, sinpine | |
68938-00-1 | Terpenes and terpenoids, turpentine-oil residues | |
65996-99-8 | Terpenes and terpenoids, turpentine-oil, limonene fraction | |
8000-41-7 | Terpineol | |
58985-02-7 | Terpineol, dihydro- | |
8006-39-1 | Terpinol | |
586-62-9 | Terpinolene | |
8007-35-0 | Terpinyl acetate (Isomer mixture) | |
2153-28-8 | Terpinyl butyrate | |
2153-26-6 | Terpinyl formate | |
7774-65-4 | Terpinyl isobutyrate | |
80-27-3 | Terpinyl propionate | |
629-59-4 | Tetradecane | |
3234-81-9 | Tetradecanoic acid, octadecyl ester | |
67634-08-6 | Tetrahydro-.alpha.-pentylfurfuryl acetate | |
13481-09-9 | Tetrahydro-2-(p-tolyloxy)-2H-pyrane | |
13477-62-8 | Tetrahydro-2-isobutyl-4-methyl-2H-pyrane | |
30310-41-9 | Tetrahydro-2-methyl-4-methylene-6-phenyl-2H-pyrane | |
16409-43-1 | Tetrahydro-4-methyl-2-(2-methylpropen-1-yl)pyran | |
94201-73-7 | Tetrahydro-4-methyl-2-phenyl-2H-pyran | |
131766-73-9 | Tetrahydro-4-methyl-2-propyl-2H-pyran-4-yl acetate | |
34686-71-0 | Tetrahydro-6-(2-pentenyl)-2H-pyran-2-one | |
32764-98-0 | Tetrahydro-6-(3-pentenyl)-2H-pyran-2-one | |
97-99-4 | Tetrahydrofurfuryl alcohol | |
5988-91-0 | Tetrahydrogeranial | |
78-69-3 | Tetrahydrolinalool | |
20780-48-7 | Tetrahydrolinalyl acetate | |
41678-36-8 | Tetrahydromuguol | |
18479-57-7 | Tetrahydromyrcenol | |
1322-58-3 | Tetrahydro-pseudo-ionone | |
61920-45-4 | Tetramethyl isopropyl dioxane | |
53850-34-3 | Thaumatin | |
36431-72-8 | Theaspirane | |
39067-80-6 | Thiogeraniol | |
8007-46-3 | Thyme absolute | |
8007-46-3 | Thyme oil, red | |
8007-46-3 | Thyme oil, white | |
85085-75-2 | Thyme, Thymus zygis, absolute | |
85085-75-2 | Thyme, Thymus zygis, oil | |
89-83-8 | Thymol | |
13463-67-7 | Titanium oxide (TiO2) | |
8037-19-2 | Tobacco extract | |
73138-76-8 | Tobacco extract, nicotine-free | |
8037-19-2 | Tobacco leaf absolute | |
73138-76-8 | Tobacco oils, nicotine-free | |
8037-19-2 | Tobacco oleoresin | |
8024-03-1 | Tolu, balsam, extract | |
8024-03-1 | Tolu, balsam, gum | |
8024-03-1 | Tolu, balsam, resinoid | |
1334-78-7 | Tolualdehydes (mixed o,m,p) | |
8024-04-2 | Tonka bean absolute | |
8024-04-2 | Tonka bean extract | |
8024-04-2 | Tonka bean resinoid | |
8024-04-2 | Tonka bean tincture | |
6876-12-6 | trans-1-Methyl-4-(1-methylvinyl)cyclohexene | |
3913-81-3 | trans-2-Decenal | |
13419-69-7 | trans-2-Hexenoic acid | |
928-95-0 | trans-2-Hexenol | |
2497-18-9 | trans-2-Hexenyl acetate | |
53398-83-7 | trans-2-Hexenyl butyrate | |
53398-86-0 | trans-2-Hexenyl hexanoate | |
68698-59-9 | trans-2-Hexenyl isovalerate | |
56922-74-8 | trans-2-Hexenyl pentanoate | |
53398-80-4 | trans-2-Hexenyl propionate | |
68133-77-7 | trans-2-Hexenyl salicylate | |
59324-17-3 | trans-2-Methyl-4-propyl-1,3-oxathiane | |
31502-14-4 | trans-2-Nonen-1-ol | |
18829-56-6 | trans-2-Nonenal | |
2548-87-0 | trans-2-Octenal | |
5448-22-6 | trans-2-tert-Butylcyclohexan-1-ol | |
20298-70-8 | trans-2-tert-Butylcyclohexyl acetate | |
7069-41-2 | trans-2-Tridecenal | |
53448-07-0 | trans-2-Undecenal | |
67801-45-0 | trans-3-Heptenyl 2-methylpropanoate | |
69112-21-6 | trans-3-Hexenal | |
3681-82-1 | trans-3-Hexenyl acetate | |
65405-70-1 | trans-4-Decen-1-al | |
21862-63-5 | trans-4-tert-Butylcyclohexanol | |
21862-63-5 | trans-4-tert-Butylcyclohexanol | |
1900-69-2 | trans-4-tert-Butylcyclohexyl acetate | |
4180-23-8 | trans-Anethole | |
140-10-3 | trans-Cinnamic acid | |
928-97-2 | trans-Hex-3-en-1-ol | |
5932-68-3 | trans-Isoeugenol | |
1189-09-9 | trans-Methylgeranate | |
40716-66-3 | trans-Nerolidol | |
89-80-5 | trans-p-Menthan-3-one | |
65418-70-4 | trans-Tetrahydro-2-isobutyl-4-methylpyran-4-ol | |
68648-41-9 | Tree moss oil, atranol, chloratranol-less | |
223747-88-4 | Tree peony flower absolute | |
68648-41-9 | Treemoss absolute | |
84696-53-7 | Treemoss extract | |
77-90-7 | Tributyl acetylcitrate | |
90-17-5 | Trichloromethyl phenyl carbinyl acetate | |
638-67-5 | Tricosane | |
508-32-7 | Tricyclo[2.2.1.02,6]heptane, 1,7,7-trimethyl- | |
122760-84-3 | Tricyclo[3.3.1.1.(3.7)]decan-2-ol, 4-methyl-8-methylene- | |
2500-83-6 | Tricyclo[5.2.1.02,6]dec-4-en-8-yl acetate | |
13380-94-4 | Tricyclo[5.2.1.02,6]decan-8-one | |
26896-48-0 | Tricyclo[5.2.1.02,7]decane-4,8-dimethanol | |
64001-15-6 | Tricyclodecanyl acetate | |
5413-60-5 | Tricyclodecenyl acetate | |
17511-60-3 | Tricyclodecenyl propionate | |
7370-92-5 | Trideca-1,5-lactone | |
10486-19-8 | Tridecanal | |
629-50-5 | Tridecane | |
22629-49-8 | Tridecene-2-nitrile | |
102-71-6 | Triethanolamine | |
77-93-0 | Triethyl citrate | |
112-27-6 | Triethyleneglycol | |
68845-35-2 | Triethyltrimethyl-2-cyclohexen-1-one | |
71735-79-0 | Trimethyl-13-oxabicyclo[10.1.0]trideca-4,8-diene | |
133636-82-5 | Trimethyl-bicyclo-heptane-spirocyclohexenone | |
20662-84-4 | Trimethyloxazole | |
538-23-8 | Trioctanoin | |
31570-04-4 | Tris(2,4-di-(tert)-butylphenyl) phosphate | |
220410-74-2 | Tris(tetramethylhydroxypiperidinol) citrate | |
828-26-2 | Trithioacetone | |
8024-05-3 | Tuberose absolute | |
8024-05-3 | Tuberose concrete | |
8024-05-3 | Tuberose oil | |
8024-05-3 | Tuberose tincture | |
8024-37-1 | Turmeric | |
8024-37-1 | Turmeric oleoresin | |
9005-90-7 | Turpentine gum | |
8006-64-2 | Turpentine oil | |
8006-64-2 | Turpentine oil, rectified | |
53179-04-7 | Undec-10-enonitrile | |
112-44-7 | Undecanal | |
1120-21-4 | Undecane | |
2244-07-7 | Undecanenitrile | |
112-37-8 | Undecanoic acid | |
30207-98-8 | Undecanol | |
112-43-6 | Undecen-1-ol | |
1337-83-3 | Undecenal | |
12262-03-2 | Undecenoic acid, 3-methylbutyl ester | |
112-42-5 | Undecyl alcohol | |
57-13-6 | Urea | |
4630-07-3 | Valencene | |
110-62-3 | Valeraldehyde | |
8008-88-6 | Valerian root extract | |
8008-88-6 | Valerian root oil | |
109-52-4 | Valeric acid | |
8024-06-4 | Vanilla absolute | |
8024-06-4 | Vanilla CO2 extract | |
8024-06-4 | Vanilla extract | |
8024-06-4 | Vanilla oleoresin | |
953789-39-4 | Vanilla tahitensis absolute | |
953789-39-4 | Vanilla tahitensis CO2 extract | |
953789-39-4 | Vanilla tahitensis extract | |
8047-24-3 | Vanilla tincture | |
121-34-6 | Vanillic acid | |
121-33-5 | Vanillin | |
180964-47-0 | Vanillin 3-(l -menthoxy)propane-1,2-diol acetal | |
20665-85-4 | Vanillin isobutyrate | |
68527-74-2 | Vanillin propylene glycol acetal | |
82654-98-6 | Vanillyl butyl ether | |
13184-86-6 | Vanillyl ethyl ether | |
120-14-9 | Veratraldehyde | |
473-67-6 | Verbenol | |
8016-96-4 | Vetiver CO2 extract | |
8016-96-4 | Vetiver extract | |
8016-96-4 | Vetiver oil | |
68917-65-7 | Vetiver oil terpenes | |
68917-34-0 | Vetiver oil, acetylated, distilled. | |
8016-96-4 | Vetiver oil, JAVA (low Furfural) | |
8016-96-4 | Vetiver oil, rectified | |
84082-84-8 | Vetiveria zizanioides, ext., acetylated | |
68129-81-7 | Vetiverol | |
73246-97-6 | Vetiverol acetate, distilled | |
62563-80-8 | Vetiverol, acetate | |
117-98-6 | Vetiveryl acetate | |
8024-08-6 | Violet leaf absolute | |
8024-08-6 | Violet leaf extract | |
7732-18-5 | Water | |
84012-44-2 | Wheat, ext. | |
8042-47-5 | White mineral oil, petroleum | |
8016-21-5 | Wine lees oil CO2 extract | Name updated on 6 Apr 2020 |
8016-21-5 | Wine lees oil, green | Name updated on 6 Apr 2020 |
8016-21-5 | Wine lees oil, white | Name updated on 6 Apr 2020 |
8016-21-5 | Wine lees oil, white, rectified | Name updated on 6 Apr 2020 |
68917-75-9 | Wintergreen extract | |
68917-75-9 | Wintergreen oil | |
8020-84-6 | Wool Wax | |
8008-93-3 | Wormwood oil | |
73138-77-9 | Wormwood oil, terpeneless | |
11138-66-2 | Xanthan gum | |
3520-42-1 | Xanthylium, 3,6-bis(diethylamino)-9-(2,4-disulfophenyl)-, inner salt, sodium salt (1:1) | |
1330-20-7 | Xylene (mixed) | |
8002-09-3 | Yarmor pine oil terpenes | |
8002-09-3 | Yarmor Pine oil, synthetic | |
8022-07-9 | Yarrow oil | |
8006-81-3 | Ylang ylang absolute | |
8006-81-3 | Ylang ylang oil | |
8006-81-3 | Ylang ylang oil (low para cresol methylether) | |
8006-81-3 | Ylang ylang oil extra | |
8006-81-3 | Ylang ylang oil I | |
8006-81-3 | Ylang ylang oil II | |
8006-81-3 | Ylang ylang oil III | |
8006-81-3 | Ylang ylang oil, rectified | |
68952-44-3 | Ylang ylang oil, terpene-free | |
8006-81-3 | Ylang-ylang extract | |
90147-57-2 | Yucca mohave extract | |
1009814-14-5 | Yuzunone | |
102242-62-6 | Zanthoxylum piperitum extract | |
1314-13-2 | Zinc oxide (zno) | |
122-48-5 | Zingerone | |
546-80-5 | α-Thujone |